Statistics and Probability

158 soru

Soru 21Soru

The grouped frequency distribution table below shows the marks scored by 100100 candidates in a Mathematics screening test:

Class IntervalFrequency
101910 - 1915
202920 - 2925
303930 - 3940
404940 - 4920

Match each data representation component on the left with its correct calculated numerical value on the right.

Soldaki öğeye tıklayın, sonra eşleşen sağdaki öğeye tıklayın

Öğeler

Sector angle representing the modal class in a pie chart
Frequency density of the modal class for a histogram
Upper class boundary of the class interval immediately preceding the modal class
Cumulative frequency corresponding to the upper boundary of the median class on an ogive

Eşleşmeler

Cevabı ve açıklamayı göster

Cevap

The sector angle matches 144144^\circ, frequency density matches 4.04.0, preceding upper class boundary matches 29.529.5, and median class cumulative frequency matches 8080.
The items match based on direct statistical computations: the modal sector angle is 144144^\circ, frequency density is 4.04.0, upper class boundary of the preceding interval is 29.529.5, and cumulative frequency at the upper boundary of the median class is 8080.

Adım Adım Çözüm

1
Determine the modal class and total frequency NN.
The highest frequency is 4040, so the modal class is 303930 - 39. Total frequency N=15+25+40+20=100N = 15 + 25 + 40 + 20 = 100.
Modal class identification is essential for pie chart sector, frequency density, and class boundary calculations.
2
Calculate the sector angle for the modal class in a pie chart.
Sector Angle =40100×360=144= \frac{40}{100} \times 360^\circ = 144^\circ.
The sector angle represents the class frequency as a fraction of total frequency multiplied by 360360^\circ.
3
Calculate the frequency density of the modal class.
Class boundary range for 303930 - 39 is 29.539.529.5 - 39.5, so width =10= 10. Frequency density =4010=4.0= \frac{40}{10} = 4.0.
Frequency density is defined as class frequency divided by class interval width.
4
Determine the preceding upper class boundary and the cumulative frequency for the median class.
Preceding interval is 202920 - 29, so its upper boundary is 29.529.5. Median is at position 5050 (in interval 303930 - 39). Cumulative frequency up to boundary 39.539.5 is 15+25+40=8015 + 25 + 40 = 80.
Class boundaries are midpoints between adjacent class limits, and cumulative frequency sums all preceding frequencies up to the upper boundary.

Anahtar Kavram

Interpretation and calculation of pie chart sector angles, histogram frequency densities, real class boundaries, and cumulative frequencies from grouped data.
Soru 22Soru

In a probability experiment, two fair six-sided dice were rolled 180180 times, yielding an experimental probability of 518\frac{5}{18} for obtaining a sum divisible by 33. If mm additional consecutive rolls were conducted and every single one resulted in a sum divisible by 33, the updated overall experimental probability equaled the theoretical probability that the absolute difference between the numbers shown on two fair six-sided dice is at most 11. Calculate the value of mm.

Cevabı ve açıklamayı göster

Cevap: 54

Cevap

54
The initial number of successful trials is 180×518=50180 \times \frac{5}{18} = 50. The theoretical probability of rolling two dice with an absolute difference of at most 11 is calculated by counting 66 outcomes with difference 00 and 1010 outcomes with difference 11, giving 1636=49\frac{16}{36} = \frac{4}{9}. Equating the updated experimental probability 50+m180+m\frac{50 + m}{180 + m} to 49\frac{4}{9} yields 9(50+m)=4(180+m)9(50 + m) = 4(180 + m), which simplifies to 5m=2705m = 270 or m=54m = 54.

Adım Adım Çözüm

1
Calculate the initial number of successful trials from the given experimental probability.
Initial successful outcomes = 180×518=50180 \times \frac{5}{18} = 50.
Experimental probability is defined as the number of successful trials divided by the total number of trials.
2
Calculate the theoretical probability that the absolute difference between two rolled six-sided dice is at most 1.
Favorable outcomes = 16, so P(theoretical)=1636=49P(\text{theoretical}) = \frac{16}{36} = \frac{4}{9}.
Outcomes with difference 0: (1,1),(2,2),(3,3),(4,4),(5,5),(6,6)(1,1), (2,2), (3,3), (4,4), (5,5), (6,6) (6 outcomes). Outcomes with difference 1: (1,2),(2,1),(2,3),(3,2),(3,4),(4,3),(4,5),(5,4),(5,6),(6,5)(1,2), (2,1), (2,3), (3,2), (3,4), (4,3), (4,5), (5,4), (5,6), (6,5) (10 outcomes). Total sample space =6×6=36= 6 \times 6 = 36.
3
Formulate the algebraic equation relating the updated experimental probability to the theoretical probability.
50+m180+m=49\frac{50 + m}{180 + m} = \frac{4}{9}.
Adding mm consecutive successful rolls increases both the number of successful outcomes (to 50+m50 + m) and the total number of trials (to 180+m180 + m).
4
Solve the equation for mm.
9(50+m)=4(180+m)    450+9m=720+4m    5m=270    m=549(50 + m) = 4(180 + m) \implies 450 + 9m = 720 + 4m \implies 5m = 270 \implies m = 54.
Cross-multiplication converts the rational expression into a linear equation.

