Non-Metals and Their Compounds

109 questions

Question 61Question

A water sample containing 0.010 mol0.010\text{ mol} of dissolved calcium hydrogentrioxocarbonate(IV), Ca(HCO3)2\text{Ca(HCO}_3)_2, responsible for temporary hardness, is boiled until complete precipitation of calcium trioxocarbonate(IV) occurs. The resulting solid residue is isolated and treated with an excess of dilute hydrochloric acid. What volume of carbon(IV) oxide gas, measured at room temperature and pressure (RTP, molar volume of gas =24.0 dm3 mol1= 24.0\text{ dm}^3\text{ mol}^{-1}), is liberated during the acid treatment?

Show answer & explanation

Answer: 0.240 dm30.240\text{ dm}^3

Answer

The volume of carbon(IV) oxide gas liberated during the acid treatment is 0.240 dm30.240\text{ dm}^3.
Boiling 0.010 mol0.010\text{ mol} of Ca(HCO3)2\text{Ca(HCO}_3)_2 yields 0.010 mol0.010\text{ mol} of CaCO3\text{CaCO}_3 precipitate. Reacting this precipitate with excess dilute acid yields 0.010 mol0.010\text{ mol} of CO2\text{CO}_2 gas. At RTP, 0.010 mol×24.0 dm3 mol1=0.240 dm30.010\text{ mol} \times 24.0\text{ dm}^3\text{ mol}^{-1} = 0.240\text{ dm}^3.

Step-by-Step Solution

1
Determine moles of CaCO3\text{CaCO}_3 precipitate formed during boiling.
The balanced thermal decomposition equation is Ca(HCO3)2(aq)CaCO3(s)+H2O(l)+CO2(g)\text{Ca(HCO}_3)_2(aq) \rightarrow \text{CaCO}_3(s) + \text{H}_2\text{O}(l) + \text{CO}_2(g). Thus, 0.010 mol0.010\text{ mol} of Ca(HCO3)2\text{Ca(HCO}_3)_2 produces 0.010 mol0.010\text{ mol} of CaCO3\text{CaCO}_3.
Temporary hardness is removed by boiling, which decomposes hydrogentrioxocarbonate(IV) into insoluble trioxocarbonate(IV).
2
Determine moles of CO2\text{CO}_2 gas evolved from the reaction of CaCO3\text{CaCO}_3 with dilute HCl\text{HCl}.
The balanced chemical equation is CaCO3(s)+2HCl(aq)CaCl2(aq)+H2O(l)+CO2(g)\text{CaCO}_3(s) + 2\text{HCl}(aq) \rightarrow \text{CaCl}_2(aq) + \text{H}_2\text{O}(l) + \text{CO}_2(g). 0.010 mol0.010\text{ mol} of CaCO3\text{CaCO}_3 reacts to release 0.010 mol0.010\text{ mol} of CO2\text{CO}_2.
Trioxocarbonate(IV) salts react with acids in a 1:1 mole ratio with respect to carbon(IV) oxide gas produced.
3
Calculate the volume of CO2\text{CO}_2 gas evolved at RTP.
\text{Volume} = 0.010\text{ mol} \times 24.0\text{ dm}^3\text{ mol}^{-1} = 0.240\text{ dm}^3$.
At room temperature and pressure, one mole of any gas occupies 24.0 dm324.0\text{ dm}^3.

Key Concept

Thermal decomposition of temporary water hardness salts and acid reactions of trioxocarbonate(IV) salts
Question 62Question

Ammonium trioxonitrate(V), NH4NO3NH_4NO_3, decomposes on heating to produce dinitrogen(I) oxide and water vapor according to the balanced chemical equation:

NH4NO3(s)N2O(g)+2H2O(g)NH_4NO_3(s) \rightarrow N_2O(g) + 2H_2O(g)

What volume of dinitrogen(I) oxide gas, measured at STP, is produced from the complete decomposition of 8.0 g8.0\text{ g} of pure ammonium trioxonitrate(V)?
[Molar mass of NH4NO3=80 g mol1, Molar volume of gas at STP =22.4 dm3 mol1][\text{Molar mass of } NH_4NO_3 = 80\text{ g mol}^{-1},\text{ Molar volume of gas at STP } = 22.4\text{ dm}^3\text{ mol}^{-1}]

Show answer & explanation

Answer: 2.24 dm32.24\text{ dm}^3

Answer

The volume of dinitrogen(I) oxide gas produced at STP is 2.24 dm32.24\text{ dm}^3.
The correct response calculates the mole value of ammonium trioxonitrate(V) as 0.10 mol0.10\text{ mol} (8.0 g/80 g mol18.0\text{ g} / 80\text{ g mol}^{-1}). Using the 1:11:1 stoichiometric ratio from the balanced decomposition reaction, 0.10 mol0.10\text{ mol} of dinitrogen(I) oxide is produced. At standard temperature and pressure (STP), one mole of any ideal gas occupies 22.4 dm322.4\text{ dm}^3, giving 0.10×22.4=2.24 dm30.10 \times 22.4 = 2.24\text{ dm}^3.

Step-by-Step Solution

1
Calculate the number of moles of NH4NO3NH_4NO_3 reacted
Moles of NH4NO3=MassMolar Mass=8.0 g80 g mol1=0.10 mol\text{Moles of } NH_4NO_3 = \frac{\text{Mass}}{\text{Molar Mass}} = \frac{8.0\text{ g}}{80\text{ g mol}^{-1}} = 0.10\text{ mol}
Converting given mass into moles is necessary to apply stoichiometric relationships.
2
Determine the mole ratio between NH4NO3NH_4NO_3 and N2ON_2O
From the balanced equation, 1 mol of NH4NO31\text{ mol of } NH_4NO_3 produces 1 mol of N2O1\text{ mol of } N_2O. Thus, 0.10 mol of NH4NO30.10\text{ mol of } NH_4NO_3 yields 0.10 mol of N2O0.10\text{ mol of } N_2O.
Stoichiometry dictates the theoretical mole yield of the target product.
3
Calculate the volume of N2ON_2O gas at STP
Volume at STP=0.10 mol×22.4 dm3 mol1=2.24 dm3\text{Volume at STP} = 0.10\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 2.24\text{ dm}^3
Multiplying the mole amount of gas by the molar volume at STP (22.4 dm3 mol122.4\text{ dm}^3\text{ mol}^{-1}) gives the volume.

