Trigonometry

112 soru

Soru 81Soru

A park planner is designing a triangular walking trail connecting three landmarks: a fountain at point FF, a gazebo at point GG, and a bridge at point BB. The distance from the fountain to the gazebo is 800800 meters, and the distance from the gazebo to the bridge is 15001{}500 meters. If the angle formed at the gazebo (FGB\angle FGB) measures 6060^\circ, what is the direct distance, in meters, from the fountain at point FF to the bridge at point BB?

Cevabı ve açıklamayı göster

Cevap: 1300

Cevap

1300 meters
Applying the Law of Cosines c2=a2+b22abcos(C)c^2 = a^2 + b^2 - 2ab\cos(C) with a=800a = 800, b=1500b = 1500, and C=60C = 60^\circ gives c2=8002+150022(800)(1500)(0.5)=1690000c^2 = 800^2 + 1500^2 - 2(800)(1500)(0.5) = 1{}690{}000. Taking the square root yields c=1300c = 1300 meters.

Adım Adım Çözüm

1
Identify given measurements and formula
FG=800FG = 800 m, GB=1500GB = 1500 m, FGB=60\angle FGB = 60^\circ, using Law of Cosines c2=a2+b22abcos(C)c^2 = a^2 + b^2 - 2ab\cos(C)
Two side lengths and the included angle (SAS) are known, requiring the Law of Cosines to solve for the opposite side.
2
Substitute values into the Law of Cosines equation
FB2=8002+150022(800)(1500)cos(60)FB^2 = 800^2 + 1500^2 - 2(800)(1500)\cos(60^\circ)
Direct replacement of known side lengths and angle measure into the formula.
3
Evaluate the arithmetic terms
FB2=640000+22500001200000=1690000FB^2 = 640{}000 + 2{}250{}000 - 1{}200{}000 = 1{}690{}000
Squaring the side lengths and calculating the product 2(800)(1500)(0.5)2(800)(1500)(0.5).
4
Take the square root to solve for FBFB
FB=1690000=1300FB = \sqrt{1{}690{}000} = 1300
Taking the principal square root yields the distance in meters.

Anahtar Kavram

Law of Cosines (SAS Triangle Solving)
Soru 82Soru

A drone is positioned in the sky above a flat field between two ground observation stations, Station AA and Station BB, which are 500500 meters apart. From Station AA, the angle of elevation to the drone is 4040^\circ. From Station BB, looking back toward the drone, the angle of elevation is 6565^\circ. Assuming the drone and both observation stations lie in the same vertical plane, which of the following expressions represents the direct distance, in meters, from Station AA to the drone?

Cevabı ve açıklamayı göster

Cevap: 500sin(65)sin(75)\frac{500 \sin(65^\circ)}{\sin(75^\circ)}

Cevap

The correct expression is 500sin(65)sin(75)\frac{500 \sin(65^\circ)}{\sin(75^\circ)}.
To find the distance from Station AA to the drone (ADAD), model the scenario as triangle ABDABD. The ground side AB=500AB = 500 meters. The interior angle at AA is 4040^\circ and at BB is 6565^\circ. The third angle at the drone DD is 1804065=75180^\circ - 40^\circ - 65^\circ = 75^\circ. By the Law of Sines, ADsin(65)=500sin(75)\frac{AD}{\sin(65^\circ)} = \frac{500}{\sin(75^\circ)}, which simplifies to AD=500sin(65)sin(75)AD = \frac{500 \sin(65^\circ)}{\sin(75^\circ)}.

Adım Adım Çözüm

1
Determine the interior angle of the triangle at the drone's location (DD).
D=180(40+65)=75\angle D = 180^\circ - (40^\circ + 65^\circ) = 75^\circ
The interior angles of any triangle must sum to 180180^\circ.
2
Apply the Law of Sines to relate the known side AB=500AB = 500 meters and its opposite angle D=75\angle D = 75^\circ to the unknown side ADAD and its opposite angle B=65\angle B = 65^\circ.
ADsin(65)=500sin(75)\frac{AD}{\sin(65^\circ)} = \frac{500}{\sin(75^\circ)}
The Law of Sines states that in any triangle, asin(A)=bsin(B)=csin(C)\frac{a}{\sin(A)} = \frac{b}{\sin(B)} = \frac{c}{\sin(C)}.
3
Solve for the side length ADAD.
AD=500sin(65)sin(75)AD = \frac{500 \sin(65^\circ)}{\sin(75^\circ)}
Multiplying both sides of the equation by sin(65)\sin(65^\circ) isolates ADAD.

Anahtar Kavram

Applying the Law of Sines to find an unknown side length given two angles and one side of a triangle.
Tahmini Süre:1m 15s
Soru 83Soru

In right triangle JKMJKM, the right angle is at vertex KK. Leg JKJK has a length of 1616 centimeters. If sin(M)=817\sin(\angle M) = \frac{8}{17}, what is the length, in centimeters, of leg KMKM?

Cevabı ve açıklamayı göster

Cevap: 3030

Cevap

The length of leg KMKM is 3030 centimeters.
By definition of sine in a right triangle, sin(M)=oppositehypotenuse=JKJM\sin(\angle M) = \frac{\text{opposite}}{\text{hypotenuse}} = \frac{JK}{JM}. Given sin(M)=817\sin(\angle M) = \frac{8}{17} and JK=16JK = 16, setting 817=16JM\frac{8}{17} = \frac{16}{JM} yields hypotenuse JM=34 cmJM = 34\text{ cm}. Using the Pythagorean theorem KM=JM2JK2=342162=900=30 cmKM = \sqrt{JM^2 - JK^2} = \sqrt{34^2 - 16^2} = \sqrt{900} = 30\text{ cm}. Therefore, the option with value 3030 is correct.