Anahtar Kavram

Experimental and Theoretical Probability Synthesis
Tahmini Süre:3m 0s
Soru 23Soru

A box contains 5050 marbles of three different colors: red, blue, and green. The theoretical probability of selecting a red marble at random is 310\frac{3}{10}. In a probability experiment, a marble was drawn with replacement 250250 times, resulting in a red marble being drawn 8585 times. What is the positive difference between the experimental probability and the theoretical probability of selecting a red marble?

Cevabı ve açıklamayı göster

Cevap: 125\frac{1}{25}

Cevap

The positive difference between the experimental probability and the theoretical probability of selecting a red marble is 125\frac{1}{25}.
The experimental probability is the ratio of observed successful trials to total trials, which is 85250=1750\frac{85}{250} = \frac{17}{50}. The theoretical probability is given as 310=1550\frac{3}{10} = \frac{15}{50}. Subtracting the theoretical probability from the experimental probability gives 17501550=250=125\frac{17}{50} - \frac{15}{50} = \frac{2}{50} = \frac{1}{25}.

Adım Adım Çözüm

1
Calculate the experimental probability (relative frequency) of drawing a red marble.
Experimental Probability=Number of successful outcomesTotal number of trials=85250=1750=0.34\text{Experimental Probability} = \frac{\text{Number of successful outcomes}}{\text{Total number of trials}} = \frac{85}{250} = \frac{17}{50} = 0.34
Experimental probability is calculated using empirical trial outcomes.
2
Identify the given theoretical probability of drawing a red marble.
Theoretical Probability=310=1550=0.30\text{Theoretical Probability} = \frac{3}{10} = \frac{15}{50} = 0.30
The theoretical probability is provided directly as 310\frac{3}{10}.
3
Compute the positive difference between experimental and theoretical probabilities.
Difference=17501550=250=125=0.04\text{Difference} = \frac{17}{50} - \frac{15}{50} = \frac{2}{50} = \frac{1}{25} = 0.04
Subtracting theoretical probability from experimental probability gives the required positive difference.

Anahtar Kavram

Experimental vs Theoretical Probability
Tahmini Süre:1m 30s
Soru 24Soru

The frequency table below shows the distribution of daily petrol consumption (in litres) recorded by 4040 commercial minibus drivers:

Daily Petrol Consumption (litres)Frequency (ff)
101410 - 1466
151915 - 191010
202420 - 241212
252925 - 2988
303430 - 3444

What is the mean daily petrol consumption of the minibus drivers?

Cevabı ve açıklamayı göster

Cevap: 21.25 litres21.25\text{ litres}

Cevap

The mean daily petrol consumption is 21.25 litres21.25\text{ litres}.
The mean of a grouped frequency distribution is computed by multiplying the midpoint of each class interval by its frequency, summing these products, and dividing by the total frequency. For the given distribution, fx=850\sum fx = 850 and f=40\sum f = 40, giving a mean of 21.25 litres21.25\text{ litres}.

Adım Adım Çözüm

1
Calculate the class mark (midpoint) xx for each class interval.
Midpoints are: 1212 for 101410 - 14, 1717 for 151915 - 19, 2222 for 202420 - 24, 2727 for 252925 - 29, and 3232 for 303430 - 34.
For grouped data, each class interval is represented by its midpoint.
2
Multiply each midpoint xx by its corresponding frequency ff to find fxfx.
6×12=726 \times 12 = 72, 10×17=17010 \times 17 = 170, 12×22=26412 \times 22 = 264, 8×27=2168 \times 27 = 216, 4×32=1284 \times 32 = 128.
This yields the total sum contribution of each class.
3
Find total frequency f\sum f and total sum of products fx\sum fx.
f=6+10+12+8+4=40\sum f = 6 + 10 + 12 + 8 + 4 = 40 and fx=72+170+264+216+128=850\sum fx = 72 + 170 + 264 + 216 + 128 = 850.
Required components for the grouped mean formula.
4
Calculate the mean xˉ=fxf\bar{x} = \frac{\sum fx}{\sum f}.
\bar{x} = \frac{850}{40} = 21.25\text{ litres}.
Applying the formula for the mean of grouped frequency distribution.

Anahtar Kavram

Grouped Mean Calculation using Midpoints
Tahmini Süre:1m 30s
Soru 25Soru

The table below shows the distribution of marks obtained by 4040 candidates in a computer-based recruitment test:

Mark IntervalFrequency (ff)
1101 - 1044
112011 - 2088
213021 - 301212
314031 - 4066
415041 - 501010

What is the estimated mean mark of the candidates?

