Chemical Equations and Stoichiometric Calculations (Mass-Mass, Mass-Volume, Mole Relations)

13 questions

Question 1Question
A sample containing 8.0 g8.0\text{ g} of impure calcium trioxocarbonate(IV) reacts completely with excess dilute hydrochloric acid according to the equation:
CaCO3(s)+2HCl(aq)CaCl2(aq)+H2O(l)+CO2(g)\text{CaCO}_3(s) + 2\text{HCl}(aq) \rightarrow \text{CaCl}_2(aq) + \text{H}_2\text{O}(l) + \text{CO}_2(g)
If 1.344 dm31.344\text{ dm}^3 of carbon(IV) oxide gas measured at s.t.p. is liberated, what is the percentage purity of the calcium trioxocarbonate(IV) sample?
[Ca=40,C=12,O=16,Molar volume of gas at s.t.p.=22.4 dm3 mol1][\text{Ca} = 40, \text{C} = 12, \text{O} = 16, \text{Molar volume of gas at s.t.p.} = 22.4\text{ dm}^3\text{ mol}^{-1}]
Show answer & explanation

Answer: 75.0%75.0\%

Answer

The percentage purity of the calcium trioxocarbonate(IV) sample is 75.0%75.0\%.
First, find the moles of carbon(IV) oxide produced at s.t.p.: 1.344/22.4=0.060 mol1.344 / 22.4 = 0.060\text{ mol}. According to the balanced chemical equation, 1 mol1\text{ mol} of calcium trioxocarbonate(IV) reacts to yield 1 mol1\text{ mol} of carbon(IV) oxide. Therefore, 0.060 mol0.060\text{ mol} of pure calcium trioxocarbonate(IV) reacted. The mass of pure calcium trioxocarbonate(IV) is 0.060×100 g mol1=6.0 g0.060 \times 100\text{ g mol}^{-1} = 6.0\text{ g}. Calculating percentage purity gives (6.0 g/8.0 g)×100%=75.0%(6.0\text{ g} / 8.0\text{ g}) \times 100\% = 75.0\%.

Step-by-Step Solution

1
Calculate the moles of carbon(IV) oxide gas produced at s.t.p.
Moles of CO2=1.344 dm322.4 dm3 mol1=0.060 mol\text{Moles of CO}_2 = \frac{1.344\text{ dm}^3}{22.4\text{ dm}^3\text{ mol}^{-1}} = 0.060\text{ mol}
Molar gas volume at s.t.p. equals 22.4 dm3 mol122.4\text{ dm}^3\text{ mol}^{-1}.
2
Determine the mole relation and calculate the mass of pure calcium trioxocarbonate(IV).
Molar mass of CaCO3=40+12+(3×16)=100 g mol1\text{CaCO}_3 = 40 + 12 + (3 \times 16) = 100\text{ g mol}^{-1}. From the 1:11:1 stoichiometric ratio, moles of pure CaCO3=0.060 mol\text{moles of pure CaCO}_3 = 0.060\text{ mol}. Mass=0.060 mol×100 g mol1=6.0 g\text{Mass} = 0.060\text{ mol} \times 100\text{ g mol}^{-1} = 6.0\text{ g}.
The balanced chemical equation shows a 1:1 mole ratio between calcium trioxocarbonate(IV) and carbon(IV) oxide.
3
Calculate the percentage purity of the sample.
Percentage purity=Mass of pure CaCO3Total mass of impure sample×100%=6.0 g8.0 g×100%=75.0%\text{Percentage purity} = \frac{\text{Mass of pure CaCO}_3}{\text{Total mass of impure sample}} \times 100\% = \frac{6.0\text{ g}}{8.0\text{ g}} \times 100\% = 75.0\%
Percentage purity expresses the mass fraction of pure active component relative to total sample mass.

Key Concept

Mass-volume stoichiometric calculations and percentage purity determination
Estimated Time:2m 0s
Question 2Question
What volume of hydrogen gas measured at s.t.p. is evolved when 13.0 g13.0\text{ g} of pure zinc completely reacts with excess dilute hydrochloric acid according to the equation below?
Zn(s)+2HCl(aq)ZnCl2(aq)+H2(g)\text{Zn}(s) + 2\text{HCl}(aq) \rightarrow \text{ZnCl}_2(aq) + \text{H}_2(g)
[Zn=65,Molar gas volume at s.t.p.=22.4 dm3 mol1][\text{Zn} = 65, \text{Molar gas volume at s.t.p.} = 22.4\text{ dm}^3\text{ mol}^{-1}]
Show answer & explanation

Answer: 4.48 dm34.48\text{ dm}^3

Answer

4.48 dm34.48\text{ dm}^3
The balanced chemical equation indicates a 1:1 molar relationship between zinc and hydrogen gas. Reacting 13.0 g13.0\text{ g} of zinc corresponds to 13.065=0.20 mol\frac{13.0}{65} = 0.20\text{ mol} of zinc, yielding 0.20 mol0.20\text{ mol} of hydrogen gas. Multiplying by the molar volume at s.t.p. (22.4 dm3 mol122.4\text{ dm}^3\text{ mol}^{-1}) gives 0.20×22.4=4.48 dm30.20 \times 22.4 = 4.48\text{ dm}^3.