Key Concept

Stoichiometric gas volume calculation at standard temperature and pressure (STP) for thermal decomposition reactions of nitrogen compounds.
Estimated Time:1m 30s
Question 63Question

When a 16.0 g16.0\text{ g} sample of pure ammonium trioxonitrate(V), NH4NO3NH_4NO_3, undergoes complete thermal decomposition, it produces dinitrogen monoxide gas, N2ON_2O, and water vapor. Assuming standard temperature and pressure (STP, where molar gas volume = 22.4 dm3mol122.4\text{ dm}^3\text{mol}^{-1}), what is the volume of the oxide of nitrogen collected, and how does its rate of diffusion compare to that of carbon(IV) oxide, CO2CO_2, under identical conditions? (Molar masses: N=14 g/molN = 14\text{ g/mol}, O=16 g/molO = 16\text{ g/mol}, H=1 g/molH = 1\text{ g/mol}, C=12 g/molC = 12\text{ g/mol})

Show answer & explanation

Answer: 4.48 dm34.48\text{ dm}^3, and its rate of diffusion is equal to that of CO2CO_2

Answer

4.48 dm34.48\text{ dm}^3, and its rate of diffusion is equal to that of CO2CO_2
Thermal decomposition of 16.0 g16.0\text{ g} (0.20 mol0.20\text{ mol}) of NH4NO3NH_4NO_3 produces 0.20 mol0.20\text{ mol} of N2ON_2O. At STP, 0.20 mol×22.4 dm3mol1=4.48 dm30.20\text{ mol} \times 22.4\text{ dm}^3\text{mol}^{-1} = 4.48\text{ dm}^3. Both N2ON_2O and CO2CO_2 have a molar mass of 44 g/mol44\text{ g/mol}, so by Graham's law of diffusion, their relative rates of diffusion are identical.

Step-by-Step Solution

1
Write the balanced chemical equation for the thermal decomposition of ammonium trioxonitrate(V)
NH4NO3(s)N2O(g)+2H2O(g)NH_4NO_3(s) \rightarrow N_2O(g) + 2H_2O(g)
Establishes the stoichiometric mole ratio between NH4NO3NH_4NO_3 and N2ON_2O, which is 1:11 : 1.
2
Calculate the molar mass and number of moles of NH4NO3NH_4NO_3 reacted
Molar mass of NH4NO3=2(14)+4(1)+3(16)=80 g/molNH_4NO_3 = 2(14) + 4(1) + 3(16) = 80\text{ g/mol}. Number of moles = 16.0 g80 g/mol=0.20 mol\frac{16.0\text{ g}}{80\text{ g/mol}} = 0.20\text{ mol}.
Determines the mole quantity of reactant available.
3
Determine the volume of N2ON_2O produced at STP
Moles of N2O=0.20 molN_2O = 0.20\text{ mol}. Volume at STP = 0.20 mol×22.4 dm3mol1=4.48 dm30.20\text{ mol} \times 22.4\text{ dm}^3\text{mol}^{-1} = 4.48\text{ dm}^3.
Applies standard molar volume of gas at STP.
4
Compare the rates of diffusion of N2ON_2O and CO2CO_2 using Graham's law
Molar mass of N2O=2(14)+16=44 g/molN_2O = 2(14) + 16 = 44\text{ g/mol}. Molar mass of CO2=12+2(16)=44 g/molCO_2 = 12 + 2(16) = 44\text{ g/mol}. Ratio of diffusion rates = 4444=1\sqrt{\frac{44}{44}} = 1.
Gases with equal molar masses diffuse at equal rates under identical conditions.

Key Concept

Thermal decomposition of nitrogen oxides, molar volume at STP, and Graham's law of diffusion
Estimated Time:2m 0s
Question 64Question

A 50.0 cm350.0\text{ cm}^3 gaseous mixture consisting of equal volumes of carbon(II) oxide and carbon(IV) oxide is passed through an excess solution of concentrated potassium hydroxide. What volume of gas remains unabsorbed, and which oxide of carbon was removed from the mixture?

Show answer & explanation

Answer: 25.0 cm325.0\text{ cm}^3, with carbon(IV) oxide being removed

Answer

25.0 cm325.0\text{ cm}^3 of gas remains unabsorbed, with carbon(IV) oxide being the component removed by potassium hydroxide solution.
Carbon(IV) oxide (CO2\text{CO}_2) is an acidic oxide that dissolves and reacts with concentrated alkali solutions such as potassium hydroxide to form potassium trioxocarbonate(IV) and water. Since the mixture contains 25.0 cm325.0\text{ cm}^3 of CO2\text{CO}_2 and 25.0 cm325.0\text{ cm}^3 of neutral carbon(II) oxide (CO\text{CO}), only CO2\text{CO}_2 is absorbed, leaving 25.0 cm325.0\text{ cm}^3 of CO\text{CO} gas remaining.

Step-by-Step Solution

1
Determine the initial volume of each gas component in the mixture.
The mixture has 50.0 cm350.0\text{ cm}^3 total volume with equal proportions, giving 25.0 cm325.0\text{ cm}^3 of CO\text{CO} and 25.0 cm325.0\text{ cm}^3 of CO2\text{CO}_2.
Equal volume proportions mean each gas makes up half of the total volume.
2
Analyze the reaction of each gas with concentrated potassium hydroxide (KOH\text{KOH}) solution.
CO2\text{CO}_2 reacts via 2KOH(aq)+CO2(g)K2CO3(aq)+H2O(l)2\text{KOH(aq)} + \text{CO}_2\text{(g)} \rightarrow \text{K}_2\text{CO}_3\text{(aq)} + \text{H}_2\text{O(l)}, absorbing all 25.0 cm325.0\text{ cm}^3 of CO2\text{CO}_2. CO\text{CO} does not react.
CO2\text{CO}_2 is an acidic oxide which neutralizes alkali solutions, whereas CO\text{CO} is a neutral oxide.
3
Calculate the unabsorbed volume of gas.
25.0 cm325.0\text{ cm}^3 of CO\text{CO} remains as unabsorbed gas.
Subtracting the absorbed volume of CO2\text{CO}_2 (25.0 cm325.0\text{ cm}^3) from total volume (50.0 cm350.0\text{ cm}^3) leaves 25.0 cm325.0\text{ cm}^3.

Key Concept

Chemical Behavior of Oxides of Carbon toward Alkalis
Question 65Question

Arrange the following sequential stages involved in the industrial isolation of pure nitrogen gas from atmospheric air via fractional distillation in the correct chronological order, from ambient air intake to nitrogen gas collection.