Cevabı ve açıklamayı göster

Cevap: 28.028.0

Cevap

The estimated mean mark of the candidates is 28.028.0.
To find the mean of grouped frequency data, each class interval must be represented by its midpoint (xx). Finding the midpoints (5.5,15.5,25.5,35.5,45.55.5, 15.5, 25.5, 35.5, 45.5) and multiplying by their frequencies gives total products summing to 11201120. Dividing by the total number of candidates (4040) yields 28.028.0.

Adım Adım Çözüm

1
Calculate the midpoint (xx) for each class interval
Class midpoints are: 5.55.5, 15.515.5, 25.525.5, 35.535.5, and 45.545.5.
The class mark or midpoint is the representative value for data within a grouped interval.
2
Multiply each class midpoint (xx) by its corresponding frequency (ff) to find fxf \cdot x
4×5.5=224 \times 5.5 = 22, 8×15.5=1248 \times 15.5 = 124, 12×25.5=30612 \times 25.5 = 306, 6×35.5=2136 \times 35.5 = 213, 10×45.5=45510 \times 45.5 = 455.
Determines the total weighted value contribution of each class.
3
Sum all fxf \cdot x values and calculate the total frequency f\sum f
fx=22+124+306+213+455=1120\sum f \cdot x = 22 + 124 + 306 + 213 + 455 = 1120, and f=4+8+12+6+10=40\sum f = 4 + 8 + 12 + 6 + 10 = 40.
Provides the overall sum of data estimates and total sample size needed for the grouped mean formula.
4
Apply the grouped mean formula xˉ=fxf\bar{x} = \frac{\sum f \cdot x}{\sum f}
xˉ=112040=28.0.\bar{x} = \frac{1120}{40} = 28.0.
Computes the estimated mean for grouped frequency data.

Anahtar Kavram

Grouped Mean Calculation using Class Midpoints
Tahmini Süre:1m 30s
Soru 26Soru

In an agricultural experiment, two crop varieties, XX and YY, are tested independently for germination under drought conditions. The probability that variety XX germinates is 0.650.65, and the probability that at least one of the two varieties germinates is 0.860.86. What is the probability that variety YY germinates?

Cevabı ve açıklamayı göster

Cevap: 0.6

Cevap

The probability that variety Y germinates is 0.6
Using the law of addition for independent events P(XY)=P(X)+P(Y)P(X)P(Y)P(X \cup Y) = P(X) + P(Y) - P(X)P(Y), substituting P(X)=0.65P(X) = 0.65 and P(XY)=0.86P(X \cup Y) = 0.86 gives 0.86=0.65+0.35P(Y)0.86 = 0.65 + 0.35 P(Y), which yields P(Y)=0.6P(Y) = 0.6.

Adım Adım Çözüm

1
Apply the general addition law for two probability events
P(XY)=P(X)+P(Y)P(XY)P(X \cup Y) = P(X) + P(Y) - P(X \cap Y)
The addition law relates the union, individual probabilities, and intersection of compound events.
2
Express the intersection using the law of multiplication for independent events
P(XY)=P(X)×P(Y)=0.65×P(Y)P(X \cap Y) = P(X) \times P(Y) = 0.65 \times P(Y)
Because germination of variety X and variety Y are independent events.
3
Substitute given values into the combined probability formula and solve for P(Y)P(Y)
0.86=0.65+P(Y)0.65P(Y)    0.21=0.35P(Y)    P(Y)=0.60.86 = 0.65 + P(Y) - 0.65 P(Y) \implies 0.21 = 0.35 P(Y) \implies P(Y) = 0.6
Isolating the unknown probability P(Y)P(Y) yields the correct decimal value.

Anahtar Kavram

Compound Probability Laws and Independent Events
Soru 27Soru

The table below shows the speed distribution (in km/h) recorded for 5050 vehicles passing a police checkpoint on a highway:

Speed Interval (km/h)Frequency (ff)
404940 - 4966
505950 - 591212
606960 - 691818
707970 - 791010
808980 - 8944

Calculate the mean speed of the vehicles.

Cevabı ve açıklamayı göster

Cevap: 63.3

Cevap

The mean speed of the vehicles is 63.3 km/h63.3\text{ km/h}.
The mean of a grouped frequency distribution is computed using the formula xˉ=fxf\bar{x} = \frac{\sum fx}{\sum f}. The midpoints (xx) for the intervals are 44.5,54.5,64.5,74.5,44.5, 54.5, 64.5, 74.5, and 84.584.5. Multiplying these midpoints by their respective frequencies yields products totaling 31653165. Dividing this total by the total number of vehicles (5050) gives a mean speed of 63.3 km/h63.3\text{ km/h}.