Adım Adım Çözüm

1
Use the definition of sine to find the hypotenuse JMJM.
sin(M)=oppositehypotenuse=JKJM    817=16JM    JM=34 cm\sin(\angle M) = \frac{\text{opposite}}{\text{hypotenuse}} = \frac{JK}{JM} \implies \frac{8}{17} = \frac{16}{JM} \implies JM = 34\text{ cm}.
Sine is defined as the ratio of the side opposite the angle to the hypotenuse in a right triangle.
2
Apply the Pythagorean theorem to solve for the missing leg KMKM.
JK2+KM2=JM2    162+KM2=342    256+KM2=1156    KM2=900    KM=30 cmJK^2 + KM^2 = JM^2 \implies 16^2 + KM^2 = 34^2 \implies 256 + KM^2 = 1156 \implies KM^2 = 900 \implies KM = 30\text{ cm}.
In any right triangle, the sum of the squares of the legs equals the square of the hypotenuse.

Anahtar Kavram

Right Triangle Trigonometry (SOHCAHTOA)
Soru 84Soru

A 25-foot ladder leans against a vertical wall on flat, horizontal ground. The base of the ladder is positioned 7 feet away from the wall. If θ\theta represents the measure of the angle formed between the ladder and the ground, what is the value of sin(θ)+cos(θ)\sin(\theta) + \cos(\theta)?

Cevabı ve açıklamayı göster

Cevap: 3125\frac{31}{25}

Cevap

3125\frac{31}{25}
The ladder forms a 7-24-25 right triangle with the ground and the wall. Relative to angle θ\theta between the ladder and the ground, the opposite side is 24 feet, the adjacent side is 7 feet, and the hypotenuse is 25 feet. Evaluating sin(θ)=2425\sin(\theta) = \frac{24}{25} and cos(θ)=725\cos(\theta) = \frac{7}{25} and adding them gives 3125\frac{31}{25}.

Adım Adım Çözüm

1
Identify known components of the right triangle
The ladder acts as the hypotenuse (c=25c = 25), and the distance along the ground is the adjacent side to angle θ\theta (a=7a = 7).
The ladder, wall, and ground form a right triangle with the right angle at the base of the wall.
2
Calculate the height of the wall (opposite side)
Opposite side b=25272=62549=576=24b = \sqrt{25^2 - 7^2} = \sqrt{625 - 49} = \sqrt{576} = 24 feet.
By the Pythagorean theorem (a2+b2=c2a^2 + b^2 = c^2), solving for bb gives b=c2a2b = \sqrt{c^2 - a^2}.
3
Determine sin(θ)\sin(\theta) and cos(θ)\cos(\theta) using SOHCAHTOA ratios
sin(θ)=OppositeHypotenuse=2425\sin(\theta) = \frac{\text{Opposite}}{\text{Hypotenuse}} = \frac{24}{25} and cos(θ)=AdjacentHypotenuse=725\cos(\theta) = \frac{\text{Adjacent}}{\text{Hypotenuse}} = \frac{7}{25}.
Sine is defined as opposite over hypotenuse, and cosine is defined as adjacent over hypotenuse.
4
Sum the trigonometric ratios
sin(θ)+cos(θ)=2425+725=3125\sin(\theta) + \cos(\theta) = \frac{24}{25} + \frac{7}{25} = \frac{31}{25}.
Add the two fractions with the common denominator 25.

Anahtar Kavram

Right Triangle Trigonometry (SOHCAHTOA) and Pythagorean Theorem
Tahmini Süre:1m 15s
Soru 85Soru

An architect is designing a triangular solar panel frame with side lengths measuring 1515 feet, 2424 feet, and 2121 feet. What is the measure, in degrees, of the interior angle opposite the side measuring 2121 feet?

Cevabı ve açıklamayı göster

Cevap: 60

Cevap

The measure of the interior angle opposite the side measuring 21 feet is 60 degrees.
Using the Law of Cosines c2=a2+b22abcos(C)c^2 = a^2 + b^2 - 2ab\cos(C) with side lengths a=15a = 15, b=24b = 24, and c=21c = 21 gives 212=152+2422(15)(24)cos(C)21^2 = 15^2 + 24^2 - 2(15)(24)\cos(C). Simplifying the equation leads to 441=801720cos(C)441 = 801 - 720\cos(C), which rearranges to 360=720cos(C)-360 = -720\cos(C) or cos(C)=0.5\cos(C) = 0.5. Evaluating arccos(0.5)\arccos(0.5) yields an angle measure of 6060^\circ.

Adım Adım Çözüm

1
Set up the Law of Cosines with the side lengths a=15a = 15, b=24b = 24, and target opposite side c=21c = 21.
212=152+2422(15)(24)cos(C)21^2 = 15^2 + 24^2 - 2(15)(24)\cos(C)
The Law of Cosines connects three side lengths of any triangle to the cosine of the angle opposite one of those sides.
2
Simplify the numerical values in the equation.
441=801720cos(C)441 = 801 - 720\cos(C)
Evaluate 212=44121^2 = 441, 152+242=225+576=80115^2 + 24^2 = 225 + 576 = 801, and 2(15)(24)=7202(15)(24) = 720.
3
Isolate the cosine expression.
cos(C)=0.5\cos(C) = 0.5
Subtracting 801801 from both sides gives 360=720cos(C)-360 = -720\cos(C), then dividing by 720-720 yields 0.50.5.
4
Find the inverse cosine of 0.50.5.
C=60C = 60^\circ
In any triangle, the angle whose cosine is 0.50.5 is 6060^\circ.

Anahtar Kavram

Applying the Law of Cosines to solve for an unknown angle given all three side lengths of a non-right triangle.
Soru 86Soru

In rhombus ABCDABCD, the diagonals ACAC and BDBD intersect at point EE. If the length of diagonal ACAC is 1616 centimeters and the length of side ABAB is 1010 centimeters, what is the value of sin(ABE)\sin(\angle ABE)?

