Tüm alıştırma soruları

13931 soru

Soru 12861Soru

In a biological survey of invertebrate excretory mechanisms, four organisms (I, II, III, and IV) were observed to possess the following primary excretory organs:

- Organism I: Flame cells (protonephridia)
- Organism II: Nephridia
- Organism III: Malpighian tubules
- Organism IV: Antennal (green) glands

Which of the following correctly identifies organisms I, II, III, and IV respectively?

Cevabı ve açıklamayı göster

Cevap: I: Planarian, II: Earthworm, III: Cockroach, IV: Prawn

Cevap

Organism I is a planarian, Organism II is an earthworm, Organism III is a cockroach, and Organism IV is a prawn.
Flame cells function in flatworms (Planarian), nephridia function in annelids (Earthworm), Malpighian tubules function in insects (Cockroach), and green glands function in crustaceans (Prawn). Therefore, the correct combination lists these four organisms in that specific sequence.

Adım Adım Çözüm

1
Identify the organism group corresponding to Organism I
Flame cells (protonephridia) are characteristic of flatworms (Platyhelminthes, such as planarians).
Flame cells serve as simple excretory structures that propel waste fluids through cilia.
2
Identify the organism group corresponding to Organism II
Nephridia are characteristic excretory structures of annelids (such as earthworms).
Nephridia filter coelomic fluid and reabsorb essential nutrients in segmented worms.
3
Identify the organism groups corresponding to Organisms III and IV
Malpighian tubules are found in terrestrial arthropods like insects (cockroaches), whereas antennal (green) glands are found in crustaceans (prawns).
Different arthropod subphyla feature specialized structures tailored to terrestrial water conservation or aquatic ion balance.

Anahtar Kavram

Comparative anatomy of invertebrate excretory structures across major phyla.
Soru 12862Soru

A rectangular coil consisting of 5050 turns of wire has dimensions of 0.10 m0.10\text{ m} by 0.05 m0.05\text{ m} and carries a steady electric current of 2.0 A2.0\text{ A}. The coil is suspended in a uniform magnetic field of flux density 0.40 T0.40\text{ T}. If the normal to the plane of the coil makes an angle of 3030^\circ with the direction of the magnetic field, what is the magnitude of the torque exerted on the coil?

Cevabı ve açıklamayı göster

Cevap: 0.10 Nm0.10\text{ N}\cdot\text{m}

Cevap

The magnitude of the torque exerted on the coil is 0.10 Nm0.10\text{ N}\cdot\text{m}.
The magnitude of torque on a current-carrying coil situated in a uniform magnetic field is given by τ=NIABsinθ\tau = N I A B \sin\theta, where θ\theta is the angle between the normal vector of the coil and the magnetic field vector. Substituting N=50N = 50, I=2.0 AI = 2.0\text{ A}, A=0.005 m2A = 0.005\text{ m}^2, B=0.40 TB = 0.40\text{ T}, and θ=30\theta = 30^\circ yields τ=50×2.0×0.005×0.40×0.5=0.10 Nm\tau = 50 \times 2.0 \times 0.005 \times 0.40 \times 0.5 = 0.10\text{ N}\cdot\text{m}.

Adım Adım Çözüm

1
Calculate the area AA of the rectangular coil.
A=length×width=0.10 m×0.05 m=0.005 m2A = \text{length} \times \text{width} = 0.10\text{ m} \times 0.05\text{ m} = 0.005\text{ m}^2
The torque on a coil depends on its total surface area.
2
Identify the given values and formula for magnetic torque.
Formula: τ=NIABsinθ\tau = N I A B \sin\theta, where N=50N = 50, I=2.0 AI = 2.0\text{ A}, A=0.005 m2A = 0.005\text{ m}^2, B=0.40 TB = 0.40\text{ T}, and θ=30\theta = 30^\circ.
When θ\theta is measured relative to the normal of the coil's plane, the sine component determines the effective perpendicular force arm.
3
Substitute the values into the formula and solve for torque τ\tau.
τ=50×2.0 A×0.005 m2×0.40 T×sin30=100×0.002×0.5=0.10 Nm\tau = 50 \times 2.0\text{ A} \times 0.005\text{ m}^2 \times 0.40\text{ T} \times \sin 30^\circ = 100 \times 0.002 \times 0.5 = 0.10\text{ N}\cdot\text{m}
Direct evaluation yields the final magnetic torque.

Anahtar Kavram

Torque on a Current-Carrying Loop in a Uniform Magnetic Field
Tahmini Süre:1m 30s
Soru 12863Soru

A mixture of 15 cm315\text{ cm}^3 of ethene (C2H4C_2H_4) and 50 cm350\text{ cm}^3 of oxygen gas was exploded at constant temperature and pressure. If the resulting mixture was cooled to room temperature, what is the total volume of the residual gas in cm3\text{cm}^3?

Cevabı ve açıklamayı göster

Cevap: 35

Cevap

35 cm³
According to Gay-Lussac's Law, 15 cm315\text{ cm}^3 of ethene reacts with 45 cm345\text{ cm}^3 of oxygen to produce 30 cm330\text{ cm}^3 of carbon(IV) oxide gas. Since 50 cm350\text{ cm}^3 of oxygen was initially present, 5 cm35\text{ cm}^3 of unreacted oxygen gas remains. Upon cooling to room temperature, water condenses to liquid, leaving a total residual gaseous volume of 5 cm3+30 cm3=35 cm35\text{ cm}^3 + 30\text{ cm}^3 = 35\text{ cm}^3.

