Statistics and Data Analysis

77 soru

Soru 41Soru

Set SS consists of five distinct integers: 14,22,18,9,14, 22, 18, 9, and 3131. What is the range of the numbers in Set SS?

Cevabı ve açıklamayı göster

Cevap: 22

Cevap

The range of the numbers in Set SS is 2222.
To find the range of a set of numbers, subtract the minimum value from the maximum value in the set. For Set S={14,22,18,9,31}S = \{14, 22, 18, 9, 31\}, the maximum value is 3131 and the minimum value is 99. Subtracting the minimum from the maximum gives 319=2231 - 9 = 22.

Adım Adım Çözüm

1
Identify the maximum and minimum elements in the given set.
The maximum element is 3131 and the minimum element is 99.
The range of a dataset is defined as the difference between its greatest and least values.
2
Subtract the minimum value from the maximum value.
319=2231 - 9 = 22.
Applying the formula Range=MaximumMinimum\text{Range} = \text{Maximum} - \text{Minimum} yields the range of the set.

Anahtar Kavram

Range of a Numerical Data Set
Soru 42Soru

In a corporate firm of NN employees, each employee earns a distinct annual salary. An employee earning a salary of $78,000\$78,000 is at the 60th60\text{th} percentile of all salaries in the firm. The firm subsequently hires 1010 new employees, each of whom earns an annual salary strictly less than $78,000\$78,000. If $78,000\$78,000 is now at the 70th70\text{th} percentile of all salaries in the expanded firm, how many employees were originally in the firm?

Cevabı ve açıklamayı göster

Cevap: 30

Cevap

30
The percentile rank of a score indicates the percentage of values in the set that are less than or equal to that score. Originally, 60%60\% of NN employees earned $78,000\le \$78,000, giving 0.60N0.60N employees. Adding 1010 employees who all earn under $78,000\$78,000 brings the count of employees earning $78,000\le \$78,000 to 0.60N+100.60N + 10, while the total workforce becomes N+10N + 10. Since $78,000\$78,000 is at the 70th percentile of the new distribution, 0.60N+10=0.70(N+10)0.60N + 10 = 0.70(N + 10). Expanding and solving yields 0.60N+10=0.70N+70.60N + 10 = 0.70N + 7, so 0.10N=30.10N = 3, which gives N=30N = 30.

Adım Adım Çözüm

1
Define the initial number of employees earning at or below $78,000.
Initially, 0.60N0.60N employees earn $78,000\le \$78,000.
By definition of percentile rank with distinct values, being at the 60th percentile of NN scores means 60%60\% of the total NN salaries are less than or equal to $78,000\$78,000.
2
Determine the new count of employees and the updated count of employees earning at or below $78,000.
New total employees =N+10= N + 10; new count earning $78,000\le \$78,000 is 0.60N+100.60N + 10.
All 10 newly hired employees earn salaries strictly less than $78,000\$78,000, increasing the count of salaries $78,000\le \$78,000 by 10.
3
Set up an equation using the new percentile rank.
0.60N+10=0.70(N+10)0.60N + 10 = 0.70(N + 10)
The salary $78,000\$78,000 is now at the 70th percentile of the updated total group size of (N+10)(N + 10).
4
Solve the algebraic equation for NN.
0.60N+10=0.70N+7    3=0.10N    N=300.60N + 10 = 0.70N + 7 \implies 3 = 0.10N \implies N = 30.
Subtracting 0.60N0.60N and 77 from both sides gives 0.10N=30.10N = 3, which yields N=30N = 30.

Anahtar Kavram

Percentile Rank in Expanding Data Sets
Soru 43Soru

A dataset contains 2020 distinct test scores arranged in ascending order:

10,12,15,17,20,22,25,28,30,32,35,38,40,43,45,48,50,52,55,6010, 12, 15, 17, 20, 22, 25, 28, 30, 32, 35, 38, 40, 43, 45, 48, 50, 52, 55, 60

If the pthp\text{th} percentile of a dataset of NN values is defined as the value at position k=p100×Nk = \frac{p}{100} \times N when ordered from least to greatest, what is the 75th75\text{th} percentile of these test scores?

Cevabı ve açıklamayı göster

Cevap: 45

Cevap

The 75th percentile of the given test scores is 45.
The 75th percentile corresponds to position k = (75/100) * 20 = 15 in the ordered list of 20 scores, which is equal to 45.

Adım Adım Çözüm

1
Calculate the position index kk for the 75th75\text{th} percentile.
k=75100×20=15k = \frac{75}{100} \times 20 = 15
The rank formula determines the 1-based index of the target percentile value in an ordered set of size N=20N = 20.
2
Locate the 15th15\text{th} score in the ordered dataset.
The 15th15\text{th} score is 4545.
Counting from the lowest score (1010 at position 1), the 15th15\text{th} score in the sequence is 4545.

Anahtar Kavram

Percentiles and Quartiles
Soru 44Soru

An investment portfolio consists of three asset classes: Equities, Bonds, and Real Estate. The total monetary value of Equities to Bonds is in the ratio 3:23 : 2, and the total value of Bonds to Real Estate is in the ratio 4:54 : 5. Over the past year, Equities yielded an average return of 12%12\%. If the overall weighted average return of the entire portfolio was 10.4%10.4\%, and the average percentage return of Bonds was 25%25\% higher than the average percentage return of Real Estate, what was the average percentage return of Bonds?

Cevabı ve açıklamayı göster

Cevap: 10.5

Cevap

The average percentage return of Bonds was 10.5%.
The correct return of Bonds is obtained by first unifying the given ratios into a continuous ratio of weights 6:4:56 : 4 : 5 for Equities, Bonds, and Real Estate respectively. Substituting these weights and the algebraic relation between Real Estate return (rr) and Bond return (1.25r1.25r) into the weighted average expression yields r=8.4%r = 8.4\%. Multiplying this by 1.251.25 gives the bond return of 10.5%10.5\%.

