All practice questions

5556 questions

Question 5101Question

A group of materials engineers evaluated the power conversion efficiency of perovskite solar cells fabricated with different layer thicknesses of a titanium dioxide (TiO2\text{TiO}_2) electron-transport layer (50 nm50\text{ nm}, 100 nm100\text{ nm}, 150 nm150\text{ nm}, and 200 nm200\text{ nm}). All solar cell samples were constructed using identical perovskite absorber layers, tested under a constant simulated solar light intensity of 1,000 W/m21,000\text{ W/m}^2, and maintained at a temperature of 25C25^\circ\text{C}. Which of the following correctly identifies the independent variable and the dependent variable in this experiment?

Show answer & explanation

Answer: Independent variable: TiO2\text{TiO}_2 layer thickness; Dependent variable: Power conversion efficiency

Answer

The independent variable is the TiO2\text{TiO}_2 layer thickness, and the dependent variable is the power conversion efficiency.
The researchers deliberately changed the thickness of the TiO2\text{TiO}_2 electron-transport layer (50 nm50\text{ nm} to 200 nm200\text{ nm}) across experimental conditions, making layer thickness the independent variable. The resulting power conversion efficiency was measured to assess solar cell performance, making efficiency the dependent variable.

Step-by-Step Solution

1
Identify the factor systematically altered by the experimenters across trials.
The researchers intentionally varied the TiO2\text{TiO}_2 layer thickness between four values (50 nm50\text{ nm}, 100 nm100\text{ nm}, 150 nm150\text{ nm}, and 200 nm200\text{ nm}). This is the independent variable.
The independent variable is the condition or factor directly manipulated in an experiment to test its effect.
2
Identify the factor being measured as a response to the experimental manipulation.
The researchers observed and measured the resulting power conversion efficiency for each solar cell sample. This is the dependent variable.
The dependent variable is the performance outcome or response variable measured during the study.
3
Distinguish independent and dependent variables from controlled experimental factors.
Factors such as light intensity (1,000 W/m21,000\text{ W/m}^2) and operating temperature (25C25^\circ\text{C}) were kept fixed across all samples, identifying them as controlled variables.
Controlled variables must be maintained constant so that observed changes in the dependent variable can be attributed solely to the independent variable.

Key Concept

Identifying Independent, Dependent, and Controlled Variables
Estimated Time:1m 0s
Question 5102Question

A lighthouse beacon sweeps across a circular region of the ocean. The illuminated area forms a circular sector with a radius of 1515 nautical miles and an area of 75π75\pi square nautical miles. What is the total perimeter, in nautical miles, of this illuminated sector?

Show answer & explanation

Answer: 10π+3010\pi + 30

Answer

10π+3010\pi + 30 nautical miles
The full circle has an area of π(15)2=225π\pi(15)^2 = 225\pi. The illuminated sector's area of 75π75\pi is 75π225π=13\frac{75\pi}{225\pi} = \frac{1}{3} of the total circle. Thus, its arc length is 13\frac{1}{3} of the total circumference 2π(15)=30π2\pi(15) = 30\pi, giving an arc length of 10π10\pi. Adding the two bounding radii of length 1515 each yields a total sector perimeter of 10π+3010\pi + 30 nautical miles.

Step-by-Step Solution

1
Calculate the total area of the full circle.
Total Area = πr2=π(15)2=225π\pi r^2 = \pi (15)^2 = 225\pi square nautical miles.
Knowing the full circle area allows us to find what fraction of the circle the sector occupies.
2
Determine the fractional proportion of the sector relative to the whole circle.
Fraction = Sector AreaTotal Area=75π225π=13\frac{\text{Sector Area}}{\text{Total Area}} = \frac{75\pi}{225\pi} = \frac{1}{3}.
The sector represents 13\frac{1}{3} of both the total area and the total circumference of the circle.
3
Calculate the arc length of the sector.
Arc length = 13×2πr=13×30π=10π\frac{1}{3} \times 2\pi r = \frac{1}{3} \times 30\pi = 10\pi nautical miles.
The curved boundary of the sector is 13\frac{1}{3} of the circle's full circumference.
4
Calculate the total perimeter of the sector by adding the arc length and the two straight radii.
Perimeter = Arc length +2r=10π+15+15=10π+30+ 2r = 10\pi + 15 + 15 = 10\pi + 30 nautical miles.
The perimeter of a circular sector consists of its curved outer arc plus its two straight bounding radii.

Key Concept

Perimeter of a Circular Sector
Question 5103Question

Read the excerpt below regarding early musicological field work. Fill in the blank with the most precise word that describes converting recorded audio into written musical notation while maintaining an academic register.

Fill in the blanks below

In the early twentieth century, ethnomusicologists traveled to remote Appalachian communities to document unwritten folk ballads before they vanished from oral tradition. Operating portable phonographs, field researchers recorded hours of vocal performances onto fragile wax cylinders. Because these physical records deteriorated rapidly with each playback, scholars had to the auditory nuances into written musical scores before the grooves wore smooth.
Show answer & explanation

Answer

transcribe (or notate)
The word 'transcribe' specifically means to process auditory performances or speech and record them in written form, such as musical notation. In this academic context, 'notate' is also a precise synonym.

