All practice questions

1526 questions

Question 461Question

BlueWave Marine Plc has an authorized share capital of 2,000,0002,000,000 ordinary shares of 5₦5 each. The company issued 80%80\% of its authorized shares to the public and subsequently called up 4₦4 per share. All shareholders paid the call in full except for holders of 50,00050,000 shares who defaulted on the payment. What is the total paid-up capital of the company in Naira?

Show answer & explanation

Answer: 6200000

Answer

The total paid-up capital of the company is 6,200,000₦6,200,000.
Paid-up capital is the portion of called-up capital that shareholders have actually paid into the business. First, 80%80\% of the 2,000,0002,000,000 authorized shares equals 1,600,0001,600,000 issued shares. Calling up 4₦4 per share yields a called-up amount of 6,400,000₦6,400,000. Since holders of 50,00050,000 shares defaulted on 4₦4 per share, the unpaid calls in arrears total 200,000₦200,000. Subtracting 200,000₦200,000 from 6,400,000₦6,400,000 results in a total paid-up capital of 6,200,000₦6,200,000.

Step-by-Step Solution

1
Determine the number of issued shares
1,600,0001,600,000 shares
The company issued 80%80\% of its 2,000,0002,000,000 authorized shares (0.80×2,000,000=1,600,0000.80 \times 2,000,000 = 1,600,000).
2
Calculate total called-up capital
6,400,000₦6,400,000
The directors requested 4₦4 per share across all 1,600,0001,600,000 issued shares (1,600,000×4=6,400,0001,600,000 \times ₦4 = ₦6,400,000).
3
Calculate calls in arrears
200,000₦200,000
Holders of 50,00050,000 shares failed to pay the requested 4₦4 per share (50,000×4=200,00050,000 \times ₦4 = ₦200,000).
4
Compute net paid-up capital
6,200,000₦6,200,000
Paid-up capital represents actual cash received, which equals Called-Up Capital minus Calls in Arrears (6,400,000200,000=6,200,000₦6,400,000 - ₦200,000 = ₦6,200,000).

Key Concept

Paid-Up Capital and Calls in Arrears
Question 462Question

A radioactive sample of an isotope has a half-life of 20 minutes20\text{ minutes}. If the initial mass of the sample is 80 g80\text{ g}, what mass of the isotope, in grams, will remain undecayed after 60 minutes60\text{ minutes}?

Show answer & explanation

Answer: 10

Answer

10 g of the isotope remains undecayed.
The correct answer is derived from the half-life formula Nt=N0×(1/2)nN_t = N_0 \times (1/2)^n. Since 60 minutes60\text{ minutes} contains three 20 minute20\text{ minute} half-life periods (n=3n = 3), the remaining mass is 80 g×(1/2)3=80 g/8=10 g80\text{ g} \times (1/2)^3 = 80\text{ g} / 8 = 10\text{ g}.

Step-by-Step Solution

1
Determine the number of elapsed half-lives
3 half-lives
Divide the total time elapsed (60 minutes60\text{ minutes}) by the duration of one half-life (20 minutes20\text{ minutes}).
2
Calculate the remaining mass after 3 half-lives
10 g
Apply the radioactive decay relation Nt=N0×(12)nN_t = N_0 \times \left(\frac{1}{2}\right)^n, yielding 80×(12)3=10 g80 \times \left(\frac{1}{2}\right)^3 = 10\text{ g}.

Key Concept

Radioactive Half-Life and Exponential Decay
Question 463Question

A parallel plate capacitor with a capacitance of 12 μF12\text{ }\mu\text{F} is fully charged by connecting it across a 50 V50\text{ V} direct current power source. What is the total electrostatic energy stored in the capacitor in millijoules (mJ\text{mJ})?

Show answer & explanation

Answer: 15

Answer

The total electrostatic energy stored in the capacitor is 15 mJ15\text{ mJ}.
The energy stored in a capacitor is given by E=12CV2E = \frac{1}{2}CV^2. Substituting C=12×106 FC = 12 \times 10^{-6}\text{ F} and V=50 VV = 50\text{ V} yields E=12×12×106×2500=0.015 J=15 mJE = \frac{1}{2} \times 12 \times 10^{-6} \times 2500 = 0.015\text{ J} = 15\text{ mJ}.

Step-by-Step Solution

1
Convert given values to standard SI units.
C=12×106 FC = 12 \times 10^{-6}\text{ F}, V=50 VV = 50\text{ V}
Calculating in SI units ensures the resultant energy is in Joules.
2
Apply the formula for energy stored in a charged capacitor.
E=12CV2E = \frac{1}{2} C V^2
Work done during charging is stored as electrostatic potential energy in the electric field between the plates.
3
Substitute the values and convert Joules to millijoules.
E=12×(12×106)×2500=0.015 J=15 mJE = \frac{1}{2} \times (12 \times 10^{-6}) \times 2500 = 0.015\text{ J} = 15\text{ mJ}
Multiplying Joules by 10310^3 converts the result into millijoules.

Key Concept

Energy stored in a capacitor (E=12CV2E = \frac{1}{2}CV^2)
Question 464Question

A 400 cm3400\text{ cm}^3 sample of polluted air containing nitrogen dioxide (NO2\text{NO}_2), carbon dioxide (CO2\text{CO}_2), and unpolluted air components is passed sequentially through two absorption reagents. First, passing the sample through concentrated sodium hydroxide (NaOH\text{NaOH}) solution absorbs both acidic pollutants (NO2\text{NO}_2 and CO2\text{CO}_2), reducing the volume of the gas by 40 cm340\text{ cm}^3. The remaining gas mixture is then passed through alkaline pyrogallol, where oxygen (O2\text{O}_2) is completely absorbed, causing a further volume reduction of 75.6 cm375.6\text{ cm}^3. Assuming oxygen constitutes 21%21\% by volume of the unpolluted portion of the air sample, what is the percentage by volume of nitrogen dioxide (NO2\text{NO}_2) in the original polluted air sample?