Step-by-Step Solution

1
Calculate the number of moles of zinc reacted
Moles of Zn=13.0 g65 g mol1=0.20 mol\text{Moles of Zn} = \frac{13.0\text{ g}}{65\text{ g mol}^{-1}} = 0.20\text{ mol}
Converting given mass of reactant to moles using relative atomic mass.
2
Determine the moles of hydrogen gas produced from the balanced equation
Mole ratio of Zn to H2=1:1\text{Mole ratio of Zn to H}_2 = 1 : 1, so moles of H2=0.20 mol\text{moles of H}_2 = 0.20\text{ mol}
Applying mole ratio constraints from the chemical equation.
3
Calculate the volume of hydrogen gas at s.t.p.
Volume of H2=0.20 mol×22.4 dm3 mol1=4.48 dm3\text{Volume of H}_2 = 0.20\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 4.48\text{ dm}^3
Multiplying moles of gas by standard molar volume at s.t.p.

Key Concept

Mass-Volume stoichiometric calculation at standard temperature and pressure (s.t.p.)
Estimated Time:1m 0s
Question 3Question
What volume of hydrogen gas, measured at STP, is liberated when 5.4 g5.4\text{ g} of aluminium react completely with excess hydrochloric acid according to the following equation?
2Al(s)+6HCl(aq)2AlCl3(aq)+3H2(g)2\text{Al}(s) + 6\text{HCl}(aq) \rightarrow 2\text{AlCl}_3(aq) + 3\text{H}_2(g)
[Relative atomic mass: Al=27\text{Al} = 27; Molar volume of gas at STP =22.4 dm3 mol1= 22.4\text{ dm}^3\text{ mol}^{-1}]
Show answer & explanation

Answer: 6.72 dm36.72\text{ dm}^3

Answer

The volume of hydrogen gas liberated at STP is 6.72 dm36.72\text{ dm}^3.
The option specifying 6.72 dm36.72\text{ dm}^3 is correct because 5.4 g5.4\text{ g} of aluminium corresponds to 0.20 mol0.20\text{ mol}. Based on the stoichiometric ratio 2Al:3H22\text{Al}:3\text{H}_2, 0.20 mol0.20\text{ mol} of aluminium liberates 0.30 mol0.30\text{ mol} of hydrogen gas. Multiplying 0.30 mol0.30\text{ mol} by the molar gas volume at STP (22.4 dm3 mol122.4\text{ dm}^3\text{ mol}^{-1}) yields exactly 6.72 dm36.72\text{ dm}^3.

Step-by-Step Solution

1
Calculate the amount in moles of aluminium that reacted
Moles of Al=5.4 g27 g mol1=0.20 mol\text{Moles of Al} = \frac{5.4\text{ g}}{27\text{ g mol}^{-1}} = 0.20\text{ mol}
Converting mass of reactant to moles is required to apply the stoichiometric mole ratio.
2
Determine the moles of hydrogen gas produced using the balanced chemical equation
Moles of H2=0.20 mol Al×3 mol H22 mol Al=0.30 mol H2\text{Moles of H}_2 = 0.20\text{ mol Al} \times \frac{3\text{ mol H}_2}{2\text{ mol Al}} = 0.30\text{ mol H}_2
The balanced chemical equation shows that 2 mol2\text{ mol} of Al\text{Al} produce 3 mol3\text{ mol} of H2\text{H}_2.
3
Calculate the volume of hydrogen gas produced at STP
Volume of H2=0.30 mol×22.4 dm3 mol1=6.72 dm3\text{Volume of H}_2 = 0.30\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 6.72\text{ dm}^3
At STP, one mole of any ideal gas occupies 22.4 dm322.4\text{ dm}^3.

Key Concept

Mass-Volume Stoichiometric Calculations at STP
Question 4Question
Consider the thermal decomposition of potassium trioxochlorate(V) represented by the balanced equation:
2KClO3(s)2KCl(s)+3O2(g)2KClO_3(s) \rightarrow 2KCl(s) + 3O_2(g)
What mass of KClO3KClO_3 is required to produce 6.72 dm36.72\text{ dm}^3 of oxygen gas measured at STP?
[K=39.0, Cl=35.5, O=16.0; Molar volume of gas at STP =22.4 dm3 mol1][K = 39.0,\text{ } Cl = 35.5,\text{ } O = 16.0;\text{ Molar volume of gas at STP } = 22.4\text{ dm}^3\text{ mol}^{-1}]
Show answer & explanation

Answer: 24.5 g24.5\text{ g}

Answer

24.5 g24.5\text{ g} of KClO3KClO_3 is required.
According to the balanced chemical equation, 2 moles2\text{ moles} of KClO3KClO_3 (245.0 g245.0\text{ g}) produce 3 moles3\text{ moles} of O2O_2 (67.2 dm367.2\text{ dm}^3 at STP). By direct proportion, 6.72 dm36.72\text{ dm}^3 of O2O_2 requires 6.7267.2×245.0=24.5 g\frac{6.72}{67.2} \times 245.0 = 24.5\text{ g} of KClO3KClO_3.