Adım Adım Çözüm

1
Write the balanced equation for the complete combustion of ethene gas.
C2H4(g)+3O2(g)2CO2(g)+2H2O(l)C_2H_4(g) + 3O_2(g) \rightarrow 2CO_2(g) + 2H_2O(l)
By Gay-Lussac's Law of Combining Volumes, gases react in simple whole-number volume ratios equal to their stoichiometric coefficients at constant temperature and pressure.
2
Determine the volume of oxygen required and the unreacted excess volume.
Volume of O2O_2 consumed = 3×15 cm3=45 cm33 \times 15\text{ cm}^3 = 45\text{ cm}^3. Remaining unreacted O2=50 cm345 cm3=5 cm3O_2 = 50\text{ cm}^3 - 45\text{ cm}^3 = 5\text{ cm}^3.
Since 15 cm315\text{ cm}^3 of C2H4C_2H_4 requires only 45 cm345\text{ cm}^3 of O2O_2, oxygen is in excess and ethene is the limiting reactant.
3
Calculate the volume of carbon(IV) oxide gas produced.
Volume of CO2CO_2 produced = 2×15 cm3=30 cm32 \times 15\text{ cm}^3 = 30\text{ cm}^3.
1 volume of C2H4C_2H_4 produces 2 volumes of CO2CO_2 gas.
4
Calculate the total volume of the residual gaseous mixture after cooling to room temperature.
Total residual gaseous volume = 5 cm3 (excess O2)+30 cm3 (produced CO2)=35 cm35\text{ cm}^3 \text{ (excess } O_2\text{)} + 30\text{ cm}^3 \text{ (produced } CO_2\text{)} = 35\text{ cm}^3.
Water formed is in the liquid state at room temperature and contributes negligible volume to the gaseous mixture.

Anahtar Kavram

Gay-Lussac's Law of Combining Volumes and Residual Gas Volume Calculations
Tahmini Süre:1m 30s
Soru 12864Soru

Match each physical analytical observation of a chemical sample with its corresponding interpretation regarding purity.

Soldaki öğeye tıklayın, sonra eşleşen sağdaki öğeye tıklayın

Öğeler

A solid sample exhibits a sharp melting point at exactly 156.5C156.5^\circ\text{C}.
A solid sample melts over a broad temperature range of 142.0C142.0^\circ\text{C} to 150.5C150.5^\circ\text{C}.
A liquid sample boils at a steady temperature higher than the literature value of the pure solvent.
Paper chromatography of a dye sample produces a single spot under varied solvent systems.

Eşleşmeler

Cevabı ve açıklamayı göster

Cevap

1. Solid with a sharp melting point at 156.5C156.5^\circ\text{C} matches 'Confirms the sample is a pure crystalline compound'.
2. Solid melting over 142.0C142.0^\circ\text{C} to 150.5C150.5^\circ\text{C} matches 'Indicates the presence of impurities that depress and broaden the melting point'.
3. Liquid boiling at a steady temperature higher than literature value matches 'Indicates the presence of a non-volatile dissolved impurity in the liquid'.
4. Single spot on paper chromatography matches 'Demonstrates chemical homogeneity and single-component composition'.
Pure compounds exhibit constant physical properties such as sharp melting points, constant boiling points, and single chromatographic spots. Impurities alter lattice stability and vapor pressure, leading to melting point depression, boiling point elevation, and broad temperature transition ranges.

Adım Adım Çözüm

1
Analyze solid sample melting characteristics
A sharp melting point indicates high purity, while a broad melting range below the expected temperature indicates contamination.
Impurities disrupt the orderly crystal lattice, requiring less thermal energy to melt and causing melting across a range of temperatures.
2
Analyze liquid boiling point behavior
Boiling point elevation at constant pressure signifies a non-volatile solute dissolved in the liquid.
Solute particles reduce the escaping tendency of liquid molecules into the vapor phase, requiring a higher temperature to match atmospheric pressure.
3
Evaluate chromatographic criteria
A pure substance contains only one chemical species and produces a single chromatogram spot.
If multiple components were present, differing partition coefficients would separate them into multiple spots.

Anahtar Kavram

Criteria of Purity for Substances
Soru 12865Soru

A trapped gas sample has a volume of 4.0 dm34.0\text{ dm}^3 at a pressure of 570 mmHg570\text{ mmHg} under isothermal conditions. If the pressure is altered to 1.5 atm1.5\text{ atm}, what is the final volume occupied by the gas? (1 atm=760 mmHg1\text{ atm} = 760\text{ mmHg})

Cevabı ve açıklamayı göster

Cevap: 2.0 dm32.0\text{ dm}^3

Cevap

The final volume occupied by the gas is 2.0 dm32.0\text{ dm}^3.
According to Boyle's Law, the pressure and volume of a fixed mass of gas at constant temperature are inversely proportional (P1V1=P2V2P_1 V_1 = P_2 V_2). First, convert 570 mmHg570\text{ mmHg} into atmospheres: 570760=0.75 atm\frac{570}{760} = 0.75\text{ atm}. Substituting the values gives 0.75 atm×4.0 dm3=1.5 atm×V20.75\text{ atm} \times 4.0\text{ dm}^3 = 1.5\text{ atm} \times V_2, which yields V2=2.0 dm3V_2 = 2.0\text{ dm}^3.

Adım Adım Çözüm

1
Convert the initial pressure P1P_1 from mmHg\text{mmHg} to atm\text{atm} to match the unit of P2P_2.
P1=570 mmHg760 mmHg/atm=0.75 atmP_1 = \frac{570\text{ mmHg}}{760\text{ mmHg/atm}} = 0.75\text{ atm}
Units of pressure must be consistent before substituting into gas law equations.
2
Apply Boyle's Law formula for an isothermal process (P1V1=P2V2P_1 V_1 = P_2 V_2).
0.75 atm×4.0 dm3=1.5 atm×V20.75\text{ atm} \times 4.0\text{ dm}^3 = 1.5\text{ atm} \times V_2
Boyle's Law states that for a fixed mass of gas at constant temperature, pressure and volume are inversely proportional.
3
Solve the algebraic equation for the final volume V2V_2.
V2=0.75×4.01.5=2.0 dm3V_2 = \frac{0.75 \times 4.0}{1.5} = 2.0\text{ dm}^3
Dividing both sides by 1.5 atm1.5\text{ atm} isolates the unknown final volume.