Adım Adım Çözüm

1
Determine the combined ratio of portfolio weights for all three asset classes
The ratio Equities : Bonds : Real Estate is 6 : 4 : 5, giving a total weight sum of 15 units.
Since Equities to Bonds is 3:2 (or 6:4) and Bonds to Real Estate is 4:5, the common term Bonds allows combining the ratios into 6 : 4 : 5.
2
Express the unknown asset returns in terms of a single variable
Return of Real Estate = r%r\%, Return of Bonds = 1.25r%1.25r\%.
The problem states the return of Bonds is 25% higher than that of Real Estate (r+0.25r=1.25rr + 0.25r = 1.25r).
3
Set up and solve the weighted average formula for the portfolio
r=8.4%r = 8.4\%.
Using 6(12)+4(1.25r)+5r15=10.4\frac{6(12) + 4(1.25r) + 5r}{15} = 10.4, we get 72+10r=15672 + 10r = 156, leading to 10r=8410r = 84.
4
Calculate the targeted return for Bonds
Return of Bonds = 10.5%10.5\%.
Multiplying 1.251.25 by 8.48.4 yields 10.510.5.

Anahtar Kavram

Combining multiple ratios to establish weighted average component weights and solving multi-variable weighted average equations
Tahmini Süre:2m 30s
Soru 45Soru

A logistics company recorded the daily number of deliveries made by each of its 8 delivery vans on a given day. Each van completed a distinct positive integer number of deliveries. The arithmetic mean of the number of deliveries made by the 8 vans was 25, the median was 24, and the range was 18. If MM represents the maximum number of deliveries completed by any single van that day, what is the maximum possible value of MM?

Cevabı ve açıklamayı göster

Cevap: 37

Cevap

The maximum possible value of MM is 37.
To maximize the largest element M=x8M = x_8, we express MM in terms of the smallest element x1x_1 using the range: M=x1+18M = x_1 + 18. Thus, maximizing MM is equivalent to maximizing x1x_1. Testing x1=20x_1 = 20 forces the minimal possible sum of the 8 distinct terms to be 20+21+22+23+25+26+27+38=20220 + 21 + 22 + 23 + 25 + 26 + 27 + 38 = 202, which exceeds the required sum of 200. Testing x1=19x_1 = 19 allows a minimal sum of 198, which can be adjusted to 200 by setting the set to {19,20,21,23,25,26,29,37}\{19, 20, 21, 23, 25, 26, 29, 37\}. Thus, the maximum possible value of MM is 19+18=3719 + 18 = 37.

Adım Adım Çözüm

1
Formulate the algebraic equations from the statistical properties given.
Sum of 8 terms = 8×25=2008 \times 25 = 200; x4+x5=48x_4 + x_5 = 48; x8=x1+18=Mx_8 = x_1 + 18 = M.
Mean gives total sum, even number of items gives median as average of 4th and 5th terms, and range links the maximum and minimum values.
2
Relate maximizing the maximum term MM to maximizing the minimum term x1x_1.
Maximizing M=x1+18M = x_1 + 18 requires making x1x_1 as large as possible.
Since the range is fixed at 18, MM increases directly as x1x_1 increases.
3
Test x1=20x_1 = 20 to determine feasibility.
Minimum possible sum for x1=20x_1 = 20 is 20+21+22+23+25+26+27+38=202>20020 + 21 + 22 + 23 + 25 + 26 + 27 + 38 = 202 > 200, which is invalid.
Distinct integer constraints force x423x_4 \ge 23; since x4+x5=48x_4 + x_5 = 48 and x4<x5x_4 < x_5, x4x_4 must be 23 and x5x_5 must be 25, forcing all lower bounds up.
4
Test x1=19x_1 = 19 to confirm feasibility and construct a valid set.
The valid set {19,20,21,23,25,26,29,37}\{19, 20, 21, 23, 25, 26, 29, 37\} meets all criteria with a sum of 200.
The minimal sum for x1=19x_1 = 19 is 198, leaving headroom to increase x7x_7 to 29 to reach the sum of 200.

Anahtar Kavram

Optimization of Extreme Values in Finite Ordered Sets using Mean, Median, and Range
Soru 46Soru

A corporation has three regional branches: Branch X, Branch Y, and Branch Z. The ratio of the number of employees in Branch X to Branch Y is 1:31 : 3. The average monthly salary of employees in Branch Y is 40%40\% higher than the average monthly salary of employees in Branch X. Branch Z has twice as many employees as Branch Y, and the average monthly salary of employees in Branch Z is x%x\% lower than the combined average monthly salary of employees in Branches X and Y. If the overall average monthly salary across all three branches combined is $910\$910, and the average monthly salary in Branch X is $1000\$1{}000, what is the value of xx?

Cevabı ve açıklamayı göster

Cevap: 50

Cevap

50
The combined average salary of Branches X and Y is calculated by weighting Branch X's salary ($1000\$1{}000) with 1 unit of weight and Branch Y's salary ($1400\$1{}400) with 3 units of weight, giving 1000+42004=$1300\frac{1{}000 + 4{}200}{4} = \$1{}300. For the entire company of 1010 units of employees with an average salary of $910\$910, the total payroll is 10×910=$910010 \times 910 = \$9{}100. Subtracting the combined payroll of Branches X and Y ($5200\$5{}200) leaves $3900\$3{}900 for Branch Z's 66 units of employees. Thus, Branch Z's average salary is 39006=$650\frac{3{}900}{6} = \$650. Comparing $650\$650 to $1300\$1{}300 gives a percentage decrease of 13006501300×100%=50%\frac{1{}300 - 650}{1{}300} \times 100\% = 50\%.

Adım Adım Çözüm

1
Determine the average monthly salary of Branch Y.
Branch Y average salary = 1000×1.40=$14001{}000 \times 1.40 = \$1{}400.
Branch Y's average salary is given as 40%40\% higher than Branch X's average salary of $1000\$1{}000.
2
Express employee counts in terms of a single variable nn.
Branch X has nn employees, Branch Y has 3n3n employees, and Branch Z has 2×3n=6n2 \times 3n = 6n employees. Total employees = n+3n+6n=10nn + 3n + 6n = 10n.
The ratio of Branch X to Branch Y employees is 1:31:3, and Branch Z has twice as many employees as Branch Y.
3
Calculate the combined average salary of Branches X and Y.
Combined average salary SXY=n(1000)+3n(1400)n+3n=5200n4n=$1300S_{XY} = \frac{n(1{}000) + 3n(1{}400)}{n + 3n} = \frac{5{}200n}{4n} = \$1{}300.
The combined average of two sets is total combined earnings divided by total combined size.
4
Calculate total company payroll and determine Branch Z's average salary.
Total payroll = 10n×910=9100n10n \times 910 = 9{}100n. Branch Z payroll = 9100n5200n=3900n9{}100n - 5{}200n = 3{}900n. Average salary for Branch Z SZ=3900n6n=$650S_Z = \frac{3{}900n}{6n} = \$650.
Total payroll is total employees times overall mean. Subtracting the combined payroll of X and Y yields Branch Z's payroll.
5
Compute the percentage by which Branch Z's average salary is lower than the combined average salary of Branches X and Y.
x = \frac{1{}300 - 650}{1{}300} \times 100\% = 50\%.
Percentage decrease is calculated as (Base Value - New Value) / Base Value.