Step-by-Step Solution

1
Calculate the molar mass of KClO3KClO_3 and the total mass of 2 moles of KClO3KClO_3.
Molar mass of KClO3=39.0+35.5+3(16.0)=122.5 g mol1KClO_3 = 39.0 + 35.5 + 3(16.0) = 122.5\text{ g mol}^{-1}. Mass of 2 moles=2×122.5=245.0 g2\text{ moles} = 2 \times 122.5 = 245.0\text{ g}.
The balanced chemical equation shows 2 moles2\text{ moles} of KClO3KClO_3 undergo decomposition.
2
Calculate the volume of 3 moles of O2O_2 at STP.
Volume of 3 moles of O2=3×22.4 dm3=67.2 dm33\text{ moles of } O_2 = 3 \times 22.4\text{ dm}^3 = 67.2\text{ dm}^3.
At STP, 1 mole1\text{ mole} of any gas occupies 22.4 dm322.4\text{ dm}^3.
3
Set up a proportion to find the mass of KClO3KClO_3 needed to yield 6.72 dm36.72\text{ dm}^3 of O2O_2.
\text{Mass of } KClO_3 = \frac{6.72\text{ dm}^3}{67.2\text{ dm}^3} \times 245.0\text{ g} = 24.5\text{ g}.
Direct stoichiometric ratio relates mass of reactant to volume of gaseous product.

Key Concept

Mass-Volume Stoichiometry at STP
Question 5Question
When 6.62 g6.62\text{ g} of lead(II) trioxonitrate(V) is completely decomposed by heating according to the balanced chemical equation:
2Pb(NO3)2(s)2PbO(s)+4NO2(g)+O2(g)2Pb(NO_3)_2(s) \rightarrow 2PbO(s) + 4NO_2(g) + O_2(g)
What is the total volume of gaseous products liberated at STP?
[1 mole of gas at STP=22.4 dm31\text{ mole of gas at STP} = 22.4\text{ dm}^3; relative atomic masses: Pb=207Pb = 207, N=14N = 14, O=16O = 16]
Show answer & explanation

Answer: 1.12 dm31.12\text{ dm}^3

Answer

1.12 dm31.12\text{ dm}^3
The correct answer is 1.12 dm31.12\text{ dm}^3. Decomposing 6.62 g6.62\text{ g} (0.02 mol0.02\text{ mol}) of Pb(NO3)2Pb(NO_3)_2 yields 0.04 mol0.04\text{ mol} of NO2NO_2 and 0.01 mol0.01\text{ mol} of O2O_2, totaling 0.05 mol0.05\text{ mol} of gas. At STP, 0.05 mol×22.4 dm3 mol1=1.12 dm30.05\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 1.12\text{ dm}^3.

Step-by-Step Solution

1
Calculate the molar mass of lead(II) trioxonitrate(V), Pb(NO3)2Pb(NO_3)_2.
Molar Mass=207+2×(14+3×16)=331 g mol1\text{Molar Mass} = 207 + 2 \times (14 + 3 \times 16) = 331\text{ g mol}^{-1}.
Molar mass is needed to convert the given mass into moles of reactant.
2
Determine the amount (in moles) of Pb(NO3)2Pb(NO_3)_2 reacted.
n(Pb(NO3)2)=6.62 g331 g mol1=0.02 moln(Pb(NO_3)_2) = \frac{6.62\text{ g}}{331\text{ g mol}^{-1}} = 0.02\text{ mol}.
Quantitative stoichiometric relations require knowing the exact mole quantity of the reactant.
3
Identify the total mole ratio of gaseous products to reactant from the balanced chemical equation.
2 moles Pb(NO3)24 moles NO2(g)+1 mole O2(g)=5 moles of total gas2\text{ moles } Pb(NO_3)_2 \rightarrow 4\text{ moles } NO_2(g) + 1\text{ mole } O_2(g) = 5\text{ moles of total gas}. Total gas mole ratio =52=2.5= \frac{5}{2} = 2.5.
Both NO2NO_2 and O2O_2 are gases at STP, so both contribute to the total volume evolved.
4
Calculate the total moles and volume of gas liberated at STP.
Total moles of gas=0.02×2.5=0.05 mol\text{Total moles of gas} = 0.02 \times 2.5 = 0.05\text{ mol}. Total volume at STP=0.05 mol×22.4 dm3 mol1=1.12 dm3\text{Total volume at STP} = 0.05\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 1.12\text{ dm}^3.
Multiplying total gaseous moles by the standard molar gas volume gives the total volume at STP.