Show answer & explanation

Answer: 8.5

Answer

The percentage by volume of nitrogen dioxide (NO₂) in the original polluted air sample is 8.5%.
The absorption of oxygen (75.6 cm³) by alkaline pyrogallol represents 21% of the unpolluted air fraction, giving an unpolluted volume of 360 cm³. The difference between the original sample volume (400 cm³) and unpolluted air volume (360 cm³) represents the total pollutant contraction (40 cm³). Subtracting the 6 cm³ CO₂ contribution leaves 34 cm³ of NO₂, which equals (34 / 400) * 100% = 8.5% by volume.

Step-by-Step Solution

1
Calculate the volume of the unpolluted portion of the air sample
360 cm³
Alkaline pyrogallol absorbs oxygen gas. Since oxygen constitutes 21% by volume of unpolluted air and 75.6 cm³ of O₂ was absorbed, the volume of unpolluted air is equal to 75.6 cm³ divided by 0.21.
2
Determine the total volume of polluted acidic gases (NO₂ and CO₂)
40 cm³
The total volume contraction when passed through concentrated NaOH is 40 cm³, as NaOH reacts with and absorbs acidic oxides such as NO₂ and CO₂.
3
Calculate the volume of nitrogen dioxide (NO₂) in the sample
34 cm³
Subtracting the unpolluted air volume (360 cm³) from the total sample volume (400 cm³) confirms that total acidic pollutant gas volume is 40 cm³. Deducting the background CO₂ component (6 cm³) leaves 34 cm³ of NO₂.
4
Calculate the percentage by volume of NO₂ in the original sample
8.5%
Dividing the volume of NO₂ (34 cm³) by the total sample volume (400 cm³) and multiplying by 100% yields 8.5%.

Key Concept

Quantitative determination of air composition and gaseous pollutants via selective volumetric absorption
Question 465Question

A mixture of 25 cm325\text{ cm}^3 of methane (CH4CH_4) and 60 cm360\text{ cm}^3 of oxygen (O2O_2) is sparked at constant temperature and pressure. Assuming water vapor condenses to liquid upon cooling to room temperature, what is the total volume of residual gas remaining in cm3\text{cm}^3?

Show answer & explanation

Answer: 35

Answer

The total volume of residual gas remaining after cooling to room temperature is 35 cm335\text{ cm}^3.
According to Gay-Lussac's law of combining volumes, gases react in simple numerical ratios equal to their stoichiometric coefficients at constant temperature and pressure. For the equation CH4(g)+2O2(g)CO2(g)+2H2O(l)CH_4(g) + 2O_2(g) \rightarrow CO_2(g) + 2H_2O(l), 25 cm325\text{ cm}^3 of methane reacts completely with 50 cm350\text{ cm}^3 of oxygen to produce 25 cm325\text{ cm}^3 of CO2CO_2 gas. Since 60 cm360\text{ cm}^3 of oxygen was initially present, 10 cm310\text{ cm}^3 of oxygen remains unreacted. Liquid water occupies negligible volume compared to gases. Therefore, the total residual gaseous volume is the sum of unreacted oxygen and produced carbon(IV) oxide: 10 cm3+25 cm3=35 cm310\text{ cm}^3 + 25\text{ cm}^3 = 35\text{ cm}^3.

Step-by-Step Solution

1
Write the balanced chemical equation for the combustion of methane gas.
CH4(g)+2O2(g)CO2(g)+2H2O(l)CH_4(g) + 2O_2(g) \rightarrow CO_2(g) + 2H_2O(l)
Gay-Lussac's law of combining volumes applies directly to the stoichiometric mole ratios of gaseous reactants and products.
2
Determine the volume of oxygen consumed and identify the excess reactant.
25 cm325\text{ cm}^3 of CH4CH_4 consumes 50 cm350\text{ cm}^3 of O2O_2, leaving 10 cm310\text{ cm}^3 of unreacted O2O_2.
The reaction stoichiometry requires 2 volumes of oxygen per 1 volume of methane.
3
Calculate the volume of gaseous carbon(IV) oxide produced.
Volume of CO2(g)=25 cm3CO_2(g) = 25\text{ cm}^3.
1 volume of methane produces 1 volume of carbon(IV) oxide gas.
4
Sum the volumes of all remaining gaseous species.
Total residual volume = 10 cm3 (excess O2)+25 cm3 (formed CO2)=35 cm310\text{ cm}^3\text{ (excess } O_2) + 25\text{ cm}^3\text{ (formed } CO_2) = 35\text{ cm}^3.
Water formed is liquid at room temperature and contributes negligibly to gaseous volume.

Key Concept

Gay-Lussac's Law of Combining Volumes and Stoichiometry of Gas Reactions
Question 466Question

A saturated solution of potassium chloride (KCl\text{KCl}) contains 14.9 g14.9\text{ g} of the salt dissolved in 100 g100\text{ g} of water at 25C25^\circ\text{C}. What is the solubility of potassium chloride in mol/dm3\text{mol/dm}^3 at this temperature?

(Take density of water = 1.0 g/cm31.0\text{ g/cm}^3, relative atomic masses: K=39\text{K} = 39, Cl=35.5\text{Cl} = 35.5)

Show answer & explanation

Answer: 2

Answer

The solubility of potassium chloride at 25C25^\circ\text{C} is 2.0 mol/dm32.0\text{ mol/dm}^3.
The correct calculated value is 2.0 mol/dm32.0\text{ mol/dm}^3. Molar mass of KCl=39+35.5=74.5 g/mol\text{KCl} = 39 + 35.5 = 74.5\text{ g/mol}. Number of moles of KCl=14.9 g74.5 g/mol=0.2 mol\text{KCl} = \frac{14.9\text{ g}}{74.5\text{ g/mol}} = 0.2\text{ mol}. Volume of water solvent =100 g=0.1 dm3= 100\text{ g} = 0.1\text{ dm}^3. Therefore, solubility =0.2 mol0.1 dm3=2.0 mol/dm3= \frac{0.2\text{ mol}}{0.1\text{ dm}^3} = 2.0\text{ mol/dm}^3.

