Statistics and Probability

158 questions

Question 101Question

A sports delegation of 66 athletes is to be selected from a pool of 77 sprinters and 55 distance runners. If the delegation must contain at least 44 sprinters, in how many different ways can the delegation be formed?

Show answer & explanation

Answer: 462

Answer

The total number of different ways to form the delegation is 462.
To select at least 4 sprinters in a delegation of 6 athletes, we must evaluate three mutually exclusive cases: selecting 4 sprinters and 2 distance runners (7C4×5C2=350{}^7\text{C}_4 \times {}^5\text{C}_2 = 350), selecting 5 sprinters and 1 distance runner (7C5×5C1=105{}^7\text{C}_5 \times {}^5\text{C}_1 = 105), and selecting 6 sprinters and 0 distance runners (7C6×5C0=7{}^7\text{C}_6 \times {}^5\text{C}_0 = 7). Adding these yields 350+105+7=462350 + 105 + 7 = 462 total ways.

Step-by-Step Solution

1
Determine all valid combinations of sprinters and distance runners satisfying the condition of having at least 4 sprinters in a group of 6.
Three valid cases: (4 sprinters, 2 distance runners), (5 sprinters, 1 distance runner), and (6 sprinters, 0 distance runners).
The delegation requires 6 members and at least 4 sprinters.
2
Calculate the combinations for each case using nCr=n!r!(nr)!{}^n\text{C}_r = \frac{n!}{r!(n-r)!}.
Case 1: 7C4×5C2=350{}^7\text{C}_4 \times {}^5\text{C}_2 = 350; Case 2: 7C5×5C1=105{}^7\text{C}_5 \times {}^5\text{C}_1 = 105; Case 3: 7C6×5C0=7{}^7\text{C}_6 \times {}^5\text{C}_0 = 7.
Apply the product rule of counting for selecting sprinters and distance runners independently within each case.
3
Sum the results of the mutually exclusive cases.
350 + 105 + 7 = 462.
Apply the addition principle of counting for mutually exclusive scenarios.

Key Concept

Combinations with restrictions and the addition principle of counting
Estimated Time:2m 0s
Question 102Question

A continuous grouped frequency distribution consists of four class intervals: 101410 - 14, 152415 - 24, 252925 - 29, and 304430 - 44. The total frequency of the distribution is 160160, and the frequency of the class interval 252925 - 29 is 2222.

In a histogram representing this data, the height of the rectangle for the interval 152415 - 24 corresponds to a frequency density of 66. In a pie chart representing the same distribution, the sector angle for the class interval 304430 - 44 is 108108^\circ.

What is the frequency density of the class interval 101410 - 14?

Show answer & explanation

Answer: 6

Answer

The frequency density of the class interval 101410 - 14 is 66.
By converting the pie chart sector angle of 108108^\circ into a frequency of 4848 out of 160160, and using the frequency density of 66 with class width 1010 to find a frequency of 6060 for 152415 - 24, the remaining frequency for 101410 - 14 is 3030. Dividing this by the true class width of 55 (from boundaries 9.59.5 to 14.514.5) gives a frequency density of 66.

Step-by-Step Solution

1
Calculate the frequency of the class interval 304430 - 44 from the pie chart sector angle.
Frequency f3044=108360×160=48f_{30-44} = \frac{108^\circ}{360^\circ} \times 160 = 48.
The sector angle in a pie chart is directly proportional to the frequency relative to the 360360^\circ total.
2
Determine the class width and frequency of the class interval 152415 - 24.
Class boundaries are 14.514.5 and 24.524.5, so width w=10w = 10. Frequency f1524=6×10=60f_{15-24} = 6 \times 10 = 60.
Frequency density is defined as frequency divided by class width, so frequency equals frequency density multiplied by class width.
3
Determine the frequency of the class interval 101410 - 14.
Frequency f1014=160(60+22+48)=30f_{10-14} = 160 - (60 + 22 + 48) = 30.
The sum of all class frequencies must equal the total frequency of 160160.
4
Calculate the class width and frequency density of 101410 - 14.
Class width w1014=14.59.5=5w_{10-14} = 14.5 - 9.5 = 5. Frequency density =305=6= \frac{30}{5} = 6.
Dividing the frequency of the class (3030) by its exact class boundary width (55) yields the frequency density.

Key Concept

Integration of Frequency Density and Pie Chart Sector Angles
Question 103Question

A container contains 66 red counters, 44 blue counters, and 33 green counters. In how many different ways can a selection of 55 counters be made if the selection must contain at least 22 red counters, at least 11 blue counter, and at most 11 green counter?

Show answer & explanation

Answer: 750

Answer

The total number of different ways to make the selection is 750.
Breaking the problem into disjoint cases based on the number of green counters (0 or 1) and applying the combination formula for red, blue, and green counters in each valid configuration yields 240+510=750240 + 510 = 750 total ways.