Anahtar Kavram

Boyle's Law (P1V1=P2V2P_1 V_1 = P_2 V_2 at constant temperature)
Tahmini Süre:2m 0s
Soru 12866Soru

Comparative biochemical analysis shows that organisms with a more recent common evolutionary ancestor possess a higher degree of similarity in the amino acid sequences of conserved proteins like Cytochrome c, irrespective of their modern geographic locations.

Cevabı ve açıklamayı göster

Cevap: True

Cevap

The statement is TRUE.
The statement accurately reflects the principles of comparative biochemistry: the degree of amino acid sequence similarity in universally conserved proteins directly indicates how recently two species shared a common ancestor, regardless of where those species are located today.

Adım Adım Çözüm

1
Identify the biological role of conserved proteins in comparative biochemistry.
Proteins such as Cytochrome c perform essential respiratory functions across diverse taxa, making them reliable indicators of phylogenetic ancestry.
Because these proteins exist across virtually all eukaryotic life, their sequences can be directly compared to gauge evolutionary relationships.
2
Relate sequence divergence to time since common ancestry.
Fewer amino acid differences correspond to a shorter time elapsed since divergence from a shared ancestor.
Genetic mutations alter protein sequences incrementally over time, acting as a molecular clock.
3
Assess the effect of geography on biochemical sequence similarity.
Molecular similarity reflects evolutionary lineage rather than geographic proximity or ecological habitat.
While geography influences speciation and external adaptation, primary biochemical sequences strictly track ancestral genetic inheritance.

Anahtar Kavram

Comparative Biochemistry and Molecular Homology
Tahmini Süre:1m 0s
Soru 12867Soru

Calculate the thermal energy, in joules, required to completely melt 0.50 kg0.50\text{ kg} of ice at its melting point of 0C0^\circ\text{C}. (Take the specific latent heat of fusion of ice as 3.36×105 J kg13.36 \times 10^5\text{ J kg}^{-1}).

Cevabı ve açıklamayı göster

Cevap: 168000

Cevap

The total heat required to completely melt the ice is 168,000 J168,000\text{ J}.
During a state change from solid to liquid at constant temperature, the thermal energy absorbed is given directly by Q=mLfQ = m L_f. Multiplying mass (0.50 kg0.50\text{ kg}) by specific latent heat (3.36×105 J kg13.36 \times 10^5\text{ J kg}^{-1}) gives 168,000 J168,000\text{ J}.

Adım Adım Çözüm

1
Identify the given values and formula
Mass m=0.50 kgm = 0.50\text{ kg}, Specific latent heat of fusion Lf=3.36×105 J kg1L_f = 3.36 \times 10^5\text{ J kg}^{-1}, Formula: Q=mLfQ = m L_f
Since the phase change occurs at constant temperature (0C0^\circ\text{C}), sensible heat calculation (mcΔTmc\Delta T) is zero and only latent heat is needed.
2
Substitute values into the formula and calculate
Q=0.50 kg×3.36×105 J kg1=168,000 JQ = 0.50\text{ kg} \times 3.36 \times 10^5\text{ J kg}^{-1} = 168,000\text{ J}
Direct multiplication of mass and specific latent heat yields the energy required in Joules.

Anahtar Kavram

Specific Latent Heat of Fusion
Soru 12868Soru

A series alternating current (AC) circuit consists of a resistor of resistance R=40 ΩR = 40\ \Omega, an inductor with inductive reactance XL=70 ΩX_L = 70\ \Omega, and a capacitor with capacitive reactance XC=40 ΩX_C = 40\ \Omega, connected to an AC voltage supply of 100 V100\ \text{V}. What is the power factor of the circuit?

Cevabı ve açıklamayı göster

Cevap: 0.8

Cevap

The power factor of the circuit is 0.8.
The total impedance ZZ of the series circuit is found using Z=R2+(XLXC)2=402+(7040)2=50 ΩZ = \sqrt{R^2 + (X_L - X_C)^2} = \sqrt{40^2 + (70 - 40)^2} = 50\ \Omega. The power factor is the ratio of resistance to impedance: cosϕ=RZ=4050=0.8\cos\phi = \frac{R}{Z} = \frac{40}{50} = 0.8.

Adım Adım Çözüm

1
Calculate the net reactance of the circuit.
X=XLXC=70 Ω40 Ω=30 ΩX = X_L - X_C = 70\ \Omega - 40\ \Omega = 30\ \Omega
In a series RLC circuit, the net reactance is the arithmetic difference between the inductive reactance and the capacitive reactance.
2
Calculate the total impedance of the circuit.
Z=R2+(XLXC)2=402+302=2500=50 ΩZ = \sqrt{R^2 + (X_L - X_C)^2} = \sqrt{40^2 + 30^2} = \sqrt{2500} = 50\ \Omega
Impedance represents the combined opposition to current flow from resistance and net reactance in quadrature.
3
Determine the power factor of the circuit.
cosϕ=RZ=4050=0.8\cos\phi = \frac{R}{Z} = \frac{40}{50} = 0.8
The power factor is equal to the cosine of the phase angle, which is defined as the ratio of resistance to total impedance.

Anahtar Kavram

Power Factor in AC Circuits
Tahmini Süre:1m 30s
Soru 12869Soru

Match each carbon species or bond descriptor on the left with its corresponding hybridization state, geometric configuration, or orbital overlap mode on the right.