Key Concept

Mass-Volume Stoichiometric Calculation for Reaction Systems Yielding Multiple Gaseous Products
Question 6Question

What volume of hydrogen gas, measured at STP, is produced when 4.8 g4.8\text{ g} of magnesium ribbon reacts completely with excess dilute tetraoxosulfate(VI) acid according to the chemical equation below?

Mg(s)+H2SO4(aq)MgSO4(aq)+H2(g)Mg(s) + H_2SO_4(aq) \rightarrow MgSO_4(aq) + H_2(g)

[Mg=24,Molar volume of gas at STP=22.4 dm3mol1][Mg = 24, \text{Molar volume of gas at STP} = 22.4\text{ dm}^3\text{mol}^{-1}]

Show answer & explanation

Answer: 4.48

Answer

The volume of hydrogen gas produced at STP is 4.48 dm34.48\text{ dm}^3.
From the stoichiometric relationship in the balanced reaction Mg(s)+H2SO4(aq)MgSO4(aq)+H2(g)Mg(s) + H_2SO_4(aq) \rightarrow MgSO_4(aq) + H_2(g), 1 mol1\text{ mol} of MgMg (24 g24\text{ g}) produces 1 mol1\text{ mol} of H2H_2 gas (22.4 dm322.4\text{ dm}^3 at STP). For 4.8 g4.8\text{ g} of MgMg, the number of moles is 4.824=0.20 mol\frac{4.8}{24} = 0.20\text{ mol}. Multiplying by the molar gas volume gives 0.20×22.4=4.48 dm30.20 \times 22.4 = 4.48\text{ dm}^3 of H2H_2 gas.

Step-by-Step Solution

1
Calculate the amount in moles of magnesium (MgMg) reacted.
n(Mg)=4.8 g24 g mol1=0.20 moln(Mg) = \frac{4.8\text{ g}}{24\text{ g mol}^{-1}} = 0.20\text{ mol}
Dividing given mass by relative atomic mass yields the number of moles.
2
Determine the amount in moles of hydrogen gas (H2H_2) produced.
n(H2)=0.20 moln(H_2) = 0.20\text{ mol}
The balanced chemical equation shows a 1:11:1 stoichiometric molar ratio between MgMg and H2H_2.
3
Calculate the volume of H2H_2 gas at STP.
V(H2)=0.20 mol×22.4 dm3mol1=4.48 dm3V(H_2) = 0.20\text{ mol} \times 22.4\text{ dm}^3\text{mol}^{-1} = 4.48\text{ dm}^3
At standard temperature and pressure (STP), one mole of any gas occupies 22.4 dm322.4\text{ dm}^3.

Key Concept

Mass-Volume stoichiometric calculation at STP
Question 7Question
Consider the balanced chemical equation for the complete combustion of ethane gas:
2C2H6(g)+7O2(g)4CO2(g)+6H2O(g)2C_2H_6(g) + 7O_2(g) \rightarrow 4CO_2(g) + 6H_2O(g)
What volume of oxygen gas, measured at STP, is required to react completely with 0.5 mol0.5\text{ mol} of ethane? Complete the statement below with the calculated numerical value.

Fill in the blanks below

The volume of oxygen gas required at STP is dm3\text{dm}^3. (Molar gas volume at STP = 22.4 dm3mol122.4\text{ dm}^3\text{mol}^{-1})
Show answer & explanation

Answer

39.2 dm³ (or 39.2)
According to the balanced equation 2C2H6(g)+7O2(g)4CO2(g)+6H2O(g)2C_2H_6(g) + 7O_2(g) \rightarrow 4CO_2(g) + 6H_2O(g), 2 moles2\text{ moles} of ethane require 7 moles7\text{ moles} of oxygen gas for complete combustion. Therefore, 0.5 mol0.5\text{ mol} of ethane requires 0.5×72=1.75 mol\frac{0.5 \times 7}{2} = 1.75\text{ mol} of oxygen gas. At standard temperature and pressure (STP), 1 mole1\text{ mole} of gas occupies 22.4 dm322.4\text{ dm}^3. Thus, the volume of oxygen gas required is 1.75 mol×22.4 dm3mol1=39.2 dm31.75\text{ mol} \times 22.4\text{ dm}^3\text{mol}^{-1} = 39.2\text{ dm}^3.

Step-by-Step Solution

1
Identify the stoichiometric mole ratio between ethane and oxygen from the balanced equation
From 2C2H6+7O22C_2H_6 + 7O_2, the mole ratio of C2H6C_2H_6 to O2O_2 is 2:72 : 7.
Stoichiometric coefficients represent the relative mole proportions of reactants.
2
Calculate the moles of oxygen gas needed for 0.5 mol of ethane
Moles of O2=0.5 mol×72=1.75 molO_2 = 0.5\text{ mol} \times \frac{7}{2} = 1.75\text{ mol}
Multiplying the given amount of ethane by the stoichiometric factor gives the required moles of oxygen.
3
Convert the calculated moles of oxygen gas to volume at STP
Volume of O2=1.75 mol×22.4 dm3mol1=39.2 dm3O_2 = 1.75\text{ mol} \times 22.4\text{ dm}^3\text{mol}^{-1} = 39.2\text{ dm}^3
One mole of any ideal gas occupies 22.4 dm322.4\text{ dm}^3 at STP.