Cevabı ve açıklamayı göster

Cevap: 45\frac{4}{5}

Cevap

The value of sin(ABE)\sin(\angle ABE) is 45\frac{4}{5}.
The correct answer is 45\frac{4}{5}. Because the diagonals of a rhombus are perpendicular bisectors, ABE\triangle ABE is a right triangle with the right angle at vertex EE. Diagonal ACAC is bisected at EE, making AE=8AE = 8 cm. For ABE\angle ABE, the opposite side is AE=8AE = 8 cm and the hypotenuse is AB=10AB = 10 cm. By SOHCAHTOA, sin(ABE)=oppositehypotenuse=810=45\sin(\angle ABE) = \frac{\text{opposite}}{\text{hypotenuse}} = \frac{8}{10} = \frac{4}{5}.

Adım Adım Çözüm

1
Use the properties of a rhombus to identify right triangles and segment lengths.
The diagonals of a rhombus intersect at right angles (9090^\circ) and bisect each other. Therefore, ABE\triangle ABE is a right triangle with right angle at vertex EE, and leg AE=12AC=12(16)=8AE = \frac{1}{2} AC = \frac{1}{2}(16) = 8 cm.
Rhombus diagonals are perpendicular bisectors.
2
Identify the sides of right triangle ABEABE relative to angle ABE\angle ABE.
The hypotenuse is side AB=10AB = 10 cm, and the side opposite to ABE\angle ABE is leg AE=8AE = 8 cm.
Opposite side is directly across from the angle of interest.
3
Apply the sine ratio formula (SOHCAHTOA).
\sin(\angle ABE) = \frac{\text{Opposite}}{\text{Hypotenuse}} = \frac{AE}{AB} = \frac{8}{10} = \frac{4}{5}
Sine is defined as the ratio of the opposite side length to the hypotenuse length.

Anahtar Kavram

Right Triangle Trigonometry (SOHCAHTOA) applied to Rhombus Geometry
Tahmini Süre:1m 15s
Soru 87Soru

A sailboat is traveling along a straight path. From point AA, a lighthouse LL is observed at an angle of 3535^\circ relative to the line of travel. After the boat travels 400400 meters directly along the path to reach point CC, the angle to the lighthouse relative to the continuing line of travel increases to 6565^\circ. Which of the following expressions represents the distance, in meters, from point CC to the lighthouse LL?

Cevabı ve açıklamayı göster

Cevap: 800sin(35)800 \sin(35^\circ)

Cevap

800sin(35)800 \sin(35^\circ) meters
To find the distance from CC to the lighthouse LL, analyze ALC\triangle ALC. The given angle at AA is 3535^\circ. Point CC is along the straight line of travel, so the interior angle LCA=18065=115\angle LCA = 180^\circ - 65^\circ = 115^\circ. The top angle ALC=180(35+115)=30\angle ALC = 180^\circ - (35^\circ + 115^\circ) = 30^\circ. By the Law of Sines, CLsin(35)=400sin(30)\frac{CL}{\sin(35^\circ)} = \frac{400}{\sin(30^\circ)}. Since sin(30)=0.5\sin(30^\circ) = 0.5, solving for CLCL gives CL=400sin(35)0.5=800sin(35)CL = \frac{400 \sin(35^\circ)}{0.5} = 800 \sin(35^\circ).

Adım Adım Çözüm

1
Determine the interior angles of ALC\triangle ALC
Angle LAC=35\angle LAC = 35^\circ. The supplementary interior angle at CC is LCA=18065=115\angle LCA = 180^\circ - 65^\circ = 115^\circ. The third interior angle ALC=180(35+115)=30\angle ALC = 180^\circ - (35^\circ + 115^\circ) = 30^\circ.
The interior angle and exterior angle along a straight path sum to 180180^\circ, and the interior angles of a triangle sum to 180180^\circ.
2
Apply the Law of Sines to find distance CLCL
CLsin(35)=ACsin(30)    CLsin(35)=400sin(30)\frac{CL}{\sin(35^\circ)} = \frac{AC}{\sin(30^\circ)} \implies \frac{CL}{\sin(35^\circ)} = \frac{400}{\sin(30^\circ)}
The Law of Sines states that the ratio of a side length to the sine of its opposite angle is constant in any triangle.
3
Simplify the expression using sin(30)=0.5\sin(30^\circ) = 0.5
CL=400sin(35)0.5=800sin(35)CL = \frac{400 \sin(35^\circ)}{0.5} = 800 \sin(35^\circ)
Dividing 400400 by 0.50.5 yields 800800.

Anahtar Kavram

Law of Sines
Soru 88Soru

Two radar stations, AA and BB, are located 1212 miles apart along a straight coastline. Both stations track a ship offshore at point CC. The angle formed by the coastline ABAB and the line of sight from station AA to the ship (BAC\angle BAC) measures 4242^\circ, and the angle formed by the coastline ABAB and the line of sight from station BB to the ship (ABC\angle ABC) measures 7878^\circ. Which of the following expressions represents the distance, in miles, from station AA to the ship?

Cevabı ve açıklamayı göster

Cevap: 12sin(78)sin(60)\frac{12 \sin(78^\circ)}{\sin(60^\circ)}

Cevap

The distance, in miles, from station A to the ship is given by 12sin(78)sin(60)\frac{12 \sin(78^\circ)}{\sin(60^\circ)}.
The sum of angles in ABC\triangle ABC is 180180^\circ, so C=1804278=60\angle C = 180^\circ - 42^\circ - 78^\circ = 60^\circ. The distance from station A to the ship corresponds to side length ACAC, which lies opposite B=78\angle B = 78^\circ. Applying the Law of Sines yields ACsin(78)=12sin(60)\frac{AC}{\sin(78^\circ)} = \frac{12}{\sin(60^\circ)}, which simplifies to AC=12sin(78)sin(60)AC = \frac{12 \sin(78^\circ)}{\sin(60^\circ)}.