Step-by-Step Solution

1
Determine the allowable counts for Green (GG), Red (RR), and Blue (BB) counters
Green counters can be 0 or 1. If G=0G=0, R+B=5R+B=5 with R2,B1R \geq 2, B \geq 1. If G=1G=1, R+B=4R+B=4 with R2,B1R \geq 2, B \geq 1.
The constraints state G1G \leq 1, R2R \geq 2, and B1B \geq 1 for a total of 5 counters.
2
Calculate combinations for Case 1 (G=0G = 0)
Ways for (2R,3B,0G)=60(2R, 3B, 0G) = 60; (3R,2B,0G)=120(3R, 2B, 0G) = 120; (4R,1B,0G)=60(4R, 1B, 0G) = 60. Total for Case 1 = 240.
Apply the combinations formula (nr)=n!r!(nr)!\binom{n}{r} = \frac{n!}{r!(n-r)!} to each sub-case.
3
Calculate combinations for Case 2 (G=1G = 1)
Ways for (2R,2B,1G)=270(2R, 2B, 1G) = 270; (3R,1B,1G)=240(3R, 1B, 1G) = 240. Total for Case 2 = 510.
Apply combinations to choose 1 Green counter along with the valid Red and Blue combinations.
4
Sum all mutually exclusive cases
Total selection ways = 240+510=750240 + 510 = 750.
According to the addition principle of counting, the totals of mutually exclusive cases are added together.

Key Concept

Combinations with Multiple Conditional Constraints
Question 104Question

The cumulative frequency distribution of the operational lifespans (in hours) for a batch of 100100 precision LED modules tested in a laboratory is summarized below:

Lifespan Interval (hours)Class BoundariesCumulative Frequency
100119100 - 11999.5119.599.5 - 119.51010
120139120 - 139119.5139.5119.5 - 139.52525
140159140 - 159139.5159.5139.5 - 159.56060
160179160 - 179159.5179.5159.5 - 179.58585
180199180 - 199179.5199.5179.5 - 199.5100100

Using linear interpolation for cumulative frequency distributions, calculate the 75th percentile (P75P_{75}) of the lifespan of these modules in hours.

Show answer & explanation

Answer: 171.5

Answer

The 75th percentile of operational lifespan is 171.5 hours.
The 75th percentile rank position is 0.75×100=750.75 \times 100 = 75. The percentile falls within the class boundary 159.5179.5159.5 - 179.5. Substituting lower class boundary L=159.5L = 159.5, preceding cumulative frequency c.f.=60c.f. = 60, class frequency f=25f = 25, and class width c=20c = 20 into P75=L+(75c.f.f)×cP_{75} = L + \left(\frac{75 - c.f.}{f}\right) \times c gives 159.5+(1525)×20=171.5159.5 + \left(\frac{15}{25}\right) \times 20 = 171.5 hours.

Step-by-Step Solution

1
Determine the rank position of the 75th percentile.
Rank position = 75th value out of 100.
The 75th percentile corresponds to 75% of the total frequency N = 100.
2
Identify the percentile class interval and extract relevant parameters.
Class interval is 159.5 - 179.5, with L = 159.5, c.f. = 60, f = 25, and c = 20.
The cumulative frequency increases from 60 to 85 across the boundary 159.5 to 179.5, which contains the 75th value.
3
Compute the percentile value using ogive linear interpolation.
P_75 = 159.5 + [(75 - 60) / 25] * 20 = 171.5 hours.
Applying the cumulative frequency interpolation formula yields the exact value.

Key Concept

Calculating Percentiles from Cumulative Frequency / Ogives
Question 105Question

A box contains 66 red balls and 44 blue balls. A ball is drawn at random, its color is recorded, and it is then returned to the box. A second ball is subsequently drawn at random. What is the probability of selecting a red ball on the first draw and a blue ball on the second draw?

Show answer & explanation

Answer: 625\frac{6}{25}

Answer

625\frac{6}{25}
Because the first ball is replaced after being recorded, the two draws are independent compound events. The probability of drawing a red ball first is 610=35\frac{6}{10} = \frac{3}{5}, and the probability of drawing a blue ball second is 410=25\frac{4}{10} = \frac{2}{5}. Multiplying these probabilities yields P(Red and Blue)=35×25=625P(\text{Red and Blue}) = \frac{3}{5} \times \frac{2}{5} = \frac{6}{25}.

Step-by-Step Solution

1
Calculate the probability of drawing a red ball on the first draw
P(Red)=66+4=610=35P(\text{Red}) = \frac{6}{6 + 4} = \frac{6}{10} = \frac{3}{5}
There are 66 red balls out of a total of 1010 balls.
2
Determine independence and calculate the probability of drawing a blue ball on the second draw
P(Blue)=410=25P(\text{Blue}) = \frac{4}{10} = \frac{2}{5}
Because the first ball is replaced before the second draw, the total number of balls and their composition remain unchanged.
3
Apply the multiplication law for independent compound events
P(Red and then Blue)=P(Red)×P(Blue)=35×25=625P(\text{Red and then Blue}) = P(\text{Red}) \times P(\text{Blue}) = \frac{3}{5} \times \frac{2}{5} = \frac{6}{25}
For independent events AA and BB, P(AB)=P(A)×P(B)P(A \cap B) = P(A) \times P(B).