Step-by-Step Solution

1
Analyze the context of the sentence surrounding the blank
The passage describes taking live auditory data captured on wax cylinders and converting it 'into written musical scores.'
Selecting the correct word requires identifying the exact relationship between the sound recording medium and written notation.
2
Select the verb that specifically denotes rendering audio into written notation
The verb 'transcribe' precisely means to represent speech or sound in written form, specifically musical notation.
Vague or colloquial alternatives like 'copy down' or 'translate' fail to capture the technical precision expected in formal academic prose.

Key Concept

Word Precision and Clarity
Estimated Time:1m 0s
Question 5104Question

A group of neurobiologists investigated the impact of a novel fungal compound, Toxin-Z, on acetylcholinesterase (AChE\text{AChE}) activity. Because Toxin-Z is hydrophobic, it was dissolved in a 1%1\% dimethyl sulfoxide (DMSO\text{DMSO}) solvent. Four reaction mixtures were prepared under constant temperature (37C37^\circ\text{C}) and pH\text{pH} (7.47.4):

- Reaction 1: AChE\text{AChE} + substrate + buffer
- Reaction 2: AChE\text{AChE} + substrate + buffer + 1%1\% DMSO\text{DMSO}
- Reaction 3: AChE\text{AChE} + substrate + buffer + 1%1\% DMSO\text{DMSO} + 10 μM10\ \mu\text{M} Toxin-Z
- Reaction 4: Substrate + buffer (no AChE\text{AChE})

Match each reaction mixture to its specific experimental role or control designation.

Click a left item, then click its matching right item

Items

Reaction 1
Reaction 2
Reaction 3
Reaction 4

Matches

Show answer & explanation

Answer

Reaction 1 matches the uninhibited baseline condition; Reaction 2 matches the vehicle control; Reaction 3 matches the experimental treatment group; Reaction 4 matches the negative control for non-enzymatic reaction.
Each reaction mixture isolates a distinct variable: Reaction 1 sets the baseline without solvent, Reaction 2 controls for the DMSO carrier solvent, Reaction 3 tests Toxin-Z, and Reaction 4 controls for spontaneous substrate breakdown without enzyme.

Step-by-Step Solution

1
Analyze the components of Reaction 1
Contains enzyme, substrate, and buffer with no added solvents or toxins.
This establishes normal, uninhibited baseline enzymatic performance under standard physiological conditions.
2
Analyze the components of Reaction 2
Contains enzyme, substrate, buffer, and 1%1\% DMSO solvent.
Because DMSO is used to deliver Toxin-Z, testing DMSO alone isolates the solvent variable to ensure it is biologically inert.
3
Analyze the components of Reaction 3
Contains enzyme, substrate, buffer, DMSO solvent, and Toxin-Z.
This is the target experimental condition designed to evaluate the effect of the independent variable (Toxin-Z).
4
Analyze the components of Reaction 4
Contains substrate and buffer but no AChE enzyme.
This negative control determines whether spontaneous (non-enzymatic) substrate hydrolysis occurs over time.

Key Concept

Identifying control groups (baseline, vehicle, and negative controls) to isolate specific variables in biological assays.
Question 5105Question

A commercial bakery mixes three types of flour—whole wheat, rye, and oat—to create a specialty bread blend. Initially, the ratio of whole wheat flour to rye flour to oat flour by weight is 5:3:25:3:2. The baker then adds 12 pounds of oat flour and 6 pounds of rye flour to the batch while leaving the amount of whole wheat flour unchanged. As a result, the ratio of whole wheat flour to oat flour in the new mixture becomes 1:11:1. What was the total weight, in pounds, of the initial flour mixture before any additional flour was added?

Show answer & explanation

Answer: 40

Answer

The total weight of the initial flour mixture was 40 pounds.
Representing the initial amounts of whole wheat, rye, and oat flour as 5x5x, 3x3x, and 2x2x establishes that the initial total weight is 10x10x. Adding 12 pounds to the oat flour makes the new oat weight 2x+122x + 12. Because the new ratio of whole wheat to oat is 1:11:1, we set 5x=2x+125x = 2x + 12, which yields x=4x = 4. Multiplying the multiplier x=4x = 4 by the total number of parts (1010) gives the original total weight of 40 pounds.

Step-by-Step Solution

1
Express the initial weights using a common multiplier xx.
Whole Wheat = 5x5x, Rye = 3x3x, Oat = 2x2x. The total initial weight is 5x+3x+2x=10x5x + 3x + 2x = 10x.
An extended ratio of 5:3:25:3:2 means each component is a multiple of a shared constant xx.
2
Set up an equation based on the new ratio of whole wheat to oat flour.
Whole Wheat = 5x5x, New Oat = 2x+122x + 12. Since the ratio is 1:11:1, 5x=2x+125x = 2x + 12.
Adding 12 pounds of oat flour changes the oat amount to 2x+122x + 12, and a 1:11:1 ratio means the two amounts are equal.
3
Solve for the multiplier xx.
3x=12x=43x = 12 \Rightarrow x = 4.
Subtract 2x2x from both sides and divide by 3.
4
Calculate the total initial weight.
Total initial weight = 10x=10(4)=4010x = 10(4) = 40 pounds.
Substitute x=4x = 4 back into the total initial expression 10x10x.