Drag items to arrange them in the correct order

Show answer & explanation

Answer

The correct chronological order of the process is: 1. Removal of dust, moisture, and carbon(IV) oxide; 2. Compression and Joule-Thomson expansion to produce liquid air; 3. Feeding liquid air into a fractionating column and gradual warming; 4. Selective vaporization and collection of nitrogen gas at -196 °C.
The industrial preparation of nitrogen gas relies on fractional distillation of liquid air. Ambient air must first be purified of water vapor and carbon(IV) oxide to prevent cryogenic equipment blockages caused by solid ice formation. The clean air is compressed under high pressure (around 200 atmospheres) and subjected to rapid Joule-Thomson expansion, which cools it repeatedly until it condenses into liquid air at approximately 200 C-200\text{ }^\circ\text{C}. When liquid air is fed into a fractionating column and warmed gradually, nitrogen gas boils off first at 196 C-196\text{ }^\circ\text{C} (77 K77\text{ K}) due to having a lower boiling point than argon (186 C-186\text{ }^\circ\text{C}) and oxygen (183 C-183\text{ }^\circ\text{C}).

Step-by-Step Solution

1
Identify the initial purification stage required before gas liquefaction.
Air is scrubbed to remove dust, water vapor, and CO2CO_2.
Freezing points of water (0 C0\text{ }^\circ\text{C}) and carbon(IV) oxide (78.5 C-78.5\text{ }^\circ\text{C}) are much higher than liquefaction temperature, meaning they would solidify and clog cryogenic tubes if not removed first.
2
Determine the phase change process of purified gaseous air into liquid air.
Purified air is compressed to 200 atm\sim 200\text{ atm} and allowed to expand through a fine nozzle.
The Joule-Thomson expansion causes progressive cooling until air liquefies around 200 C-200\text{ }^\circ\text{C}.
3
Analyze the fractionating column feed and thermal gradient.
Liquid air enters the fractionating column and is warmed slowly.
Gradual heating drives components with lower boiling points to vaporize first.
4
Compare boiling points to establish which component distills first.
Nitrogen boils off at 196 C-196\text{ }^\circ\text{C}, followed by argon (186 C-186\text{ }^\circ\text{C}) and oxygen (183 C-183\text{ }^\circ\text{C}).
Nitrogen has the lowest boiling point, so it boils off first as a gas at the top of the column.

Key Concept

Fractional Distillation of Liquid Air for Industrial Production of Nitrogen
Question 66Question

Under identical conditions of temperature and pressure, a neutral oxide of nitrogen diffuses 1.211.21 times faster than carbon(IV) oxide (CO2CO_2). Which of the following is a characteristic chemical property of this oxide of nitrogen? (Relative atomic masses: C=12,N=14,O=16\text{Relative atomic masses: } C = 12, N = 14, O = 16)

Show answer & explanation

Answer: It reacts rapidly with atmospheric oxygen at room temperature to form reddish-brown fumes.

Answer

The gas reacts rapidly with atmospheric oxygen at room temperature to form reddish-brown fumes.
Using Graham's law of diffusion, the molar mass of the unknown gas is calculated as 441.21230.0 g mol1\frac{44}{1.21^2} \approx 30.0\text{ g mol}^{-1}, which corresponds uniquely to nitrogen(II) oxide (NONO). A defining chemical test for NONO is its immediate oxidation by air to give reddish-brown fumes of nitrogen(IV) oxide (NO2NO_2).

Step-by-Step Solution

1
Calculate the molar mass of carbon(IV) oxide (CO2CO_2).
M(CO2)=12+2(16)=44 g mol1M(CO_2) = 12 + 2(16) = 44\text{ g mol}^{-1}.
Graham's law requires the molar mass of the reference gas.
2
Apply Graham's law of diffusion to determine the molar mass of the unknown nitrogen oxide (MxM_x).
RxRCO2=M(CO2)Mx    1.21=44Mx    (1.21)2=44Mx    Mx=441.464130.0 g mol1\frac{R_x}{R_{CO_2}} = \sqrt{\frac{M(CO_2)}{M_x}} \implies 1.21 = \sqrt{\frac{44}{M_x}} \implies (1.21)^2 = \frac{44}{M_x} \implies M_x = \frac{44}{1.4641} \approx 30.0\text{ g mol}^{-1}.
The rate of diffusion of a gas is inversely proportional to the square root of its molar mass.
3
Identify the formula of the nitrogen oxide with a molar mass of 30 g mol130\text{ g mol}^{-1}.
For nitrogen(II) oxide (NONO), M(NO)=14+16=30 g mol1M(NO) = 14 + 16 = 30\text{ g mol}^{-1}.
Matching the calculated molar mass to known oxides of nitrogen (N2O=44N_2O = 44, NO=30NO = 30, NO2=46NO_2 = 46).
4
Determine the key chemical property of nitrogen(II) oxide (NONO).
Nitrogen(II) oxide (NONO) is a colorless neutral gas that reacts spontaneously with oxygen in air to form brown nitrogen(IV) oxide (2NO+O22NO22NO + O_2 \rightarrow 2NO_2).
To select the correct property corresponding to NONO.

Key Concept

Graham's Law of Diffusion and Chemical Properties of Oxides of Nitrogen
Estimated Time:2m 0s
Question 67Question

During the industrial separation of liquefied air to obtain pure nitrogen gas, nitrogen vaporizes at 196C-196^\circ\text{C} while oxygen remains in the liquid state at 183C-183^\circ\text{C}. Which of the following statements correctly explains why nitrogen distills over first?

Show answer & explanation

Answer: Nitrogen has a lower boiling point than oxygen, so it vaporizes at a lower temperature.

Answer

Nitrogen has a lower boiling point than oxygen, so it vaporizes at a lower temperature.
Nitrogen has a lower boiling point (196C-196^\circ\text{C} or 77 K77\text{ K}) than oxygen (183C-183^\circ\text{C} or 90 K90\text{ K}). In fractional distillation, liquid mixtures are separated based on differences in boiling points, and the component with the lower boiling point boils off and distills over first.

Step-by-Step Solution

1
Compare the boiling point values on the Celsius and Kelvin temperature scales.
Nitrogen boils at 196C-196^\circ\text{C} (77 K77\text{ K}) while oxygen boils at 183C-183^\circ\text{C} (90 K90\text{ K}).
On the Celsius scale, 196-196 is smaller (lower) than 183-183.
2
Apply the physical principle of fractional distillation.
As liquefied air warms, nitrogen reaches its boiling point first and converts into gas.
The component with the lower boiling point always distills over first during fractional distillation.

Key Concept

Fractional Distillation of Liquid Air
Question 68Question

Under identical conditions of temperature and pressure, a 100 cm3100\text{ cm}^3 sample of nitrogen(II) oxide (NONO) diffuses through a porous container in 20 seconds20\text{ seconds}. If 100 cm3100\text{ cm}^3 of an unknown oxide of nitrogen diffuses through the exact same porous container in 35 seconds35\text{ seconds}, what is the molecular formula of the unknown oxide of nitrogen? [N=14,O=16][N = 14, O = 16]

Show answer & explanation

Answer: N2O4N_2O_4

Answer

The molecular formula of the unknown oxide is N2O4N_2O_4.
The correct answer is derived using Graham's Law of Diffusion (t2t1=M2M1\frac{t_2}{t_1} = \sqrt{\frac{M_2}{M_1}}). Given that nitrogen(II) oxide (NONO) has a molar mass of 30 g/mol30\text{ g/mol} and diffuses in 20 s20\text{ s}, an oxide diffusing in 35 s35\text{ s} must have a molar mass of 30×(35/20)2=91.87592 g/mol30 \times (35/20)^2 = 91.875 \approx 92\text{ g/mol}. The formula matching this molar mass is dinitrogen tetroxide (N2O4N_2O_4).