Key Concept

Multiplication Law of Probability for Independent Events
Estimated Time:45s
Question 106Question

Two independent security systems, XX and YY, operate in a facility. The probability that system YY detects an intrusion is 0.200.20 greater than the probability that system XX detects it. If the probability that at least one of the systems detects an intrusion is 0.920.92, what is the probability that exactly one of the systems detects the intrusion?

Show answer & explanation

Answer: 0.440.44

Answer

The probability that exactly one of the systems detects the intrusion is 0.440.44.
The correct answer is 0.440.44. Setting P(X)=pP(X) = p and P(Y)=p+0.20P(Y) = p + 0.20, we use the independence rule P(XY)=P(X)P(Y)P(X \cap Y) = P(X)P(Y) in the addition law P(XY)=P(X)+P(Y)P(X)P(Y)=0.92P(X \cup Y) = P(X) + P(Y) - P(X)P(Y) = 0.92. Solving p21.80p+0.72=0p^2 - 1.80p + 0.72 = 0 gives P(X)=0.60P(X) = 0.60 and P(Y)=0.80P(Y) = 0.80. The probability of both detecting the intrusion is 0.60×0.80=0.480.60 \times 0.80 = 0.48. Subtracting the probability of both from the probability of at least one (0.920.480.92 - 0.48) gives 0.440.44 for exactly one system detecting the intrusion.

Step-by-Step Solution

1
Define variables for the individual probabilities
Let P(X)=pP(X) = p. Then P(Y)=p+0.20P(Y) = p + 0.20.
System YY's probability is given as 0.200.20 greater than System XX's probability.
2
Apply the addition law for independent events
P(XY)=P(X)+P(Y)P(XY)=p+(p+0.20)p(p+0.20)=0.92P(X \cup Y) = P(X) + P(Y) - P(X \cap Y) = p + (p + 0.20) - p(p + 0.20) = 0.92
Since XX and YY are independent, P(XY)=P(X)P(Y)P(X \cap Y) = P(X)P(Y).
3
Solve the quadratic equation for pp
2p+0.20p20.20p=0.92    p2+1.80p0.72=0    p21.80p+0.72=02p + 0.20 - p^2 - 0.20p = 0.92 \implies -p^2 + 1.80p - 0.72 = 0 \implies p^2 - 1.80p + 0.72 = 0. Factoring yields (p0.60)(p1.20)=0(p - 0.60)(p - 1.20) = 0. Since p1p \le 1, p=0.60p = 0.60.
Probability values cannot exceed 11, so p=0.60p = 0.60 is the valid root.
4
Calculate individual probabilities and the probability of both occurring
P(X)=0.60P(X) = 0.60, P(Y)=0.80P(Y) = 0.80, and P(XY)=0.60×0.80=0.48P(X \cap Y) = 0.60 \times 0.80 = 0.48.
These are needed to evaluate the compound probability of exactly one event occurring.
5
Calculate the probability that exactly one system detects the intrusion
P(exactly one)=P(XY)P(XY)=0.920.48=0.44P(\text{exactly one}) = P(X \cup Y) - P(X \cap Y) = 0.92 - 0.48 = 0.44.
The probability of exactly one event occurring is the probability of at least one minus the probability of both.

Key Concept

Probability laws for independent and compound events
Question 107Question

A fair spinner is divided into 88 equal sectors numbered 11 to 88. In an experiment, the spinner is spun 120120 times, and it lands on a multiple of 33 a total of 3636 times. What is the positive difference between the experimental probability and the theoretical probability of landing on a multiple of 33?

Show answer & explanation

Answer: 120\frac{1}{20}

Answer

The positive difference between the experimental probability and theoretical probability is 120\frac{1}{20}.
The correct option is 120\frac{1}{20}. The theoretical probability of hitting a multiple of 33 on an 88-sector spinner is 28=14\frac{2}{8} = \frac{1}{4}. The experimental probability over 120120 spins with 3636 successes is 36120=310\frac{36}{120} = \frac{3}{10}. Subtracting theoretical probability from experimental probability gives 31014=6520=120\frac{3}{10} - \frac{1}{4} = \frac{6-5}{20} = \frac{1}{20}.

Step-by-Step Solution

1
Calculate the theoretical probability of landing on a multiple of 33.
The sample space is {1,2,3,4,5,6,7,8}\{1, 2, 3, 4, 5, 6, 7, 8\} (total 88 outcomes). Multiples of 33 in this set are {3,6}\{3, 6\} (22 outcomes). Thus, P(Theoretical)=28=14P(\text{Theoretical}) = \frac{2}{8} = \frac{1}{4}.
Theoretical probability is the ratio of favorable outcomes to total possible outcomes in a fair trial.
2
Calculate the experimental probability (relative frequency) from the trial results.
P(Experimental)=36120=310P(\text{Experimental}) = \frac{36}{120} = \frac{3}{10}.
Experimental probability is defined as the number of observed successful events divided by the total number of trials conducted.
3
Find the positive difference between the experimental and theoretical probabilities.
Difference=31014=620520=120\text{Difference} = \frac{3}{10} - \frac{1}{4} = \frac{6}{20} - \frac{5}{20} = \frac{1}{20}.
Subtracting the smaller theoretical probability from the larger experimental probability yields the positive difference.

