Question

Difficulty: MediumChemical Equations and Stoichiometric Calculations (Mass-Mass, Mass-Volume, Mole Relations)
Propane burns completely in oxygen gas according to the following balanced chemical equation:
C3H8(g)+5O2(g)3CO2(g)+4H2O(l)C_3H_8(g) + 5O_2(g) \rightarrow 3CO_2(g) + 4H_2O(l)
What volume of oxygen gas, measured at STP, is required for the complete combustion of 4.4 g4.4\text{ g} of propane?
[H=1.0,C=12.0;Molar volume of gas at STP=22.4 dm3 mol1][\text{H} = 1.0, \text{C} = 12.0; \text{Molar volume of gas at STP} = 22.4\text{ dm}^3\text{ mol}^{-1}]
  1. A
    2.24 dm32.24\text{ dm}^3
  2. B
    6.72 dm36.72\text{ dm}^3
  3. 11.2 dm311.2\text{ dm}^3Answer
  4. D
    12.0 dm312.0\text{ dm}^3

Answer

The volume of oxygen gas required at STP is 11.2 dm311.2\text{ dm}^3.
The option stating 11.2 dm311.2\text{ dm}^3 is correct. 4.4 g4.4\text{ g} of propane corresponds to 0.10 mol0.10\text{ mol}. According to the balanced equation, 1 mol1\text{ mol} of C3H8C_3H_8 reacts with 5 mol5\text{ mol} of O2O_2, so 0.10 mol0.10\text{ mol} of propane requires 0.50 mol0.50\text{ mol} of O2O_2. At STP, 0.50 mol×22.4 dm3 mol1=11.2 dm30.50\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 11.2\text{ dm}^3.

Step-by-Step Solution

1
Calculate the molar mass of propane (C3H8C_3H_8).
Molar mass of C3H8=(3×12.0)+(8×1.0)=36.0+8.0=44.0 g mol1C_3H_8 = (3 \times 12.0) + (8 \times 1.0) = 36.0 + 8.0 = 44.0\text{ g mol}^{-1}.
Molar mass is needed to convert the given mass of reactant into moles.
2
Determine the number of moles of propane in 4.4 g4.4\text{ g}.
Moles of C3H8=4.4 g44.0 g mol1=0.10 molC_3H_8 = \frac{4.4\text{ g}}{44.0\text{ g mol}^{-1}} = 0.10\text{ mol}.
Stoichiometric calculations rely on mole ratios from the balanced chemical equation.
3
Use the mole ratio from the balanced equation to find the required moles of O2O_2.
Mole ratio C3H8:O2=1:5C_3H_8 : O_2 = 1 : 5. Moles of O2=0.10 mol×5=0.50 molO_2 = 0.10\text{ mol} \times 5 = 0.50\text{ mol}.
Every 1 mole1\text{ mole} of propane requires 5 moles5\text{ moles} of oxygen gas for complete combustion.
4
Calculate the volume of O2O_2 gas at STP.
Volume of O2=0.50 mol×22.4 dm3 mol1=11.2 dm3O_2 = 0.50\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 11.2\text{ dm}^3.
Multiply the calculated number of moles of gas by the molar volume at STP (22.4 dm3 mol122.4\text{ dm}^3\text{ mol}^{-1}).

Key Concept

Mass-Volume Stoichiometric Calculations at STP
Estimated Time:1m 30s
Rate this question