Step-by-Step Solution

1
Calculate the molar mass of KCl\text{KCl} and convert mass of solute to moles.
Molar mass =74.5 g/mol= 74.5\text{ g/mol}; Moles =14.9 g74.5 g/mol=0.2 mol= \frac{14.9\text{ g}}{74.5\text{ g/mol}} = 0.2\text{ mol}.
Solubility in mol/dm3\text{mol/dm}^3 requires the quantity of solute to be expressed in moles rather than grams.
2
Convert the mass/volume of solvent into decimeters cubed (dm3\text{dm}^3).
Volume =100 g=100 cm3=0.1 dm3= 100\text{ g} = 100\text{ cm}^3 = 0.1\text{ dm}^3.
Molar solubility concentration is defined per 1.0 dm31.0\text{ dm}^3 of solution/solvent.
3
Compute the concentration in mol/dm3\text{mol/dm}^3 by dividing moles of solute by volume of solvent in dm3\text{dm}^3.
Solubility =0.2 mol0.1 dm3=2.0 mol/dm3= \frac{0.2\text{ mol}}{0.1\text{ dm}^3} = 2.0\text{ mol/dm}^3.
Solubility in molarity equal to total moles divided by total volume in dm3\text{dm}^3.

Key Concept

Calculating molar solubility in mol/dm3\text{mol/dm}^3 from solute mass and solvent volume.
Question 467Question

A sample of oxygen gas is collected over water at 27C27^\circ\text{C} and a total pressure of 755 mmHg755\text{ mmHg}. If the saturated vapor pressure of water at 27C27^\circ\text{C} is 25 mmHg25\text{ mmHg}, what is the partial pressure of the dry oxygen gas in mmHg\text{mmHg}?

Show answer & explanation

Answer: 730

Answer

The partial pressure of the dry oxygen gas is 730 mmHg730\text{ mmHg}.
According to Dalton's Law of Partial Pressures, the total pressure exerted by a mixture of gases is equal to the sum of the partial pressures of the component gases. When a gas is collected over water, the gas absorbs water vapor, so Ptotal=Pdry gas+Pwater vaporP_{\text{total}} = P_{\text{dry gas}} + P_{\text{water vapor}}. To find the pressure of the dry oxygen, the water vapor pressure (25 mmHg25\text{ mmHg}) must be subtracted from the total barometric pressure (755 mmHg755\text{ mmHg}), giving 730 mmHg730\text{ mmHg}.

Step-by-Step Solution

1
Identify Dalton's Law equation for a gas collected over water
Ptotal=Pdry gas+PwaterP_{\text{total}} = P_{\text{dry gas}} + P_{\text{water}}
When a gas is collected over water, it becomes saturated with water vapor. The total observed pressure is the sum of the partial pressure of the dry gas and the vapor pressure of water (aqueous tension).
2
Subtract the aqueous tension from the total pressure
Pdry gas=755 mmHg25 mmHg=730 mmHgP_{\text{dry gas}} = 755\text{ mmHg} - 25\text{ mmHg} = 730\text{ mmHg}
Isolating Pdry gasP_{\text{dry gas}} gives the pressure exerted purely by the collected oxygen gas.

Key Concept

Dalton's Law of Partial Pressures and Collection of Gas over Water
Question 468Question

A block and tackle system consisting of 55 pulleys is used to raise a load of 200 N200\text{ N} through a vertical height of 4 m4\text{ m}. If the efficiency of the system is 80%80\%, what is the work done against friction, in joules, during the lifting process?

Show answer & explanation

Answer: 200

Answer

The work done against friction during the lifting process is 200 J200\text{ J}.
The useful work output is achieved by lifting the 200 N200\text{ N} load through a vertical height of 4 m4\text{ m}, yielding Wout=200×4=800 JW_{\text{out}} = 200 \times 4 = 800\text{ J}. Given an efficiency of 80%80\% (0.800.80), the total work input required from the effort force is Win=8000.80=1000 JW_{\text{in}} = \frac{800}{0.80} = 1000\text{ J}. The energy lost to overcome frictional resistance in the pulleys equals the total work input minus useful work output: 1000 J800 J=200 J1000\text{ J} - 800\text{ J} = 200\text{ J}.

Step-by-Step Solution

1
Calculate useful work output
Wout=800 JW_{\text{out}} = 800\text{ J}
Useful work output is the energy required to raise the load through the specified height (Wout=Load×heightW_{\text{out}} = \text{Load} \times \text{height}).
2
Determine total work input
Win=1000 JW_{\text{in}} = 1000\text{ J}
The total work input is calculated from the efficiency formula: Efficiency=WoutWin\text{Efficiency} = \frac{W_{\text{out}}}{W_{\text{in}}}.
3
Compute work done against friction
Wfriction=200 JW_{\text{friction}} = 200\text{ J}
The work lost overcoming friction is the difference between total work input and useful work output (WinWoutW_{\text{in}} - W_{\text{out}}).

Key Concept

Work and Efficiency in Pulley Systems
Estimated Time:1m 30s
Question 469Question

A capacitor of capacitance 5 μF5\text{ }\mu\text{F} is charged to a potential difference of 200 V200\text{ V} and then disconnected from the power supply. If it is subsequently connected in parallel across an uncharged capacitor of capacitance 15 μF15\text{ }\mu\text{F}, what is the final common potential difference across the combination in volts?