Soldaki öğeye tıklayın, sonra eşleşen sağdaki öğeye tıklayın

Öğeler

Central carbon in methane (CH4\text{CH}_4)
Carbon-carbon double bond π\pi component
Central carbon in carbon dioxide (CO2\text{CO}_2)
Carbon atom in ethene (C2H4\text{C}_2\text{H}_4)

Eşleşmeler

Cevabı ve açıklamayı göster

Cevap

The central carbon in methane matches sp3sp^3 hybridization with tetrahedral geometry (109.5109.5^\circ); the π\pi bond component matches sideways overlap of unhybridized pp orbitals; the central carbon in carbon dioxide matches spsp hybridization with linear geometry (180180^\circ); and the carbon in ethene matches sp2sp^2 hybridization with trigonal planar geometry (120120^\circ).
Each carbon atom's hybridization and spatial arrangement depend directly on its steric number (number of σ\sigma bonds). Methane features four σ\sigma bonds (sp3sp^3, 109.5109.5^\circ tetrahedral). Ethene features three σ\sigma bonds per carbon (sp2sp^2, 120120^\circ trigonal planar). Carbon dioxide features two σ\sigma bonds (spsp, 180180^\circ linear). Π\Pi bonds are characterized by the sideways overlap of unhybridized 2p2p atomic orbitals.

Adım Adım Çözüm

1
Determine the steric number and geometry of the carbon in methane (CH4\text{CH}_4).
Four single σ\sigma bonds give a steric number of 4, which dictates sp3sp^3 hybridization and a tetrahedral angle of 109.5109.5^\circ.
Mixing one ss and three pp orbitals forms four equivalent sp3sp^3 hybrid orbitals pointing to tetrahedral corners.
2
Identify how a carbon-carbon π\pi bond is formed.
It forms via lateral/sideways overlap of parallel, unhybridized pp orbitals above and below the internuclear axis.
Head-on overlap forms σ\sigma bonds, whereas parallel side-by-side overlap creates π\pi electron clouds.
3
Analyze the steric environment around the carbon in carbon dioxide (CO2\text{CO}_2).
The carbon forms two σ\sigma bonds (one to each oxygen atom) and two π\pi bonds, yielding a steric number of 2, corresponding to spsp hybridization and 180180^\circ linear geometry.
Two hybrid orbitals position themselves as far apart as possible at 180180^\circ.
4
Determine the hybridization and bond angles of carbon in ethene (C2H4\text{C}_2\text{H}_4).
Each carbon atom forms three σ\sigma bonds (steric number 3), requiring sp2sp^2 hybridization with a trigonal planar shape and 120120^\circ bond angles.
Three hybrid orbitals lie in a single plane separated by 120120^\circ.

Anahtar Kavram

Carbon Hybridization, Geometry, and Orbital Overlap
Soru 12870Soru

An electric generator supplies power to a workshop through transmission lines having a total resistance of 2Ω2\,\Omega. The workshop operates electrical equipment drawing a power of 4kW4\,\text{kW} at a terminal voltage of 200V200\,\text{V}. What is the total power generated by the generator?

Cevabı ve açıklamayı göster

Cevap: 4.8kW4.8\,\text{kW}

Cevap

The total power generated by the generator is 4.8kW4.8\,\text{kW}.
The electrical current flowing through the system is 20A20\,\text{A} based on the load power of 4000W4000\,\text{W} at 200V200\,\text{V}. The power lost in transmission lines is P=I2R=202×2=800WP = I^2 R = 20^2 \times 2 = 800\,\text{W} (0.8kW0.8\,\text{kW}). Therefore, the total electrical power generated by the source must be the sum of the load power and line losses, giving 4.0kW+0.8kW=4.8kW4.0\,\text{kW} + 0.8\,\text{kW} = 4.8\,\text{kW}.

Adım Adım Çözüm

1
Calculate the current flowing through the circuit using the power and voltage at the workshop.
I=PworkshopV=4000W200V=20AI = \frac{P_{\text{workshop}}}{V} = \frac{4000\,\text{W}}{200\,\text{V}} = 20\,\text{A}
Current is uniform across the series transmission line.
2
Calculate the power loss dissipated as heat in the transmission lines.
Ploss=I2R=(20A)2×2Ω=400×2=800W=0.8kWP_{\text{loss}} = I^2 R = (20\,\text{A})^2 \times 2\,\Omega = 400 \times 2 = 800\,\text{W} = 0.8\,\text{kW}
By Joule's law of heating, power dissipated in a resistor carrying current II is I2RI^2 R.
3
Sum the useful power delivered to the workshop and the transmission power loss to obtain total generated power.
Ptotal=Pworkshop+Ploss=4.0kW+0.8kW=4.8kWP_{\text{total}} = P_{\text{workshop}} + P_{\text{loss}} = 4.0\,\text{kW} + 0.8\,\text{kW} = 4.8\,\text{kW}
Total energy generated per unit time equals energy consumed by load plus energy lost.

Anahtar Kavram

Power Loss in Transmission Lines and Total Source Power
Soru 12871Soru

A proton of mass 1.67×1027 kg1.67 \times 10^{-27}\text{ kg} and charge 1.60×1019 C1.60 \times 10^{-19}\text{ C} enters a uniform magnetic field of flux density 0.50 T0.50\text{ T} at a speed of 4.00×106 m s14.00 \times 10^6\text{ m s}^{-1}. If the path of the proton makes an angle of 3030^\circ with the magnetic field lines, what is the magnitude of the initial acceleration of the proton?

Cevabı ve açıklamayı göster

Cevap: 9.58×1013 m s29.58 \times 10^{13}\text{ m s}^{-2}

Cevap

The magnitude of the initial acceleration of the proton is 9.58×1013 m s29.58 \times 10^{13}\text{ m s}^{-2}.
The magnetic force on a moving charged particle is given by F=qvBsinθF = qvB\sin\theta. Substituting q=1.60×1019 Cq = 1.60 \times 10^{-19}\text{ C}, v=4.00×106 m s1v = 4.00 \times 10^6\text{ m s}^{-1}, B=0.50 TB = 0.50\text{ T}, and θ=30\theta = 30^\circ gives F=1.60×1013 NF = 1.60 \times 10^{-13}\text{ N}. By Newton's second law, acceleration a=Fm=1.60×1013 N1.67×1027 kg=9.58×1013 m s2a = \frac{F}{m} = \frac{1.60 \times 10^{-13}\text{ N}}{1.67 \times 10^{-27}\text{ kg}} = 9.58 \times 10^{13}\text{ m s}^{-2}.