Key Concept

Mole-Volume Stoichiometric Calculations at STP
Question 8Question
Sodium hydrogentrioxocarbonate(IV) decomposes upon heating according to the balanced chemical equation:
2NaHCO3(s)Na2CO3(s)+H2O(l)+CO2(g)2NaHCO_3(s) \rightarrow Na_2CO_3(s) + H_2O(l) + CO_2(g)
What mass of sodium trioxocarbonate(IV) (Na2CO3Na_2CO_3) is produced by the complete decomposition of 16.8 g16.8\text{ g} of NaHCO3NaHCO_3?
[Na=23,C=12,O=16,H=1][Na = 23, C = 12, O = 16, H = 1]
Show answer & explanation

Answer: 10.6 g10.6\text{ g}

Answer

The mass of sodium trioxocarbonate(IV) produced is 10.6 g10.6\text{ g}.
The complete decomposition of 16.8 g16.8\text{ g} (0.20 mol0.20\text{ mol}) of NaHCO3NaHCO_3 produces 0.10 mol0.10\text{ mol} of Na2CO3Na_2CO_3 according to the 2:12:1 mole ratio in the balanced equation. Multiplying 0.10 mol0.10\text{ mol} by the molar mass of Na2CO3Na_2CO_3 (106 g mol1106\text{ g mol}^{-1}) gives 10.6 g10.6\text{ g}.

Step-by-Step Solution

1
Calculate the molar masses of NaHCO3NaHCO_3 and Na2CO3Na_2CO_3
Molar mass of NaHCO3=23+1+12+3(16)=84 g mol1NaHCO_3 = 23 + 1 + 12 + 3(16) = 84\text{ g mol}^{-1}. Molar mass of Na2CO3=2(23)+12+3(16)=106 g mol1Na_2CO_3 = 2(23) + 12 + 3(16) = 106\text{ g mol}^{-1}.
Molar masses are required to convert between mass and mole amounts.
2
Determine the number of moles of NaHCO3NaHCO_3 reacted
\text{Moles of } NaHCO_3 = \frac{16.8\text{ g}}{84\text{ g mol}^{-1}} = 0.20\text{ mol}.
Stoichiometric relations are calculated using mole amounts rather than raw masses.
3
Use the mole ratio from the balanced chemical equation to find moles of Na2CO3Na_2CO_3
From 2NaHCO3Na2CO32NaHCO_3 \rightarrow Na_2CO_3, ratio is 2:12:1. Therefore, \text{moles of } Na_2CO_3 = \frac{0.20}{2} = 0.10\text{ mol}.
Two moles of NaHCO3NaHCO_3 produce one mole of Na2CO3Na_2CO_3.
4
Calculate the mass of Na2CO3Na_2CO_3 produced
\text{Mass of } Na_2CO_3 = 0.10\text{ mol} \times 106\text{ g mol}^{-1} = 10.6\text{ g}.
Multiplying moles of product by its molar mass yields the theoretical yield mass.

Key Concept

Mass-Mass Stoichiometric Calculations
Estimated Time:1m 30s
Question 9Question

What volume of chlorine gas, measured at STP, is required for the complete reaction with a given mass of iron metal?

Fill in the blanks below

When 11.2 g11.2\text{ g} of iron reacts completely with excess dry chlorine gas according to the balanced equation:
2Fe(s)+3Cl2(g)2FeCl3(s)2Fe(s) + 3Cl_2(g) \rightarrow 2FeCl_3(s)
the volume of chlorine gas consumed at STP is
dm3\text{dm}^3.
[Relative atomic mass: Fe=56\text{Fe} = 56; Molar gas volume at STP =22.4 dm3 mol1= 22.4\text{ dm}^3\text{ mol}^{-1}]
Show answer & explanation

Answer

The volume of chlorine gas consumed at STP is 6.72 dm36.72\text{ dm}^3.
To find the volume of Cl2Cl_2 gas consumed at STP, first determine the amount of FeFe in moles: Moles of Fe=11.2 g56 g mol1=0.20 mol\text{Moles of } Fe = \frac{11.2\text{ g}}{56\text{ g mol}^{-1}} = 0.20\text{ mol}. From the balanced equation 2Fe(s)+3Cl2(g)2FeCl3(s)2Fe(s) + 3Cl_2(g) \rightarrow 2FeCl_3(s), 2 moles of Fe2\text{ moles of } Fe react with 3 moles of Cl23\text{ moles of } Cl_2. Therefore, 0.20 mol of Fe0.20\text{ mol of } Fe requires 0.20×32=0.30 mol of Cl20.20 \times \frac{3}{2} = 0.30\text{ mol of } Cl_2. At STP, 1 mole of gas1\text{ mole of gas} occupies 22.4 dm322.4\text{ dm}^3, so the volume of Cl2Cl_2 is 0.30 mol×22.4 dm3 mol1=6.72 dm30.30\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 6.72\text{ dm}^3.