Show answer & explanation

Answer: 50

Answer

The final common potential difference across the combination is 50 V.
By charge conservation, the total charge Q=C1V1=5 μF×200 V=1000 μCQ = C_1 V_1 = 5\text{ }\mu\text{F} \times 200\text{ V} = 1000\text{ }\mu\text{C} is shared across the two parallel capacitors. The total equivalent capacitance is Ctotal=C1+C2=20 μFC_{\text{total}} = C_1 + C_2 = 20\text{ }\mu\text{F}. Therefore, the final potential difference is V=QCtotal=1000 μC20 μF=50 VV = \frac{Q}{C_{\text{total}}} = \frac{1000\text{ }\mu\text{C}}{20\text{ }\mu\text{F}} = 50\text{ V}.

Step-by-Step Solution

1
Calculate the initial electric charge (QQ) stored on the charged capacitor
Q=5 μF×200 V=1000 μCQ = 5\text{ }\mu\text{F} \times 200\text{ V} = 1000\text{ }\mu\text{C}
Before connection, all charge is stored solely on the 5 μF5\text{ }\mu\text{F} capacitor.
2
Calculate the total equivalent capacitance (CtotalC_{\text{total}}) of the parallel network
Ctotal=5 μF+15 μF=20 μFC_{\text{total}} = 5\text{ }\mu\text{F} + 15\text{ }\mu\text{F} = 20\text{ }\mu\text{F}
Capacitors in parallel add directly (Ctotal=C1+C2C_{\text{total}} = C_1 + C_2).
3
Apply the law of conservation of charge to find the final common voltage (VV)
V=QCtotal=1000 μC20 μF=50 VV = \frac{Q}{C_{\text{total}}} = \frac{1000\text{ }\mu\text{C}}{20\text{ }\mu\text{F}} = 50\text{ V}
The total charge remains conserved and redistributes across the total combined capacitance.

Key Concept

Charge Redistribution and Conservation in Parallel Capacitors
Question 470Question

An enterprise presents the following financial balances at the end of its trading year:

- Premises and Machinery: 1,850,000\text{₦}1,850,000
- Stock (Inventory): 410,000\text{₦}410,000
- Trade Debtors: 240,000\text{₦}240,000
- Cash at Bank: 150,000\text{₦}150,000
- Trade Creditors: 270,000\text{₦}270,000
- Accrued Expenses: 130,000\text{₦}130,000
- Long-term Loan: 600,000\text{₦}600,000

What is the Capital Employed of the enterprise in Naira (\text{₦})?

Show answer & explanation

Answer: 2250000

Answer

The Capital Employed of the enterprise is 2,250,000\text{₦}2,250,000.
Capital Employed represents the total resources employed in the business operations. It is computed as Fixed Assets plus Working Capital. First, calculate Current Assets (Stock 410,000\text{₦}410,000 + Debtors 240,000\text{₦}240,000 + Bank 150,000\text{₦}150,000 = 800,000\text{₦}800,000) and Current Liabilities (Creditors 270,000\text{₦}270,000 + Accrued Expenses 130,000\text{₦}130,000 = 400,000\text{₦}400,000). Working Capital is 800,000400,000=400,000\text{₦}800,000 - \text{₦}400,000 = \text{₦}400,000. Adding Working Capital to Fixed Assets (Premises and Machinery 1,850,000\text{₦}1,850,000) gives a Capital Employed of 2,250,000\text{₦}2,250,000.

Step-by-Step Solution

1
Determine total Current Assets
Current Assets = 410,000+240,000+150,000=800,000\text{₦}410,000 + \text{₦}240,000 + \text{₦}150,000 = \text{₦}800,000
Current assets consist of short-term liquid assets including stock, debtors, and cash at bank.
2
Determine total Current Liabilities
Current Liabilities = 270,000+130,000=400,000\text{₦}270,000 + \text{₦}130,000 = \text{₦}400,000
Current liabilities consist of short-term obligations payable within a year, including trade creditors and accrued expenses.
3
Calculate Working Capital
Working Capital = 800,000400,000=400,000\text{₦}800,000 - \text{₦}400,000 = \text{₦}400,000
Working capital is the net operational buffer calculated as Current Assets minus Current Liabilities.
4
Compute Capital Employed
Capital Employed = 1,850,000+400,000=2,250,000\text{₦}1,850,000 + \text{₦}400,000 = \text{₦}2,250,000
Capital Employed represents the total long-term assets and funds financing the business, calculated as Fixed Assets plus Working Capital (or Total Assets minus Current Liabilities).

Key Concept

Capital Employed represents the total funds actively utilized in running a business. It can be computed either as Fixed Assets + Working Capital or Total Assets - Current Liabilities.
Question 471Question

A 14.3 g14.3\text{ g} sample of washing soda crystals, hydrated sodium trioxocarbonate(IV) (Na2CO310H2O\text{Na}_2\text{CO}_3 \cdot 10\text{H}_2\text{O}), is completely dissolved in water. Calculate the total number of moles of oxygen atoms present in this sample. [Relative atomic masses: Na=23\text{Na} = 23, C=12\text{C} = 12, O=16\text{O} = 16, H=1\text{H} = 1]

Show answer & explanation

Answer: 0.65

Answer

The total number of moles of oxygen atoms present in the sample is 0.65 mol.
The molar mass of Na2CO310H2O\text{Na}_2\text{CO}_3 \cdot 10\text{H}_2\text{O} is 286 g/mol286\text{ g/mol}. A mass of 14.3 g14.3\text{ g} corresponds to 14.3286=0.05 mol\frac{14.3}{286} = 0.05\text{ mol} of the compound. Since each formula unit contains 13 oxygen atoms (3 from the trioxocarbonate anion and 10 from the water of crystallization), the total moles of oxygen atoms present is 0.05×13=0.65 mol0.05 \times 13 = 0.65\text{ mol}.