Adım Adım Çözüm

1
Calculate the measure of the third angle ACB\angle ACB in ABC\triangle ABC.
ACB=180(42+78)=60\angle ACB = 180^\circ - (42^\circ + 78^\circ) = 60^\circ
The interior angles of any triangle must sum to 180180^\circ.
2
Set up the Law of Sines relating the known side AB=12AB = 12 and its opposite angle ACB=60\angle ACB = 60^\circ to the unknown side AC=bAC = b and its opposite angle ABC=78\angle ABC = 78^\circ.
ACsin(78)=12sin(60)\frac{AC}{\sin(78^\circ)} = \frac{12}{\sin(60^\circ)}
The Law of Sines states that asin(A)=bsin(B)=csin(C)\frac{a}{\sin(A)} = \frac{b}{\sin(B)} = \frac{c}{\sin(C)}.
3
Solve the equation for ACAC.
AC=12sin(78)sin(60)AC = \frac{12 \sin(78^\circ)}{\sin(60^\circ)}
Multiply both sides of the equation by sin(78)\sin(78^\circ).

Anahtar Kavram

Law of Sines
Tahmini Süre:1m 15s
Soru 89Soru

A sailboat travels due east from Port PP for 1515 nautical miles to Point QQ, then turns due north and travels 3636 nautical miles to Point RR. The straight line of sight from Port PP to Point RR forms an angle θ\theta with segment PQPQ. What is the value of cosθsinθ\cos \theta - \sin \theta?

Cevabı ve açıklamayı göster

Cevap: 713-\frac{7}{13}

Cevap

The correct value of cosθsinθ\cos \theta - \sin \theta is 713-\frac{7}{13}.
The direct distance between Port PP and Point RR forms the hypotenuse of right triangle PQRPQR. By applying the Pythagorean theorem, the hypotenuse length is 152+362=39\sqrt{15^2 + 36^2} = 39. Relative to angle θ\theta at vertex PP, the adjacent leg is 1515 and the opposite leg is 3636. Therefore, cosθ=1539=513\cos \theta = \frac{15}{39} = \frac{5}{13} and sinθ=3639=1213\sin \theta = \frac{36}{39} = \frac{12}{13}. Subtracting these yields 5131213=713\frac{5}{13} - \frac{12}{13} = -\frac{7}{13}.

Adım Adım Çözüm

1
Determine the length of the hypotenuse PRPR using the Pythagorean theorem.
PR=152+362=225+1296=1521=39PR = \sqrt{15^2 + 36^2} = \sqrt{225 + 1296} = \sqrt{1521} = 39 nautical miles.
Triangle PQRPQR is a right triangle with right angle at vertex QQ because the path turns from due east to due north.
2
Identify the opposite side, adjacent side, and hypotenuse relative to angle θ=QPR\theta = \angle QPR.
Adjacent side PQ=15PQ = 15, Opposite side QR=36QR = 36, Hypotenuse PR=39PR = 39.
Angle θ\theta is formed at vertex PP between the base path PQPQ and the direct distance PRPR.
3
Calculate cosθ\cos \theta and sinθ\sin \theta using SOHCAHTOA ratios.
cosθ=AdjacentHypotenuse=1539=513\cos \theta = \frac{\text{Adjacent}}{\text{Hypotenuse}} = \frac{15}{39} = \frac{5}{13} and sinθ=OppositeHypotenuse=3639=1213\sin \theta = \frac{\text{Opposite}}{\text{Hypotenuse}} = \frac{36}{39} = \frac{12}{13}.
Cosine is adjacent over hypotenuse and sine is opposite over hypotenuse.
4
Evaluate the expression cosθsinθ\cos \theta - \sin \theta.
cosθsinθ=5131213=713\cos \theta - \sin \theta = \frac{5}{13} - \frac{12}{13} = -\frac{7}{13}.
Subtracting the sine value from the cosine value gives a negative result since the opposite leg is longer than the adjacent leg.

Anahtar Kavram

Right Triangle Trigonometry (SOHCAHTOA)
Tahmini Süre:1m 30s
Soru 90Soru

A landscape architect is designing a triangular courtyard garden. Two adjacent edges of the garden measure 88 meters and 1515 meters, and the angle between these two edges is 6060^\circ. What is the length, in meters, of the third edge of the garden?

Cevabı ve açıklamayı göster

Cevap: 13

Cevap

The length of the third edge of the garden is 13 meters.
Applying the Law of Cosines c2=a2+b22abcos(C)c^2 = a^2 + b^2 - 2ab \cos(C) with a=8a = 8, b=15b = 15, and C=60C = 60^\circ yields c2=82+1522(8)(15)cos(60)=64+225240(0.5)=169c^2 = 8^2 + 15^2 - 2(8)(15)\cos(60^\circ) = 64 + 225 - 240(0.5) = 169. Taking the square root gives c=13c = 13 meters.

Adım Adım Çözüm

1
Identify the given side lengths and included angle.
Two sides are a=8 ma = 8\text{ m} and b=15 mb = 15\text{ m}, and their included angle is C=60C = 60^\circ.
The Law of Cosines is used when two sides and the included angle (SAS) are known.
2
Substitute the values into the Law of Cosines formula c2=a2+b22abcos(C)c^2 = a^2 + b^2 - 2ab \cos(C).
c2=82+1522(8)(15)cos(60)=64+225240(0.5)=169c^2 = 8^2 + 15^2 - 2(8)(15)\cos(60^\circ) = 64 + 225 - 240(0.5) = 169.
Evaluating the squared terms and trigonometric value cos(60)=0.5\cos(60^\circ) = 0.5 simplifies the equation to c2=169c^2 = 169.
3
Solve for the side length cc by taking the square root.
c=169=13 metersc = \sqrt{169} = 13\text{ meters}.
The physical side length of a geometric figure must be positive.

Anahtar Kavram

Law of Cosines (c2=a2+b22abcos(C)c^2 = a^2 + b^2 - 2ab \cos(C))
Tahmini Süre:1m 30s
Soru 91Soru

A civil engineer is designing a triangular bridge support structure with vertices PP, QQ, and RR. The support beam PQPQ is 8080 feet long, the beam QRQR is 5050 feet long, and the interior angle PQR\angle PQR measures 6060^\circ. What is the length, in feet, of the support beam PRPR?