Anahtar Kavram

Weighted Averages of Combined Sets
Tahmini Süre:2m 0s
Soru 47Soru

A data set consists of 99 positive integers. The set has a unique mode of 1414, a median of 1212, and an arithmetic mean of 1111. If the range of the data set is 1010, what is the maximum possible value of the largest integer in the set?

Cevabı ve açıklamayı göster

Cevap: 1616

Cevap

The maximum possible value of the largest integer in the set is 1616.
The correct answer states that the maximum possible value is 1616. By ordering the 99 terms x1x2x9x_1 \le x_2 \le \dots \le x_9, the sum of all terms must equal 9999, with median x5=12x_5 = 12 and x9=x1+10x_9 = x_1 + 10. If x9=16x_9 = 16, then x1=6x_1 = 6, and we can construct a valid set {6,6,8,9,12,14,14,14,16}\{6, 6, 8, 9, 12, 14, 14, 14, 16\} where 1414 is the unique mode appearing 33 times. Trying a larger value such as 1717 forces x1=7x_1 = 7, which makes it impossible to maintain 1414 as the unique mode without violating the total sum of 9999.

Adım Adım Çözüm

1
Express the total sum and set structure using ordered variables.
Let the 99 positive integers in non-decreasing order be x1x2x3x4x5x6x7x8x9x_1 \le x_2 \le x_3 \le x_4 \le x_5 \le x_6 \le x_7 \le x_8 \le x_9. The total sum is 9×11=999 \times 11 = 99. The median is x5=12x_5 = 12. The range is x9x1=10    x9=x1+10x_9 - x_1 = 10 \implies x_9 = x_1 + 10.
Establishing the position of the median and the exact sum provides structural bounds for maximizing x9x_9.
2
Analyze the frequency requirements for the unique mode.
Since 14>1214 > 12 (the median), the number 1414 must lie in the upper half of the set (x6,x7,x8,x9x_6, x_7, x_8, x_9). To be a unique mode, 1414 must appear at least twice. If x9=16x_9 = 16, then x1=6x_1 = 6.
Maximizing x9x_9 is equivalent to maximizing x1x_1, so we test the largest possible values for x1x_1 and verify the uniqueness of the mode 1414.
3
Evaluate x1=7x_1 = 7 (which would give x9=17x_9 = 17).
If x1=7x_1 = 7, then x9=17x_9 = 17. The sum equation becomes 7+x2+x3+x4+12+x6+x7+x8+17=99    x2+x3+x4+x6+x7+x8=637 + x_2 + x_3 + x_4 + 12 + x_6 + x_7 + x_8 + 17 = 99 \implies x_2 + x_3 + x_4 + x_6 + x_7 + x_8 = 63. Since x2,x3,x47x_2, x_3, x_4 \ge 7 and x6,x7,x812x_6, x_7, x_8 \ge 12, achieving this sum while keeping 1414 as the unique mode is impossible (it would require 77 to appear 44 times, making 77 the mode instead of 1414). Thus, x9x_9 cannot be 1717 or greater.
Testing x9=17x_9 = 17 shows a violation of the unique mode condition.
4
Construct a valid set for x1=6x_1 = 6 (giving x9=16x_9 = 16).
If x1=6x_1 = 6 and x9=16x_9 = 16, consider the set {6,6,8,9,12,14,14,14,16}\{6, 6, 8, 9, 12, 14, 14, 14, 16\}. Sum = 6+6+8+9+12+14+14+14+16=996+6+8+9+12+14+14+14+16 = 99. Median = 1212. Unique mode = 1414 (frequency 33). Range = 166=1016 - 6 = 10. All conditions are satisfied.
Constructing an explicit valid data set proves that 1616 is attainable and is the maximum.

Anahtar Kavram

Maximizing elements in a constrained discrete data set using mean, median, mode, and range properties
Soru 48Soru

The table below shows the distribution of scores achieved by 5050 candidates on a professional certification assessment:

ScoreNumber of Candidates
606044
70701111
80802020
90901010
10010055

What is the interquartile range (IQR) of the assessment scores?

Cevabı ve açıklamayı göster

Cevap: 2020

Cevap

The interquartile range of the assessment scores is 2020.
To find the interquartile range (IQR), first find Q1Q_1 (25th25\text{th} percentile) and Q3Q_3 (75th75\text{th} percentile). With 5050 total candidates, Q1Q_1 is situated around position 12.512.5, which falls into the score of 7070. Q3Q_3 is situated around position 37.537.5, which falls into the score of 9090. Subtracting Q1Q_1 from Q3Q_3 yields 9070=2090 - 70 = 20.

Adım Adım Çözüm

1
Calculate the cumulative frequency distribution to find score positions.
Score 6060: candidates 11 to 44; Score 7070: candidates 55 to 1515; Score 8080: candidates 1616 to 3535; Score 9090: candidates 3636 to 4545; Score 100100: candidates 4646 to 5050. Total N=50N = 50.
Cumulative frequencies identify the precise position of ranked scores.
2
Determine the first quartile (Q1Q_1), which represents the 25th25\text{th} percentile.
The 25th25\text{th} percentile corresponds to the 0.25×50=12.5th0.25 \times 50 = 12.5\text{th} position. Looking at the cumulative frequencies, candidate positions 55 through 1515 all scored 7070, so Q1=70Q_1 = 70.
The first quartile marks the score boundary below which 25%25\% of the dataset falls.
3
Determine the third quartile (Q3Q_3), which represents the 75th75\text{th} percentile.
The 75th75\text{th} percentile corresponds to the 0.75×50=37.5th0.75 \times 50 = 37.5\text{th} position. Candidate positions 3636 through 4545 all scored 9090, so Q3=90Q_3 = 90.
The third quartile marks the score boundary below which 75%75\% of the dataset falls.
4
Compute the interquartile range (IQR=Q3Q1)(\text{IQR} = Q_3 - Q_1).
\text{IQR} = 90 - 70 = 20.
The interquartile range measures the spread of the middle 50%50\% of the distribution.

