Question

Difficulty: Very hardNitrogen Gas, Nitrogen Cycle, and Oxides of Nitrogen

When a 16.0 g16.0\text{ g} sample of pure ammonium trioxonitrate(V), NH4NO3NH_4NO_3, undergoes complete thermal decomposition, it produces dinitrogen monoxide gas, N2ON_2O, and water vapor. Assuming standard temperature and pressure (STP, where molar gas volume = 22.4 dm3mol122.4\text{ dm}^3\text{mol}^{-1}), what is the volume of the oxide of nitrogen collected, and how does its rate of diffusion compare to that of carbon(IV) oxide, CO2CO_2, under identical conditions? (Molar masses: N=14 g/molN = 14\text{ g/mol}, O=16 g/molO = 16\text{ g/mol}, H=1 g/molH = 1\text{ g/mol}, C=12 g/molC = 12\text{ g/mol})

  1. 4.48 dm34.48\text{ dm}^3, and its rate of diffusion is equal to that of CO2CO_2Answer
  2. B
    4.80 dm34.80\text{ dm}^3, and its rate of diffusion is equal to that of CO2CO_2
  3. C
    4.48 dm34.48\text{ dm}^3, and it diffuses 2\sqrt{2} times faster than CO2CO_2
  4. D
    8.96 dm38.96\text{ dm}^3, and its rate of diffusion is slower than that of CO2CO_2

Answer

4.48 dm34.48\text{ dm}^3, and its rate of diffusion is equal to that of CO2CO_2
Thermal decomposition of 16.0 g16.0\text{ g} (0.20 mol0.20\text{ mol}) of NH4NO3NH_4NO_3 produces 0.20 mol0.20\text{ mol} of N2ON_2O. At STP, 0.20 mol×22.4 dm3mol1=4.48 dm30.20\text{ mol} \times 22.4\text{ dm}^3\text{mol}^{-1} = 4.48\text{ dm}^3. Both N2ON_2O and CO2CO_2 have a molar mass of 44 g/mol44\text{ g/mol}, so by Graham's law of diffusion, their relative rates of diffusion are identical.

Step-by-Step Solution

1
Write the balanced chemical equation for the thermal decomposition of ammonium trioxonitrate(V)
NH4NO3(s)N2O(g)+2H2O(g)NH_4NO_3(s) \rightarrow N_2O(g) + 2H_2O(g)
Establishes the stoichiometric mole ratio between NH4NO3NH_4NO_3 and N2ON_2O, which is 1:11 : 1.
2
Calculate the molar mass and number of moles of NH4NO3NH_4NO_3 reacted
Molar mass of NH4NO3=2(14)+4(1)+3(16)=80 g/molNH_4NO_3 = 2(14) + 4(1) + 3(16) = 80\text{ g/mol}. Number of moles = 16.0 g80 g/mol=0.20 mol\frac{16.0\text{ g}}{80\text{ g/mol}} = 0.20\text{ mol}.
Determines the mole quantity of reactant available.
3
Determine the volume of N2ON_2O produced at STP
Moles of N2O=0.20 molN_2O = 0.20\text{ mol}. Volume at STP = 0.20 mol×22.4 dm3mol1=4.48 dm30.20\text{ mol} \times 22.4\text{ dm}^3\text{mol}^{-1} = 4.48\text{ dm}^3.
Applies standard molar volume of gas at STP.
4
Compare the rates of diffusion of N2ON_2O and CO2CO_2 using Graham's law
Molar mass of N2O=2(14)+16=44 g/molN_2O = 2(14) + 16 = 44\text{ g/mol}. Molar mass of CO2=12+2(16)=44 g/molCO_2 = 12 + 2(16) = 44\text{ g/mol}. Ratio of diffusion rates = 4444=1\sqrt{\frac{44}{44}} = 1.
Gases with equal molar masses diffuse at equal rates under identical conditions.

Key Concept

Thermal decomposition of nitrogen oxides, molar volume at STP, and Graham's law of diffusion
Estimated Time:2m 0s
Rate this question