Key Concept

Solving multi-part ratio change problems by expressing quantities in terms of a common variable.
Estimated Time:1m 30s
Question 5106Question

An environmental scientist measured the rate of enzymatic breakdown of microplastics (mg/L/hr\text{mg/L/hr}) by a bacterial strain across five different incubation temperatures (C^\circ\text{C}). The results are shown in the table below:

Incubation Temperature (C^\circ\text{C})Breakdown Rate (mg/L/hr\text{mg/L/hr})
102.0
205.5
3012.0
408.5
501.0

Which of the following descriptions best characterizes the line graph that accurately translates these experimental results?

Show answer & explanation

Answer: A line graph plotting Incubation Temperature (C^\circ\text{C}) on the x-axis and Breakdown Rate (mg/L/hr\text{mg/L/hr}) on the y-axis, where the curve rises from a point at (10,2.0)(10, 2.0) to a peak at (30,12.0)(30, 12.0), before declining to (50,1.0)(50, 1.0).

Answer

The correct line graph plots Incubation Temperature on the horizontal x-axis and Breakdown Rate on the vertical y-axis, forming a curve that increases to a peak value of 12.0 mg/L/hr at 30°C and then drops to 1.0 mg/L/hr at 50°C.
The correct graph properly places Incubation Temperature on the x-axis and Breakdown Rate on the y-axis. The data points from the table demonstrate an initial rise in rate up to 30°C (12.0 mg/L/hr), followed by a decline as temperature increases further to 50°C (1.0 mg/L/hr), which corresponds exactly to a peaked curve.

Step-by-Step Solution

1
Identify axis assignments for translating tabular data to a line graph.
The independent variable (Incubation Temperature in °C) belongs on the horizontal x-axis, and the dependent variable (Breakdown Rate in mg/L/hr) belongs on the vertical y-axis.
Standard ACT scientific graphical conventions place controlled/independent variables on the x-axis and measured/dependent variables on the y-axis.
2
Trace the key data coordinates from the table (x,y)(x, y).
Points are (10,2.0)(10, 2.0), (20,5.5)(20, 5.5), (30,12.0)(30, 12.0), (40,8.5)(40, 8.5), and (50,1.0)(50, 1.0).
Accurate format translation requires verifying specific numeric values at each data level.
3
Analyze the trend of the data points.
The rate increases from 10°C to 30°C (reaching a peak of 12.0 mg/L/hr), then decreases from 30°C to 50°C.
The curve must visually reflect this unimodal (bell-shaped) trend.

Key Concept

Translating Tabular Data into Graphical Representations
Estimated Time:1m 0s
Question 5107Question

A circular theater stage has a designated performance section shaped as a circular sector with a central angle measuring 2π5\frac{2\pi}{5} radians. If the arc length along the outer edge of this sector is 8π8\pi feet, what is the area, in square feet, of the performance section?

Show answer & explanation

Answer: 80π80\pi

Answer

The area of the performance sector is 80π80\pi square feet.
First, determine the radius of the circle using the radian arc length formula s=rθs = r\theta. Substituting s=8πs = 8\pi and θ=2π5\theta = \frac{2\pi}{5} yields r=20r = 20 feet. Next, calculate the area of the circular sector using A=12r2θ=12(20)2(2π5)=80πA = \frac{1}{2}r^2\theta = \frac{1}{2}(20)^2\left(\frac{2\pi}{5}\right) = 80\pi square feet (or equivalently A=12rs=12(20)(8π)=80πA = \frac{1}{2}rs = \frac{1}{2}(20)(8\pi) = 80\pi square feet).

Step-by-Step Solution

1
Use the arc length formula in radians to solve for the radius (rr).
Since s=rθs = r\theta, substituting s=8πs = 8\pi and θ=2π5\theta = \frac{2\pi}{5} gives 8π=r2π58\pi = r \cdot \frac{2\pi}{5}, so r=8π52π=20r = 8\pi \cdot \frac{5}{2\pi} = 20 feet.
The radius of the circular stage is required to calculate the sector area.
2
Calculate the area of the sector using the formula A=12r2θA = \frac{1}{2}r^2\theta (or A=12rsA = \frac{1}{2}rs).
A=12(20)2(2π5)=12(400)(2π5)=200(2π5)=80πA = \frac{1}{2}(20)^2\left(\frac{2\pi}{5}\right) = \frac{1}{2}(400)\left(\frac{2\pi}{5}\right) = 200\left(\frac{2\pi}{5}\right) = 80\pi square feet.
Applying the known radius and central angle into the sector area formula yields the final area.

Key Concept

Calculating sector area from arc length and central angle in radians
Estimated Time:1m 15s
Question 5108Question

Read the sentence below. Which choice provides the idiomatically correct preposition for the underlined portion?

In his monograph on modern typography, the design critic argued that minimalist aesthetics are not necessarily synonymous to functional design.

Show answer & explanation

Answer: synonymous with

Answer

The correct option is 'synonymous with' because the adjective 'synonymous' requires the preposition 'with' to form a standard English idiom.
The adjective 'synonymous' idiomatically requires the preposition 'with' when expressing that two terms or concepts share the same meaning or identity. Thus, 'synonymous with' is the only grammatically and idiomatically correct choice.