Key Concept

Experimental versus Theoretical Probability
Estimated Time:1m 30s
Question 108Question

A bag contains 55 red balls, 33 blue balls, and nn green balls. The theoretical probability of drawing a blue ball at random from the bag is 320\frac{3}{20}. In a probability experiment, a ball is drawn at random from the bag and replaced 500500 times. If a green ball is observed 340340 times, calculate the absolute difference between the experimental probability and the theoretical probability of drawing a green ball.

Show answer & explanation

Answer: 0.08

Answer

The absolute difference between the experimental probability and the theoretical probability of drawing a green ball is 0.080.08 (or 225\frac{2}{25}).
The theoretical probability of drawing a blue ball establishes that the bag contains 2020 total balls, meaning there are 1212 green balls. The theoretical probability of picking a green ball is therefore 1220=0.60\frac{12}{20} = 0.60. The experimental probability is 340500=0.68\frac{340}{500} = 0.68. Taking the positive difference gives 0.680.60=0.08|0.68 - 0.60| = 0.08.

Step-by-Step Solution

1
Find the total number of balls and the value of nn
n=12n = 12, Total balls = 2020
The theoretical probability of picking a blue ball is 38+n=320\frac{3}{8+n} = \frac{3}{20}, giving 8+n=208 + n = 20.
2
Find the theoretical probability of drawing a green ball
P(Green)theo=0.60P(\text{Green})_{\text{theo}} = 0.60
There are 1212 green balls out of 2020 total balls, so 1220=0.60\frac{12}{20} = 0.60.
3
Find the experimental probability of drawing a green ball
P(Green)exp=0.68P(\text{Green})_{\text{exp}} = 0.68
In 500500 trials, a green ball was observed 340340 times, so 340500=0.68\frac{340}{500} = 0.68.
4
Calculate the absolute difference
0.680.60=0.08|0.68 - 0.60| = 0.08
Subtract the theoretical probability from the experimental probability and take the absolute value.

Key Concept

Comparison of theoretical probability based on outcome sample space and experimental probability based on observed trial relative frequencies.
Question 109Question

The mean of four positive integers is 99. If the mode of the set of numbers is 1212 and their median is 1010, what is the value of the smallest integer?

Show answer & explanation

Answer: 44

Answer

The smallest integer is 4.
Let the four positive integers in ascending order be abcda \le b \le c \le d. The sum of the four numbers is 4×9=364 \times 9 = 36. For 1212 to be the mode, it must appear at least twice, so c=12c = 12 and d=12d = 12. The median of four numbers is b+c2=10\frac{b + c}{2} = 10, which gives b+122=10\frac{b + 12}{2} = 10, so b=8b = 8. Substituting these into the sum equation a+8+12+12=36a + 8 + 12 + 12 = 36 gives a=4a = 4.

Step-by-Step Solution

1
Calculate the sum of all four integers from the given mean.
Sum =4×9=36= 4 \times 9 = 36.
The mean of nn numbers is the sum divided by nn.
2
Determine the two largest numbers using the mode.
Let the ordered numbers be abcda \le b \le c \le d. Since the mode is 1212 and the set contains 44 numbers with a single mode, c=12c = 12 and d=12d = 12.
For 1212 to be the mode in a 4-element set without tie, it must appear at least twice.
3
Use the median to find the second integer bb.
Median =b+c2=b+122=10    b+12=20    b=8= \frac{b + c}{2} = \frac{b + 12}{2} = 10 \implies b + 12 = 20 \implies b = 8.
The median of an even number of ordered elements is the arithmetic mean of the two middle elements.
4
Solve for the smallest integer aa.
a+b+c+d=36    a+8+12+12=36    a+32=36    a=4a + b + c + d = 36 \implies a + 8 + 12 + 12 = 36 \implies a + 32 = 36 \implies a = 4.
Subtracting the sum of the known three numbers from the total sum gives the smallest integer.

Key Concept

Using mean, median, and mode definitions simultaneously to deduce unknown values in an ungrouped dataset
Question 110Question

Two independent weather forecasting stations, AA and BB, operate in a region. The probability that station AA makes an accurate forecast on any given day is 0.800.80, and the probability that station BB makes an accurate forecast is 0.750.75. What is the probability that at least one of the two stations makes an accurate forecast on a given day?

Show answer & explanation

Answer: 0.95

Answer

The probability that at least one of the two stations makes an accurate forecast is 0.950.95.
The probability of at least one event occurring is given by P(AB)=P(A)+P(B)P(AB)P(A \cup B) = P(A) + P(B) - P(A \cap B). Because events AA and BB are independent, P(AB)=P(A)×P(B)=0.80×0.75=0.60P(A \cap B) = P(A) \times P(B) = 0.80 \times 0.75 = 0.60. Substituting into the addition rule yields 0.80+0.750.60=0.950.80 + 0.75 - 0.60 = 0.95. Alternatively, using the complement rule: 1P(A)P(B)=1(10.80)(10.75)=1(0.20×0.25)=10.05=0.951 - P(A')P(B') = 1 - (1 - 0.80)(1 - 0.75) = 1 - (0.20 \times 0.25) = 1 - 0.05 = 0.95.