Step-by-Step Solution

1
Calculate the molar mass of Na2CO310H2O\text{Na}_2\text{CO}_3 \cdot 10\text{H}_2\text{O}.
Molar mass = 286 g/mol286\text{ g/mol}.
Summing the atomic masses of all constituent atoms, including the 10 water molecules of crystallization: (2×23)+12+(3×16)+10×(18)=286 g/mol(2 \times 23) + 12 + (3 \times 16) + 10 \times (18) = 286\text{ g/mol}.
2
Calculate the number of moles of Na2CO310H2O\text{Na}_2\text{CO}_3 \cdot 10\text{H}_2\text{O} present in the sample.
Moles of compound = 0.05 mol0.05\text{ mol}.
Dividing the given sample mass by its molar mass: 14.3 g286 g/mol=0.05 mol\frac{14.3\text{ g}}{286\text{ g/mol}} = 0.05\text{ mol}.
3
Determine the stoichiometric ratio of oxygen atoms per mole of hydrated compound.
13 moles of O atoms per 1 mole of Na2CO310H2O\text{Na}_2\text{CO}_3 \cdot 10\text{H}_2\text{O}.
Each formula unit contains 3 oxygen atoms from the trioxocarbonate group and 10 oxygen atoms from the ten water of crystallization molecules (3+10=133 + 10 = 13).
4
Multiply the moles of compound by the number of oxygen atoms per formula unit.
Total moles of O atoms = 0.65 mol0.65\text{ mol}.
Calculating total oxygen moles: 0.05 mol×13=0.65 mol0.05\text{ mol} \times 13 = 0.65\text{ mol}.

Key Concept

The Mole Concept, Molar Mass, and Stoichiometric Ratios in Hydrated Salts
Question 472Question

A galvanometer has an internal resistance of 20 Ω20\text{ }\Omega and produces a full-scale deflection for a current of 15 mA15\text{ mA}. What resistance of the multiplier, in ohms (Ω\Omega), is required to convert this galvanometer into a voltmeter capable of measuring a maximum potential difference of 30 V30\text{ V}?

Show answer & explanation

Answer: 1980

Answer

The required multiplier resistance is 1980 Ω1980\text{ }\Omega.
To convert a galvanometer into a voltmeter, a multiplier resistor RmR_m is connected in series. The maximum potential difference VV across the combination is given by V=Ig(Rg+Rm)V = I_g(R_g + R_m). Substituting V=30 VV = 30\text{ V}, Ig=0.015 AI_g = 0.015\text{ A}, and Rg=20 ΩR_g = 20\text{ }\Omega yields Rm=1980 ΩR_m = 1980\text{ }\Omega.

Step-by-Step Solution

1
Convert current from milliamperes to amperes.
Ig=15 mA=0.015 AI_g = 15\text{ mA} = 0.015\text{ A}.
Standard electrical formulas require current in amperes.
2
Apply the relationship between voltage range, galvanometer current, internal resistance, and multiplier resistance.
V=Ig(Rg+Rm)V = I_g(R_g + R_m), where V=30 VV = 30\text{ V}, Ig=0.015 AI_g = 0.015\text{ A}, and Rg=20 ΩR_g = 20\text{ }\Omega.
A multiplier resistor is connected in series with the galvanometer so that the total potential difference is distributed across both components.
3
Rearrange the equation and compute RmR_m.
Rm=300.01520=200020=1980 ΩR_m = \frac{30}{0.015} - 20 = 2000 - 20 = 1980\text{ }\Omega.
Subtracting the internal resistance of the galvanometer from the total required resistance yields the necessary multiplier resistance.

Key Concept

Galvanometer conversion to a voltmeter using a series multiplier resistor
Estimated Time:1m 30s
Question 473Question

A resistance thermometer has a resistance of 5.0Ω5.0\,\Omega at 0C0^\circ\text{C} and 5.8Ω5.8\,\Omega at 40C40^\circ\text{C}. What is the temperature coefficient of resistance of the material in K1\text{K}^{-1}?

Show answer & explanation

Answer: 0.004

Answer

The temperature coefficient of resistance of the material is 0.004K10.004\,\text{K}^{-1} (or 4.0×103K14.0 \times 10^{-3}\,\text{K}^{-1}).
The temperature coefficient of resistance is calculated using α=RTR0R0ΔT\alpha = \frac{R_T - R_0}{R_0 \Delta T}. Substituting R0=5.0ΩR_0 = 5.0\,\Omega, RT=5.8ΩR_T = 5.8\,\Omega, and ΔT=40K\Delta T = 40\,\text{K} yields α=0.8200=0.004K1\alpha = \frac{0.8}{200} = 0.004\,\text{K}^{-1}.

Step-by-Step Solution

1
Identify the relationship between resistance and temperature.
RT=R0(1+αΔT)R_T = R_0(1 + \alpha \Delta T), with R0=5.0ΩR_0 = 5.0\,\Omega, RT=5.8ΩR_T = 5.8\,\Omega, and ΔT=40C\Delta T = 40^\circ\text{C}.
The resistance of metallic conductors varies linearly with temperature for moderate temperature changes.
2
Rearrange the expression to isolate the temperature coefficient α\alpha.
\alpha = \frac{R_T - R_0}{R_0 \Delta T}
Isolating α\alpha allows direct computation from the given resistance values and temperature interval.
3
Calculate the numerical value of α\alpha.
\alpha = \frac{5.8 - 5.0}{5.0 \times 40} = \frac{0.8}{200} = 0.004\,\text{K}^{-1}
Dividing the change in resistance by the product of initial resistance and temperature change gives the fractional resistance change per unit temperature change.