Adım Adım Çözüm

1
Find the class midpoints (xx) for each speed interval
Midpoints are x1=44.5x_1 = 44.5, x2=54.5x_2 = 54.5, x3=64.5x_3 = 64.5, x4=74.5x_4 = 74.5, and x5=84.5x_5 = 84.5.
The midpoint of a grouped class interval is calculated as Lower limit+Upper limit2\frac{\text{Lower limit} + \text{Upper limit}}{2}.
2
Calculate the product fxfx for each class
6×44.5=2676 \times 44.5 = 267, 12×54.5=65412 \times 54.5 = 654, 18×64.5=116118 \times 64.5 = 1161, 10×74.5=74510 \times 74.5 = 745, and 4×84.5=3384 \times 84.5 = 338.
Multiplying class midpoint by frequency estimates the total contribution of all items within that interval.
3
Find total frequency f\sum f and sum of products fx\sum fx
f=6+12+18+10+4=50\sum f = 6 + 12 + 18 + 10 + 4 = 50 and fx=267+654+1161+745+338=3165\sum fx = 267 + 654 + 1161 + 745 + 338 = 3165.
Summing frequencies gives total sample size, and summing fxfx gives estimated grand total.
4
Compute the estimated mean speed
xˉ=fxf=316550=63.3 km/h\bar{x} = \frac{\sum fx}{\sum f} = \frac{3165}{50} = 63.3\text{ km/h}.
The standard formula for the mean of grouped frequency data is xˉ=fxf\bar{x} = \frac{\sum fx}{\sum f}.

Anahtar Kavram

Grouped Mean Calculation
Soru 28Soru

The table below shows the frequency distribution of marks obtained by a group of students in a mathematics test:

Mark (xx)246810
Frequency (ff)21412

Find the mean deviation of the distribution.

Cevabı ve açıklamayı göster

Cevap: 2

Cevap

The mean deviation of the distribution is 2.
To find the mean deviation, first calculate the mean xˉ=fxf=6010=6\bar{x} = \frac{\sum fx}{\sum f} = \frac{60}{10} = 6. Next, sum the absolute deviations multiplied by their frequencies: fxxˉ=2(4)+1(2)+4(0)+1(2)+2(4)=20\sum f|x - \bar{x}| = 2(4) + 1(2) + 4(0) + 1(2) + 2(4) = 20. Dividing this total by the sum of frequencies 1010 yields a mean deviation of 22.

Adım Adım Çözüm

1
Calculate the arithmetic mean of the distribution
\bar{x} = \frac{\sum f x}{\sum f} = \frac{(2 \times 2) + (1 \times 4) + (4 \times 6) + (1 \times 8) + (2 \times 10)}{2 + 1 + 4 + 1 + 2} = \frac{60}{10} = 6
The mean is required as the central benchmark from which individual deviations are measured.
2
Calculate the sum of absolute deviations weighted by frequency
\sum f |x - \bar{x}| = 2|2 - 6| + 1|4 - 6| + 4|6 - 6| + 1|8 - 6| + 2|10 - 6| = 8 + 2 + 0 + 2 + 8 = 20
Each absolute difference from the mean must be multiplied by its frequency to account for the total deviation.
3
Divide the total absolute deviation by the total frequency
\text{Mean Deviation} = \frac{\sum f |x - \bar{x}|}{\sum f} = \frac{20}{10} = 2
The mean deviation represents the average distance of all observations from the arithmetic mean.

Anahtar Kavram

Mean Deviation of a Frequency Distribution
Tahmini Süre:1m 30s
Soru 29Soru

The distribution of daily solar energy generation (in kWh) recorded at an agricultural research station over a period of days is summarized in the table below:

Daily Generation (kWh)Frequency (ff)
101910 - 1933
202920 - 29xx
303930 - 3988
404940 - 4955
505950 - 59x+2x + 2

If the mean daily solar energy generation for the recorded period is 37.5 kWh37.5\text{ kWh}, what is the value of xx?

Cevabı ve açıklamayı göster

Cevap: 66

Cevap

66
The exact class marks are 14.5,24.5,34.5,44.5,14.5, 24.5, 34.5, 44.5, and 54.554.5. The total frequency is f=18+2x\sum f = 18 + 2x and the sum of products is fx=651+79x\sum f x = 651 + 79x. Substituting these into xˉ=fxf\bar{x} = \frac{\sum f x}{\sum f} with xˉ=37.5\bar{x} = 37.5 gives 675+75x=651+79x675 + 75x = 651 + 79x, which solves to 4x=244x = 24, giving the value 66.

Adım Adım Çözüm

1
Determine the class mark (midpoint xix_i) for each class interval
The midpoints are 14.5,24.5,34.5,44.5,14.5, 24.5, 34.5, 44.5, and 54.554.5.
The class mark is calculated as Lower Limit+Upper Limit2\frac{\text{Lower Limit} + \text{Upper Limit}}{2}.
2
Calculate total frequency f\sum f and total product sum fxi\sum f x_i
f=3+x+8+5+(x+2)=18+2x\sum f = 3 + x + 8 + 5 + (x + 2) = 18 + 2x.
fxi=3(14.5)+x(24.5)+8(34.5)+5(44.5)+(x+2)(54.5)=43.5+24.5x+276+222.5+54.5x+109=651+79x\sum f x_i = 3(14.5) + x(24.5) + 8(34.5) + 5(44.5) + (x+2)(54.5) = 43.5 + 24.5x + 276 + 222.5 + 54.5x + 109 = 651 + 79x
To compute the mean of grouped data, sum the products of each frequency and its corresponding class mark.
3
Set up the mean formula equation and solve for xx
xˉ=fxif    37.5=651+79x18+2x\bar{x} = \frac{\sum f x_i}{\sum f} \implies 37.5 = \frac{651 + 79x}{18 + 2x}
37.5(18+2x)=651+79x37.5(18 + 2x) = 651 + 79x
675+75x=651+79x675 + 75x = 651 + 79x
79x75x=67565179x - 75x = 675 - 651
4x=24    x=64x = 24 \implies x = 6
Equating the expression for mean to the given mean value 37.5 kWh37.5\text{ kWh} yields a linear equation in xx.