Adım Adım Çözüm

1
Calculate the magnetic force acting on the proton using F=qvBsinθF = qvB\sin\theta.
F=(1.60×1019 C)×(4.00×106 m s1)×(0.50 T)×sin30=1.60×1013 NF = (1.60 \times 10^{-19}\text{ C}) \times (4.00 \times 10^6\text{ m s}^{-1}) \times (0.50\text{ T}) \times \sin 30^\circ = 1.60 \times 10^{-13}\text{ N}.
The magnetic force on a moving charge in a magnetic field depends on the component of velocity perpendicular to the field.
2
Apply Newton's second law of motion (F=maF = ma) to find acceleration.
a=Fm=1.60×1013 N1.67×1027 kg9.58×1013 m s2a = \frac{F}{m} = \frac{1.60 \times 10^{-13}\text{ N}}{1.67 \times 10^{-27}\text{ kg}} \approx 9.58 \times 10^{13}\text{ m s}^{-2}.
Dividing the magnetic force by the mass yields the magnitude of the resulting acceleration.

Anahtar Kavram

Magnetic force on a moving charged particle and Newton's second law
Soru 12872Soru

A body of mass 0.50 kg0.50\text{ kg} connected to a light helical spring of force constant 32 N/m32\text{ N/m} executes simple harmonic motion on a smooth horizontal surface. If the total mechanical energy of the oscillating system is 0.16 J0.16\text{ J}, what is the maximum speed of the body in m/s\text{m/s}?

Cevabı ve açıklamayı göster

Cevap: 0.8

Cevap

The maximum speed of the body is 0.8 m/s0.8\text{ m/s}.
The total mechanical energy in simple harmonic motion is equal to the maximum kinetic energy at the equilibrium position: E=12mvmax2E = \frac{1}{2} m v_{\text{max}}^2. Substituting E=0.16 JE = 0.16\text{ J} and m=0.50 kgm = 0.50\text{ kg} yields 0.16=0.25vmax20.16 = 0.25 v_{\text{max}}^2, so vmax2=0.64v_{\text{max}}^2 = 0.64 and vmax=0.8 m/sv_{\text{max}} = 0.8\text{ m/s}.

Adım Adım Çözüm

1
Relate total energy to maximum kinetic energy
E=12mvmax2E = \frac{1}{2} m v_{\text{max}}^2
At the equilibrium position, potential energy is zero and total mechanical energy is entirely kinetic.
2
Substitute given values into the equation
0.16=12(0.50)vmax20.16 = \frac{1}{2} (0.50) v_{\text{max}}^2
Mass m=0.50 kgm = 0.50\text{ kg} and total energy E=0.16 JE = 0.16\text{ J} are provided.
3
Solve for the maximum speed
vmax=2×0.160.50=0.64=0.8 m/sv_{\text{max}} = \sqrt{\frac{2 \times 0.16}{0.50}} = \sqrt{0.64} = 0.8\text{ m/s}
Solving for vmaxv_{\text{max}} gives 0.8 m/s0.8\text{ m/s}.

Anahtar Kavram

Conservation of Energy in Simple Harmonic Motion
Soru 12873Soru

An object is placed 24 cm24\text{ cm} in front of a concave mirror with a focal length of 8 cm8\text{ cm}. What is the distance of the image from the mirror in cm\text{cm}?

Cevabı ve açıklamayı göster

Cevap: 12

Cevap

The distance of the image from the mirror is 12 cm12\text{ cm}.
Applying the spherical mirror formula 1f=1u+1v\frac{1}{f} = \frac{1}{u} + \frac{1}{v} with focal length f=8 cmf = 8\text{ cm} and object distance u=24 cmu = 24\text{ cm} yields 1v=18124=112\frac{1}{v} = \frac{1}{8} - \frac{1}{24} = \frac{1}{12}, giving an image distance of 12 cm12\text{ cm}.

Adım Adım Çözüm

1
Identify the given parameters and select the appropriate relation.
Focal length f=8 cmf = 8\text{ cm}, object distance u=24 cmu = 24\text{ cm}, using the mirror equation 1f=1u+1v\frac{1}{f} = \frac{1}{u} + \frac{1}{v}.
The mirror formula relates focal length, object distance, and image distance for spherical mirrors.
2
Substitute the given values into the formula and solve for 1v\frac{1}{v}.
\frac{1}{8} = \frac{1}{24} + \frac{1}{v} \implies \frac{1}{v} = \frac{1}{8} - \frac{1}{24} = \frac{3-1}{24} = \frac{2}{24} = \frac{1}{12}
Subtracting 124\frac{1}{24} from 18\frac{1}{8} isolates the reciprocal of the image distance.
3
Invert the result to determine the image distance vv.
v = 12\text{ cm}
Taking the reciprocal of 112\frac{1}{12} gives the image distance in centimeters.

Anahtar Kavram

Mirror Formula for Concave Mirrors
Tahmini Süre:45s
Soru 12874Soru

When dilute tetraoxosulfate(VI) acid (H2SO4H_2SO_4) reacts with zinc metal, hydrogen gas (H2H_2) is liberated. However, when concentrated trioxonitrate(V) acid (HNO3HNO_3) reacts with zinc metal, hydrogen gas is not evolved. Which property of concentrated trioxonitrate(V) acid accounts for this difference in behavior?