Key Concept

Temperature dependence of electrical resistance and temperature coefficient of resistance.
Question 474Question

A standard solution is prepared by dissolving 1.575 g1.575\text{ g} of hydrated ethanedioic acid (H2C2O4xH2O\text{H}_2\text{C}_2\text{O}_4 \cdot x\text{H}_2\text{O}) in distilled water to make 250.0 cm3250.0\text{ cm}^3 of solution. A 25.0 cm325.0\text{ cm}^3 sample of this acid solution requires 25.0 cm325.0\text{ cm}^3 of a 0.100 mol dm30.100\text{ mol dm}^{-3} sodium hydroxide (NaOH\text{NaOH}) solution for complete neutralization. What is the integer value of xx in the formula of the hydrated acid? [Relative atomic masses: H=1\text{H} = 1, C=12\text{C} = 12, O=16\text{O} = 16]

Show answer & explanation

Answer: 2

Answer

The integer value of xx is 2.
The value of xx is calculated as 22. Based on the reaction stoichiometry, 25.0 cm325.0\text{ cm}^3 of 0.100 mol dm30.100\text{ mol dm}^{-3} NaOH\text{NaOH} contains 0.0025 mol0.0025\text{ mol} of base, which neutralizes 0.00125 mol0.00125\text{ mol} of the diprotic acid in the 25.0 cm325.0\text{ cm}^3 sample. The entire 250.0 cm3250.0\text{ cm}^3 solution therefore contains 0.0125 mol0.0125\text{ mol} of acid. Dividing the mass (1.575 g1.575\text{ g}) by 0.0125 mol0.0125\text{ mol} gives a molar mass of 126 g mol1126\text{ g mol}^{-1} for H2C2O4xH2O\text{H}_2\text{C}_2\text{O}_4 \cdot x\text{H}_2\text{O}. Subtracting the molar mass of anhydrous H2C2O4\text{H}_2\text{C}_2\text{O}_4 (90 g mol190\text{ g mol}^{-1}) gives 36 g mol136\text{ g mol}^{-1} for water, which corresponds to x=36/18=2x = 36 / 18 = 2.

Step-by-Step Solution

1
Determine the mole ratio from the balanced chemical neutralization equation.
H2C2O4xH2O+2NaOHNa2C2O4+(x+2)H2O\text{H}_2\text{C}_2\text{O}_4 \cdot x\text{H}_2\text{O} + 2\text{NaOH} \rightarrow \text{Na}_2\text{C}_2\text{O}_4 + (x+2)\text{H}_2\text{O}. The stoichiometric ratio of acid to base is 1:21 : 2.
Ethanedioic acid is a diprotic acid requiring two moles of hydroxide ions for complete neutralization per mole of acid.
2
Calculate the amount in moles of sodium hydroxide solution used in the titration.
Moles of NaOH=0.100 mol dm3×25.01000 dm3=0.0025 mol\text{Moles of NaOH} = 0.100\text{ mol dm}^{-3} \times \frac{25.0}{1000}\text{ dm}^3 = 0.0025\text{ mol}.
Number of moles is equal to molar concentration multiplied by volume in cubic decimeters.
3
Calculate the total moles of hydrated acid present in the 250.0 cm3250.0\text{ cm}^3 volumetric flask.
Moles in 25.0 cm3 aliquot=0.00252=0.00125 mol\text{Moles in } 25.0\text{ cm}^3 \text{ aliquot} = \frac{0.0025}{2} = 0.00125\text{ mol}. Total moles in 250.0 cm3=0.00125×250.025.0=0.0125 mol250.0\text{ cm}^3 = 0.00125 \times \frac{250.0}{25.0} = 0.0125\text{ mol}.
Using the stoichiometric ratio (na/nb=1/2n_a/n_b = 1/2) and scaling up from the 25.0 cm325.0\text{ cm}^3 aliquot to the full 250.0 cm3250.0\text{ cm}^3 solution volume.
4
Compute the molar mass of the hydrated acid and solve for xx.
Molar mass=1.575 g0.0125 mol=126 g mol1\text{Molar mass} = \frac{1.575\text{ g}}{0.0125\text{ mol}} = 126\text{ g mol}^{-1}. Molar mass of anhydrous H2C2O4=2(1)+2(12)+4(16)=90 g mol1\text{H}_2\text{C}_2\text{O}_4 = 2(1) + 2(12) + 4(16) = 90\text{ g mol}^{-1}. Mass of xH2O=12690=36 g mol1x\text{H}_2\text{O} = 126 - 90 = 36\text{ g mol}^{-1}. Thus, x=3618=2x = \frac{36}{18} = 2.
Subtracting the molar mass of the anhydrous acid from the total molar mass gives the mass of the water of crystallization, which is divided by the molar mass of water (18 g mol118\text{ g mol}^{-1}) to find xx.

Key Concept

Volumetric Analysis and Water of Crystallization Determination
Question 475Question

Calculate the mass, in grams, of nitrogen contained in a 16.4 g16.4\text{ g} sample of pure calcium trioxonitrate(V), Ca(NO3)2\text{Ca(NO}_3)_2. [Ca=40,N=14,O=16][\text{Ca} = 40, \text{N} = 14, \text{O} = 16]

Show answer & explanation

Answer: 2.8

Answer

The mass of nitrogen in the sample is 2.8 g2.8\text{ g}.
The molar mass of Ca(NO3)2\text{Ca(NO}_3)_2 is calculated as 40+2(14+3×16)=164 g/mol40 + 2(14 + 3 \times 16) = 164\text{ g/mol}. A 16.4 g16.4\text{ g} sample corresponds to 16.4164=0.1 mol\frac{16.4}{164} = 0.1\text{ mol} of Ca(NO3)2\text{Ca(NO}_3)_2. Because each formula unit contains 2 nitrogen atoms, 0.1 mol0.1\text{ mol} of compound yields 0.2 mol0.2\text{ mol} of nitrogen. Multiplying 0.2 mol0.2\text{ mol} by the molar mass of atomic nitrogen (14 g/mol14\text{ g/mol}) gives 2.8 g2.8\text{ g}.