Step-by-Step Solution

1
Calculate the number of moles of iron reacted
Moles of Fe=11.2 g56 g mol1=0.20 mol\text{Moles of } Fe = \frac{11.2\text{ g}}{56\text{ g mol}^{-1}} = 0.20\text{ mol}
Convert the mass of iron to moles using its relative atomic mass.
2
Determine the moles of chlorine gas (Cl2Cl_2) required using the stoichiometric mole ratio
Moles of Cl2=0.20 mol Fe×3 mol Cl22 mol Fe=0.30 mol\text{Moles of } Cl_2 = 0.20\text{ mol } Fe \times \frac{3\text{ mol } Cl_2}{2\text{ mol } Fe} = 0.30\text{ mol}
The balanced chemical equation shows that 2 moles of Fe2\text{ moles of } Fe react with 3 moles of Cl23\text{ moles of } Cl_2 (a 2:32:3 mole ratio).
3
Calculate the volume of Cl2Cl_2 gas consumed at STP
Volume of Cl2=0.30 mol×22.4 dm3 mol1=6.72 dm3\text{Volume of } Cl_2 = 0.30\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 6.72\text{ dm}^3
Multiply the number of moles of Cl2Cl_2 by the molar volume of a gas at STP.

Key Concept

Mass-Volume Stoichiometric Calculations at STP
Estimated Time:2m 0s
Question 10Question

Complete the statement by calculating the required volume of gas at STP and the mass of metal produced in the following reduction reaction.

Fill in the blanks below

When 16.0 g16.0\text{ g} of iron(III) oxide (Fe2O3Fe_2O_3) is completely reduced by carbon monoxide gas according to the equation:
Fe2O3(s)+3CO(g)2Fe(s)+3CO2(g)Fe_2O_3(s) + 3CO(g) \rightarrow 2Fe(s) + 3CO_2(g)
the volume of carbon monoxide gas consumed at STP is
, and the mass of iron metal produced is .

[Relative atomic masses: Fe=56\text{Fe} = 56, O=16\text{O} = 16; Molar volume of gas at STP =22.4 dm3 mol1= 22.4\text{ dm}^3\text{ mol}^{-1}]
Show answer & explanation

Answer

The volume of carbon monoxide consumed at STP is 6.72 dm36.72\text{ dm}^3 and the mass of iron metal produced is 11.2 g11.2\text{ g}.
Based on the stoichiometry of the reaction Fe2O3(s)+3CO(g)2Fe(s)+3CO2(g)Fe_2O_3(s) + 3CO(g) \rightarrow 2Fe(s) + 3CO_2(g), 1 mol1\text{ mol} (160 g160\text{ g}) of Fe2O3Fe_2O_3 reacts with 3 mol3\text{ mol} (0.30 mol0.30\text{ mol} for 16.0 g16.0\text{ g}) of COCO gas, yielding a volume of 6.72 dm36.72\text{ dm}^3 at STP, and produces 2 mol2\text{ mol} (0.20 mol0.20\text{ mol} for 16.0 g16.0\text{ g}) of FeFe, corresponding to 11.2 g11.2\text{ g}.

Step-by-Step Solution

1
Calculate the molar mass of Fe2O3Fe_2O_3 and determine the number of moles of Fe2O3Fe_2O_3 present.
Molar mass of Fe2O3=(2×56)+(3×16)=160 g mol1Fe_2O_3 = (2 \times 56) + (3 \times 16) = 160\text{ g mol}^{-1}. Moles of Fe2O3=16.0 g160 g mol1=0.10 molFe_2O_3 = \frac{16.0\text{ g}}{160\text{ g mol}^{-1}} = 0.10\text{ mol}.
Converting given mass to moles is required for stoichiometric mole-ratio calculations.
2
Use the mole ratio from the balanced equation to find the moles and volume of CO(g)CO(g) required at STP.
From the balanced equation, 1 mol Fe2O31\text{ mol } Fe_2O_3 reacts with 3 mol CO3\text{ mol } CO.
Moles of CO=3×0.10 mol=0.30 molCO = 3 \times 0.10\text{ mol} = 0.30\text{ mol}.
Volume of COCO at STP =0.30 mol×22.4 dm3 mol1=6.72 dm3= 0.30\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 6.72\text{ dm}^3.
Gas volume at STP is obtained by multiplying moles of gas by the molar volume (22.4 dm3 mol122.4\text{ dm}^3\text{ mol}^{-1}).
3
Use the mole ratio from the balanced equation to calculate the mass of iron (FeFe) produced.
From the equation, 1 mol Fe2O31\text{ mol } Fe_2O_3 produces 2 mol Fe2\text{ mol } Fe.
Moles of Fe=2×0.10 mol=0.20 molFe = 2 \times 0.10\text{ mol} = 0.20\text{ mol}.
Mass of Fe=0.20 mol×56 g mol1=11.2 gFe = 0.20\text{ mol} \times 56\text{ g mol}^{-1} = 11.2\text{ g}.
Mass of product is calculated by multiplying its moles by its relative atomic mass.