Anahtar Kavram

Interquartile Range (IQR) and Quartile Positions in Frequency Distributions
Soru 49Soru
A software quality team tracked the number of bug tickets resolved daily over a period of 1515 consecutive workdays. The recorded number of resolved tickets for the first 1414 days, listed in ascending order, were: 2,3,3,4,5,5,6,7,8,9,9,10,11,122, 3, 3, 4, 5, 5, 6, 7, 8, 9, 9, 10, 11, 12 If the number of tickets resolved on the 15th15\text{th} day was xx, and the arithmetic mean of the complete 1515-day data set is equal to its median, what is the value of xx?
Cevabı ve açıklamayı göster

Cevap: 1111

Cevap

The value of xx is 1111.
Summing the initial 14 numbers yields 94. In a set of 15 numbers, the median is the 8th term when ordered. Because there are exactly 7 terms smaller than 7 in the initial list, any value of x7x \ge 7 keeps 7 at the 8th position, making the median 7. Setting the mean 94+x15\frac{94+x}{15} equal to 7 gives 94+x=10594 + x = 105, which leads to x=11x = 11.

Adım Adım Çözüm

1
Calculate the sum of the known 14 values.
Sum14=2+3+3+4+5+5+6+7+8+9+9+10+11+12=94\text{Sum}_{14} = 2 + 3 + 3 + 4 + 5 + 5 + 6 + 7 + 8 + 9 + 9 + 10 + 11 + 12 = 94.
The sum of all 15 terms will be 94+x94 + x, making the arithmetic mean 94+x15\frac{94 + x}{15}.
2
Determine the position of the median in a 15-element set.
The median of an odd-numbered set with N=15N = 15 is the 15+12=8th\frac{15+1}{2} = 8\text{th} term when arranged in ascending order.
To set the mean equal to the median, we must determine how xx affects the 8th term.
3
Analyze the position of the 8th term based on potential values of xx.
The first 14 numbers contain 7 values less than 7 (2,3,3,4,5,5,62, 3, 3, 4, 5, 5, 6) and 7 values greater than or equal to 7 (7,8,9,9,10,11,127, 8, 9, 9, 10, 11, 12). Therefore, for any x7x \ge 7, the 8th term in the sorted set of 15 numbers is fixed at 77.
Since 7 values are strictly less than 7, placing x7x \ge 7 ensures that 7 is the 8th smallest value.
4
Set the arithmetic mean equal to the median (77) and solve for xx.
\frac{94 + x}{15} = 7 \implies 94 + x = 105 \implies x = 11.
Since x=117x = 11 \ge 7, the condition holds and the median remains 7.

Anahtar Kavram

Properties of Mean and Median in a Data Set
Soru 50Soru

Data Set AA consists of nn numbers with mean μ\mu and standard deviation σ\sigma, where σ>0\sigma > 0. Data Set BB is created by transforming each element xx in Data Set AA into y=52xy = 5 - 2x. If the variance of Data Set BB is equal to kk, which of the following expressions represents the standard deviation of Data Set AA in terms of kk?

Cevabı ve açıklamayı göster

Cevap: k2\frac{\sqrt{k}}{2}

Cevap

k2\frac{\sqrt{k}}{2}
Under a linear transformation y=ax+by = ax + b, constant shifts do not change data dispersion, while multiplying elements by aa scales the standard deviation by a|a| and the variance by a2a^2. Here, y=2x+5y = -2x + 5, so a=2a = -2. The variance of Data Set BB is Var(B)=(2)2Var(A)=4σ2\text{Var}(B) = (-2)^2 \cdot \text{Var}(A) = 4\sigma^2. Given Var(B)=k\text{Var}(B) = k, we get 4σ2=k4\sigma^2 = k, which leads to σ2=k4\sigma^2 = \frac{k}{4}. Taking the positive square root yields σ=k2\sigma = \frac{\sqrt{k}}{2}.

Adım Adım Çözüm

1
Analyze the linear transformation rule for standard deviation and variance.
For y=ax+by = ax + b, SD(y)=aSD(x)\text{SD}(y) = |a| \cdot \text{SD}(x) and Var(y)=a2Var(x)\text{Var}(y) = a^2 \cdot \text{Var}(x).
Adding a constant bb shifts all data points equally without altering dispersion, while multiplying by aa scales distance from the mean by a|a|.
2
Apply the transformation y=2x+5y = -2x + 5 to find the variance of Data Set BB in terms of σ\sigma.
\text{Var}(B) = (-2)^2 \cdot \text{Var}(A) = 4\sigma^2.
The coefficient of xx is a=2a = -2, so variance scales by a2=(2)2=4a^2 = (-2)^2 = 4.
3
Set the variance equal to kk and solve for the standard deviation σ\sigma of Data Set AA.
4\sigma^2 = k \implies \sigma^2 = \frac{k}{4} \implies \sigma = \frac{\sqrt{k}}{2}.
Standard deviation is strictly non-negative (σ>0\sigma > 0), requiring the positive square root.

Anahtar Kavram

Linear Transformation of Dispersion Measures
Tahmini Süre:2m 0s
Soru 51Soru

In a dataset of NN distinct values arranged in ascending order, the pthp\text{th} percentile is defined as the value at position p100×N\left\lceil \frac{p}{100} \times N \right\rceil.

Initially, a dataset contains 100100 distinct test scores. The 40th40\text{th} percentile score is S1S_1 and the 70th70\text{th} percentile score is S2S_2. A researcher adds xx new scores that are strictly less than S1S_1, and yy new scores that are strictly between S1S_1 and S2S_2, where xx and yy are positive integers.

If the 40th40\text{th} percentile score of the expanded dataset remains S1S_1 and the 70th70\text{th} percentile score of the expanded dataset remains S2S_2, what is the maximum possible value of x+yx + y?