Cevabı ve açıklamayı göster

Cevap: 70

Cevap

The length of the support beam PRPR is 7070 feet.
Using the Law of Cosines formula c2=a2+b22abcos(C)c^2 = a^2 + b^2 - 2ab\cos(C) with side lengths 8080 and 5050 and included angle 6060^\circ, we calculate PR2=802+5022(80)(50)cos(60)=6400+25004000=4900PR^2 = 80^2 + 50^2 - 2(80)(50)\cos(60^\circ) = 6400 + 2500 - 4000 = 4900. Taking the square root gives PR=70PR = 70 feet.

Adım Adım Çözüm

1
Identify the given dimensions and included angle
Side PQ=80PQ = 80 ft, side QR=50QR = 50 ft, and included angle PQR=60\angle PQR = 60^\circ.
The Law of Cosines applies directly when two side lengths and the included angle (SAS) are known.
2
Set up the Law of Cosines equation for the unknown side PRPR
PR2=PQ2+QR22(PQ)(QR)cos(PQR)PR^2 = PQ^2 + QR^2 - 2(PQ)(QR)\cos(\angle PQR)
This formula generalizes the Pythagorean theorem to non-right triangles.
3
Substitute the known values into the equation and evaluate
PR2=802+5022(80)(50)cos(60)=6400+25004000=4900PR^2 = 80^2 + 50^2 - 2(80)(50)\cos(60^\circ) = 6400 + 2500 - 4000 = 4900
Evaluating squares and using cos(60)=0.5\cos(60^\circ) = 0.5 simplifies the calculation.
4
Take the positive square root to find PRPR
PR=4900=70PR = \sqrt{4900} = 70
Side length must be a positive real number.

Anahtar Kavram

Applying the Law of Cosines to solve for an unknown side in a Side-Angle-Side (SAS) triangle.
Soru 92Soru

A surveyor standing at point AA on level ground measures the angle of elevation to the top, point CC, of a vertical observation tower. The base of the tower is at point BB, forming right triangle ABCABC with the right angle at vertex BB. The horizontal distance along the ground from point AA to base BB is 4040 meters. If sin(A)=941\sin(\angle A) = \frac{9}{41}, what is the height, in meters, of the tower?

Cevabı ve açıklamayı göster

Cevap: 99

Cevap

The height of the tower is 99 meters.
By definition of SOHCAHTOA, sin(A)=oppositehypotenuse=BCAC=941\sin(\angle A) = \frac{\text{opposite}}{\text{hypotenuse}} = \frac{BC}{AC} = \frac{9}{41}. Since cos(A)=adjacenthypotenuse=ABAC\cos(\angle A) = \frac{\text{adjacent}}{\text{hypotenuse}} = \frac{AB}{AC}, and using the Pythagorean triple 99-4040-4141, we find cos(A)=4041\cos(\angle A) = \frac{40}{41}. Given that the adjacent side AB=40AB = 40 meters, the hypotenuse ACAC must be 4141 meters, which means the opposite side (tower height BCBC) is 99 meters.

Adım Adım Çözüm

1
Identify the given trigonometric ratio and sides of the right triangle.
In right triangle ABCABC with right angle at BB, the adjacent side to A\angle A is AB=40AB = 40, the opposite side is BCBC (height of the tower), and the hypotenuse is ACAC. We are given sin(A)=BCAC=941\sin(\angle A) = \frac{BC}{AC} = \frac{9}{41}.
SOHCAHTOA defines sine as the ratio of the opposite side to the hypotenuse.
2
Determine the relationship between the sides using the Pythagorean theorem or cosine ratio.
Since sin(A)=941\sin(\angle A) = \frac{9}{41}, we know cos(A)=ABAC=1(941)2=1681811681=16001681=4041\cos(\angle A) = \frac{AB}{AC} = \sqrt{1 - \left(\frac{9}{41}\right)^2} = \sqrt{\frac{1681 - 81}{1681}} = \sqrt{\frac{1600}{1681}} = \frac{40}{41}.
The Pythagorean identity sin2(θ)+cos2(θ)=1\sin^2(\theta) + \cos^2(\theta) = 1 relates sine and cosine for any acute angle in a right triangle.
3
Calculate the length of the hypotenuse and the height of the tower.
Setting cos(A)=40AC=4041\cos(\angle A) = \frac{40}{AC} = \frac{40}{41} gives AC=41AC = 41 meters. Then, BC=41×sin(A)=41×941=9BC = 41 \times \sin(\angle A) = 41 \times \frac{9}{41} = 9 meters.
Substituting the known adjacent length of 4040 meters into the ratio yields the exact vertical height.

Anahtar Kavram

Right Triangle Trigonometry (SOHCAHTOA) and Pythagorean Triples
Tahmini Süre:1m 0s
Soru 93Soru

A straight ramp is constructed for a skateboard park. The ramp rises to a vertical height of 535\sqrt{3} feet above flat horizontal ground, and the horizontal distance from the base of the ramp to the point directly beneath its highest point is 1515 feet. If θ\theta represents the angle of inclination of the ramp with respect to the ground, what is the value of cos(θ)\cos(\theta)?

Cevabı ve açıklamayı göster

Cevap: 32\frac{\sqrt{3}}{2}

Cevap

The value of cos(θ)\cos(\theta) is 32\frac{\sqrt{3}}{2}.
The horizontal distance of 1515 feet is adjacent to angle θ\theta, and the vertical height of 535\sqrt{3} feet is opposite to θ\theta. By the Pythagorean theorem, the hypotenuse is 152+(53)2=225+75=103\sqrt{15^2 + (5\sqrt{3})^2} = \sqrt{225 + 75} = 10\sqrt{3} feet. Using SOHCAHTOA, cos(θ)=adjacenthypotenuse=15103=32\cos(\theta) = \frac{\text{adjacent}}{\text{hypotenuse}} = \frac{15}{10\sqrt{3}} = \frac{\sqrt{3}}{2}.