Key Concept

Mass-Mass and Mass-Volume Stoichiometric Calculations
Question 11Question
Consider the catalytic oxidation of ammonia gas represented by the balanced chemical equation below:
4NH3(g)+5O2(g)4NO(g)+6H2O(g)4NH_3(g) + 5O_2(g) \rightarrow 4NO(g) + 6H_2O(g)
If 6.8 g6.8\text{ g} of ammonia gas reacts completely with excess oxygen gas at STP, calculate the volume of nitrogen(II) oxide gas and the volume of steam produced.
[H=1,N=14,O=16,Molar volume of gas at STP=22.4 dm3 mol1][H = 1, N = 14, O = 16, \text{Molar volume of gas at STP} = 22.4\text{ dm}^3\text{ mol}^{-1}]
Fill in the missing values in the statement below.

Fill in the blanks below

The volume of nitrogen(II) oxide gas (NONO) produced at STP is dm³, and the volume of steam (H2OH_2O) produced at STP is dm³.
Show answer & explanation

Answer

The volume of nitrogen(II) oxide produced at STP is 8.96 dm³ and the volume of steam produced at STP is 13.44 dm³.
Molar mass of ammonia is 17 g/mol, meaning 6.8 g equals 0.4 mol of ammonia. According to the balanced equation, 4 moles of ammonia produce 4 moles of nitrogen(II) oxide gas and 6 moles of steam. Thus, 0.4 mol of ammonia yields 0.4 mol of nitrogen(II) oxide gas (0.4 * 22.4 = 8.96 dm³) and 0.6 mol of steam (0.6 * 22.4 = 13.44 dm³).

Step-by-Step Solution

1
Calculate the molar mass of ammonia (NH3NH_3)
Molar mass of NH3=14+(3×1)=17 g mol1NH_3 = 14 + (3 \times 1) = 17\text{ g mol}^{-1}
Required to convert the given mass of reactant into moles.
2
Calculate the number of moles of NH3NH_3 reacted
\text{Moles of } NH_3 = \frac{6.8\text{ g}}{17\text{ g mol}^{-1}} = 0.4\text{ mol}
Stoichiometric relations in chemical equations are expressed in mole ratios.
3
Determine the moles of NO(g)NO(g) and H2O(g)H_2O(g) produced using stoichiometric coefficients
From the balanced equation, 4 mol NH34 mol NO4\text{ mol } NH_3 \rightarrow 4\text{ mol } NO, so 0.4 mol NH30.4 mol NO0.4\text{ mol } NH_3 \rightarrow 0.4\text{ mol } NO.
Also, 4 mol NH36 mol H2O(g)4\text{ mol } NH_3 \rightarrow 6\text{ mol } H_2O(g), so Moles of H2O=64×0.4=0.6 mol\text{Moles of } H_2O = \frac{6}{4} \times 0.4 = 0.6\text{ mol}.
The coefficients in the balanced equation define the molar ratio between reactants and products.
4
Convert the moles of each gaseous product to volume at STP using molar gas volume
\text{Volume of } NO = 0.4\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 8.96\text{ dm}^3 Volume of H2O=0.6 mol×22.4 dm3 mol1=13.44 dm3 \text{Volume of } H_2O = 0.6\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 13.44\text{ dm}^3
At STP, 1 mole1\text{ mole} of any ideal gas occupies 22.4 dm322.4\text{ dm}^3.

Key Concept

Mass-Volume Stoichiometry at STP
Estimated Time:2m 0s
Question 12Question
Potassium trioxonitrate(V) decomposes upon heating according to the balanced chemical equation:
2KNO3(s)2KNO2(s)+O2(g)2KNO_3(s) \rightarrow 2KNO_2(s) + O_2(g)
What volume of oxygen gas measured at STP is produced by the complete thermal decomposition of 50.5 g50.5\text{ g} of KNO3KNO_3?
[K=39,N=14,O=16; Molar gas volume at STP =22.4 dm3 mol1][K = 39, N = 14, O = 16\text{; Molar gas volume at STP } = 22.4\text{ dm}^3\text{ mol}^{-1}]
Show answer & explanation

Answer: 5.6 dm35.6\text{ dm}^3

Answer

The correct volume of oxygen gas produced at STP is 5.6 dm35.6\text{ dm}^3.
The complete decomposition of 50.5 g50.5\text{ g} (0.5 mol0.5\text{ mol}) of KNO3KNO_3 yields 0.25 mol0.25\text{ mol} of O2O_2 gas according to the 2:12:1 stoichiometric mole ratio. Multiplying 0.25 mol0.25\text{ mol} by the standard molar gas volume at STP (22.4 dm3 mol122.4\text{ dm}^3\text{ mol}^{-1}) gives 5.6 dm35.6\text{ dm}^3.