Step-by-Step Solution

1
Identify the target word and the attached preposition in the underlined segment.
The target word is the adjective 'synonymous', currently paired with the preposition 'to'.
Idiomatic usage questions test whether specific adjectives, verbs, or nouns pair correctly with their conventional prepositions.
2
Recall standard English idiomatic conventions for the adjective 'synonymous'.
Standard written English dictates that 'synonymous' takes the preposition 'with' (e.g., 'X is synonymous with Y').
Prepositions such as 'to', 'for', or 'of' are non-standard pairings in formal English prose when following 'synonymous'.
3
Select the option that replaces the underlined text with the correct idiom.
Replacing 'synonymous to' with 'synonymous with' yields a grammatically and idiomatically precise sentence.
This substitution satisfies standard ACT conventions of usage.

Key Concept

Idiomatic Prepositions with Adjectives
Estimated Time:45s
Question 5109Question

A local library recorded the number of books read by students participating in a summer reading program. The results are summarized in the frequency table below.

Number of Books ReadNumber of Students
2244
3366
5555
8833
101022

What is the mean number of books read per student for this group?

Show answer & explanation

Answer: 4.754.75

Answer

The mean number of books read per student is 4.754.75.
The value 4.754.75 is correct because finding the mean from a frequency table requires calculating the weighted sum of all data values divided by the total frequency. Multiplying each book count by its student count gives 2×4+3×6+5×5+8×3+10×2=952 \times 4 + 3 \times 6 + 5 \times 5 + 8 \times 3 + 10 \times 2 = 95 total books. Dividing 9595 by the total student count of 2020 yields 4.754.75.

Step-by-Step Solution

1
Calculate the total number of students.
Total students = 4+6+5+3+2=204 + 6 + 5 + 3 + 2 = 20.
To find the mean per student, the total number of participants is needed for the denominator.
2
Calculate the total number of books read by multiplying each value by its frequency and summing.
Total books = (2×4)+(3×6)+(5×5)+(8×3)+(10×2)=8+18+25+24+20=95(2 \times 4) + (3 \times 6) + (5 \times 5) + (8 \times 3) + (10 \times 2) = 8 + 18 + 25 + 24 + 20 = 95.
The mean calculation requires the aggregate total of all books read across all students.
3
Divide the total number of books by the total number of students.
Mean = 9520=4.75\frac{95}{20} = 4.75.
The mean of a frequency distribution is given by the total sum divided by the total frequency.

Key Concept

Weighted Mean from a Frequency Table
Estimated Time:1m 30s
Question 5110Question

Glaciologists studying subglacial Lake Mercer in Antarctica deployed a customized hot-water drill to penetrate over one thousand meters of ice. They successfully recovered sediment cores containing ancient microbial forms, however, maintaining sterile conditions throughout the drilling process presented unprecedented technological challenges. Subsequent analysis revealed viable bacteria that had survived in extreme isolation for thousands of years.

Which choice produces a grammatically correct sentence that properly joins the two independent clauses?

Show answer & explanation

Answer: forms; however, maintaining

Answer

The option containing 'forms; however, maintaining' is correct because a semicolon is required to separate two independent clauses when joined by a conjunctive adverb like 'however'.
The correct choice places a semicolon after the first independent clause ('forms') and follows the conjunctive adverb ('however') with a comma. This correctly resolves the comma splice while preserving the logical relationship between the two complete sentences.

Step-by-Step Solution

1
Identify the clause boundary and structure
The text contains two independent clauses: 'They successfully recovered sediment cores containing ancient microbial forms' and 'maintaining sterile conditions throughout the drilling process presented unprecedented technological challenges.'
Both clauses contain complete subjects and verbs and can stand alone as complete thoughts.
2
Evaluate punctuation rules for conjunctive adverbs
When a conjunctive adverb such as 'however' connects two independent clauses, it must be preceded by a semicolon (or a period) and followed by a comma.
A single comma combined with 'however' is insufficient to join two independent clauses and results in a comma splice.

Key Concept

Joining Independent Clauses with Conjunctive Adverbs
Estimated Time:1m 0s
Question 5111Question

A box contains 55 red tickets, 77 blue tickets, and 88 green tickets. If one ticket is selected at random from the box, what is the probability that the selected ticket is NOT blue?

Show answer & explanation

Answer: 1320\frac{13}{20}

Answer

The probability that the selected ticket is not blue is 1320\frac{13}{20}.
To find the probability of selecting a ticket that is not blue, divide the number of non-blue tickets by the total number of tickets. There are 5+7+8=205 + 7 + 8 = 20 total tickets, of which 5+8=135 + 8 = 13 are not blue. Thus, the probability is 1320\frac{13}{20}.

Step-by-Step Solution

1
Find the total number of outcomes (total tickets in the box).
Total tickets = 5+7+8=205 + 7 + 8 = 20.
Basic probability requires dividing the number of favorable outcomes by the total sample space.
2
Calculate the number of favorable outcomes (tickets that are NOT blue).
Favorable tickets = 5 (red)+8 (green)=135\text{ (red)} + 8\text{ (green)} = 13 (or 207=1320 - 7 = 13).
The complement of choosing a blue ticket is choosing a red or green ticket.
3
Form the probability ratio of favorable outcomes to total outcomes.
Probability = 1320\frac{13}{20}.
Probability is defined as Favorable OutcomesTotal Outcomes\frac{\text{Favorable Outcomes}}{\text{Total Outcomes}}.