Adım Adım Çözüm

1
Identify the given side lengths relative to the angle θ\theta
The side opposite to angle θ\theta is 535\sqrt{3} feet, and the side adjacent to angle θ\theta is 1515 feet.
The height of the ramp is opposite to the angle of inclination, and the horizontal ground distance is adjacent.
2
Calculate the length of the hypotenuse using the Pythagorean theorem
Hypotenuse =152+(53)2=225+75=300=103= \sqrt{15^2 + (5\sqrt{3})^2} = \sqrt{225 + 75} = \sqrt{300} = 10\sqrt{3} feet.
Cosine is defined as adjacent divided by hypotenuse, so the hypotenuse length must be calculated first.
3
Apply the cosine ratio definition cos(θ)=adjacenthypotenuse\cos(\theta) = \frac{\text{adjacent}}{\text{hypotenuse}} and simplify
cos(θ)=15103=323=336=32\cos(\theta) = \frac{15}{10\sqrt{3}} = \frac{3}{2\sqrt{3}} = \frac{3\sqrt{3}}{6} = \frac{\sqrt{3}}{2}.
Rationalizing the denominator yields the simplified exact ratio.

Anahtar Kavram

Right Triangle Trigonometry (SOHCAHTOA)
Tahmini Süre:1m 15s
Soru 94Soru

For any real number xx such that 0<x<30 < x < 3, which of the following expressions is equivalent to sin(arccos(x3))\sin\left(\arccos\left(\frac{x}{3}\right)\right)?

Cevabı ve açıklamayı göster

Cevap: 9x23\frac{\sqrt{9 - x^2}}{3}

Cevap

9x23\frac{\sqrt{9 - x^2}}{3}
By letting θ=arccos(x3)\theta = \arccos\left(\frac{x}{3}\right), we construct a right triangle with an adjacent side of length xx and a hypotenuse of length 33. Applying the Pythagorean theorem yields an opposite side length of 32x2=9x2\sqrt{3^2 - x^2} = \sqrt{9 - x^2}. The sine of θ\theta is the ratio of the opposite side to the hypotenuse, which evaluates to 9x23\frac{\sqrt{9 - x^2}}{3}.

Adım Adım Çözüm

1
Define an angle variable for the inverse trigonometric expression
Let θ=arccos(x3)\theta = \arccos\left(\frac{x}{3}\right), so cos(θ)=x3\cos(\theta) = \frac{x}{3} for 0<θ<π20 < \theta < \frac{\pi}{2}.
Setting the inverse trigonometric function to an angle allows setting up a right triangle relationship.
2
Set up side lengths of a right triangle using the definition of cosine
Adjacent side = xx, Hypotenuse = 33.
By definition, cos(θ)=adjacenthypotenuse\cos(\theta) = \frac{\text{adjacent}}{\text{hypotenuse}}.
3
Calculate the opposite side using the Pythagorean theorem
\text{opposite} = \sqrt{3^2 - x^2} = \sqrt{9 - x^2}.
In any right triangle, opposite2+adjacent2=hypotenuse2\text{opposite}^2 + \text{adjacent}^2 = \text{hypotenuse}^2.
4
Determine the sine of the angle
\sin(\theta) = \frac{\text{opposite}}{\text{hypotenuse}} = \frac{\sqrt{9 - x^2}}{3}.
By definition, sin(θ)=oppositehypotenuse\sin(\theta) = \frac{\text{opposite}}{\text{hypotenuse}}.

Anahtar Kavram

Evaluating algebraic compositions of trigonometric and inverse trigonometric functions using right triangle geometry.
Tahmini Süre:1m 15s
Soru 95Soru

In right triangle PQRPQR, the right angle is located at vertex QQ. The length of leg PQPQ is 3030 centimeters. If sin(P)=817\sin(P) = \frac{8}{17}, what is the length, in centimeters, of leg QRQR?

Cevabı ve açıklamayı göster

Cevap: 1616

Cevap

16 centimeters
In right triangle PQRPQR, sin(P)=QRPR=817\sin(P) = \frac{QR}{PR} = \frac{8}{17}. The corresponding cosine ratio is cos(P)=PQPR=1517\cos(P) = \frac{PQ}{PR} = \frac{15}{17}. Given PQ=30PQ = 30, we solve 30PR=1517\frac{30}{PR} = \frac{15}{17} to find PR=34PR = 34. Then, leg QR=34×817=16QR = 34 \times \frac{8}{17} = 16.

Adım Adım Çözüm

1
Express the given sine ratio in terms of the triangle sides.
sin(P)=oppositehypotenuse=QRPR=817\sin(P) = \frac{\text{opposite}}{\text{hypotenuse}} = \frac{QR}{PR} = \frac{8}{17}
By definition of the sine function in a right triangle.
2
Find the cosine ratio cos(P)\cos(P) using the Pythagorean identity or the 8-15-17 right triangle ratio.
cos(P)=1sin2(P)=164289=1517\cos(P) = \sqrt{1 - \sin^2(P)} = \sqrt{1 - \frac{64}{289}} = \frac{15}{17}
Cosine represents the ratio of the adjacent side (PQPQ) to the hypotenuse (PRPR).
3
Calculate the hypotenuse PRPR using the known leg PQ=30PQ = 30.
PQPR=1517    30PR=1517    PR=34\frac{PQ}{PR} = \frac{15}{17} \implies \frac{30}{PR} = \frac{15}{17} \implies PR = 34
Setting the adjacent side ratio equal to cos(P)\cos(P) solves for the hypotenuse length.
4
Calculate the opposite leg QRQR.
QR=PR×sin(P)=34×817=16QR = PR \times \sin(P) = 34 \times \frac{8}{17} = 16
Multiplying the hypotenuse by sin(P)\sin(P) gives the opposite leg length.