Cevabı ve açıklamayı göster

Cevap: 33

Cevap

The maximum possible value of x+yx + y is 33.
The correct choice is 33. By setting up the percentile rank equations using the ceiling function, the position of S1S_1 in the expanded dataset requires 0.4(x+y)=x\lceil 0.4(x + y) \rceil = x, while the position of S2S_2 requires 0.7(x+y)=x+y\lceil 0.7(x + y) \rceil = x + y. Letting k=x+yk = x + y, the ceiling condition 0.7k=k\lceil 0.7k \rceil = k implies k1<0.7kkk - 1 < 0.7k \le k, which simplifies to 0.3k<10.3k < 1 or k<3.33k < 3.33. Since xx and yy are positive integers, kk can take integer values of 22 or 33. Thus, the maximum possible value of x+yx + y is 33.

Adım Adım Çözüm

1
Determine the initial rank positions of S1S_1 and S2S_2 in the 100-element dataset.
Position of S1=0.40×100=40S_1 = \lceil 0.40 \times 100 \rceil = 40; Position of S2=0.70×100=70S_2 = \lceil 0.70 \times 100 \rceil = 70.
Applying the given percentile formula to N=100N = 100 gives the exact index of each score in ascending order.
2
Express the new rank positions of S1S_1 and S2S_2 after inserting xx scores below S1S_1 and yy scores between S1S_1 and S2S_2.
In the new dataset of size 100+x+y100 + x + y, S1S_1 is at position 40+x40 + x and S2S_2 is at position 70+x+y70 + x + y.
Adding xx scores less than S1S_1 shifts S1S_1's rank by xx. Adding yy scores between S1S_1 and S2S_2 further shifts S2S_2's rank by x+yx + y relative to its original position.
3
Formulate the percentile conditions for the expanded dataset of size M=100+x+yM = 100 + x + y.
For S1S_1: 0.40(100+x+y)=40+x    0.4(x+y)=x\lceil 0.40(100 + x + y) \rceil = 40 + x \implies \lceil 0.4(x + y) \rceil = x.
For S2S_2: 0.70(100+x+y)=70+x+y    0.7(x+y)=x+y\lceil 0.70(100 + x + y) \rceil = 70 + x + y \implies \lceil 0.7(x + y) \rceil = x + y.
The percentile rank of S1S_1 must equal its new position 40+x40 + x, and the percentile rank of S2S_2 must equal its new position 70+x+y70 + x + y.
4
Solve for the total added elements k=x+yk = x + y.
From 0.7k=k\lceil 0.7k \rceil = k, we get k1<0.7kkk - 1 < 0.7k \le k, which simplifies to 0.3k<1    k<1033.330.3k < 1 \implies k < \frac{10}{3} \approx 3.33.
By definition of the ceiling function, z=k    k1<zk\lceil z \rceil = k \iff k - 1 < z \le k for integer kk.
5
Evaluate integer solutions for k=x+yk = x + y given x,y1x, y \ge 1.
For k=2k = 2: x=0.4(2)=1x = \lceil 0.4(2) \rceil = 1, y=1y = 1 (valid).
For k=3k = 3: x=0.4(3)=2x = \lceil 0.4(3) \rceil = 2, y=1y = 1 (valid).
The maximum integer value for k=x+yk = x + y is 33.
Since xx and yy are positive integers, k2k \ge 2. The maximum integer k<3.33k < 3.33 is 33.

Anahtar Kavram

Percentile Rank and Indexing with Ceiling Functions
Tahmini Süre:2m 30s
Soru 52Soru

A market research study examined the streaming service subscriptions of 250250 households. Every surveyed household subscribes to at least one of three streaming services: Service X, Service Y, or Service Z.

- 130130 households subscribe to Service X.
- 110110 households subscribe to Service Y.
- 120120 households subscribe to Service Z.
- 4040 households subscribe to both Service X and Service Y.
- 3535 households subscribe to both Service Y and Service Z.
- 4545 households subscribe to both Service X and Service Z.

How many households subscribe to all three streaming services?

Cevabı ve açıklamayı göster

Cevap: 10

Cevap

10 households subscribe to all three streaming services.
According to the Principle of Inclusion-Exclusion for three sets, XYZ=X+Y+Z(XY+YZ+XZ)+XYZ|X \cup Y \cup Z| = |X| + |Y| + |Z| - (|X \cap Y| + |Y \cap Z| + |X \cap Z|) + |X \cap Y \cap Z|. Since every household subscribes to at least one service, XYZ=250|X \cup Y \cup Z| = 250. Substituting the values yields 250=130+110+120(40+35+45)+XYZ250 = 130 + 110 + 120 - (40 + 35 + 45) + |X \cap Y \cap Z|, which simplifies to 250=240+XYZ250 = 240 + |X \cap Y \cap Z|. Solving for XYZ|X \cap Y \cap Z| gives 1010.

Adım Adım Çözüm

1
Set up the Inclusion-Exclusion formula for three overlapping sets
Total = |X| + |Y| + |Z| - (|X ∩ Y| + |Y ∩ Z| + |X ∩ Z|) + |X ∩ Y ∩ Z|
Because every household subscribes to at least one service, the total number of households equals the union of all three sets.
2
Sum the individual set sizes and the pairwise intersection sizes
Sum of individual sets = 130 + 110 + 120 = 360; Sum of pairwise intersections = 40 + 35 + 45 = 120
Aggregating individual and overlapping counts simplifies substitution.
3
Substitute the values into the formula and solve for the intersection of all three sets
250 = 360 - 120 + |X ∩ Y ∩ Z| => 250 = 240 + |X ∩ Y ∩ Z| => |X ∩ Y ∩ Z| = 10
Subtracting 240 from 250 yields the exact count of households subscribing to all three services.

Anahtar Kavram

Inclusion-Exclusion Principle for Three Sets
Tahmini Süre:1m 30s
Soru 53Soru

A data set consists of five positive integers a,b,c,d,a, b, c, d, and ee, written in non-decreasing order (abcdea \le b \le c \le d \le e). The set has a unique mode of 88, a median of 1010, and an arithmetic mean of 1212. If the range of the set is 1414, what is the value of the largest integer ee?

Cevabı ve açıklamayı göster

Cevap: 22

Cevap

22
The median of a 5-element ordered set is the middle element, so c=10c = 10. Because 8 is the unique mode and is strictly less than 10, the first two numbers must both be 8 (a=8,b=8a = 8, b = 8). The range is 14, meaning the difference between the maximum element ee and the minimum element aa is 14. Therefore, e=8+14=22e = 8 + 14 = 22.