Step-by-Step Solution

1
Calculate the molar mass of the reference gas, nitrogen(II) oxide (NONO).
M1(NO)=14+16=30 g/molM_1(NO) = 14 + 16 = 30\text{ g/mol}.
Graham's law requires the molar mass of the reference gas to determine the unknown gas mass.
2
Apply Graham's Law of Diffusion in terms of time taken for equal volumes of gas to diffuse.
t2t1=M2M1\frac{t_2}{t_1} = \sqrt{\frac{M_2}{M_1}}, where t1=20 st_1 = 20\text{ s}, t2=35 st_2 = 35\text{ s}, and M1=30 g/molM_1 = 30\text{ g/mol}.
Rate of diffusion is inversely proportional to diffusion time for fixed volume, so Rate1Rate2=t2t1=M2M1\frac{\text{Rate}_1}{\text{Rate}_2} = \frac{t_2}{t_1} = \sqrt{\frac{M_2}{M_1}}.
3
Solve for the unknown molar mass M2M_2.
3520=1.75    (1.75)2=M230    3.0625=M230    M2=91.87592 g/mol\frac{35}{20} = 1.75 \implies (1.75)^2 = \frac{M_2}{30} \implies 3.0625 = \frac{M_2}{30} \implies M_2 = 91.875 \approx 92\text{ g/mol}.
Squaring the time ratio isolates the molar mass ratio.
4
Identify the formula of the nitrogen oxide with a molar mass of 92 g/mol92\text{ g/mol}.
N2O4N_2O_4: 2(14)+4(16)=28+64=92 g/mol2(14) + 4(16) = 28 + 64 = 92\text{ g/mol}.
Matching the calculated molar mass to the chemical formula of oxides of nitrogen.

Key Concept

Graham's Law of Diffusion applied to Oxides of Nitrogen
Estimated Time:2m 0s
Question 69Question

Arrange the following sequential transformations of nitrogen in the biological nitrogen cycle, beginning with atmospheric molecular nitrogen (N2N_2) and concluding with its re-release into the atmosphere:

Drag items to arrange them in the correct order

Show answer & explanation

Answer

The correct sequence of nitrogen cycle transformations is: Nitrogen fixation (N2NH4+N_2 \rightarrow NH_4^+), Nitrosification (NH4+NO2NH_4^+ \rightarrow NO_2^-), Nitration (NO2NO3NO_2^- \rightarrow NO_3^-), Assimilation (NO3organic plant proteinsNO_3^- \rightarrow \text{organic plant proteins}), and Denitrification (NO3N2NO_3^- \rightarrow N_2).
The biological nitrogen cycle proceeds in a specific logical sequence. First, atmospheric nitrogen gas (N2N_2) must undergo nitrogen fixation to become ammonium ions (NH4+NH_4^+). Next, nitrification occurs in two steps: nitrosification converts ammonium (NH4+NH_4^+) to nitrite (NO2NO_2^-) via *Nitrosomonas*, followed by nitration converting nitrite (NO2NO_2^-) to nitrate (NO3NO_3^-) via *Nitrobacter*. Plants then assimilate these nitrate ions (NO3NO_3^-) into organic plant proteins. Finally, denitrifying bacteria reduce residual soil nitrates (NO3NO_3^-) back into atmospheric nitrogen gas (N2N_2) under anaerobic conditions.

Step-by-Step Solution

1
Identify the initial entry point of atmospheric nitrogen into the biosphere.
Gaseous nitrogen (N2N_2) is fixed into ammonium ions (NH4+NH_4^+) by nitrogen-fixing bacteria (e.g., *Rhizobium*, *Azotobacter*).
Atmospheric N2N_2 has a strong triple covalent bond (NNN \equiv N) and cannot be directly utilized by higher plants without preliminary biological fixation.
2
Determine the initial oxidation stage of nitrification (nitrosification).
Ammonium ions (NH4+NH_4^+) are oxidized to nitrite ions (NO2NO_2^-) by *Nitrosomonas*.
Nitrification occurs in two distinct microbial steps, starting with ammonium conversion to nitrite.
3
Determine the second oxidation stage of nitrification (nitration).
Nitrite ions (NO2NO_2^-) are oxidized to nitrate ions (NO3NO_3^-) by *Nitrobacter*.
Nitrate (NO3NO_3^-) is the most readily absorbed and utilized form of inorganic nitrogen for plants.
4
Trace the biological uptake of bioavailable soil nitrogen.
Plants absorb NO3NO_3^- ions and assimilate them into plant proteins and nucleic acids.
Inorganic nitrate is reduced inside plant tissues and converted into organic amino acids.
5
Identify the pathway responsible for returning gaseous nitrogen to the atmosphere.
Denitrifying bacteria (e.g., *Pseudomonas denitrificans*) convert unabsorbed soil nitrates (NO3NO_3^-) into atmospheric N2N_2 gas under anaerobic conditions.
Denitrification closes the global nitrogen loop by replenishing free atmospheric N2N_2.

Key Concept

Nitrogen Cycle Transformations and Microorganisms
Estimated Time:2m 0s
Question 70Question

Complete the following passage regarding the redox behavior of hydrogen sulfide gas when reacted with an iron(III) compound by filling in the blanks with the correct chemical terms.

Fill in the blanks below

When hydrogen sulfide gas is bubbled through an acidified solution of iron(III) chloride, the characteristic yellow color of the solution changes to due to the reduction of iron(III) ions to iron(II) ions, while a fine precipitate of elemental sulfur is deposited.
Show answer & explanation

Answer

The solution turns pale green (or green) due to the formation of iron(II) ions (Fe2+Fe^{2+}), accompanied by the deposition of a yellow precipitate of elemental sulfur (SS).
Hydrogen sulfide gas (H2SH_2S) acts as a strong reducing agent. When passed into an acidified solution of iron(III) chloride (FeCl3FeCl_3), it reduces yellow Fe3+Fe^{3+} ions to light green Fe2+Fe^{2+} ions, while H2SH_2S itself gets oxidized to form a yellow precipitate of elemental sulfur (SS). The overall ionic equation for the reaction is: 2Fe(aq)3++H2S(g)2Fe(aq)2++2H(aq)++S(s)2Fe^{3+}_{(aq)} + H_2S_{(g)} \rightarrow 2Fe^{2+}_{(aq)} + 2H^+_{(aq)} + S_{(s)}.