Cevabı ve açıklamayı göster

Cevap: Its strong oxidizing property, which oxidizes the evolved hydrogen to water

Cevap

Concentrated trioxonitrate(V) acid does not liberate hydrogen gas with zinc because of its strong oxidizing property, which oxidizes hydrogen to water.
Unlike typical mineral acids that liberate hydrogen gas when reacting with electropositive metals, concentrated trioxonitrate(V) acid (HNO3HNO_3) is a powerful oxidizing agent. It oxidizes hydrogen to water (H2OH_2O) as soon as it is produced, while the acid itself undergoes reduction to nitrogen dioxide (NO2NO_2).

Adım Adım Çözüm

1
Analyze the typical reaction of metals with dilute acids
Dilute acids such as H2SO4H_2SO_4 or HClHCl act as typical acids where reactive metals displace hydrogen: Zn(s)+H2SO4(aq)ZnSO4(aq)+H2(g)Zn_{(s)} + H_2SO_{4(aq)} \rightarrow ZnSO_{4(aq)} + H_{2(g)}.
This is a standard displacement reaction driven by hydrogen ion reduction.
2
Examine the behavior of concentrated trioxonitrate(V) acid (HNO3HNO_3)
Concentrated HNO3HNO_3 is a powerful oxidizing acid. Instead of releasing H2H_2 gas, any formed hydrogen is immediately oxidized to water (H2OH_2O), while HNO3HNO_3 is reduced to brown nitrogen dioxide gas (NO2NO_2).
The equation is: Zn(s)+4HNO3(aq)Zn(NO3)2(aq)+2NO2(g)+2H2O(l)Zn_{(s)} + 4HNO_{3(aq)} \rightarrow Zn(NO_3)_{2(aq)} + 2NO_{2(g)} + 2H_2O_{(l)}.
3
Identify the chemical property responsible
The absence of hydrogen gas is due to the strong oxidizing nature of concentrated HNO3HNO_3.
The acid acts primarily as an oxidizing agent rather than a simple proton donor.

Anahtar Kavram

Oxidizing property of trioxonitrate(V) acid
Soru 12875Soru

During a normal mammalian cardiac cycle, electrical excitation coordinates the synchronized contraction of the heart chambers. What is the correct sequence of electrical impulse propagation through the cardiac tissues starting from the initiation of the heartbeat?

Öğeleri doğru sıraya koymak için sürükleyin

Cevabı ve açıklamayı göster

Cevap

The correct sequence of cardiac conduction begins with depolarization at the sinoatrial (SA) node, followed by the spread of excitation across the atrial myocardium, a brief delay at the atrioventricular (AV) node, rapid signal conduction through the Bundle of His and Purkinje fibers, and finally contraction of the ventricular myocardium.
In the mammalian heart, the electrical signal originates spontaneously at the sinoatrial (SA) node in the right atrium. The impulse spreads across the atrial myocardium, causing atrial systole. It then reaches the atrioventricular (AV) node, where conduction is delayed to allow complete ventricular filling. From the AV node, the impulse travels rapidly through the Bundle of His and Purkinje fibers, causing coordinated contraction of the ventricular myocardium from the apex upward.

Adım Adım Çözüm

1
Identify the primary pacemaker site where the cardiac action potential originates.
The heartbeat starts at the sinoatrial (SA) node located in the right atrium wall.
The SA node possesses the intrinsic capability for spontaneous rhythm generation.
2
Trace the path of electrical excitation across the upper chambers.
The signal spreads through the muscle cells of both atria, causing atrial contraction.
Atrial muscle fibers are electrically connected via intercalated discs.
3
Determine the role and location of the secondary conducting node.
The signal reaches the atrioventricular (AV) node, where its transmission is momentarily delayed.
This delay ensures ventricular filling occurs prior to ventricular systole.
4
Follow the specialized rapid conducting pathway down the ventricles.
The signal travels down the Bundle of His and through Purkinje fibers in the ventricular walls.
Standard muscle conduction would be too slow to produce coordinated ventricular pumping.
5
Identify the final mechanical response of the lower chambers.
The ventricular myocardium depolarizes and contracts from the apex toward the base of the heart.
This upward squeezing motion efficiently ejects blood into the major arterial trunks.

Anahtar Kavram

Mammalian Cardiac Conduction Pathway
Soru 12876Soru

An electric heater rated at 500 W500\text{ W} is used to melt 0.20 kg0.20\text{ kg} of ice initially at 0C0^\circ\text{C} and heat the resulting water to 20C20^\circ\text{C}. Assuming no heat losses to the surroundings, what is the time required in seconds? (Specific latent heat of fusion of ice = 3.36×105 J kg13.36 \times 10^5\text{ J kg}^{-1}, specific heat capacity of water = 4.2×103 J kg1 K14.2 \times 10^3\text{ J kg}^{-1}\text{ K}^{-1})

Cevabı ve açıklamayı göster

Cevap: 168

Cevap

168 s
The total energy required is the sum of the heat required for melting (mLf=67,200 JmL_f = 67,200\text{ J}) and the heat required for warming the liquid (mcΔT=16,800 Jmc\Delta T = 16,800\text{ J}), giving 84,000 J84,000\text{ J}. Dividing this by the heater power rating of 500 W500\text{ W} gives 168 s168\text{ s}.

Adım Adım Çözüm

1
Calculate thermal energy needed to change phase from ice to water at 0C0^\circ\text{C}
Q1=mLf=0.20 kg×3.36×105 J kg1=67,200 JQ_1 = m L_f = 0.20\text{ kg} \times 3.36 \times 10^5\text{ J kg}^{-1} = 67,200\text{ J}
Latent heat of fusion accounts for phase change at constant temperature.
2
Calculate thermal energy needed to raise water temperature from 0C0^\circ\text{C} to 20C20^\circ\text{C}
Q2=mcΔT=0.20 kg×4.2×103 J kg1K1×20 K=16,800 JQ_2 = m c \Delta T = 0.20\text{ kg} \times 4.2 \times 10^3\text{ J kg}^{-1}\text{K}^{-1} \times 20\text{ K} = 16,800\text{ J}
Sensible heat increases kinetic energy of liquid water molecules.
3
Sum energy required for both phase change and temperature change
Qtotal=Q1+Q2=67,200 J+16,800 J=84,000 JQ_{\text{total}} = Q_1 + Q_2 = 67,200\text{ J} + 16,800\text{ J} = 84,000\text{ J}
Total energy is the sum of sensible heat and latent heat.
4
Calculate heating time using heater power rating
t=QtotalP=84,000 J500 W=168 st = \frac{Q_{\text{total}}}{P} = \frac{84,000\text{ J}}{500\text{ W}} = 168\text{ s}
Power is defined as energy transferred per unit time (P=QtP = \frac{Q}{t}).