Step-by-Step Solution

1
Calculate the molar mass of KNO3KNO_3
Molar mass of KNO3=39+14+(3×16)=101 g mol1KNO_3 = 39 + 14 + (3 \times 16) = 101\text{ g mol}^{-1}
Molar mass is needed to convert the given mass of reactant into moles.
2
Calculate the number of moles of KNO3KNO_3 reacted
\text{Moles of } KNO_3 = \frac{50.5\text{ g}}{101\text{ g mol}^{-1}} = 0.5\text{ mol}
Determines the exact mole amount of reactant supplied.
3
Use the mole ratio from the balanced equation to find moles of O2O_2 produced
\text{Moles of } O_2 = \frac{1}{2} \times 0.5\text{ mol} = 0.25\text{ mol}
The equation shows that 2 moles2\text{ moles} of KNO3KNO_3 yield 1 mole1\text{ mole} of O2O_2.
4
Convert moles of O2O_2 to volume at STP
\text{Volume of } O_2 = 0.25\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 5.6\text{ dm}^3
Molar gas volume at standard temperature and pressure (STP) is 22.4 dm3 mol122.4\text{ dm}^3\text{ mol}^{-1}.

Key Concept

Mass-Volume Stoichiometric Calculations at STP
Estimated Time:1m 30s
Question 13Question
Propane burns completely in oxygen gas according to the following balanced chemical equation:
C3H8(g)+5O2(g)3CO2(g)+4H2O(l)C_3H_8(g) + 5O_2(g) \rightarrow 3CO_2(g) + 4H_2O(l)
What volume of oxygen gas, measured at STP, is required for the complete combustion of 4.4 g4.4\text{ g} of propane?
[H=1.0,C=12.0;Molar volume of gas at STP=22.4 dm3 mol1][\text{H} = 1.0, \text{C} = 12.0; \text{Molar volume of gas at STP} = 22.4\text{ dm}^3\text{ mol}^{-1}]
Show answer & explanation

Answer: 11.2 dm311.2\text{ dm}^3

Answer

The volume of oxygen gas required at STP is 11.2 dm311.2\text{ dm}^3.
The option stating 11.2 dm311.2\text{ dm}^3 is correct. 4.4 g4.4\text{ g} of propane corresponds to 0.10 mol0.10\text{ mol}. According to the balanced equation, 1 mol1\text{ mol} of C3H8C_3H_8 reacts with 5 mol5\text{ mol} of O2O_2, so 0.10 mol0.10\text{ mol} of propane requires 0.50 mol0.50\text{ mol} of O2O_2. At STP, 0.50 mol×22.4 dm3 mol1=11.2 dm30.50\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 11.2\text{ dm}^3.

Step-by-Step Solution

1
Calculate the molar mass of propane (C3H8C_3H_8).
Molar mass of C3H8=(3×12.0)+(8×1.0)=36.0+8.0=44.0 g mol1C_3H_8 = (3 \times 12.0) + (8 \times 1.0) = 36.0 + 8.0 = 44.0\text{ g mol}^{-1}.
Molar mass is needed to convert the given mass of reactant into moles.
2
Determine the number of moles of propane in 4.4 g4.4\text{ g}.
Moles of C3H8=4.4 g44.0 g mol1=0.10 molC_3H_8 = \frac{4.4\text{ g}}{44.0\text{ g mol}^{-1}} = 0.10\text{ mol}.
Stoichiometric calculations rely on mole ratios from the balanced chemical equation.
3
Use the mole ratio from the balanced equation to find the required moles of O2O_2.
Mole ratio C3H8:O2=1:5C_3H_8 : O_2 = 1 : 5. Moles of O2=0.10 mol×5=0.50 molO_2 = 0.10\text{ mol} \times 5 = 0.50\text{ mol}.
Every 1 mole1\text{ mole} of propane requires 5 moles5\text{ moles} of oxygen gas for complete combustion.
4
Calculate the volume of O2O_2 gas at STP.
Volume of O2=0.50 mol×22.4 dm3 mol1=11.2 dm3O_2 = 0.50\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 11.2\text{ dm}^3.
Multiply the calculated number of moles of gas by the molar volume at STP (22.4 dm3 mol122.4\text{ dm}^3\text{ mol}^{-1}).

Key Concept

Mass-Volume Stoichiometric Calculations at STP
Estimated Time:1m 30s
Chemical Equations and Stoichiometric Calculations (Mass-Mass, Mass-Volume, Mole Relations) Practice Questions — JAMB UTME | Examkin