Step-by-Step Solution

1
Identify the role of hydrogen sulfide (H2SH_2S) in the reaction.
H2SH_2S acts as a reducing agent in acidic solution.
Sulfur in H2SH_2S has an oxidation state of 2-2 and undergoes oxidation to elemental sulfur (00 oxidation state).
2
Determine the change in oxidation state of iron.
Iron(III) ions (Fe3+Fe^{3+}) are reduced to iron(II) ions (Fe2+Fe^{2+}).
Iron(III) chloride solution is yellow/brown due to Fe(aq)3+Fe^{3+}_{(aq)}, whereas iron(II) ions (Fe(aq)2+Fe^{2+}_{(aq)}) impart a light green/pale green color to the aqueous solution.
3
Identify the physical appearance of oxidized sulfur product.
Elemental sulfur precipitates out of the solution.
Insoluble sulfur particles form a yellow suspension or precipitate in the solution.

Key Concept

Reducing property of Hydrogen Sulfide (H2SH_2S)
Question 71Question

Rhombic sulfur (α\alpha-sulfur) and monoclinic sulfur (β\beta-sulfur) are two well-known crystalline allotropes of sulfur. Which of the following statements correctly describes the stability and thermal transformation relationship between these two allotropes at standard atmospheric pressure?

Show answer & explanation

Answer: Above 96C96^\circ\text{C}, monoclinic sulfur is the stable crystalline form, whereas below 96C96^\circ\text{C}, rhombic sulfur is the stable crystalline form.

Answer

Above 96C96^\circ\text{C}, monoclinic sulfur is the stable crystalline form, whereas below 96C96^\circ\text{C}, rhombic sulfur is the stable crystalline form.
The transition temperature for the two main crystalline allotropes of sulfur is 96C96^\circ\text{C}. Below this temperature, rhombic sulfur (α\alpha-sulfur) is the thermodynamically stable form. When heated above 96C96^\circ\text{C}, rhombic sulfur slowly transforms into monoclinic sulfur (β\beta-sulfur), which remains stable up to its melting point of 119C119^\circ\text{C}.

Step-by-Step Solution

1
Identify the nature of the allotropes of sulfur.
Both rhombic sulfur (α\alpha-sulfur) and monoclinic sulfur (β\beta-sulfur) are crystalline allotropes made up of crown-shaped S8S_8 molecules.
Allotropes are different structural forms of the same element in the same physical state.
2
Determine the transition temperature between rhombic and monoclinic sulfur.
The transition temperature is 96C96^\circ\text{C}. At this temperature, both allotropes coexist in equilibrium.
Temperature determines which crystal lattice structure is thermodynamically stable.
3
Evaluate stability ranges above and below the transition temperature.
Rhombic sulfur is stable below 96C96^\circ\text{C}, while monoclinic sulfur is stable between 96C96^\circ\text{C} and its melting point (119C119^\circ\text{C}).
Heating rhombic sulfur above 96C96^\circ\text{C} slowly converts it to monoclinic sulfur needles.

Key Concept

Transition temperature and allotropy of crystalline sulfur
Estimated Time:1m 0s
Question 72Question

A sample of 9.0 g9.0\text{ g} of anhydrous ethanedioic acid, H2C2O4\text{H}_2\text{C}_2\text{O}_4, is completely dehydrated using excess concentrated tetraoxosulfate(VI) acid. The evolved gaseous mixture is passed through an excess concentrated sodium hydroxide solution to absorb carbon(IV) oxide. What volume of pure carbon(II) oxide gas is collected at STP? [Molar mass of H2C2O4=90 g mol1\text{H}_2\text{C}_2\text{O}_4 = 90\text{ g mol}^{-1}; Molar volume of gas at STP =22.4 dm3 mol1= 22.4\text{ dm}^3\text{ mol}^{-1}]

Show answer & explanation

Answer: 2.24 dm32.24\text{ dm}^3

Answer

The volume of pure carbon(II) oxide collected at STP is 2.24 dm32.24\text{ dm}^3.
Dehydration of 9.0 g9.0\text{ g} (0.10 mol0.10\text{ mol}) of ethanedioic acid produces 0.10 mol0.10\text{ mol} of CO\text{CO} and 0.10 mol0.10\text{ mol} of CO2\text{CO}_2. Concentrated sodium hydroxide absorbs all the CO2\text{CO}_2, leaving only 0.10 mol0.10\text{ mol} of neutral CO\text{CO} gas. At STP (22.4 dm3 mol122.4\text{ dm}^3\text{ mol}^{-1}), 0.10 mol0.10\text{ mol} of CO\text{CO} occupies 2.24 dm32.24\text{ dm}^3.

Step-by-Step Solution

1
Calculate the number of moles of ethanedioic acid (H2C2O4\text{H}_2\text{C}_2\text{O}_4).
Moles=9.0 g90 g mol1=0.10 mol\text{Moles} = \frac{9.0\text{ g}}{90\text{ g mol}^{-1}} = 0.10\text{ mol}.
Determining initial mole quantity from given mass and molar mass.
2
Write the balanced chemical equation for the dehydration of ethanedioic acid.
H2C2O4(s)conc. H2SO4CO(g)+CO2(g)+H2O(l)\text{H}_2\text{C}_2\text{O}_4(\text{s}) \xrightarrow{\text{conc. } \text{H}_2\text{SO}_4} \text{CO}(\text{g}) + \text{CO}_2(\text{g}) + \text{H}_2\text{O}(\text{l}).
1 mole of ethanedioic acid yields 1 mole of CO\text{CO} gas and 1 mole of CO2\text{CO}_2 gas.
3
Determine the mole amount of carbon(II) oxide collected after passing through sodium hydroxide.
Sodium hydroxide reacts with acidic oxide CO2\text{CO}_2 to form Na2CO3\text{Na}_2\text{CO}_3, leaving 0.10 mol0.10\text{ mol} of unreacted neutral CO\text{CO} gas to be collected.
Sodium hydroxide selectively absorbs carbon(IV) oxide, allowing pure carbon(II) oxide gas to pass through.
4
Calculate the volume of pure CO\text{CO} gas at STP.
\text{Volume} = 0.10\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 2.24\text{ dm}^3$.
Converting moles of gas to volume at standard temperature and pressure.