Anahtar Kavram

Measures of Central Tendency for Grouped Data - Finding Unknown Frequencies from Grouped Mean
Soru 30Soru

The test scores of five students in a mathematics quiz are 5,8,11,12,5, 8, 11, 12, and 1414. What is the variance of these test scores?

Cevabı ve açıklamayı göster

Cevap: 1010

Cevap

The variance of the test scores is 1010.
The mean of the scores is 1010. Subtracting 1010 from each score gives deviations of 5,2,1,2,-5, -2, 1, 2, and 44. Squaring these gives 25,4,1,4,25, 4, 1, 4, and 1616, which sum to 5050. Dividing this sum by the number of data points (55) yields a variance of 1010.

Adım Adım Çözüm

1
Calculate the mean (xˉ\bar{x}) of the data set
xˉ=5+8+11+12+145=505=10\bar{x} = \frac{5 + 8 + 11 + 12 + 14}{5} = \frac{50}{5} = 10
The mean is required to find the deviation of each score from the central value.
2
Compute the squared deviations from the mean (xixˉ)2(x_i - \bar{x})^2
(510)2=25(5-10)^2 = 25, (810)2=4(8-10)^2 = 4, (1110)2=1(11-10)^2 = 1, (1210)2=4(12-10)^2 = 4, (1410)2=16(14-10)^2 = 16
Squaring deviations ensures all negative differences become positive.
3
Find the sum of all squared deviations
\sum (x_i - \bar{x})^2 = 25 + 4 + 1 + 4 + 16 = 50
Summing the squared deviations measures total variation around the mean.
4
Divide the total sum of squared deviations by the number of data values (N=5N = 5)
\text{Variance } (\sigma^2) = \frac{50}{5} = 10
Variance is defined as the average of the squared deviations.

Anahtar Kavram

Variance of Ungrouped Data
Tahmini Süre:1m 30s
Soru 31Soru

A small business recorded the number of customer inquiries received per day over six consecutive days as follows: 44, 77, 88, 1111, 1313, and 1717. What is the variance of the daily customer inquiries?

Cevabı ve açıklamayı göster

Cevap: 18

Cevap

The variance of the daily customer inquiries is 1818.
To find the variance of the data set {4,7,8,11,13,17}\{4, 7, 8, 11, 13, 17\}, first calculate the mean: xˉ=4+7+8+11+13+176=10\bar{x} = \frac{4+7+8+11+13+17}{6} = 10. Next, compute the squared deviation of each data point from the mean: (410)2=36(4-10)^2 = 36, (710)2=9(7-10)^2 = 9, (810)2=4(8-10)^2 = 4, (1110)2=1(11-10)^2 = 1, (1310)2=9(13-10)^2 = 9, and (1710)2=49(17-10)^2 = 49. Summing these squared deviations gives 108108. Dividing this total by the number of observations (66) yields a variance of 1818.

Adım Adım Çözüm

1
Calculate the arithmetic mean of the given data set.
xˉ=10\bar{x} = 10
The mean is required as the central point from which deviations are calculated.
2
Determine the squared deviation of each data value from the mean.
(6)2=36(-6)^2 = 36, (3)2=9(-3)^2 = 9, (2)2=4(-2)^2 = 4, 12=11^2 = 1, 32=93^2 = 9, 72=497^2 = 49
Variance measures the average squared distance of data points from the mean.
3
Sum all calculated squared deviations.
(xxˉ)2=36+9+4+1+9+49=108\sum (x - \bar{x})^2 = 36 + 9 + 4 + 1 + 9 + 49 = 108
This provides the total sum of squares for the data set.
4
Divide the total sum of squares by the number of observations (n=6n = 6).
σ2=1086=18\sigma^2 = \frac{108}{6} = 18
Population variance formula is σ2=(xxˉ)2n\sigma^2 = \frac{\sum (x - \bar{x})^2}{n}.

Anahtar Kavram

Variance of Ungrouped Data
Tahmini Süre:1m 30s
Soru 32Soru

Five daily rainfall measurements (in mm) recorded in a city are 3,6,7,9,3, 6, 7, 9, and 1515. What is the standard deviation of these rainfall measurements?