Key Concept

Basic Probability of Complementary Events
Estimated Time:45s
Question 5112Question

Researchers investigated the hydrothermal growth of zinc oxide (ZnO\text{ZnO}) nanorods for use in piezoelectric nanogenerators. In five separate experimental trials, the reaction vessel temperature was set to 90C90^\circ\text{C}, 100C100^\circ\text{C}, 110C110^\circ\text{C}, 120C120^\circ\text{C}, and 130C130^\circ\text{C}, respectively. In all trials, the zinc nitrate precursor concentration was maintained at 0.05 M0.05\text{ M}, the reaction duration was held at 4 hours4\text{ hours}, and the autoclave fill volume was kept at 100 mL100\text{ mL}. After each trial, the average aspect ratio (length-to-diameter ratio) of the synthesized nanorods was determined using scanning electron microscopy. Match each experimental component to its correct variable classification.

Click a left item, then click its matching right item

Items

Reaction vessel temperature (90C90^\circ\text{C} to 130C130^\circ\text{C})
Average aspect ratio of the synthesized nanorods
Zinc nitrate precursor concentration (0.05 M0.05\text{ M}) and reaction duration (4 hours4\text{ hours})

Matches

Show answer & explanation

Answer

Reaction vessel temperature matches Independent Variable; Average aspect ratio of synthesized nanorods matches Dependent Variable; Precursor concentration and reaction duration match Controlled Variable.
In scientific experiments, the independent variable is the parameter deliberately manipulated (here, the reaction vessel temperature across five distinct values). The dependent variable is the observed outcome measured to test the hypothesis (here, the nanorod aspect ratio). Controlled variables are baseline parameters held constant across all conditions (here, precursor concentration and duration) to ensure a fair test.

Step-by-Step Solution

1
Identify the factor explicitly varied by the experimenters across trials.
The reaction vessel temperature is systematically altered (90C90^\circ\text{C} to 130C130^\circ\text{C}), identifying it as the independent variable.
The independent variable is the factor deliberately manipulated by the researcher.
2
Identify the outcome measured as a result of changing the independent variable.
The average aspect ratio of the nanorods is measured after each trial, identifying it as the dependent variable.
The dependent variable is the measured response or outcome affected by changes in the independent variable.
3
Identify the parameters maintained at constant values across all trials.
Precursor concentration (0.05 M0.05\text{ M}) and reaction duration (4 hours4\text{ hours}) remain constant in every trial, identifying them as controlled variables.
Controlled variables are held constant to prevent extraneous factors from influencing the dependent variable.

Key Concept

Classification of variables in experimental design (independent, dependent, and controlled variables).
Estimated Time:1m 30s
Question 5113Question

A straight ramp is constructed for a skateboard park. The ramp rises to a vertical height of 535\sqrt{3} feet above flat horizontal ground, and the horizontal distance from the base of the ramp to the point directly beneath its highest point is 1515 feet. If θ\theta represents the angle of inclination of the ramp with respect to the ground, what is the value of cos(θ)\cos(\theta)?

Show answer & explanation

Answer: 32\frac{\sqrt{3}}{2}

Answer

The value of cos(θ)\cos(\theta) is 32\frac{\sqrt{3}}{2}.
The horizontal distance of 1515 feet is adjacent to angle θ\theta, and the vertical height of 535\sqrt{3} feet is opposite to θ\theta. By the Pythagorean theorem, the hypotenuse is 152+(53)2=225+75=103\sqrt{15^2 + (5\sqrt{3})^2} = \sqrt{225 + 75} = 10\sqrt{3} feet. Using SOHCAHTOA, cos(θ)=adjacenthypotenuse=15103=32\cos(\theta) = \frac{\text{adjacent}}{\text{hypotenuse}} = \frac{15}{10\sqrt{3}} = \frac{\sqrt{3}}{2}.

Step-by-Step Solution

1
Identify the given side lengths relative to the angle θ\theta
The side opposite to angle θ\theta is 535\sqrt{3} feet, and the side adjacent to angle θ\theta is 1515 feet.
The height of the ramp is opposite to the angle of inclination, and the horizontal ground distance is adjacent.
2
Calculate the length of the hypotenuse using the Pythagorean theorem
Hypotenuse =152+(53)2=225+75=300=103= \sqrt{15^2 + (5\sqrt{3})^2} = \sqrt{225 + 75} = \sqrt{300} = 10\sqrt{3} feet.
Cosine is defined as adjacent divided by hypotenuse, so the hypotenuse length must be calculated first.
3
Apply the cosine ratio definition cos(θ)=adjacenthypotenuse\cos(\theta) = \frac{\text{adjacent}}{\text{hypotenuse}} and simplify
cos(θ)=15103=323=336=32\cos(\theta) = \frac{15}{10\sqrt{3}} = \frac{3}{2\sqrt{3}} = \frac{3\sqrt{3}}{6} = \frac{\sqrt{3}}{2}.
Rationalizing the denominator yields the simplified exact ratio.