Adım Adım Çözüm

1
Determine the median value cc
c=10c = 10
In an ordered 5-element set, the median is the 3rd element.
2
Determine the values of aa and bb using the unique mode
a=8a = 8 and b=8b = 8
Since 8 is the unique mode and 8<108 < 10, 8 must appear at least twice in the first two positions.
3
Calculate the largest integer ee using the given range
e=a+14=8+14=22e = a + 14 = 8 + 14 = 22
The range of a set is the difference between the maximum (ee) and minimum (aa) values.
4
Verify consistency with the mean
Sum =5×12=60= 5 \times 12 = 60; d=60(8+8+10+22)=12d = 60 - (8 + 8 + 10 + 22) = 12, which satisfies 10122210 \le 12 \le 22.
Ensures all set conditions (mean of 12, non-decreasing order, unique mode) are satisfied.

Anahtar Kavram

Relating Mean, Median, Mode, and Range in Ordered Data Sets
Soru 54Soru

A panel of 150150 sommeliers evaluated three vintages of wine: Cabernet, Pinot Noir, and Syrah. Every sommelier rated at least one vintage as Exceptional. Overall, 7979 sommeliers rated Cabernet as Exceptional, 7171 rated Pinot Noir as Exceptional, and 8484 rated Syrah as Exceptional. Exactly 1818 sommeliers rated all three vintages as Exceptional, and exactly 2727 rated ONLY Cabernet as Exceptional. If the total number of sommeliers who rated BOTH Cabernet and Pinot Noir as Exceptional is twice the number of sommeliers who rated ONLY Pinot Noir and Syrah as Exceptional, how many sommeliers rated ONLY Cabernet and Syrah as Exceptional?

Cevabı ve açıklamayı göster

Cevap: 24

Cevap

24
Applying the 3-set Inclusion-Exclusion Principle determines that 4848 sommeliers rated exactly two vintages. Combining the Cabernet set total (7979) with the given ONLY Cabernet count (2727) establishes that cp+cs=34cp + cs = 34. Substituting cp=2ps18cp = 2ps - 18 into these two relationships forms a system of linear equations (3ps+cs=663ps + cs = 66 and 2ps+cs=522ps + cs = 52). Solving this system yields ps=14ps = 14 and cs=24cs = 24 sommeliers who rated ONLY Cabernet and Syrah as Exceptional.

Adım Adım Çözüm

1
Calculate the sum of all pairwise set overlaps using the Inclusion-Exclusion Principle.
CP+PS+CS=102|C \cap P| + |P \cap S| + |C \cap S| = 102
The total union is equal to the sum of individual set sizes minus the sum of pairwise intersections plus the three-set intersection.
2
Determine the sum of regions representing sommeliers who rated exactly two vintages.
cp+ps+cs=48cp + ps + cs = 48
Each pairwise intersection consists of an 'exactly two' region plus the 'all three' region (1818). Subtracting 3×18=543 \times 18 = 54 from 102102 leaves 4848.
3
Set up linear equations using the given ratio and Cabernet set total.
3ps+cs=663ps + cs = 66 and 2ps+cs=522ps + cs = 52
Expressing cp=2ps18cp = 2ps - 18 and substituting it into cp+ps+cs=48cp + ps + cs = 48 gives the first equation; substituting into the Cabernet total 27+cp+cs+18=7927 + cp + cs + 18 = 79 gives the second equation.
4
Solve the system of equations for the target region cscs.
ps=14ps = 14 and cs=24cs = 24
Subtracting the two equations yields ps=14ps = 14, and substituting back gives cs=24cs = 24.

Anahtar Kavram

Three-set Venn diagram algebraic modeling and inclusion-exclusion principle
Soru 55Soru

In a university computer science department, students belong to one of three groups: Undergraduates, Master's students, or Doctoral candidates. The ratio of the number of Undergraduates to Master's students is 3:23 : 2, and the ratio of the number of Master's students to Doctoral candidates is 4:14 : 1. The average number of weekly research hours is 66 hours for Undergraduates and 1414 hours for Master's students. If the combined average number of weekly research hours across all three groups is 1111 hours, what is the average number of weekly research hours for a Doctoral candidate?

Cevabı ve açıklamayı göster

Cevap: 29

Cevap

The average number of weekly research hours for a Doctoral candidate is 29 hours.
To find the average weekly research hours for Doctoral candidates, first combine the group ratios. Given U:M=3:2U : M = 3 : 2 and M:D=4:1M : D = 4 : 1, scale U:MU : M to 6:46 : 4 so that the MM term is identical in both ratios. This yields a single combined ratio U:M:D=6:4:1U : M : D = 6 : 4 : 1, giving a total of 6+4+1=116 + 4 + 1 = 11 equal parts.

Next, calculate the total research hours across all parts: 6(6)+4(14)+1(x)=36+56+x=92+x6(6) + 4(14) + 1(x) = 36 + 56 + x = 92 + x. Setting the overall weighted average to 1111 yields 92+x11=11\frac{92 + x}{11} = 11, which simplifies to 92+x=12192 + x = 121, so x=29x = 29.

Adım Adım Çözüm

1
Determine the combined ratio of students across the three groups.
Undergraduates : Master's : Doctoral = 6:4:16 : 4 : 1.
We are given U:M=3:2U : M = 3 : 2 and M:D=4:1M : D = 4 : 1. To combine these into a single ratio U:M:DU : M : D, scale U:MU : M by multiplying by 22 so that the MM term matches: U:M=6:4U : M = 6 : 4. Thus, U:M:D=6:4:1U : M : D = 6 : 4 : 1.
2
Express total students and total research hours in terms of a multiplier kk.
Total students = 11k11k; Total hours = 36k+56k+kx=92k+kx36k + 56k + kx = 92k + kx.
Let the number of students be U=6kU = 6k, M=4kM = 4k, and D=1kD = 1k. The total research hours contributed by Undergraduates is 6k×6=36k6k \times 6 = 36k, by Master's students is 4k×14=56k4k \times 14 = 56k, and by Doctoral candidates is 1k×x=kx1k \times x = kx.
3
Set up the weighted average formula and solve for xx.
x=29x = 29.
The combined average is given by Total HoursTotal Students=11\frac{\text{Total Hours}}{\text{Total Students}} = 11. Substituting our values gives 92k+kx11k=11    92+x11=11    92+x=121    x=29\frac{92k + kx}{11k} = 11 \implies \frac{92 + x}{11} = 11 \implies 92 + x = 121 \implies x = 29.