Anahtar Kavram

Right Triangle Trigonometry (SOHCAHTOA)
Tahmini Süre:1m 15s
Soru 96Soru

What is the value, in degrees, of the expression arcsin(32)+arccos(12)\arcsin\left(\frac{\sqrt{3}}{2}\right) + \arccos\left(-\frac{1}{2}\right)?

Cevabı ve açıklamayı göster

Cevap: 180

Cevap

The value of the expression is 180 degrees.
To evaluate arcsin(32)+arccos(12)\arcsin\left(\frac{\sqrt{3}}{2}\right) + \arccos\left(-\frac{1}{2}\right), find the principal value for each term. The principal range for arcsin\arcsin is [90,90][-90^\circ, 90^\circ], so arcsin(32)=60\arcsin\left(\frac{\sqrt{3}}{2}\right) = 60^\circ. The principal range for arccos\arccos is [0,180][0^\circ, 180^\circ], so for a negative argument, the result lies in Quadrant II, giving arccos(12)=120\arccos\left(-\frac{1}{2}\right) = 120^\circ. Adding these values together gives 60+120=18060^\circ + 120^\circ = 180^\circ.

Adım Adım Çözüm

1
Find the principal angle for arcsin(32)\arcsin\left(\frac{\sqrt{3}}{2}\right) in degrees.
arcsin(32)=60\arcsin\left(\frac{\sqrt{3}}{2}\right) = 60^\circ
The inverse sine function yields outputs restricted to the range [90,90][-90^\circ, 90^\circ]. The angle in Quadrant I whose sine is 32\frac{\sqrt{3}}{2} is 6060^\circ.
2
Find the principal angle for arccos(12)\arccos\left(-\frac{1}{2}\right) in degrees.
arccos(12)=120\arccos\left(-\frac{1}{2}\right) = 120^\circ
The inverse cosine function yields outputs restricted to the range [0,180][0^\circ, 180^\circ]. For a negative input, the output must be in Quadrant II. The angle whose cosine is 12-\frac{1}{2} is 120120^\circ.
3
Sum the two evaluated angle measures.
60+120=18060^\circ + 120^\circ = 180^\circ
Perform standard addition on the two principal values.

Anahtar Kavram

Evaluating inverse trigonometric functions within their standard principal value ranges.
Soru 97Soru

What is the exact value of csc(arctan(724))\csc\left(\arctan\left(-\frac{7}{24}\right)\right)?

Cevabı ve açıklamayı göster

Cevap: 257-\frac{25}{7}

Cevap

257-\frac{25}{7}
Let θ=arctan(724)\theta = \arctan\left(-\frac{7}{24}\right). By definition of the inverse tangent function's principal range (π2,π2)\left(-\frac{\pi}{2}, \frac{\pi}{2}\right), a negative input produces an angle in Quadrant IV. In Quadrant IV, the opposite side is 7-7, the adjacent side is 2424, and the hypotenuse is 242+(7)2=25\sqrt{24^2 + (-7)^2} = 25. Cosecant is the ratio of hypotenuse to opposite, giving 257=257\frac{25}{-7} = -\frac{25}{7}.

Adım Adım Çözüm

1
Determine the quadrant for θ=arctan(724)\theta = \arctan\left(-\frac{7}{24}\right)
θ\theta lies in Quadrant IV because the principal range of arctan(x)\arctan(x) is (π2,π2)\left(-\frac{\pi}{2}, \frac{\pi}{2}\right) and the input is negative.
Inverse tangent maps negative real numbers to angles in the interval (π2,0)\left(-\frac{\pi}{2}, 0\right).
2
Set up a right triangle ratio for tan(θ)=724\tan(\theta) = -\frac{7}{24}
Opposite side = 7-7, adjacent side = 2424, hypotenuse = 242+(7)2=25\sqrt{24^2 + (-7)^2} = 25.
Tangent is the ratio of opposite to adjacent sides, and the hypotenuse is determined using the Pythagorean theorem.
3
Calculate csc(θ)\csc(\theta)
csc(θ)=hypotenuseopposite=257=257\csc(\theta) = \frac{\text{hypotenuse}}{\text{opposite}} = \frac{25}{-7} = -\frac{25}{7}.
Cosecant is defined as the reciprocal of sine, which equals hypotenuse divided by opposite side.

Anahtar Kavram

Evaluating trigonometric compositions involving inverse trigonometric functions using right triangle geometry and principal angle ranges.
Soru 98Soru

A kite string of length 5050 meters is attached to a stake anchored in level ground at point KK. The kite is flying at point HH, directly above a landmark LL on the ground, forming right triangle KLHKLH with the right angle at LL. If the angle of elevation from the stake to the kite is θ\theta, such that cos(θ)=2425\cos(\theta) = \frac{24}{25}, what is the vertical height, in meters, of the kite above the ground?

Cevabı ve açıklamayı göster

Cevap: 1414

Cevap

The vertical height of the kite above the ground is 1414 meters.
The vertical height corresponds to the leg opposite to angle θ\theta. Using cos(θ)=2425\cos(\theta) = \frac{24}{25}, the adjacent side is 4848 meters. Applying the Pythagorean theorem LH=502482=14LH = \sqrt{50^2 - 48^2} = 14 meters gives the correct vertical height.

Adım Adım Çözüm

1
Identify the given trigonometric ratio and side length
Hypotenuse KH=50KH = 50 meters and cos(θ)=adjacenthypotenuse=KL50=2425\cos(\theta) = \frac{\text{adjacent}}{\text{hypotenuse}} = \frac{KL}{50} = \frac{24}{25}.
Cosine relates the adjacent side (ground distance) to the hypotenuse (string length).
2
Calculate the horizontal ground distance KLKL
KL=50×2425=48KL = 50 \times \frac{24}{25} = 48 meters.
Multiply the hypotenuse length by the cosine ratio.
3
Determine the sine ratio or use the Pythagorean theorem to find the vertical height LHLH
Since sin(θ)=1cos2(θ)=1(2425)2=725\sin(\theta) = \sqrt{1 - \cos^2(\theta)} = \sqrt{1 - \left(\frac{24}{25}\right)^2} = \frac{7}{25}, the height LH=50×sin(θ)=50×725=14LH = 50 \times \sin(\theta) = 50 \times \frac{7}{25} = 14 meters.
The sine ratio relates the opposite vertical height to the hypotenuse.