Key Concept

Dehydration of ethanedioic acid yields an equimolar mixture of carbon(II) oxide and carbon(IV) oxide. Sodium hydroxide selectively absorbs carbon(IV) oxide, allowing pure carbon(II) oxide to be collected.
Question 73Question
When excess hydrogen sulfide gas (H2SH_2S) reacts with sulfur(IV) oxide (SO2SO_2) according to the balanced chemical equation:
2H2S(g)+SO2(g)3S(s)+2H2O(l)2H_2S(g) + SO_2(g) \rightarrow 3S(s) + 2H_2O(l)
What mass of elemental sulfur is precipitated when 5.6 dm35.6\text{ dm}^3 of SO2SO_2 gas at STP reacts completely?
(Molar volume of gas at STP = 22.4 dm3 mol122.4\text{ dm}^3\text{ mol}^{-1}; Relative atomic mass: S=32S = 32)
Show answer & explanation

Answer: 24.0 g24.0\text{ g}

Answer

The mass of elemental sulfur precipitated is 24.0 g24.0\text{ g}.
First, find the moles of SO2SO_2 at STP: 5.6 dm322.4 dm3 mol1=0.25 mol\frac{5.6\text{ dm}^3}{22.4\text{ dm}^3\text{ mol}^{-1}} = 0.25\text{ mol}. According to the balanced equation, 1 mole of SO21\text{ mole of } SO_2 produces 3 moles of S3\text{ moles of } S. Thus, 0.25 mol of SO20.25\text{ mol of } SO_2 produces 0.75 mol of S0.75\text{ mol of } S. Multiplying by the relative atomic mass of sulfur (32 g mol132\text{ g mol}^{-1}) gives 0.75×32=24.0 g0.75 \times 32 = 24.0\text{ g}.

Step-by-Step Solution

1
Calculate the number of moles of SO2SO_2 gas reacting at STP.
Moles of SO2=Volume at STPMolar volume at STP=5.6 dm322.4 dm3 mol1=0.25 mol\text{Moles of } SO_2 = \frac{\text{Volume at STP}}{\text{Molar volume at STP}} = \frac{5.6\text{ dm}^3}{22.4\text{ dm}^3\text{ mol}^{-1}} = 0.25\text{ mol}.
Gas volume at STP is converted to moles using the standard molar volume of 22.4 dm3 mol122.4\text{ dm}^3\text{ mol}^{-1}.
2
Determine the mole ratio between SO2SO_2 and SS from the balanced reaction equation.
From 2H2S(g)+SO2(g)3S(s)+2H2O(l)2H_2S(g) + SO_2(g) \rightarrow 3S(s) + 2H_2O(l), 1 mol of SO21\text{ mol of } SO_2 yields 3 mol of S3\text{ mol of } S.
Stoichiometric coefficients give the exact molar equivalence between reactants and products.
3
Calculate the moles of SS formed.
\text{Moles of } S = 0.25\text{ mol } SO_2 \times 3 = 0.75\text{ mol } S.
Multiplying moles of SO2SO_2 by the stoichiometric factor of 3 gives the moles of produced sulfur.
4
Convert the moles of sulfur to mass in grams.
\text{Mass of } S = 0.75\text{ mol} \times 32\text{ g mol}^{-1} = 24.0\text{ g}.
Mass is obtained by multiplying number of moles by relative atomic mass.

Key Concept

Gas stoichiometry at STP and redox reaction between hydrogen sulfide and sulfur(IV) oxide
Estimated Time:1m 30s
Question 74Question

During the industrial production of water gas, steam is blown over red-hot coke at elevated temperatures (1000C1000^\circ\text{C}). Why must the steam supply be periodically interrupted to blow air over the coke bed instead?

Show answer & explanation

Answer: The reaction between steam and coke is endothermic, which continuously cools the coke bed below the required reaction temperature.

Answer

The steam supply must be interrupted because the reaction between steam and red-hot coke (C(s)+H2O(g)CO(g)+H2(g)\text{C}_{(s)} + \text{H}_2\text{O}_{(g)} \rightarrow \text{CO}_{(g)} + \text{H}_{2(g)}) is strongly endothermic. This lowers the temperature of the coke bed below 1000C1000^\circ\text{C}, requiring air to be blown in so that carbon burns exothermically in oxygen (C+O2CO2\text{C} + \text{O}_2 \rightarrow \text{CO}_2) to reheat the bed.
The reaction C(s)+H2O(g)CO(g)+H2(g)\text{C}_{(s)} + \text{H}_2\text{O}_{(g)} \rightarrow \text{CO}_{(g)} + \text{H}_{2(g)} is endothermic, absorbing heat from the red-hot coke. To maintain the high temperatures necessary for continuous reaction, the steam blow is periodically stopped and an air blow is introduced to exothermically burn some coke and reheat the bed.

Step-by-Step Solution

1
Analyze the thermochemical nature of the water gas reaction.
The formation of water gas (CO+H2\text{CO} + \text{H}_2) from coke and steam absorbs heat (ΔH>0\Delta H > 0).
Endothermic reactions remove heat from the reaction vessel, causing the solid coke bed temperature to drop.
2
Determine the industrial necessity of alternating steam and air runs.
Blowing air causes exothermic combustion of carbon, restoring the red-hot temperature necessary for water gas synthesis.
High temperatures (1000C1000^\circ\text{C}) are required to maintain high reaction rates and favor product yield.

Key Concept

Industrial production and energetics of water gas synthesis from coal/coke
Estimated Time:1m 0s
Question 75Question
When 6.62 g6.62\text{ g} of lead(II) trioxonitrate(V), Pb(NO3)2\text{Pb(NO}_3)_2, is heated strongly until complete decomposition occurs according to the equation:
2Pb(NO3)2(s)2PbO(s)+4NO2(g)+O2(g)2\text{Pb(NO}_3)_2(s) \rightarrow 2\text{PbO}(s) + 4\text{NO}_2(g) + \text{O}_2(g)
What is the total volume of gaseous products evolved at standard temperature and pressure (STP)?
[Mr(Pb(NO3)2)=331 g mol1M_{\text{r}}(\text{Pb(NO}_3)_2) = 331\text{ g mol}^{-1}; Molar volume of gas at STP =22.4 dm3 mol1= 22.4\text{ dm}^3\text{ mol}^{-1}]
Show answer & explanation

Answer: 1.12 dm31.12\text{ dm}^3

Answer

The total volume of gaseous products evolved at STP is 1.12 dm31.12\text{ dm}^3.
Decomposition of 0.02 mol0.02\text{ mol} of lead(II) trioxonitrate(V) yields 0.04 mol0.04\text{ mol} of NO2\text{NO}_2 and 0.01 mol0.01\text{ mol} of O2\text{O}_2, making 0.05 mol0.05\text{ mol} of total gas. At STP, 0.05 mol×22.4 dm3 mol1=1.12 dm30.05\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 1.12\text{ dm}^3.