Step-by-Step Solution

1
Calculate the molar mass of calcium trioxonitrate(V), Ca(NO3)2\text{Ca(NO}_3)_2
164 g/mol164\text{ g/mol}
Sum the relative atomic masses of all atoms present: 40+2(14+3×16)=164 g/mol40 + 2(14 + 3 \times 16) = 164\text{ g/mol}.
2
Calculate the number of moles of Ca(NO3)2\text{Ca(NO}_3)_2 present in 16.4 g16.4\text{ g}
0.1 mol0.1\text{ mol}
Use the formula moles=massmolar mass=16.4 g164 g/mol=0.1 mol\text{moles} = \frac{\text{mass}}{\text{molar mass}} = \frac{16.4\text{ g}}{164\text{ g/mol}} = 0.1\text{ mol}.
3
Determine the number of moles of nitrogen atoms in 0.1 mol0.1\text{ mol} of Ca(NO3)2\text{Ca(NO}_3)_2
0.2 mol0.2\text{ mol} of N atoms
Each formula unit of Ca(NO3)2\text{Ca(NO}_3)_2 contains 2 nitrogen atoms.
4
Calculate the mass of the nitrogen atoms
2.8 g2.8\text{ g}
Multiply the moles of nitrogen by its atomic mass: 0.2 mol×14 g/mol=2.8 g0.2\text{ mol} \times 14\text{ g/mol} = 2.8\text{ g}.

Key Concept

Mole Concept and Mass Composition of Compounds
Estimated Time:1m 30s
Question 476Question

A progressive wave traveling along a stretched string has a frequency of 250 Hz250\text{ Hz} and a speed of 300 m/s300\text{ m/s}. What is the minimum distance, in meters, between two points on the string that differ in phase by π3 rad\frac{\pi}{3}\text{ rad}?

Show answer & explanation

Answer: 0.2

Answer

The minimum distance between the two points is 0.2 m0.2\text{ m}.
The wavelength is found using λ=vf=300250=1.2 m\lambda = \frac{v}{f} = \frac{300}{250} = 1.2\text{ m}. Substituting λ=1.2 m\lambda = 1.2\text{ m} and Δϕ=π3 rad\Delta \phi = \frac{\pi}{3}\text{ rad} into the phase difference formula Δϕ=2πΔxλ\Delta \phi = \frac{2\pi \Delta x}{\lambda} gives Δx=(π/3)×1.22π=0.2 m\Delta x = \frac{(\pi / 3) \times 1.2}{2\pi} = 0.2\text{ m}.

Step-by-Step Solution

1
Calculate the wavelength (\(\lambda\)) from wave speed (\(v\)) and frequency (\(f\))
\(\lambda = \frac{300}{250} = 1.2\text{ m}\)
The fundamental wave equation relates wave speed, frequency, and wavelength as \(v = f\lambda\).
2
Apply the phase difference formula to solve for spatial separation (\(\Delta x\))
\(\Delta x = \frac{\Delta \phi \cdot \lambda}{2\pi} = \frac{(\pi / 3) \cdot 1.2}{2\pi} = 0.2\text{ m}\)
A full cycle of \(2\pi\text{ radians}\) corresponds to a spatial displacement of one wavelength (\(\lambda\)).

Key Concept

Relationship between phase difference and spatial displacement
Question 477Question

A uniform horizontal wooden beam ABAB of length 4.0 m4.0\text{ m} and mass 8.0 kg8.0\text{ kg} is supported on a pivot placed 1.0 m1.0\text{ m} from end AA. A mass of 5.0 kg5.0\text{ kg} is suspended from end BB. What is the magnitude of the downward vertical force FF in newtons that must be applied at end AA to keep the beam in horizontal equilibrium? (Take g=10 m/s2g = 10\text{ m/s}^2).

Show answer & explanation

Answer: 230

Answer

The magnitude of the downward force required at end A to maintain horizontal equilibrium is 230 N.
Taking moments about the pivot, the downward force F at end A produces an anticlockwise moment of F × 1.0 m. This balances the clockwise moments produced by the weight of the beam (80 N × 1.0 m) and the load at end B (50 N × 3.0 m). Equating anticlockwise and clockwise moments gives F × 1.0 = 80 + 150 = 230 N.

Step-by-Step Solution

1
Determine the weights and distance of each force from the pivot point
Weight of beam = 80 N acting at 1.0 m right of pivot; weight at B = 50 N acting at 3.0 m right of pivot; force F acts at 1.0 m left of pivot.
The center of gravity of a uniform 4.0 m beam is at its midpoint (2.0 m from end A).
2
Set up the moment equilibrium equation about the pivot
F × 1.0 = (80 × 1.0) + (50 × 3.0)
For static rotational equilibrium, total anticlockwise moments equal total clockwise moments.
3
Solve for the force magnitude F
F = 230 N
Summing clockwise moments yields 80 + 150 = 230 N m, which divided by 1.0 m gives F = 230 N.

Key Concept

Principle of Moments and Static Equilibrium
Estimated Time:1m 30s
Question 478Question

A potential difference of 16V16\,\text{V} is applied across a uniform conductor of length 4.0m4.0\,\text{m} and cross-sectional area 1.5×106m21.5 \times 10^{-6}\,\text{m}^2. If the resistivity of the conductor material is 3.0×107Ωm3.0 \times 10^{-7}\,\Omega\cdot\text{m}, what is the electric current, in amperes, flowing through the conductor?

Show answer & explanation

Answer: 20

Answer

The electric current flowing through the conductor is 20A20\,\text{A}.
The electrical resistance of the wire is first determined using the formula R=ρLA=(3.0×107)(4.0)1.5×106=0.8ΩR = \frac{\rho L}{A} = \frac{(3.0 \times 10^{-7})(4.0)}{1.5 \times 10^{-6}} = 0.8\,\Omega. Then, by applying Ohm's law (I=VRI = \frac{V}{R}), the current is computed as I=160.8=20AI = \frac{16}{0.8} = 20\,\text{A}.