Anahtar Kavram

Weighted Average and Combined Sets with Compound Ratios
Tahmini Süre:2m 0s
Soru 56Soru

A commercial airline conducted a fleet audit of 180180 transoceanic aircraft to evaluate their emergency navigation systems: Satellite Positioning (SS), Inertial Guidance (II), and Terrestrial Radio Navigation (TT). The audit revealed the following data:
- 9595 aircraft are equipped with Satellite Positioning.
- 8080 aircraft are equipped with Inertial Guidance.
- 7575 aircraft are equipped with Terrestrial Radio Navigation.
- 3030 aircraft are equipped with Satellite Positioning and Inertial Guidance, but not Terrestrial Radio Navigation.
- 2020 aircraft are equipped with Inertial Guidance and Terrestrial Radio Navigation, but not Satellite Positioning.
- 2525 aircraft are equipped with Satellite Positioning and Terrestrial Radio Navigation, but not Inertial Guidance.
- 1515 aircraft are not equipped with any of these three navigation systems.

How many aircraft in the fleet are equipped with exactly one of these three navigation systems?

Cevabı ve açıklamayı göster

Cevap: 8585

Cevap

The number of aircraft equipped with exactly one navigation system is 8585.
Subtracting the 1515 unequipped aircraft from the total fleet of 180180 gives 165165 aircraft equipped with at least one navigation system. Letting xx represent the number of aircraft with all three systems, the single-system counts are (953025x)=40x(95 - 30 - 25 - x) = 40 - x for Satellite Positioning only, (803020x)=30x(80 - 30 - 20 - x) = 30 - x for Inertial Guidance only, and (752520x)=30x(75 - 25 - 20 - x) = 30 - x for Terrestrial Radio Navigation only. Summing all seven mutually exclusive regions yields (40x)+(30x)+(30x)+30+20+25+x=165(40 - x) + (30 - x) + (30 - x) + 30 + 20 + 25 + x = 165, which simplifies to 1752x=165175 - 2x = 165, giving x=5x = 5. Substituting x=5x = 5 into the single-system expressions gives 35+25+25=8535 + 25 + 25 = 85.

Adım Adım Çözüm

1
Calculate the total number of aircraft equipped with at least one system.
18015=165180 - 15 = 165 aircraft.
Subtracting the 1515 aircraft with no systems from the fleet total gives the union of sets SS, II, and TT.
2
Express the regions of the 3-set Venn diagram in terms of xx, where xx is the number of aircraft equipped with all three systems.
Only S=40xS = 40 - x, Only I=30xI = 30 - x, Only T=30xT = 30 - x.
For set SS: 95(30+25+x)=40x95 - (30 + 25 + x) = 40 - x. For set II: 80(30+20+x)=30x80 - (30 + 20 + x) = 30 - x. For set TT: 75(25+20+x)=30x75 - (25 + 20 + x) = 30 - x.
3
Set up an equation for the total number of aircraft with at least one system to solve for xx.
(40x)+(30x)+(30x)+30+20+25+x=165    1752x=165    x=5(40 - x) + (30 - x) + (30 - x) + 30 + 20 + 25 + x = 165 \implies 175 - 2x = 165 \implies x = 5.
Summing all 77 non-overlapping regions inside the Venn diagram equals the total union of 165165.
4
Compute the sum of aircraft equipped with exactly one system.
(Only SS) + (Only II) + (Only TT) = (405)+(305)+(305)=35+25+25=85(40 - 5) + (30 - 5) + (30 - 5) = 35 + 25 + 25 = 85.
Substitute x=5x = 5 into each of the single-system region expressions.

Anahtar Kavram

Three-Set Inclusion-Exclusion Principle and Venn Diagram Region Decomposition
Tahmini Süre:2m 0s
Soru 57Soru

A financial advisory board of 66 members is to be selected from a pool of 66 senior analysts and 55 junior analysts. The board must include at least 22 senior analysts and at least 22 junior analysts. However, two specific senior analysts, AA and BB, cannot both serve on the board together. How many different 66-member boards can be formed under these conditions?

Cevabı ve açıklamayı göster

Cevap: 320

Cevap

The total number of valid 6-member boards that can be formed is 320.
To find the number of valid boards, we first calculate all possible 6-member boards satisfying the minimum criteria of having at least 2 senior analysts and at least 2 junior analysts. The possible (senior, junior) distributions are (4,2), (3,3), and (2,4). Calculating each case gives (64)(52)=150\binom{6}{4}\binom{5}{2} = 150, (63)(53)=200\binom{6}{3}\binom{5}{3} = 200, and (62)(54)=75\binom{6}{2}\binom{5}{4} = 75, for a total of 150+200+75=425150 + 200 + 75 = 425 boards. Next, we determine how many of these boards contain both senior analysts A and B. Fixing A and B requires choosing 4 more members from the remaining 4 seniors and 5 juniors such that the total junior count is at least 2. The valid remaining senior choices ss' are 0, 1, or 2, yielding (40)(54)=5\binom{4}{0}\binom{5}{4} = 5, (41)(53)=40\binom{4}{1}\binom{5}{3} = 40, and (42)(52)=60\binom{4}{2}\binom{5}{2} = 60, totaling 5+40+60=1055 + 40 + 60 = 105 boards. Subtracting these forbidden boards from 425 yields 425105=320425 - 105 = 320.

Adım Adım Çözüm

1
Calculate total valid boards with at least 2 senior analysts and at least 2 junior analysts without restriction on A and B.
Total valid boards without conflict constraint = 425
The valid (Senior, Junior) distributions for a 6-member board are (4,2), (3,3), and (2,4). Their combinations are (64)(52)=150\binom{6}{4}\binom{5}{2} = 150, (63)(53)=200\binom{6}{3}\binom{5}{3} = 200, and (62)(54)=75\binom{6}{2}\binom{5}{4} = 75, giving 150+200+75=425150 + 200 + 75 = 425.
2
Calculate the number of valid boards that contain BOTH senior analysts A and B.
Number of invalid boards containing both A and B = 105
If A and B are both selected, 2 senior spots are fixed. We need 4 remaining members from the remaining 4 seniors and 5 juniors. To satisfy the junior constraint (at least 2 juniors), the additional senior count ss' can be 0, 1, or 2: s=0    (40)(54)=5s'=0 \implies \binom{4}{0}\binom{5}{4}=5, s=1    (41)(53)=40s'=1 \implies \binom{4}{1}\binom{5}{3}=40, s=2    (42)(52)=60s'=2 \implies \binom{4}{2}\binom{5}{2}=60. Summing gives 5+40+60=1055 + 40 + 60 = 105.
3
Subtract the conflicting boards containing both A and B from the total valid boards.
Valid boards = 425 - 105 = 320
Complementary counting gives the exact number of boards satisfying all conditions.