Cevabı ve açıklamayı göster

Cevap: 44

Cevap

The standard deviation of the rainfall measurements is 44.
First compute the mean of the data set: xˉ=3+6+7+9+155=8\bar{x} = \frac{3 + 6 + 7 + 9 + 15}{5} = 8. Next, sum the squared deviations from the mean: (38)2+(68)2+(78)2+(98)2+(158)2=25+4+1+1+49=80(3-8)^2 + (6-8)^2 + (7-8)^2 + (9-8)^2 + (15-8)^2 = 25 + 4 + 1 + 1 + 49 = 80. Dividing by the number of observations (55) yields the variance σ2=805=16\sigma^2 = \frac{80}{5} = 16. Taking the square root gives the standard deviation σ=16=4\sigma = \sqrt{16} = 4.

Adım Adım Çözüm

1
Calculate the arithmetic mean (xˉ\bar{x}) of the dataset
xˉ=3+6+7+9+155=405=8\bar{x} = \frac{3 + 6 + 7 + 9 + 15}{5} = \frac{40}{5} = 8
The mean is needed to find deviations for each data point.
2
Find the deviation of each number from the mean and square it
(38)2=25(3-8)^2 = 25, (68)2=4(6-8)^2 = 4, (78)2=1(7-8)^2 = 1, (98)2=1(9-8)^2 = 1, (158)2=49(15-8)^2 = 49
Squaring ensures all deviation values are non-negative.
3
Sum the squared deviations and divide by the total number of items (n=5n = 5) to find the variance
\text{Variance } (\sigma^2) = \frac{25 + 4 + 1 + 1 + 49}{5} = \frac{80}{5} = 16
Variance measures the average squared distance from the mean.
4
Take the square root of the variance to obtain standard deviation
\text{Standard Deviation } (\sigma) = \sqrt{16} = 4
Standard deviation returns the dispersion measure back to the original units.

Anahtar Kavram

Standard Deviation of Ungrouped Data
Soru 33Soru

Find the positive integer value of nn such that nP4=42×nP2^{n}P_4 = 42 \times {^{n}P_2}.

Cevabı ve açıklamayı göster

Cevap: 9

Cevap

The positive integer value of nn is 9.
Expanding nP4^{n}P_4 as n(n1)(n2)(n3)n(n-1)(n-2)(n-3) and nP2^{n}P_2 as n(n1)n(n-1) allows dividing out n(n1)n(n-1), leading to (n2)(n3)=42(n-2)(n-3) = 42. Expanding and factoring gives n25n36=0n^2 - 5n - 36 = 0, which yields n=9n = 9 as the only valid positive integer.

Adım Adım Çözüm

1
Apply the permutation formula nPr=n!(nr)!^{n}P_r = \frac{n!}{(n-r)!}
nP4=n(n1)(n2)(n3)^{n}P_4 = n(n-1)(n-2)(n-3) and nP2=n(n1)^{n}P_2 = n(n-1)
By definition of permutations, selecting rr items from nn distinct items without replacement.
2
Substitute the expansions into the given relation
n(n1)(n2)(n3)=42n(n1)n(n-1)(n-2)(n-3) = 42 n(n-1)
Direct substitution into nP4=42×nP2^{n}P_4 = 42 \times {^{n}P_2}.
3
Simplify by dividing out common non-zero terms
(n2)(n3)=42(n-2)(n-3) = 42
Since n4n \ge 4, n(n1)0n(n-1) \neq 0 and can be safely divided from both sides.
4
Form and solve the quadratic equation
n25n+6=42    n25n36=0    (n9)(n+4)=0n^2 - 5n + 6 = 42 \implies n^2 - 5n - 36 = 0 \implies (n-9)(n+4) = 0
Expanding terms and factoring the resulting quadratic expression.
5
Determine the valid root
n=9n = 9
Permutation total items nn must satisfy nr0n \ge r \ge 0, rejecting the negative root n=4n = -4.

Anahtar Kavram

Algebraic equations involving permutations
Tahmini Süre:1m 15s
Soru 34Soru

Six members of a board of directors are to be seated around a circular conference table. If two specific members refuse to sit next to each other, how many different seating arrangements are possible?

Cevabı ve açıklamayı göster

Cevap: 72

Cevap

72
To find the number of circular seating arrangements where two specific members do not sit next to each other, use the complement rule. First, the total unrestricted circular arrangements of 6 members is (61)!=5!=120(6 - 1)! = 5! = 120. Next, calculate the arrangements where the two members sit together by treating them as 1 unit (giving 5 units in total). The circular arrangements of these 5 units is (51)!=4!=24(5 - 1)! = 4! = 24, and the 2 members can swap seats in 2!=22! = 2 ways, yielding 24×2=4824 \times 2 = 48 arrangements together. Subtracting this from the total yields 12048=72120 - 48 = 72.

Adım Adım Çözüm

1
Calculate total circular arrangements without restrictions
Total arrangements = (61)!=5!=120(6 - 1)! = 5! = 120
The number of ways to arrange nn distinct items in a circle is (n1)!(n - 1)!.
2
Calculate arrangements where the two specific members sit together
Restricted arrangements = (51)!×2!=4!×2=24×2=48(5 - 1)! \times 2! = 4! \times 2 = 24 \times 2 = 48
Treat the two members as a single block, giving 5 units to arrange around a circle in (51)!(5-1)! ways, and multiply by 2!2! for internal ordering of the pair.
3
Subtract the together arrangements from total arrangements
Ways apart = 12048=72120 - 48 = 72
Complementary counting gives the number of arrangements where the two members do not sit next to each other.