Anahtar Kavram

Energy balance combining latent heat and sensible heat
Tahmini Süre:2m 0s
Soru 12877Soru
A mixture of 10 cm310\text{ cm}^3 of hydrogen sulfide (H2SH_2S) gas and 40 cm340\text{ cm}^3 of oxygen gas was sparked to react completely at constant temperature and pressure according to the equation:
2H2S(g)+3O2(g)2SO2(g)+2H2O(l)2H_2S(g) + 3O_2(g) \rightarrow 2SO_2(g) + 2H_2O(l)
Assuming the water formed condenses into liquid, what is the total volume of the residual gas mixture?
Cevabı ve açıklamayı göster

Cevap: 35 cm335\text{ cm}^3

Cevap

The total volume of the residual gas mixture is 35 cm335\text{ cm}^3.
According to Gay-Lussac's law, 2 cm32\text{ cm}^3 of H2SH_2S reacts with 3 cm33\text{ cm}^3 of O2O_2 to form 2 cm32\text{ cm}^3 of SO2SO_2 gas. Thus, 10 cm310\text{ cm}^3 of H2SH_2S consumes 15 cm315\text{ cm}^3 of O2O_2 and yields 10 cm310\text{ cm}^3 of SO2SO_2. The remaining excess O2O_2 is 40 cm315 cm3=25 cm340\text{ cm}^3 - 15\text{ cm}^3 = 25\text{ cm}^3. Combining the unreacted oxygen (25 cm325\text{ cm}^3) and produced sulfur(IV) oxide (10 cm310\text{ cm}^3) gives a total residual gas volume of 35 cm335\text{ cm}^3.

Adım Adım Çözüm

1
Determine the stoichiometric volume ratios from the balanced chemical equation
2 volumes of H2S(g)H_2S(g) react with 3 volumes of O2(g)O_2(g) to produce 2 volumes of SO2(g)SO_2(g).
According to Gay-Lussac's Law of Combining Volumes, gases react in simple whole-number volume ratios at constant temperature and pressure.
2
Calculate the volume of oxygen required to react with 10 cm310\text{ cm}^3 of H2SH_2S
Volume of O2O_2 used = 10 cm3×32=15 cm310\text{ cm}^3 \times \frac{3}{2} = 15\text{ cm}^3.
Since 10 cm310\text{ cm}^3 of H2SH_2S is available, it is the limiting reactant and requires 15 cm315\text{ cm}^3 of O2O_2.
3
Find the volume of unreacted excess oxygen
Unreacted O2=40 cm315 cm3=25 cm3O_2 = 40\text{ cm}^3 - 15\text{ cm}^3 = 25\text{ cm}^3.
Subtracting the reacted oxygen volume from the initial volume gives the excess.
4
Calculate the volume of gaseous SO2SO_2 produced
Volume of SO2=10 cm3×22=10 cm3SO_2 = 10\text{ cm}^3 \times \frac{2}{2} = 10\text{ cm}^3.
The mole ratio of H2SH_2S to SO2SO_2 is 2:22:2, so 10 cm310\text{ cm}^3 of H2SH_2S produces 10 cm310\text{ cm}^3 of SO2SO_2 gas. Water is liquid so its volume is neglected.
5
Calculate total residual gas volume
Total residual volume = 25 cm3 (excess O2)+10 cm3 (produced SO2)=35 cm325\text{ cm}^3 \text{ (excess } O_2) + 10\text{ cm}^3 \text{ (produced } SO_2) = 35\text{ cm}^3.
The residual gas consists of both unreacted excess reactant and gaseous product.

Anahtar Kavram

Gay-Lussac's Law of Combining Volumes
Soru 12878Soru

A student records the mass of a chemical sample using a digital balance as 0.02050 kg0.02050\text{ kg}. How many significant figures are contained in this measurement?

Cevabı ve açıklamayı göster

Cevap: 4

Cevap

4 significant figures
In the measurement 0.02050 kg0.02050\text{ kg}, the leading zeros (0.00.0) are placeholders and do not count as significant. The non-zero digits (22 and 55), the captive zero between them, and the trailing zero following the decimal point are all significant. This gives a total of four significant figures.

Adım Adım Çözüm

1
Identify and evaluate leading zeros in 0.02050 kg0.02050\text{ kg}.
The zeros before the digit '2' (0.00.0) are leading zeros.
Leading zeros serve only as decimal placeholders and are never significant.
2
Identify non-zero digits and zeros between non-zero digits.
The digits '2' and '5' are non-zero, and the zero between them is a captive zero.
All non-zero digits and zeros trapped between non-zero digits are always significant.
3
Evaluate the trailing zero.
The zero after '5' is a trailing zero in a decimal number.
Trailing zeros to the right of a decimal point indicate measurement precision and are significant.
4
Sum the total number of significant figures.
Digits '2', '0', '5', and '0' give a total of 4 significant figures.
Combining two non-zero digits, one captive zero, and one trailing decimal zero gives four significant figures.

Anahtar Kavram

Rules for counting significant figures in physical measurements
Tahmini Süre:45s
Soru 12879Soru

A simple pendulum on Earth (g=10 m/s2g = 10\text{ m/s}^2) completes 5050 full oscillations in 40 s40\text{ s}. The pendulum is then transferred to a lunar station where the acceleration due to gravity is 1.6 m/s21.6\text{ m/s}^2, and its length is reduced by 64%64\%. What is the time taken, in seconds, for this modified pendulum to complete 3030 oscillations on the lunar station?