Step-by-Step Solution

1
Calculate the probability of both events occurring simultaneously using the multiplication law for independent events.
P(AB)=P(A)×P(B)=0.80×0.75=0.60P(A \cap B) = P(A) \times P(B) = 0.80 \times 0.75 = 0.60
Since the two forecasting stations operate independently, the joint probability is the product of their individual probabilities.
2
Apply the general addition law of probability to calculate the probability of at least one station making an accurate forecast.
P(AB)=P(A)+P(B)P(AB)=0.80+0.750.60=0.95P(A \cup B) = P(A) + P(B) - P(A \cap B) = 0.80 + 0.75 - 0.60 = 0.95
The probability of compound event 'at least one' corresponds to the union of the two events.

Key Concept

Addition and Multiplication Laws of Probability for Independent Events
Question 111Question

The table below presents the cumulative frequency distribution of delay times (in minutes) for 5050 regional flights recorded at an airport:

Delay Time (minutes)Cumulative Frequency
101910 - 1988
202920 - 292020
303930 - 394040
404940 - 495050

What is the 70th70\text{th} percentile of the delay times?

Show answer & explanation

Answer: 37.037.0 minutes

Answer

The 70th70\text{th} percentile of the delay times is 37.037.0 minutes.
The 70th70\text{th} percentile position is found by taking 70%70\% of 5050, which yields 3535. Looking at the cumulative frequency table, the 35th item falls in the 303930 - 39 interval (class boundaries 29.539.529.5 - 39.5). Applying the percentile interpolation formula: P70=29.5+(352020)×10=29.5+7.5=37.0 minutesP_{70} = 29.5 + \left(\frac{35 - 20}{20}\right) \times 10 = 29.5 + 7.5 = 37.0\text{ minutes}.

Step-by-Step Solution

1
Determine the position of the 70th percentile rank.
Position rank =70100×50=35th value= \frac{70}{100} \times 50 = 35\text{th value}.
The 70th percentile corresponds to 70% of the total frequency N=50N = 50.
2
Identify the 70th percentile class interval and its parameters.
Interval: 303930 - 39; Lower class boundary L=29.5L = 29.5, cumulative frequency preceding class F=20F = 20, frequency of percentile class f=20f = 20, class width c=10c = 10.
The cumulative frequency reaches 20 at 29.529.5 and 40 at 39.539.5, so the 35th value lies in the 303930 - 39 class interval.
3
Apply the percentile interpolation formula P70=L+(70N100Ff)×cP_{70} = L + \left(\frac{\frac{70N}{100} - F}{f}\right) \times c.
P70=29.5+(352020)×10=29.5+(1520)×10=29.5+7.5=37.0 minutesP_{70} = 29.5 + \left(\frac{35 - 20}{20}\right) \times 10 = 29.5 + \left(\frac{15}{20}\right) \times 10 = 29.5 + 7.5 = 37.0\text{ minutes}.
Linear interpolation distributes the cumulative frequencies evenly across the class interval.

Key Concept

Calculating percentiles from grouped cumulative frequency data using class boundaries and linear interpolation.
Question 112Question

A research committee of 55 members is to be formed from 66 male scientists and 55 female scientists. The committee must contain strictly more male scientists than female scientists. If one particular male scientist and one particular female scientist refuse to serve on the same committee together, in how many different ways can the committee be selected?

Show answer & explanation

Answer: 231

Answer

The total number of valid ways to select the committee is 231.
The correct response of 231 is found by calculating the total committees having strictly more men than women (281) and subtracting the subset of those committees where both restricted individuals are chosen together (50).

Step-by-Step Solution

1
Calculate the unconstrained ways to form a 5-member committee with strictly more males than females.
Three possible gender distributions exist:
- 5 Males, 0 Females: (65)×(50)=6×1=6\binom{6}{5} \times \binom{5}{0} = 6 \times 1 = 6
- 4 Males, 1 Female: (64)×(51)=15×5=75\binom{6}{4} \times \binom{5}{1} = 15 \times 5 = 75
- 3 Males, 2 Females: (63)×(52)=20×10=200\binom{6}{3} \times \binom{5}{2} = 20 \times 10 = 200
Total unconstrained ways = 6+75+200=2816 + 75 + 200 = 281.
Establishing the total pool of valid gender-ratio committees before applying the exclusion condition.
2
Calculate the number of forbidden committee selections where both the restricted male scientist and restricted female scientist are included together.
Since 1 male and 1 female are already chosen, 3 remaining members must be selected from the remaining 5 males and 4 females:
- For 4 Males, 1 Female total (need 3 more males, 0 more females): (53)×(40)=10×1=10\binom{5}{3} \times \binom{4}{0} = 10 \times 1 = 10
- For 3 Males, 2 Females total (need 2 more males, 1 more female): (52)×(41)=10×4=40\binom{5}{2} \times \binom{4}{1} = 10 \times 4 = 40
Total forbidden ways = 10+40=5010 + 40 = 50.
To enforce the restriction that both specific members cannot serve together, calculate all committee configurations containing both.
3
Subtract the forbidden selections from the unconstrained selections.
Valid ways = 28150=231281 - 50 = 231.
Applying the subtraction principle of combinations to yield the final allowed arrangements.