Key Concept

Right Triangle Trigonometry (SOHCAHTOA)
Estimated Time:1m 15s
Question 5114Question

For any real number xx such that 0<x<30 < x < 3, which of the following expressions is equivalent to sin(arccos(x3))\sin\left(\arccos\left(\frac{x}{3}\right)\right)?

Show answer & explanation

Answer: 9x23\frac{\sqrt{9 - x^2}}{3}

Answer

9x23\frac{\sqrt{9 - x^2}}{3}
By letting θ=arccos(x3)\theta = \arccos\left(\frac{x}{3}\right), we construct a right triangle with an adjacent side of length xx and a hypotenuse of length 33. Applying the Pythagorean theorem yields an opposite side length of 32x2=9x2\sqrt{3^2 - x^2} = \sqrt{9 - x^2}. The sine of θ\theta is the ratio of the opposite side to the hypotenuse, which evaluates to 9x23\frac{\sqrt{9 - x^2}}{3}.

Step-by-Step Solution

1
Define an angle variable for the inverse trigonometric expression
Let θ=arccos(x3)\theta = \arccos\left(\frac{x}{3}\right), so cos(θ)=x3\cos(\theta) = \frac{x}{3} for 0<θ<π20 < \theta < \frac{\pi}{2}.
Setting the inverse trigonometric function to an angle allows setting up a right triangle relationship.
2
Set up side lengths of a right triangle using the definition of cosine
Adjacent side = xx, Hypotenuse = 33.
By definition, cos(θ)=adjacenthypotenuse\cos(\theta) = \frac{\text{adjacent}}{\text{hypotenuse}}.
3
Calculate the opposite side using the Pythagorean theorem
\text{opposite} = \sqrt{3^2 - x^2} = \sqrt{9 - x^2}.
In any right triangle, opposite2+adjacent2=hypotenuse2\text{opposite}^2 + \text{adjacent}^2 = \text{hypotenuse}^2.
4
Determine the sine of the angle
\sin(\theta) = \frac{\text{opposite}}{\text{hypotenuse}} = \frac{\sqrt{9 - x^2}}{3}.
By definition, sin(θ)=oppositehypotenuse\sin(\theta) = \frac{\text{opposite}}{\text{hypotenuse}}.

Key Concept

Evaluating algebraic compositions of trigonometric and inverse trigonometric functions using right triangle geometry.
Estimated Time:1m 15s
Question 5115Question

A municipal water authority pumps water into a storage reservoir. During a drought conservation phase, the authority reduces its standard daily pumping volume by 35%35\%. If the resulting reduced daily pumping volume is WW acre-feet, which of the following equations correctly expresses the standard daily pumping volume, SS, in acre-feet, in terms of WW?

Show answer & explanation

Answer: S=W0.65S = \frac{W}{0.65}

Answer

The standard daily pumping volume is given by S=W0.65S = \frac{W}{0.65}.
Reducing the standard volume SS by 35%35\% leaves 65%65\% of SS, which can be written algebraically as 0.65S0.65S. Since this reduced amount equals WW, the relationship is 0.65S=W0.65S = W. Dividing both sides by 0.650.65 isolates SS to give the one-step equation solution S=W0.65S = \frac{W}{0.65}.

Step-by-Step Solution

1
Express the reduced volume in terms of the standard volume SS
Reduced volume =S0.35S=0.65S= S - 0.35S = 0.65S
A 35%35\% reduction leaves 100%35%=65%100\% - 35\% = 65\% of the original standard volume SS.
2
Set up the one-step algebraic equation matching the given variable WW
0.65S=W0.65S = W
The reduced volume is defined as WW acre-feet.
3
Solve the one-step equation for SS
S=W0.65S = \frac{W}{0.65}
Divide both sides of the equation by 0.650.65 to isolate SS.

Key Concept

Formulating and solving a one-step algebraic equation involving a percentage decrease.

Alternative Method

Convert 65%65\% to the fraction 1320\frac{13}{20}. Then 1320S=W\frac{13}{20}S = W, which yields S=2013W=W0.65S = \frac{20}{13}W = \frac{W}{0.65}.
Estimated Time:1m 30s
Question 5116Question

Biologists conducted an experiment to investigate the effects of heavy metal contamination on the photosynthetic activity of the freshwater alga *Chlorella vulgaris*. Four identical culture flasks were prepared, each containing 100 mL100\text{ mL} of standard growth medium and an initial cell density of 1.0×105 cells/mL1.0 \times 10^5\text{ cells/mL}:

- Flask 1: Standard growth medium with no added heavy metal ions.
- Flask 2: Standard growth medium containing 5.0 mg/L5.0\text{ mg/L} of copper ions (Cu2+\text{Cu}^{2+}).
- Flask 3: Standard growth medium containing 5.0 mg/L5.0\text{ mg/L} of lead ions (Pb2+\text{Pb}^{2+}).
- Flask 4: Standard growth medium containing 5.0 mg/L5.0\text{ mg/L} of cadmium ions (Cd2+\text{Cd}^{2+}).

All four flasks were kept at 25C25^\circ\text{C} under continuous illumination for 48 hours. Dissolved oxygen (DO\text{DO}) concentration was then measured to quantify photosynthetic output.