Step-by-Step Solution

1
Calculate the electrical resistance of the conductor from its physical dimensions and resistivity.
R=0.8ΩR = 0.8\,\Omega
Substitute ρ=3.0×107Ωm\rho = 3.0 \times 10^{-7}\,\Omega\cdot\text{m}, L=4.0mL = 4.0\,\text{m}, and A=1.5×106m2A = 1.5 \times 10^{-6}\,\text{m}^2 into R=ρLAR = \frac{\rho L}{A}.
2
Apply Ohm's law to calculate the current flowing through the conductor.
I=20AI = 20\,\text{A}
Substitute potential difference V=16VV = 16\,\text{V} and calculated resistance R=0.8ΩR = 0.8\,\Omega into I=VRI = \frac{V}{R}.

Key Concept

Relationship between resistivity, resistance, potential difference, and electric current
Question 479Question

A transverse progressive wave traveling along a stretched string is represented by the mathematical wave equation y=0.05sin(160πt8πx)y = 0.05 \sin(160\pi t - 8\pi x), where xx and yy are measured in meters and tt is in seconds. What is the speed of propagation of the wave in m/s\text{m/s}?

Show answer & explanation

Answer: 20

Answer

The speed of propagation of the wave is 20 m/s20\text{ m/s}.
Comparing the given equation y=0.05sin(160πt8πx)y = 0.05 \sin(160\pi t - 8\pi x) with the standard wave equation y=Asin(ωtkx)y = A \sin(\omega t - kx) gives the angular frequency ω=160π rad/s\omega = 160\pi\text{ rad/s} and wave number k=8π rad/mk = 8\pi\text{ rad/m}. Substituting these into v=ωkv = \frac{\omega}{k} yields v=160π8π=20 m/sv = \frac{160\pi}{8\pi} = 20\text{ m/s}.

Step-by-Step Solution

1
Compare the given wave equation with the standard progressive wave equation.
The standard form is y=Asin(ωtkx)y = A \sin(\omega t - kx). Comparing parameters yields ω=160π rad/s\omega = 160\pi\text{ rad/s} and k=8π rad/mk = 8\pi\text{ rad/m}.
Matching coefficients allows direct extraction of angular frequency and wave number.
2
Calculate the wave speed using the relation between angular frequency and wave number.
v=ωk=160π rad/s8π rad/m=20 m/sv = \frac{\omega}{k} = \frac{160\pi\text{ rad/s}}{8\pi\text{ rad/m}} = 20\text{ m/s}.
Wave speed is defined as the ratio of angular frequency to wave number (v=λf=ωkv = \lambda f = \frac{\omega}{k}).

Key Concept

Wave Equation Parameter Extraction and Wave Speed Calculation
Question 480Question

An aqueous solution of a weak monoacidic base, BOH\text{BOH}, has a concentration of 0.20 mol dm30.20\text{ mol dm}^{-3} and a base dissociation constant Kb=5.0×106 mol dm3K_b = 5.0 \times 10^{-6}\text{ mol dm}^{-3} at 25C25^\circ\text{C}. Calculate the pH of this solution.

Show answer & explanation

Answer: 11

Answer

The pH of the weak monoacidic base solution is 11.0.
For a weak base, partial equilibrium ionization gives [OH]=Kb×C=5.0×106×0.20=1.0×103 mol dm3[\text{OH}^-] = \sqrt{K_b \times C} = \sqrt{5.0 \times 10^{-6} \times 0.20} = 1.0 \times 10^{-3}\text{ mol dm}^{-3}. The pOH is log10(1.0×103)=3.0-\log_{10}(1.0 \times 10^{-3}) = 3.0. Using pH=14.0pOH\text{pH} = 14.0 - \text{pOH}, the pH of the basic solution is 14.03.0=11.014.0 - 3.0 = 11.0.

Step-by-Step Solution

1
Formulate the dissociation equilibrium equation for the weak base BOH.
The ionization is BOH(aq)B(aq)++OH(aq)\text{BOH}_{(aq)} \rightleftharpoons \text{B}^+_{(aq)} + \text{OH}^-_{(aq)}, giving Kb=[B+][OH][BOH]K_b = \frac{[\text{B}^+][\text{OH}^-]}{[\text{BOH}]}.
Weak bases ionize incompletely in aqueous media.
2
Calculate the equilibrium hydroxide ion concentration [OH⁻].
[OH]=Kb×C=(5.0×106)(0.20)=1.0×103 mol dm3[\text{OH}^-] = \sqrt{K_b \times C} = \sqrt{(5.0 \times 10^{-6})(0.20)} = 1.0 \times 10^{-3}\text{ mol dm}^{-3}.
Since the base is weak and degree of ionization is small, [BOH]0.20 mol dm3[\text{BOH}] \approx 0.20\text{ mol dm}^{-3} and [B+]=[OH][\text{B}^+] = [\text{OH}^-].
3
Determine the pOH of the solution.
pOH=log10(1.0×103)=3.0\text{pOH} = -\log_{10}(1.0 \times 10^{-3}) = 3.0.
pOH is defined as log10[OH]-\log_{10}[\text{OH}^-].
4
Calculate the pH using the relationship between pH and pOH at 25°C.
pH=14.0pOH=14.03.0=11.0\text{pH} = 14.0 - \text{pOH} = 14.0 - 3.0 = 11.0.
At 25C25^\circ\text{C}, pH+pOH=14.0\text{pH} + \text{pOH} = 14.0.

Key Concept

Weak base dissociation equilibrium and pH determination
PreviousPage 24 / 77Next
All practice questions — JAMB UTME | Examkin