Key Concept

Combinations with gender ratio constraints and mutual exclusion restrictions
Estimated Time:2m 30s
Question 113Question

A committee of 66 delegates is to be seated around a circular table for a conference. If two specific delegates must always sit next to each other, in how many distinct ways can the delegates be arranged?

Show answer & explanation

Answer: 48

Answer

48
The correct answer is 48 because treating the 2 restricted delegates as a single unit leaves 5 items to arrange around a circle, which yields (51)!=24(5-1)! = 24 arrangements. Since the 2 delegates can arrange themselves in 2!=22! = 2 ways within their block, the total number of arrangements is 24×2=4824 \times 2 = 48.

Step-by-Step Solution

1
Group the restricted delegates into a single block
2 specified delegates are treated as 1 unit, leaving 4 remaining delegates, making a total of 5 items to arrange.
Since the two delegates must sit next to each other, treating them as a single entity ensures they remain together in all seating positions.
2
Calculate the circular arrangements of the 5 items
(51)!=4!=24(5 - 1)! = 4! = 24 ways.
The number of ways to arrange nn distinct items around a circular table is given by (n1)!(n - 1)!.
3
Account for internal arrangements of the paired delegates
2!=22! = 2 ways.
The two delegates within the single block can swap positions between themselves.
4
Multiply the circular arrangements by the internal arrangements
24×2=4824 \times 2 = 48 total distinct arrangements.
By the fundamental counting principle, total arrangements equal the product of the independent steps.

Key Concept

Circular Permutations with Restrictions
Estimated Time:1m 15s
Question 114Question

A pie chart illustrates the annual allocation of funds for an agricultural research station across four sectors: Crop Research, Livestock, Irrigation, and Equipment Maintenance. The sector angles for Crop Research, Livestock, and Irrigation are 135135^\circ, 9090^\circ, and 6060^\circ respectively. If the total annual budget is N7,200,000\text{N}7,200,000, what is the amount allocated to Equipment Maintenance in Naira?

Show answer & explanation

Answer: 1500000

Answer

The amount allocated to Equipment Maintenance is 1,500,000 Naira.
A complete pie chart has a total angle of 360360^\circ, representing the full amount of N7,200,000\text{N}7,200,000. The angle corresponding to Equipment Maintenance is 360(135+90+60)=75360^\circ - (135^\circ + 90^\circ + 60^\circ) = 75^\circ. The dollar/naira allocation is given by 75360×7,200,000=1,500,000\frac{75^\circ}{360^\circ} \times 7,200,000 = 1,500,000.

Step-by-Step Solution

1
Calculate the sum of the given sector angles
Sum of known angles = 285 degrees
Determining the total angular measure already accounted for by the three known sectors.
2
Subtract the sum of known angles from 360 degrees
Sector angle for Equipment Maintenance = 75 degrees
The sum of all sector angles in a pie chart is always 360 degrees.
3
Multiply the fraction of the pie chart by the total funds
1,500,000 Naira
Converting the sector angle representation to its corresponding quantitative value.

Key Concept

Pie chart sector angle computation and value conversion
Question 115Question

A plane contains 1212 distinct points such that exactly 55 of them lie on the same straight line, while no other subset of three points is collinear. How many distinct straight lines can be formed by joining pairs of these points?

Show answer & explanation

Answer: 57

Answer

The total number of distinct straight lines that can be formed is 57.
The total number of distinct straight lines is obtained by taking all possible pairs of points from 12, which is 12C2=66^{12}C_2 = 66, subtracting the pairs formed among the 5 collinear points (5C2=10^5C_2 = 10), and adding 1 back to account for the single straight line on which those 5 points lie. This gives 6610+1=5766 - 10 + 1 = 57.

Step-by-Step Solution

1
Calculate the total possible lines by selecting any 2 points out of 12.
12C2=12×112=66^{12}C_2 = \frac{12 \times 11}{2} = 66
Any pair of non-collinear points uniquely determines a straight line.
2
Calculate the combinations of 2 points selected from the 5 collinear points.
5C2=5×42=10^5C_2 = \frac{5 \times 4}{2} = 10
These 10 point pairs all lie on the exact same single straight line instead of forming 10 distinct lines.
3
Adjust the count to find the net number of distinct straight lines.
6610+1=5766 - 10 + 1 = 57
Subtracting the 10 overcounted combinations and adding back 1 for the single line passing through all 5 collinear points gives the correct total.

Key Concept

Combinations with Collinear Constraints
Question 116Question

A biased four-sided die numbered 11, 22, 33, and 44 is rolled 200200 times in a probability experiment. The frequency of each outcome is recorded in the table below:

OutcomeFrequency
114545
226060
335555
444040

What is the experimental probability of rolling an odd number?

Show answer & explanation

Answer: 0.5

Answer

0.5
The correct experimental probability is calculated by dividing the total frequency of observed odd outcomes (45+55=10045 + 55 = 100) by the total number of trials (200200), which gives 100200=0.5\frac{100}{200} = 0.5.