Cevabı ve açıklamayı göster

Cevap: 36

Cevap

The time taken for the modified pendulum to complete 30 oscillations on the lunar station is 36 s.
The initial period on Earth is T1=4050=0.8 sT_1 = \frac{40}{50} = 0.8\text{ s}. The formula for the period of a simple pendulum is T=2πLgT = 2\pi\sqrt{\frac{L}{g}}. When length decreases by 64%64\%, the remaining length ratio is L2L1=0.36\frac{L_2}{L_1} = 0.36. The ratio of gravity is g1g2=101.6=6.25\frac{g_1}{g_2} = \frac{10}{1.6} = 6.25. Taking the ratio gives T2T1=0.36×6.25=2.25=1.5\frac{T_2}{T_1} = \sqrt{0.36 \times 6.25} = \sqrt{2.25} = 1.5. Thus, the new period is T2=1.5×0.8 s=1.2 sT_2 = 1.5 \times 0.8\text{ s} = 1.2\text{ s}. For 3030 oscillations, the total time is t=30×1.2 s=36 st = 30 \times 1.2\text{ s} = 36\text{ s}.

Adım Adım Çözüm

1
Calculate the initial period of oscillation on Earth
T1=0.8 sT_1 = 0.8\text{ s}
Period T1T_1 is total time divided by the number of oscillations: T1=40 s50=0.8 sT_1 = \frac{40\text{ s}}{50} = 0.8\text{ s}.
2
Set up the ratio for period under altered length and gravitational field
T2T1=1.5\frac{T_2}{T_1} = 1.5
Using T=2πLgT = 2\pi \sqrt{\frac{L}{g}}, we have T2T1=L2L1g1g2=(10.64)101.6=0.366.25=2.25=1.5\frac{T_2}{T_1} = \sqrt{\frac{L_2}{L_1} \cdot \frac{g_1}{g_2}} = \sqrt{(1 - 0.64) \cdot \frac{10}{1.6}} = \sqrt{0.36 \cdot 6.25} = \sqrt{2.25} = 1.5.
3
Determine the new period of oscillation
T2=1.2 sT_2 = 1.2\text{ s}
T2=1.5×T1=1.5×0.8 s=1.2 sT_2 = 1.5 \times T_1 = 1.5 \times 0.8\text{ s} = 1.2\text{ s}.
4
Calculate the total time required for 30 oscillations
t2=36 st_2 = 36\text{ s}
Total time t2=N2×T2=30×1.2 s=36 st_2 = N_2 \times T_2 = 30 \times 1.2\text{ s} = 36\text{ s}.

Anahtar Kavram

Period of a simple pendulum and its dependence on length and gravitational acceleration
Soru 12880Soru

In a nuclear fusion reaction, a lithium-6 nucleus (36Li{^{6}_{3}\text{Li}}) fuses with a deuterium nucleus (12H{^{2}_{1}\text{H}}) to form two alpha particles (24He{^{4}_{2}\text{He}}). Given the atomic masses of 36Li=6.0151 u{^{6}_{3}\text{Li}} = 6.0151\text{ u}, 12H=2.0141 u{^{2}_{1}\text{H}} = 2.0141\text{ u}, and 24He=4.0026 u{^{4}_{2}\text{He}} = 4.0026\text{ u}, and taking 1 u=931.5 MeV1\text{ u} = 931.5\text{ MeV}, what is the total energy released in this reaction in MeV\text{MeV}?

Cevabı ve açıklamayı göster

Cevap: 22.356

Cevap

The total energy released in the fusion reaction is 22.356 MeV.
The total mass before fusion (36Li+12H{^{6}_{3}\text{Li}} + {^{2}_{1}\text{H}}) is 8.0292 u8.0292\text{ u}, while the total mass after fusion (2×24He2 \times {^{4}_{2}\text{He}}) is 8.0052 u8.0052\text{ u}. The resulting mass defect is Δm=0.0240 u\Delta m = 0.0240\text{ u}. Multiplying this mass loss by 931.5 MeV/u931.5\text{ MeV/u} gives an energy release of 22.356 MeV22.356\text{ MeV}.

Adım Adım Çözüm

1
Calculate the total initial mass of the reactants
minitial=6.0151 u+2.0141 u=8.0292 um_{\text{initial}} = 6.0151\text{ u} + 2.0141\text{ u} = 8.0292\text{ u}
Add the rest masses of the lithium-6 nucleus and the deuterium nucleus together.
2
Calculate the total final mass of the products
mfinal=2×4.0026 u=8.0052 um_{\text{final}} = 2 \times 4.0026\text{ u} = 8.0052\text{ u}
The reaction produces two helium-4 nuclei (alpha particles), so multiply the mass of one alpha particle by 2.
3
Determine the mass defect
Δm=minitialmfinal=8.0292 u8.0052 u=0.0240 u\Delta m = m_{\text{initial}} - m_{\text{final}} = 8.0292\text{ u} - 8.0052\text{ u} = 0.0240\text{ u}
Subtract the final mass of products from the initial mass of reactants to find the mass lost.
4
Convert the mass defect into energy released
E=Δm×931.5 MeV/u=0.0240×931.5=22.356 MeVE = \Delta m \times 931.5\text{ MeV/u} = 0.0240 \times 931.5 = 22.356\text{ MeV}
Apply Einstein's mass-energy equivalence principle using the standard conversion factor 1 u=931.5 MeV1\text{ u} = 931.5\text{ MeV}.

Anahtar Kavram

Mass Defect and Energy Release in Nuclear Fusion Reactions
ÖncekiSayfa 644 / 697Sonraki
Tüm alıştırma soruları — JAMB UTME | Examkin