Step-by-Step Solution

1
Calculate the amount in moles of Pb(NO3)2\text{Pb(NO}_3)_2 decomposed
Moles of Pb(NO3)2=6.62 g331 g mol1=0.02 mol\text{Moles of Pb(NO}_3)_2 = \frac{6.62\text{ g}}{331\text{ g mol}^{-1}} = 0.02\text{ mol}
Dividing given mass by relative formula mass gives the mole amount.
2
Determine total moles of gaseous products using stoichiometric ratios
From the balanced equation, 2 mol of Pb(NO3)22\text{ mol of Pb(NO}_3)_2 yields 4 mol of NO2(g)+1 mol of O2(g)=5 mol of gas4\text{ mol of NO}_2(g) + 1\text{ mol of O}_2(g) = 5\text{ mol of gas}. Total gas moles =0.02×52=0.05 mol= 0.02 \times \frac{5}{2} = 0.05\text{ mol}.
Both NO2\text{NO}_2 and O2\text{O}_2 are gases at STP, so their mole quantities must be summed.
3
Calculate total gas volume at STP
\text{Volume} =0.05 mol×22.4 dm3 mol1=1.12 dm3= 0.05\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 1.12\text{ dm}^3
Multiplying total gaseous moles by the molar volume at STP (22.4 dm3 mol122.4\text{ dm}^3\text{ mol}^{-1}) gives the required volume.

Key Concept

Thermal decomposition of metallic trioxonitrate(V) salts and gas stoichiometry at STP
Estimated Time:1m 30s
Question 76Question

A sample of 4.80 g4.80\text{ g} of pure rhombic sulfur is completely burned in excess oxygen gas at room temperature and pressure (RTP). What is the volume of sulfur(IV) oxide gas liberated at RTP, and what is the change in the oxidation state of sulfur during this combustion process?

(Relative atomic mass: S=32.0S = 32.0; Molar volume of gas at RTP = 24.0 dm3 mol124.0\text{ dm}^3\text{ mol}^{-1})

Show answer & explanation

Answer: 3.60 dm33.60\text{ dm}^3 and an increase from 0 to +4+4

Answer

The volume of sulfur(IV) oxide gas produced at RTP is 3.60 dm33.60\text{ dm}^3, and the oxidation state of sulfur increases from 0 to +4+4.
Burning 4.80 g4.80\text{ g} (0.15 mol0.15\text{ mol}) of sulfur produces 0.15 mol0.15\text{ mol} of SO2SO_2 gas. Multiplying by the molar volume at RTP (24.0 dm3 mol124.0\text{ dm}^3\text{ mol}^{-1}) gives 3.60 dm33.60\text{ dm}^3. In elemental rhombic sulfur, sulfur has an oxidation state of 0, which increases to +4+4 in SO2SO_2.

Step-by-Step Solution

1
Calculate the amount of sulfur reacted in moles.
Moles of S=4.80 g32.0 g mol1=0.15 mol\text{Moles of } S = \frac{4.80\text{ g}}{32.0\text{ g mol}^{-1}} = 0.15\text{ mol}
Dividing the mass of sulfur by its relative atomic mass gives the mole amount.
2
Write the balanced chemical equation and determine the mole ratio.
S(s)+O2(g)SO2(g)S(s) + O_2(g) \rightarrow SO_2(g) (Mole ratio of S:SO2=1:1S : SO_2 = 1 : 1, so 0.15 mol0.15\text{ mol} of SO2SO_2 is formed).
Direct combustion of sulfur yields sulfur(IV) oxide.
3
Calculate the volume of SO2SO_2 gas produced at RTP.
Volume=0.15 mol×24.0 dm3 mol1=3.60 dm3\text{Volume} = 0.15\text{ mol} \times 24.0\text{ dm}^3\text{ mol}^{-1} = 3.60\text{ dm}^3
At room temperature and pressure (RTP), 1 mol1\text{ mol} of any gas occupies 24.0 dm324.0\text{ dm}^3.
4
Determine the change in oxidation state of sulfur.
Elemental sulfur S(s)S(s) has an oxidation number of 0. In SO2SO_2, oxygen is 2-2, so x+2(2)=0    x=+4x + 2(-2) = 0 \implies x = +4. The change is from 0 to +4+4.
Free uncombined elements have an oxidation state of 0.

Key Concept

Stoichiometry of gas liberation at RTP and oxidation state changes during non-metal combustion
Question 77Question

Graphite and diamond are two crystalline allotropes of carbon that exhibit vastly different physical properties. Which of the following statements correctly accounts for why graphite conducts electricity whereas diamond is an electrical insulator?

Show answer & explanation

Answer: Each carbon atom in graphite forms three covalent bonds using sp2sp^2 hybridization, leaving one delocalized electron per atom free to move along the hexagonal layers.

Answer

Each carbon atom in graphite forms three covalent bonds using sp2sp^2 hybridization, leaving one delocalized electron per atom free to move along the hexagonal layers.
In graphite, each carbon atom forms three covalent σ\sigma-bonds via sp2sp^2 hybridization. The fourth valence electron resides in an unhybridized pp-orbital and becomes delocalized across the hexagonal layer, allowing electrical current to flow. In contrast, diamond features sp3sp^3 hybridization where all four valence electrons are tightly bound in localized covalent bonds, leaving no mobile electrons.

Step-by-Step Solution

1
Analyze the bonding and hybridization of carbon in diamond.
In diamond, each carbon atom undergoes sp3sp^3 hybridization and forms four strong covalent bonds directed tetrahedrally toward adjacent carbon atoms.
All four valence electrons per carbon atom are involved in localized single covalent bonds, leaving no free electrons to conduct electricity.
2
Analyze the bonding and hybridization of carbon in graphite.
In graphite, each carbon atom undergoes sp2sp^2 hybridization to form three strong covalent bonds within a hexagonal planar sheet.
This leaves one unhybridized pp-orbital electron per carbon atom, which forms a delocalized π\pi-electron system capable of moving freely along the layers.
3
Correlate structural features to electrical conductivity.
The presence of delocalized valence electrons in graphite enables electrical conduction, whereas the localized sp3sp^3 bonding in diamond makes it an insulator.
Electrical conduction in solid non-metallic elements requires mobile charge carriers such as delocalized electrons.

Key Concept

Structural bonding and hybridization of carbon allotropes (Graphite vs Diamond)
Estimated Time:1m 0s
Question 78Question

Match each sulfur-related compound or allotrope on the left with its correct physical characteristic, qualitative test, or stability range on the right.