Step-by-Step Solution

1
Identify the favorable outcomes for rolling an odd number
The odd outcomes on the die are 11 and 33.
Odd numbers are integers that are not divisible by 22.
2
Calculate the total frequency of the favorable outcomes
Frequency of 11 is 4545 and frequency of 33 is 5555. Total frequency =45+55=100= 45 + 55 = 100.
The total number of times an odd number was rolled is the sum of the frequencies of outcome 11 and outcome 33.
3
Compute the experimental probability
Experimental Probability=Frequency of odd outcomesTotal number of trials=100200=0.5\text{Experimental Probability} = \frac{\text{Frequency of odd outcomes}}{\text{Total number of trials}} = \frac{100}{200} = 0.5.
Experimental probability measures the relative frequency of an event occurring in an actual experiment.

Key Concept

Experimental Probability
Question 117Question

The frequency distribution table below shows the masses (in kg\text{kg}) of 4040 cassava tubers harvested from an agricultural test plot:

Mass (kg\text{kg})Frequency (ff)
101410 - 1444
151915 - 1988
202420 - 241212
252925 - 291010
303430 - 3466

What is the estimated mean mass of the harvested cassava tubers?

Show answer & explanation

Answer: 22.75 kg22.75\text{ kg}

Answer

22.75 kg22.75\text{ kg}
The value 22.75 kg22.75\text{ kg} is correct because the mean for grouped data is obtained by multiplying each class midpoint by its frequency, summing these products to get 910910, and dividing by the total frequency of 4040.

Step-by-Step Solution

1
Find the class midpoint (xx) for each class interval using x=Lower limit+Upper limit2x = \frac{\text{Lower limit} + \text{Upper limit}}{2}.
Midpoints are: 1212 for 101410-14, 1717 for 151915-19, 2222 for 202420-24, 2727 for 252925-29, and 3232 for 303430-34.
Grouped data calculations require representative central values for each class interval.
2
Multiply each class midpoint (xx) by its corresponding frequency (ff) to get fxfx, then sum all fxfx values.
fx=(4×12)+(8×17)+(12×22)+(10×27)+(6×32)=48+136+264+270+192=910\sum fx = (4 \times 12) + (8 \times 17) + (12 \times 22) + (10 \times 27) + (6 \times 32) = 48 + 136 + 264 + 270 + 192 = 910.
This calculates the total estimated mass of all harvested cassava tubers.
3
Sum the frequencies to get the total number of items f\sum f.
\sum f = 4 + 8 + 12 + 10 + 6 = 40.
The mean formula divides the total sum by the total frequency.
4
Compute the grouped mean using xˉ=fxf\bar{x} = \frac{\sum fx}{\sum f}.
\bar{x} = \frac{910}{40} = 22.75\text{ kg}.
Dividing the sum of products by the total frequency yields the estimated mean.

Key Concept

Grouped Mean Calculation
Question 118Question

During a quality control inspection at a manufacturing plant, two independent automated scanners, S1S_1 and S2S_2, inspect items along a production line. The probability that scanner S1S_1 detects a surface flaw on a defective item is 0.900.90, and the probability that scanner S2S_2 detects the flaw is 0.800.80. What is the probability that a surface flaw is detected by exactly one of the two scanners?

Show answer & explanation

Answer: 0.26

Answer

The probability that a surface flaw is detected by exactly one of the two scanners is 0.26.
The probability of a surface flaw being detected by exactly one scanner is calculated by combining two mutually exclusive compound events: scanner S1S_1 detects it while scanner S2S_2 fails (0.90×0.20=0.180.90 \times 0.20 = 0.18), and scanner S1S_1 fails while scanner S2S_2 detects it (0.10×0.80=0.080.10 \times 0.80 = 0.08). Adding these two values yields 0.18+0.08=0.260.18 + 0.08 = 0.26.

Step-by-Step Solution

1
Determine the probabilities of non-detection for each scanner.
P(S_1') = 0.10, P(S_2') = 0.20
The probability of an event's complement is 1 minus the probability of the event.
2
Calculate the probability that scanner S_1 detects the flaw while scanner S_2 misses it.
P(S_1 \cap S_2') = 0.90 \times 0.20 = 0.18
Because the scanners operate independently, joint probability is the product of their individual probabilities.
3
Calculate the probability that scanner S_1 misses the flaw while scanner S_2 detects it.
P(S_1' \cap S_2) = 0.10 \times 0.80 = 0.08
Independence allows multiplication of individual probabilities.
4
Sum the probabilities of the two mutually exclusive outcomes.
P(\text{exactly one}) = 0.18 + 0.08 = 0.26
The addition law applies because detecting the flaw with only S_1 and only S_2 are mutually exclusive events.

Key Concept

Compound probability laws for independent and mutually exclusive events
Question 119Question

Given the permutation equation nP4=42nP2{^{n}P_4} = 42 \cdot {^{n}P_2}, what is the positive integer value of nn?