Anahtar Kavram

Right Triangle Trigonometry (SOHCAHTOA) and Pythagorean Triples
Tahmini Süre:1m 0s
Soru 99Soru

If θ=arcsin(35)\theta = \arcsin\left(-\frac{3}{5}\right), what is the exact decimal value of cos(2θ)\cos(2\theta)?

Cevabı ve açıklamayı göster

Cevap: 0.28

Cevap

The exact decimal value of cos(2θ)\cos(2\theta) is 0.280.28.
Given θ=arcsin(35)\theta = \arcsin\left(-\frac{3}{5}\right), the sine of θ\theta is sin(θ)=35\sin(\theta) = -\frac{3}{5}. Using the double-angle formula for cosine, cos(2θ)=12sin2(θ)\cos(2\theta) = 1 - 2\sin^2(\theta), we substitute sin(θ)\sin(\theta) to get cos(2θ)=12(35)2=11825=725=0.28\cos(2\theta) = 1 - 2\left(-\frac{3}{5}\right)^2 = 1 - \frac{18}{25} = \frac{7}{25} = 0.28.

Adım Adım Çözüm

1
Identify the value of sin(θ)\sin(\theta) from the inverse trigonometric expression
sin(θ)=35\sin(\theta) = -\frac{3}{5}
By definition of the inverse sine function, if θ=arcsin(35)\theta = \arcsin\left(-\frac{3}{5}\right), then sin(θ)=35\sin(\theta) = -\frac{3}{5} where π2θπ2-\frac{\pi}{2} \le \theta \le \frac{\pi}{2}.
2
Select the double-angle identity for cosine that uses sine
cos(2θ)=12sin2(θ)\cos(2\theta) = 1 - 2\sin^2(\theta)
This form of the double-angle identity allows direct calculation without needing to calculate cos(θ)\cos(\theta) first.
3
Substitute sin(θ)\sin(\theta) and evaluate the expression
cos(2θ)=0.28\cos(2\theta) = 0.28
Substituting sin(θ)=35\sin(\theta) = -\frac{3}{5} gives 12(35)2=12(925)=11825=725=0.281 - 2\left(-\frac{3}{5}\right)^2 = 1 - 2\left(\frac{9}{25}\right) = 1 - \frac{18}{25} = \frac{7}{25} = 0.28.

Anahtar Kavram

Evaluating Trigonometric Functions of Inverse Trigonometric Expressions using Double-Angle Identities

Alternatif Yöntem

Alternatively, place θ\theta in Quadrant IV (since π2θ<0-\frac{\pi}{2} \le \theta < 0 for a negative inverse sine input). The adjacent side is 52(3)2=4\sqrt{5^2 - (-3)^2} = 4, so cos(θ)=45\cos(\theta) = \frac{4}{5}. Then apply the alternative double-angle identity cos(2θ)=cos2(θ)sin2(θ)=(45)2(35)2=1625925=725=0.28\cos(2\theta) = \cos^2(\theta) - \sin^2(\theta) = \left(\frac{4}{5}\right)^2 - \left(-\frac{3}{5}\right)^2 = \frac{16}{25} - \frac{9}{25} = \frac{7}{25} = 0.28.
Tahmini Süre:1m 15s
Soru 100Soru

In right triangle LMNLMN, the right angle is at vertex MM. The hypotenuse LNLN has a length of 2525 units. If cos(L)=725\cos(L) = \frac{7}{25}, what is the value of tan(N)\tan(N)?

Cevabı ve açıklamayı göster

Cevap: 724\frac{7}{24}

Cevap

724\frac{7}{24}
The ratio cos(L)=725\cos(L) = \frac{7}{25} means the leg adjacent to angle LL (LMLM) is 77 units and the hypotenuse (LNLN) is 2525 units. Using the Pythagorean theorem (72+MN2=2527^2 + MN^2 = 25^2), the remaining leg MNMN is 2424 units. For angle NN, the opposite side is LM=7LM = 7 and the adjacent side is MN=24MN = 24. Thus, tan(N)=oppositeadjacent=724\tan(N) = \frac{\text{opposite}}{\text{adjacent}} = \frac{7}{24}.

Adım Adım Çözüm

1
Use the definition of cosine for angle LL to identify the length of leg LMLM.
Since cos(L)=adjacenthypotenuse=LM25=725\cos(L) = \frac{\text{adjacent}}{\text{hypotenuse}} = \frac{LM}{25} = \frac{7}{25}, the length of leg LMLM is 77 units.
Cosine is defined as the ratio of the adjacent side to the hypotenuse in a right triangle.
2
Calculate the length of the remaining leg MNMN using the Pythagorean theorem.
MN=LN2LM2=25272=62549=576=24MN = \sqrt{LN^2 - LM^2} = \sqrt{25^2 - 7^2} = \sqrt{625 - 49} = \sqrt{576} = 24 units.
In a right triangle, the square of the hypotenuse equals the sum of the squares of the legs.
3
Set up the tangent ratio for angle NN.
tan(N)=opposite side to Nadjacent side to N=LMMN=724\tan(N) = \frac{\text{opposite side to } N}{\text{adjacent side to } N} = \frac{LM}{MN} = \frac{7}{24}.
Tangent is defined as the ratio of the side opposite the angle to the side adjacent to the angle.

Anahtar Kavram

Right Triangle Trigonometric Ratios (SOHCAHTOA)
Tahmini Süre:1m 0s
ÖncekiSayfa 5 / 6Sonraki
Trigonometry Alıştırma Soruları — ACT — Sayfa 5 | Examkin