Click a left item, then click its matching right item

Items

Rhombic sulfur (α \alpha-sulfur)
Hydrogen sulfide (H2SH_2S)
Sulfur(IV) oxide (SO2SO_2)
Monoclinic sulfur (β \beta-sulfur)

Matches

Show answer & explanation

Answer

Rhombic sulfur matches the octahedral allotrope stable up to 96°C; Hydrogen sulfide matches the rotten-egg smelling gas turning lead(II) ethanoate paper black; Sulfur(IV) oxide matches the choking gas turning acidified potassium dichromate(VI) green; Monoclinic sulfur matches the needle-shaped allotrope stable between 96°C and 119°C.
Rhombic sulfur (α \alpha-sulfur) is octahedral and stable below 96C96^\circ\text{C}. Monoclinic sulfur (β \beta-sulfur) is needle-shaped and stable between 96C96^\circ\text{C} and 119C119^\circ\text{C}. Hydrogen sulfide (H2SH_2S) is a gas with a rotten-egg odor that reacts with Pb2+Pb^{2+} to form black insoluble PbSPbS. Sulfur(IV) oxide (SO2SO_2) has a pungent choking smell and reduces orange dichromate(VI) solutions to green Cr3+Cr^{3+} ions.

Step-by-Step Solution

1
Analyze the crystal structures and thermal stability range of sulfur allotropes.
Rhombic sulfur is octahedral and stable below 96°C. Monoclinic sulfur is needle-shaped and stable between 96°C and 119°C.
96°C is the transition temperature at which the two crystalline allotropes exist in equilibrium.
2
Identify the qualitative gas tests and chemical properties of H2SH_2S and SO2SO_2.
H2SH_2S forms black PbSPbS precipitate with lead(II) ethanoate paper. SO2SO_2 reduces orange dichromate(VI) to green Cr3+Cr^{3+} ions.
Both gases are reducing agents, but H2SH_2S forms insoluble sulfides while SO2SO_2 undergoes specific color-change redox reactions with dichromate ions.

Key Concept

Physical and chemical properties of sulfur allotropes, hydrogen sulfide, and sulfur(IV) oxide
Question 79Question

In the Contact Process for the industrial manufacture of tetraoxosulfate(VI) acid, sulfur(IV) oxide gas reacts with oxygen gas according to the equation: 2SO2(g)+O2(g)2SO3(g)2SO_2(g) + O_2(g) \rightarrow 2SO_3(g). What volume of oxygen gas, measured in dm3\text{dm}^3 at stp, is required to completely react with 56 dm356\text{ dm}^3 of SO2SO_2 gas at stp?

Show answer & explanation

Answer: 28

Answer

The volume of oxygen gas required at stp is 28 dm³.
According to the balanced chemical equation 2SO2(g)+O2(g)2SO3(g)2SO_2(g) + O_2(g) \rightarrow 2SO_3(g), 2 volumes of SO2SO_2 gas require 1 volume of O2O_2 gas for complete oxidation. Therefore, 56 dm356\text{ dm}^3 of SO2SO_2 requires half its volume in oxygen, which equals 28 dm328\text{ dm}^3.

Step-by-Step Solution

1
Determine the stoichiometric ratio between SO2SO_2 and O2O_2 from the balanced equation.
2 volumes of SO2(g)SO_2(g) react with 1 volume of O2(g)O_2(g).
By Gay-Lussac's Law of Combining Volumes, gases react in simple whole-number volume ratios under the same conditions of temperature and pressure.
2
Compute the required volume of O2O_2 gas for 56 dm356\text{ dm}^3 of SO2SO_2.
Volume of O2=56 dm32=28 dm3\text{Volume of } O_2 = \frac{56\text{ dm}^3}{2} = 28\text{ dm}^3.
Since the ratio of SO2SO_2 to O2O_2 is 2:12:1, the volume of oxygen gas required is half the volume of sulfur(IV) oxide gas.

Key Concept

Stoichiometric Volume Calculations in Gas Reactions (Contact Process)
Question 80Question
When excess dry ammonia gas is passed over 24.0 g24.0\text{ g} of heated copper(II) oxide (CuOCuO), the oxide is completely reduced to copper metal according to the equation:
2NH3(g)+3CuO(s)3Cu(s)+N2(g)+3H2O(l)2NH_3(g) + 3CuO(s) \rightarrow 3Cu(s) + N_2(g) + 3H_2O(l)
What is the volume of nitrogen gas, in dm3\text{dm}^3, evolved at s.t.p.?
(Cu=64.0Cu = 64.0, O=16.0O = 16.0, molar volume of gas at s.t.p. =22.4 dm3mol1= 22.4\text{ dm}^3\text{mol}^{-1})
Show answer & explanation

Answer: 2.24

Answer

The volume of nitrogen gas evolved at s.t.p. is 2.24 dm32.24\text{ dm}^3.
According to the balanced chemical equation 2NH3(g)+3CuO(s)3Cu(s)+N2(g)+3H2O(l)2NH_3(g) + 3CuO(s) \rightarrow 3Cu(s) + N_2(g) + 3H_2O(l), 3 moles (240.0 g240.0\text{ g}) of copper(II) oxide produce 1 mole (22.4 dm322.4\text{ dm}^3 at s.t.p.) of nitrogen gas. Hence, 24.0 g24.0\text{ g} of CuOCuO yields 24.0240.0×22.4 dm3=2.24 dm3\frac{24.0}{240.0} \times 22.4\text{ dm}^3 = 2.24\text{ dm}^3 of nitrogen gas.

Step-by-Step Solution

1
Calculate the molar mass of CuOCuO
Molar mass of CuO=64.0+16.0=80.0 g mol1CuO = 64.0 + 16.0 = 80.0\text{ g mol}^{-1}
Required to convert the given mass of reactant to moles.
2
Find the number of moles of CuOCuO
Moles of CuO=24.0 g80.0 g mol1=0.30 molCuO = \frac{24.0\text{ g}}{80.0\text{ g mol}^{-1}} = 0.30\text{ mol}
Determines the exact amount of copper(II) oxide reacting.
3
Apply stoichiometry to find moles of N2N_2 gas produced
Moles of N2=0.30 mol CuO×1 mol N23 mol CuO=0.10 mol N2N_2 = 0.30\text{ mol } CuO \times \frac{1\text{ mol } N_2}{3\text{ mol } CuO} = 0.10\text{ mol } N_2
The mole ratio between CuOCuO and N2N_2 in the balanced chemical equation is 3:13:1.
4
Convert moles of N2N_2 to volume at s.t.p.
Volume of N2=0.10 mol×22.4 dm3 mol1=2.24 dm3N_2 = 0.10\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 2.24\text{ dm}^3
1 mole1\text{ mole} of any ideal gas occupies 22.4 dm322.4\text{ dm}^3 at s.t.p.

Key Concept

Reduction of metallic oxides by ammonia gas and gas stoichiometry at STP
PreviousPage 4 / 6Next
Non-Metals and Their Compounds Practice Questions — JAMB UTME — Page 4 | Examkin