Show answer & explanation

Answer: 9

Answer

The positive integer value of nn is 99.
Expanding nP4{^{n}P_4} as n(n1)(n2)(n3)n(n-1)(n-2)(n-3) and nP2{^{n}P_2} as n(n1)n(n-1) transforms the equation to n(n1)(n2)(n3)=42n(n1)n(n-1)(n-2)(n-3) = 42n(n-1). Dividing both sides by n(n1)n(n-1) gives (n2)(n3)=42(n-2)(n-3) = 42, which simplifies to n25n36=0n^2 - 5n - 36 = 0. Factoring this quadratic gives (n9)(n+4)=0(n-9)(n+4) = 0. Since nn must be a positive integer greater than or equal to 44, the correct answer is 99.

Step-by-Step Solution

1
Write out the expanded expressions for nP4{^{n}P_4} and nP2{^{n}P_2}.
nP4=n(n1)(n2)(n3){^{n}P_4} = n(n-1)(n-2)(n-3) and nP2=n(n1){^{n}P_2} = n(n-1).
By definition, nPr=n!(nr)!=n(n1)(nr+1){^{n}P_r} = \frac{n!}{(n-r)!} = n(n-1)\dots(n-r+1).
2
Set up the algebraic equation based on the given problem statement.
n(n1)(n2)(n3)=42n(n1)n(n-1)(n-2)(n-3) = 42n(n-1).
Substitute the expanded permutation formulas into the given identity.
3
Simplify the equation by dividing both sides by the non-zero common product n(n1)n(n-1).
(n2)(n3)=42(n-2)(n-3) = 42.
Since n4n \ge 4, n(n1)0n(n-1) \neq 0, so we can cancel these terms from both sides.
4
Expand and rearrange the resulting expression into a standard quadratic equation.
n25n36=0n^2 - 5n - 36 = 0.
Expanding (n2)(n3)(n-2)(n-3) gives n25n+6n^2 - 5n + 6; subtracting 4242 yields n25n36=0n^2 - 5n - 36 = 0.
5
Solve the quadratic equation for nn and discard non-physical roots.
n=9n = 9.
Factoring yields (n9)(n+4)=0(n-9)(n+4) = 0, so n=9n = 9 or n=4n = -4. A permutation requires nn to be a positive integer 4\ge 4, so n=9n = 9.

Key Concept

Solving algebraic equations involving permutations nPr=n!(nr)!{^{n}P_r} = \frac{n!}{(n-r)!}
Question 120Question

Two independent events AA and BB in a sample space satisfy P(A)=25P(A') = \frac{2}{5} and P(AB)=710P(A \cup B) = \frac{7}{10}, where AA' denotes the complement of event AA. What is the probability that exactly one of the two events occurs?

Show answer & explanation

Answer: 1120\frac{11}{20}

Answer

1120\frac{11}{20}
First, find P(A)=125=35P(A) = 1 - \frac{2}{5} = \frac{3}{5}. Since AA and BB are independent, P(AB)=P(A)P(B)P(A \cap B) = P(A)P(B). Using the addition law P(AB)=P(A)+P(B)P(A)P(B)P(A \cup B) = P(A) + P(B) - P(A)P(B), we substitute the values to get 710=35+P(B)(135)\frac{7}{10} = \frac{3}{5} + P(B)\left(1 - \frac{3}{5}\right), which gives P(B)=14P(B) = \frac{1}{4}. The probability of exactly one event occurring is P(A)P(B)+P(A)P(B)=35×34+25×14=1120P(A)P(B') + P(A')P(B) = \frac{3}{5} \times \frac{3}{4} + \frac{2}{5} \times \frac{1}{4} = \frac{11}{20}.

Step-by-Step Solution

1
Calculate the probability of event A
P(A)=1P(A)=125=35P(A) = 1 - P(A') = 1 - \frac{2}{5} = \frac{3}{5}
The sum of the probabilities of an event and its complement equals 1.
2
Apply the addition law for independent events to find P(B)
P(AB)=P(A)+P(B)P(A)P(B)    710=35+P(B)(135)    P(B)=14P(A \cup B) = P(A) + P(B) - P(A)P(B) \implies \frac{7}{10} = \frac{3}{5} + P(B)\left(1 - \frac{3}{5}\right) \implies P(B) = \frac{1}{4}
For independent events, the intersection probability is P(AB)=P(A)P(B)P(A \cap B) = P(A)P(B).
3
Calculate the complement of event B
P(B)=1P(B)=114=34P(B') = 1 - P(B) = 1 - \frac{1}{4} = \frac{3}{4}
The complement of event B represents the event that B does not occur.
4
Compute the probability that exactly one event occurs
P(exactly one)=P(AB)+P(AB)=P(A)P(B)+P(A)P(B)=(35×34)+(25×14)=920+220=1120P(\text{exactly one}) = P(A \cap B') + P(A' \cap B) = P(A)P(B') + P(A')P(B) = \left(\frac{3}{5} \times \frac{3}{4}\right) + \left(\frac{2}{5} \times \frac{1}{4}\right) = \frac{9}{20} + \frac{2}{20} = \frac{11}{20}
The occurrence of exactly one event means either A occurs and B does not, or A does not occur and B occurs.

Key Concept

Compound Probability and Probability Laws for Independent Events
Estimated Time:2m 0s
PreviousPage 6 / 8Next
Statistics and Probability Practice Questions — JAMB UTME — Page 6 | Examkin