Which flask served as the control group in this experiment, and what was its primary purpose?

Show answer & explanation

Answer: Flask 1, to establish a baseline measurement of photosynthetic activity in the absence of heavy metal contamination.

Answer

Flask 1 served as the control group to establish a baseline measurement of photosynthetic activity in the absence of heavy metal contamination.
Flask 1 is the control group because it includes all constant environmental conditions (growth medium, cell density, light, temperature) but omits the independent variable (heavy metal ions). This allows researchers to measure baseline photosynthetic activity and quantify any decrease caused by heavy metal exposure in Flasks 2, 3, and 4.

Step-by-Step Solution

1
Identify the independent variable being tested.
The independent variable is the type of heavy metal added to the algal cultures (copper, lead, or cadmium).
Understanding the variable manipulated across experimental groups isolates what baseline condition is missing.
2
Locate the setup where the independent variable is omitted or kept at normal unmanipulated conditions.
Flask 1 contains standard growth medium without any added heavy metal ions.
A control group provides a reference point by keeping all baseline factors identical except for the variable under investigation.
3
Determine the scientific purpose of this setup.
Comparing DO measurements from Flasks 2–4 against Flask 1 reveals the specific impact of each heavy metal relative to normal conditions.
Without Flask 1, researchers could not determine whether oxygen levels changed due to heavy metal toxicity or normal biological processes.

Key Concept

Experimental Control Groups and Baseline Conditions
Estimated Time:1m 0s
Question 5117Question

Biochemists measured the rate of glucose consumption (in mM/min\text{mM/min}) by a newly isolated bacterial strain across 3 temperature treatments (25C25^\circ\text{C}, 35C35^\circ\text{C}, and 45C45^\circ\text{C}). Each temperature condition was evaluated in 3 separate trials. The results are recorded in the table below:

Temperature (C^\circ\text{C})Trial 1 (mM/min\text{mM/min})Trial 2 (mM/min\text{mM/min})Trial 3 (mM/min\text{mM/min})
25251.21.21.51.51.81.8
35354.04.04.64.64.64.6
45452.12.12.52.52.02.0

Based on the data provided, what is the average rate of glucose consumption, in mM/min\text{mM/min}, for the 35C35^\circ\text{C} treatment across the 3 trials?

Show answer & explanation

Answer: 4.4

Answer

The average rate of glucose consumption at 35C35^\circ\text{C} across the 3 trials is 4.4 mM/min4.4\text{ mM/min}.
To find the average glucose consumption rate at 35C35^\circ\text{C}, locate the row for 35C35^\circ\text{C} in the table and sum the values across the 3 trials (4.0+4.6+4.6=13.2 mM/min4.0 + 4.6 + 4.6 = 13.2\text{ mM/min}). Then divide by the number of trials (33) to get 13.23=4.4 mM/min\frac{13.2}{3} = 4.4\text{ mM/min}.

Step-by-Step Solution

1
Extract data points for the 35C35^\circ\text{C} row
Trial 1 = 4.0 mM/min4.0\text{ mM/min}, Trial 2 = 4.6 mM/min4.6\text{ mM/min}, Trial 3 = 4.6 mM/min4.6\text{ mM/min}
The question specifically asks for the average at 35C35^\circ\text{C}.
2
Calculate the sum of the trial values
4.0+4.6+4.6=13.2 mM/min4.0 + 4.6 + 4.6 = 13.2\text{ mM/min}
Calculating an average requires finding the total sum of all trial measurements first.
3
Divide the sum by the total number of trials
13.23=4.4 mM/min\frac{13.2}{3} = 4.4\text{ mM/min}
Dividing the sum by 33 calculates the arithmetic mean across the 3 trials.

Key Concept

Calculating the average (mean) of data values from a table
Estimated Time:1m 0s
Question 5118Question

A community theater company uses a combination of red, yellow, and blue light filters to create a specific lighting effect on stage. The ratio of the number of red filters to yellow filters is 4:34:3, and the ratio of the number of yellow filters to blue filters is 2:52:5. If the lighting setup uses a total of 5858 filters across these three colors, how many blue filters are used in the setup?

Show answer & explanation

Answer: 30

Answer

30
To find the number of blue filters, we must write a single combined ratio for Red : Yellow : Blue. Since Red : Yellow = 4:34 : 3 and Yellow : Blue = 2:52 : 5, we convert both ratios so that Yellow has the same term. Multiples of 33 and 22 give a common value of 66. Scaling Red : Yellow by 22 gives 8:68 : 6, and scaling Yellow : Blue by 33 gives 6:156 : 15. Thus, Red : Yellow : Blue = 8:6:158 : 6 : 15. The total number of ratio units is 8+6+15=298 + 6 + 15 = 29. Each ratio unit represents 58÷29=258 \div 29 = 2 filters. Therefore, the number of blue filters is 15×2=3015 \times 2 = 30.