Anahtar Kavram

Circular Permutations with Restrictions
Tahmini Süre:1m 30s
Soru 35Soru

A school committee of 44 members is to be selected from 66 male teachers and 44 female teachers. If the committee must contain exactly 22 male teachers and 22 female teachers, how many different committees can be formed?

Cevabı ve açıklamayı göster

Cevap: 90

Cevap

The total number of different committees that can be formed is 9090.
Selecting 2 female teachers from 4 yields (42)=6\binom{4}{2} = 6 ways. Selecting 2 male teachers from 6 yields (62)=15\binom{6}{2} = 15 ways. By the multiplication principle, the total number of ways to form the committee is 6×15=906 \times 15 = 90.

Adım Adım Çözüm

1
Find the number of ways to select 2 female teachers out of 4
\(\binom{4}{2} = 6\)
Selection order does not matter within the committee, so combination formula \(nCr\) applies.
2
Find the number of ways to select 2 male teachers out of 6
\(\binom{6}{2} = 15\)
Selection order does not matter within the committee, so combination formula \(nCr\) applies.
3
Multiply the possibilities for selecting male and female members
\(6 \times 15 = 90\)
According to the fundamental counting principle, independent group selections are multiplied.

Anahtar Kavram

Combinations with restricted subset selections (Product Rule of Counting)
Soru 36Soru

1010 distinct points are marked on the circumference of a circle. How many different triangles can be formed by connecting any 33 of these points as vertices?

Cevabı ve açıklamayı göster

Cevap: 120120

Cevap

The number of distinct triangles that can be formed is 120120.
To form a triangle, any 33 points must be chosen from the 1010 available points. Because no three points on a circle are collinear, every choice of 33 points forms a unique triangle. Since the order of choosing vertices does not alter the triangle, we use combinations: (103)=10×9×83×2×1=120\binom{10}{3} = \frac{10 \times 9 \times 8}{3 \times 2 \times 1} = 120.

Adım Adım Çözüm

1
Identify the total number of items nn and the subset size rr.
n=10n = 10 points on the circle, and r=3r = 3 points required to form a triangle.
Any set of 33 non-collinear points uniquely determines a triangle. Since all points lie on a circle, no three points are collinear.
2
Determine whether order matters.
Order does not matter because choosing points A,B,CA, B, C produces the same triangle as choosing B,C,AB, C, A.
Selection of vertices for a geometric shape is a combination problem, not a permutation problem.
3
Apply the combination formula (nr)=n!r!(nr)!\binom{n}{r} = \frac{n!}{r!(n - r)!}.
(103)=10×9×83×2×1=7206=120\binom{10}{3} = \frac{10 \times 9 \times 8}{3 \times 2 \times 1} = \frac{720}{6} = 120
Evaluating the combination gives the total number of distinct triangles.

Anahtar Kavram

Combinations for Geometric Formations
Tahmini Süre:1m 30s
Soru 37Soru

A box contains 3030 tickets numbered 11 to 3030. In a probability experiment, a ticket is drawn at random from the box and its number recorded before being replaced. This trial is performed 150150 times, and a ticket with a number that is a multiple of 44 is recorded 4545 times. What is the absolute difference between the experimental probability and the theoretical probability of selecting a ticket bearing a multiple of 44?

Cevabı ve açıklamayı göster

Cevap: 115\frac{1}{15}

Cevap

The absolute difference between the experimental probability and the theoretical probability is 115\frac{1}{15}.
The theoretical probability of drawing a multiple of 4 is 730\frac{7}{30} since there are 7 favorable tickets (4,8,12,16,20,24,284, 8, 12, 16, 20, 24, 28) out of 30 total tickets. The experimental probability from 150 draws is 45150=930\frac{45}{150} = \frac{9}{30}. Taking the absolute difference gives 930730=230=115\frac{9}{30} - \frac{7}{30} = \frac{2}{30} = \frac{1}{15}.

Adım Adım Çözüm

1
Determine the theoretical probability
Theoretical probability P(T)=730P(T) = \frac{7}{30}
The multiples of 44 between 11 and 3030 are 4,8,12,16,20,24,284, 8, 12, 16, 20, 24, 28, giving 77 favorable outcomes out of 3030 possible outcomes.
2
Determine the experimental probability
Experimental probability P(E)=45150=310P(E) = \frac{45}{150} = \frac{3}{10}
The event occurred 4545 times out of 150150 experimental trials.
3
Calculate the absolute difference between P(E)P(E) and P(T)P(T)
P(E)P(T)=930730=230=115|P(E) - P(T)| = |\frac{9}{30} - \frac{7}{30}| = \frac{2}{30} = \frac{1}{15}
Express both fractions with a common denominator of 3030 and subtract the smaller probability from the larger.