Anahtar Kavram

Combinations with Subgroup Constraints and Complementary Counting
Tahmini Süre:2m 0s
Soru 58Soru

A data set consists of seven integers written in ascending order: 10,12,15,x,26,29,3410, 12, 15, x, 26, 29, 34. If the arithmetic mean of the data set is equal to its median, what is the value of xx?

Cevabı ve açıklamayı göster

Cevap: 2121

Cevap

The value of xx is 2121.
In an ordered set of seven numbers, the median is the 4th number, which is xx. The arithmetic mean of the seven numbers is 10+12+15+x+26+29+347=126+x7\frac{10 + 12 + 15 + x + 26 + 29 + 34}{7} = \frac{126 + x}{7}. Equating the mean to the median gives 126+x7=x\frac{126 + x}{7} = x. Solving this linear equation yields 126+x=7x    6x=126    x=21126 + x = 7x \implies 6x = 126 \implies x = 21. Since 2121 lies between 1515 and 2626, it maintains the ascending order of the set.

Adım Adım Çözüm

1
Identify the median of the ordered set
Median = xx
For an ordered set with an odd number of elements (n=7n = 7), the median is the middle element, which is the 7+12=4\frac{7 + 1}{2} = 4 th element. Since the elements are in ascending order, the 4th element is xx.
2
Calculate the sum of all elements in terms of xx
Sum = 126+x126 + x
The sum of the known six numbers is 10+12+15+26+29+34=12610 + 12 + 15 + 26 + 29 + 34 = 126. Adding xx gives a total sum of 126+x126 + x.
3
Set up the equation equating mean and median
126+x7=x\frac{126 + x}{7} = x
The arithmetic mean is defined as the total sum divided by the total number of elements (77). We are given that Mean = Median.
4
Solve for xx and verify ordering bounds
x = 21
Multiplying both sides by 77 gives 126+x=7x126 + x = 7x, so 6x=1266x = 126, yielding x=21x = 21. Checking the ascending order condition 15x2615 \le x \le 26, 2121 satisfies the condition 15212615 \le 21 \le 26.

Anahtar Kavram

Mean and Median of an Ordered Set
Tahmini Süre:1m 30s
Soru 59Soru

A 5-digit passcode is to be created using five distinct digits chosen from the set {1,2,3,4,5,6,7}\{1, 2, 3, 4, 5, 6, 7\}. The passcode must include both the digit 33 and the digit 55, and the digit 33 must appear somewhere to the left of the digit 55 in the passcode. How many such 5-digit passcodes can be formed?

Cevabı ve açıklamayı göster

Cevap: 600

Cevap

600
To form a valid passcode, first select 3 digits from the 5 available digits {1,2,4,6,7}\{1, 2, 4, 6, 7\}, which can be done in (53)=10\binom{5}{3} = 10 ways. Each chosen set of 5 distinct digits (including 3 and 5) can be arranged in 5!=1205! = 120 ways. Because the digits 3 and 5 are distinct, the digit 3 appears before the digit 5 in exactly half of these arrangements (120/2=60120 / 2 = 60). Multiplying the 10 combinations of digits by the 60 valid arrangements gives a total of 600600 valid passcodes.

Adım Adım Çözüm

1
Determine the number of ways to choose the remaining digits.
(53)=10\binom{5}{3} = 10 ways to choose 3 additional digits from {1,2,4,6,7}\{1, 2, 4, 6, 7\}.
Since the passcode must contain both 3 and 5, 3 additional distinct digits must be selected from the 5 available remaining digits.
2
Calculate the total permutations of the 5 chosen digits.
5!=1205! = 120 total permutations.
Any set of 5 distinct digits can be arranged into a 5-digit sequence in 5!5! ways.
3
Apply the positional restriction using symmetry.
1202=60\frac{120}{2} = 60 valid arrangements per set of digits.
In exactly half of all permutations containing both 3 and 5, the digit 3 appears before the digit 5.
4
Compute the total number of valid passcodes.
10×60=60010 \times 60 = 600 passcodes.
Multiply the number of digit selections by the number of valid orderings per selection.

Anahtar Kavram

Combining selection (combinations) with symmetry-restricted arrangements (permutations)
Tahmini Süre:2m 0s
Soru 60Soru

A security system generates 4-digit passcodes using distinct digits selected from the set {1,2,3,4,5,6,7}\{1, 2, 3, 4, 5, 6, 7\}. How many different 4-digit passcodes can be formed if the first digit must be odd and the last digit must be even?

Cevabı ve açıklamayı göster

Cevap: 240

Cevap

240
To form a valid passcode under the given constraints, we analyze each position step-by-step. The first digit has 4 possible choices (odd numbers: 1, 3, 5, 7), and the fourth digit has 3 possible choices (even numbers: 2, 4, 6). Since the problem specifies that the digits in the passcode must be distinct, choosing the first and last digits consumes 2 of the 7 available digits, leaving 5 digits for the second position and 4 digits for the third position. Applying the Fundamental Counting Principle gives a total of 4×5×4×3=2404 \times 5 \times 4 \times 3 = 240 unique passcodes.

Adım Adım Çözüm

1
Determine choices for the first digit
4 choices
The set contains 4 odd digits: 1, 3, 5, and 7.
2
Determine choices for the fourth (last) digit
3 choices
The set contains 3 even digits: 2, 4, and 6.
3
Determine choices for the second and third digits
5 choices for the second digit, 4 choices for the third digit
All digits in the passcode must be distinct. Having used 2 digits for the first and last positions, 5 digits remain out of 7 for the second slot, and 4 digits remain for the third slot.
4
Apply the Fundamental Counting Principle
4 × 5 × 4 × 3 = 240
Multiply the number of available options for each position to find the total number of distinct passcodes.

Anahtar Kavram

Permutations with Position Restrictions
ÖncekiSayfa 3 / 4Sonraki