Step-by-Step Solution

1
Find a common value for the yellow ratio component to combine the two ratios into a single three-part ratio.
The ratio of Red to Yellow is 4:3=8:64:3 = 8:6. The ratio of Yellow to Blue is 2:5=6:152:5 = 6:15. Therefore, Red : Yellow : Blue = 8:6:158 : 6 : 15.
Yellow is the shared quantity between both given ratios, so its ratio value must be equal in both expressions to combine them.
2
Calculate the total number of ratio parts and determine the value of one part.
Total parts = 8+6+15=298 + 6 + 15 = 29 parts. Value per part = 5829=2\frac{58}{29} = 2 filters per part.
Dividing the total filter quantity by the total number of parts yields the scale factor for the ratio.
3
Multiply the blue filter ratio parts by the value per part.
15 parts×2=3015 \text{ parts} \times 2 = 30 blue filters.
The question specifically asks for the total quantity of blue filters.

Key Concept

Three-Quantity Ratio Combination and Scaling
Question 5119Question

In right triangle PQRPQR, the right angle is located at vertex QQ. The length of leg PQPQ is 3030 centimeters. If sin(P)=817\sin(P) = \frac{8}{17}, what is the length, in centimeters, of leg QRQR?

Show answer & explanation

Answer: 1616

Answer

16 centimeters
In right triangle PQRPQR, sin(P)=QRPR=817\sin(P) = \frac{QR}{PR} = \frac{8}{17}. The corresponding cosine ratio is cos(P)=PQPR=1517\cos(P) = \frac{PQ}{PR} = \frac{15}{17}. Given PQ=30PQ = 30, we solve 30PR=1517\frac{30}{PR} = \frac{15}{17} to find PR=34PR = 34. Then, leg QR=34×817=16QR = 34 \times \frac{8}{17} = 16.

Step-by-Step Solution

1
Express the given sine ratio in terms of the triangle sides.
sin(P)=oppositehypotenuse=QRPR=817\sin(P) = \frac{\text{opposite}}{\text{hypotenuse}} = \frac{QR}{PR} = \frac{8}{17}
By definition of the sine function in a right triangle.
2
Find the cosine ratio cos(P)\cos(P) using the Pythagorean identity or the 8-15-17 right triangle ratio.
cos(P)=1sin2(P)=164289=1517\cos(P) = \sqrt{1 - \sin^2(P)} = \sqrt{1 - \frac{64}{289}} = \frac{15}{17}
Cosine represents the ratio of the adjacent side (PQPQ) to the hypotenuse (PRPR).
3
Calculate the hypotenuse PRPR using the known leg PQ=30PQ = 30.
PQPR=1517    30PR=1517    PR=34\frac{PQ}{PR} = \frac{15}{17} \implies \frac{30}{PR} = \frac{15}{17} \implies PR = 34
Setting the adjacent side ratio equal to cos(P)\cos(P) solves for the hypotenuse length.
4
Calculate the opposite leg QRQR.
QR=PR×sin(P)=34×817=16QR = PR \times \sin(P) = 34 \times \frac{8}{17} = 16
Multiplying the hypotenuse by sin(P)\sin(P) gives the opposite leg length.

Key Concept

Right Triangle Trigonometry (SOHCAHTOA)
Estimated Time:1m 15s
Question 5120Question

A biology class recorded the height, in centimeters, of 1515 plant seedlings after two weeks of growth. The frequency table below summarizes the recorded measurements:

Height (cm)Number of Seedlings
3322
4444
5555
6633
7711

What is the positive difference between the mean height and the median height, in centimeters, of these 1515 seedlings?

Show answer & explanation

Answer: 0.20.2

Answer

The positive difference between the mean height and the median height is 0.20.2 centimeters.
To calculate the mean height, multiply each height by its frequency, sum the products (7272), and divide by the total number of seedlings (1515), giving 4.84.8 cm. To find the median, locate the middle value (8th8^{\text{th}} value) in the ordered dataset of 1515 measurements, which is 5.05.0 cm. The positive difference between 5.05.0 cm and 4.84.8 cm is 0.20.2 cm.

Step-by-Step Solution

1
Calculate the total sum of all seedling heights using the frequency table
(3×2)+(4×4)+(5×5)+(6×3)+(7×1)=6+16+25+18+7=72(3 \times 2) + (4 \times 4) + (5 \times 5) + (6 \times 3) + (7 \times 1) = 6 + 16 + 25 + 18 + 7 = 72 cm
Each height value must be multiplied by its corresponding frequency count to find the total sum.
2
Calculate the weighted mean height
Mean = 7215=4.8\frac{72}{15} = 4.8 cm
The sum of all heights (7272) is divided by the total number of seedlings (1515).
3
Determine the median height of the 1515 seedlings
Median = 5.05.0 cm
For 1515 ordered values, the median is the 8th8^{\text{th}} data point. Accumulating counts from smallest height: 22 (at height 3) +4+ 4 (at height 4) =6= 6 values. The next 55 values (positions 7 through 11) all have a height of 5. Therefore, the 8th8^{\text{th}} value is 5.05.0 cm.
4
Find the positive difference between the mean and the median
4.85.0=0.2|4.8 - 5.0| = 0.2 cm
Subtracting the mean (4.84.8) from the median (5.05.0) gives a positive difference of 0.20.2 cm.

Key Concept

Descriptive Statistics and Data Representations
Estimated Time:1m 30s
PreviousPage 256 / 278Next
All practice questions — ACT | Examkin