Anahtar Kavram

Experimental probability is calculated from trial data (favorable trials divided by total trials), whereas theoretical probability is calculated from expected sample space outcomes (favorable outcomes divided by total sample space size).
Tahmini Süre:1m 30s
Soru 38Soru

In a mathematics examination, a student is required to answer 55 questions out of 88 available questions. If the first 22 questions are compulsory, in how many different ways can the student select the questions to answer?

Cevabı ve açıklamayı göster

Cevap: 20

Cevap

The student can select the questions in 20 different ways.
With 2 compulsory questions, the student only has to select 3 more questions from the remaining 6 questions. The number of ways to select 3 items from 6 without regard to order is given by ^6C_3 = \frac{6 \times 5 \times 4}{3 \times 2 \times 1} = 20.

Adım Adım Çözüm

1
Deduct compulsory questions from both the required total and available total
The student must choose 3 additional questions from the remaining 6 questions.
Compulsory questions are fixed and provide only 1 selection choice.
2
Apply the combination formula ^6C_3 to calculate selection ways
^6C_3 = \frac{6 \times 5 \times 4}{3 \times 2 \times 1} = 20
The order in which the student chooses the examination questions does not alter the group of questions selected.

Anahtar Kavram

Combinations with restricted/compulsory choices
Soru 39Soru

A container holds a large number of red, blue, and yellow counters. The theoretical probability of selecting a red counter at random is 25\frac{2}{5}, and the theoretical probability of selecting a blue counter is 13\frac{1}{3}. In an experiment where a counter is drawn and replaced 300300 times, a yellow counter is selected 7272 times. What is the absolute difference between the theoretical expected number of yellow counters and the experimental frequency of yellow counters obtained?

Cevabı ve açıklamayı göster

Cevap: 88

Cevap

The absolute difference between the theoretical expected number of yellow counters and the experimental frequency is 88.
The theoretical probability of drawing a yellow counter is 1(25+13)=4151 - (\frac{2}{5} + \frac{1}{3}) = \frac{4}{15}. For 300300 trials, the theoretical expected count of yellow counters is 415×300=80\frac{4}{15} \times 300 = 80. Subtracting the experimental observed count of 7272 from 8080 gives an absolute difference of 88.

Adım Adım Çözüm

1
Calculate the theoretical probability of drawing a yellow counter.
P(Yellow)=1(P(Red)+P(Blue))=1(25+13)=11115=415P(\text{Yellow}) = 1 - \left(P(\text{Red}) + P(\text{Blue})\right) = 1 - \left(\frac{2}{5} + \frac{1}{3}\right) = 1 - \frac{11}{15} = \frac{4}{15}
The sum of probabilities of all mutually exclusive outcomes in the sample space must equal 11.
2
Calculate the theoretical expected frequency of yellow counters in 300300 trials.
Expected frequency=P(Yellow)×Total trials=415×300=80\text{Expected frequency} = P(\text{Yellow}) \times \text{Total trials} = \frac{4}{15} \times 300 = 80
The expected number of occurrences of an outcome is the product of its theoretical probability and the number of trials.
3
Find the absolute difference between expected frequency and experimental frequency.
|80 - 72| = 8
The question asks for the difference between the theoretical expected value (8080) and the actual experimental result (7272).

Anahtar Kavram

Experimental and Theoretical Probability
Tahmini Süre:1m 30s
Soru 40Soru

Two marksmen, Kemi and Chidi, independently shoot at a target once. The probability that Kemi hits the target is 0.70.7, and the probability that Chidi hits the target is 0.60.6. What is the probability that at least one of them hits the target?

Cevabı ve açıklamayı göster

Cevap: 0.88

Cevap

The probability that at least one marksman hits the target is 0.88.
Since the two shooting attempts are independent, the probability that both marksmen miss is (10.7)×(10.6)=0.3×0.4=0.12(1 - 0.7) \times (1 - 0.6) = 0.3 \times 0.4 = 0.12. Subtracting this probability from 1 yields 10.12=0.881 - 0.12 = 0.88, which represents the probability that at least one marksman hits the target.

Adım Adım Çözüm

1
Find the probability of each event not occurring (missing the target).
P(Kemi misses)=0.3P(\text{Kemi misses}) = 0.3 and P(Chidi misses)=0.4P(\text{Chidi misses}) = 0.4
The sum of an event's probability and its complement is always 1.
2
Determine the probability of both events failing simultaneously.
P(both miss)=0.3×0.4=0.12P(\text{both miss}) = 0.3 \times 0.4 = 0.12
For independent events AA and BB, P(AB)=P(A)×P(B)P(A' \cap B') = P(A') \times P(B').
3
Use the complement rule to find the probability of at least one success.
P(at least one hits)=10.12=0.88P(\text{at least one hits}) = 1 - 0.12 = 0.88
The event 'at least one hits' is the exact complement of 'neither hits'.

Anahtar Kavram

Compound probability laws for independent events and complement of combined events
ÖncekiSayfa 2 / 8Sonraki