Chemical Combination and Stoichiometry

77 questions

Question 61Question
Consider the catalytic oxidation of ammonia gas represented by the balanced chemical equation below:
4NH3(g)+5O2(g)4NO(g)+6H2O(g)4NH_3(g) + 5O_2(g) \rightarrow 4NO(g) + 6H_2O(g)
If 6.8 g6.8\text{ g} of ammonia gas reacts completely with excess oxygen gas at STP, calculate the volume of nitrogen(II) oxide gas and the volume of steam produced.
[H=1,N=14,O=16,Molar volume of gas at STP=22.4 dm3 mol1][H = 1, N = 14, O = 16, \text{Molar volume of gas at STP} = 22.4\text{ dm}^3\text{ mol}^{-1}]
Fill in the missing values in the statement below.

Fill in the blanks below

The volume of nitrogen(II) oxide gas (NONO) produced at STP is dm³, and the volume of steam (H2OH_2O) produced at STP is dm³.
Show answer & explanation

Answer

The volume of nitrogen(II) oxide produced at STP is 8.96 dm³ and the volume of steam produced at STP is 13.44 dm³.
Molar mass of ammonia is 17 g/mol, meaning 6.8 g equals 0.4 mol of ammonia. According to the balanced equation, 4 moles of ammonia produce 4 moles of nitrogen(II) oxide gas and 6 moles of steam. Thus, 0.4 mol of ammonia yields 0.4 mol of nitrogen(II) oxide gas (0.4 * 22.4 = 8.96 dm³) and 0.6 mol of steam (0.6 * 22.4 = 13.44 dm³).

Step-by-Step Solution

1
Calculate the molar mass of ammonia (NH3NH_3)
Molar mass of NH3=14+(3×1)=17 g mol1NH_3 = 14 + (3 \times 1) = 17\text{ g mol}^{-1}
Required to convert the given mass of reactant into moles.
2
Calculate the number of moles of NH3NH_3 reacted
\text{Moles of } NH_3 = \frac{6.8\text{ g}}{17\text{ g mol}^{-1}} = 0.4\text{ mol}
Stoichiometric relations in chemical equations are expressed in mole ratios.
3
Determine the moles of NO(g)NO(g) and H2O(g)H_2O(g) produced using stoichiometric coefficients
From the balanced equation, 4 mol NH34 mol NO4\text{ mol } NH_3 \rightarrow 4\text{ mol } NO, so 0.4 mol NH30.4 mol NO0.4\text{ mol } NH_3 \rightarrow 0.4\text{ mol } NO.
Also, 4 mol NH36 mol H2O(g)4\text{ mol } NH_3 \rightarrow 6\text{ mol } H_2O(g), so Moles of H2O=64×0.4=0.6 mol\text{Moles of } H_2O = \frac{6}{4} \times 0.4 = 0.6\text{ mol}.
The coefficients in the balanced equation define the molar ratio between reactants and products.
4
Convert the moles of each gaseous product to volume at STP using molar gas volume
\text{Volume of } NO = 0.4\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 8.96\text{ dm}^3 Volume of H2O=0.6 mol×22.4 dm3 mol1=13.44 dm3 \text{Volume of } H_2O = 0.6\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 13.44\text{ dm}^3
At STP, 1 mole1\text{ mole} of any ideal gas occupies 22.4 dm322.4\text{ dm}^3.

Key Concept

Mass-Volume Stoichiometry at STP
Estimated Time:2m 0s
Question 62Question
Potassium trioxonitrate(V) decomposes upon heating according to the balanced chemical equation:
2KNO3(s)2KNO2(s)+O2(g)2KNO_3(s) \rightarrow 2KNO_2(s) + O_2(g)
What volume of oxygen gas measured at STP is produced by the complete thermal decomposition of 50.5 g50.5\text{ g} of KNO3KNO_3?
[K=39,N=14,O=16; Molar gas volume at STP =22.4 dm3 mol1][K = 39, N = 14, O = 16\text{; Molar gas volume at STP } = 22.4\text{ dm}^3\text{ mol}^{-1}]
Show answer & explanation

Answer: 5.6 dm35.6\text{ dm}^3

Answer

The correct volume of oxygen gas produced at STP is 5.6 dm35.6\text{ dm}^3.
The complete decomposition of 50.5 g50.5\text{ g} (0.5 mol0.5\text{ mol}) of KNO3KNO_3 yields 0.25 mol0.25\text{ mol} of O2O_2 gas according to the 2:12:1 stoichiometric mole ratio. Multiplying 0.25 mol0.25\text{ mol} by the standard molar gas volume at STP (22.4 dm3 mol122.4\text{ dm}^3\text{ mol}^{-1}) gives 5.6 dm35.6\text{ dm}^3.

Step-by-Step Solution

1
Calculate the molar mass of KNO3KNO_3
Molar mass of KNO3=39+14+(3×16)=101 g mol1KNO_3 = 39 + 14 + (3 \times 16) = 101\text{ g mol}^{-1}
Molar mass is needed to convert the given mass of reactant into moles.
2
Calculate the number of moles of KNO3KNO_3 reacted
\text{Moles of } KNO_3 = \frac{50.5\text{ g}}{101\text{ g mol}^{-1}} = 0.5\text{ mol}
Determines the exact mole amount of reactant supplied.
3
Use the mole ratio from the balanced equation to find moles of O2O_2 produced
\text{Moles of } O_2 = \frac{1}{2} \times 0.5\text{ mol} = 0.25\text{ mol}
The equation shows that 2 moles2\text{ moles} of KNO3KNO_3 yield 1 mole1\text{ mole} of O2O_2.
4
Convert moles of O2O_2 to volume at STP
\text{Volume of } O_2 = 0.25\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 5.6\text{ dm}^3
Molar gas volume at standard temperature and pressure (STP) is 22.4 dm3 mol122.4\text{ dm}^3\text{ mol}^{-1}.

Key Concept

Mass-Volume Stoichiometric Calculations at STP
Estimated Time:1m 30s
Question 63Question
Phosphorus reacts with oxygen gas to produce phosphorus(V) oxide according to the balanced chemical equation:
4P(s)+5O2(g)P4O10(s)4\text{P}_{(s)} + 5\text{O}_{2(g)} \rightarrow \text{P}_4\text{O}_{10(s)}
If a mixture containing 12.4 g12.4\text{ g} of phosphorus and 20.0 g20.0\text{ g} of oxygen gas is allowed to react to completion, what is the mass of the excess reactant remaining unreacted in grams? [P=31.0,O=16.0][\text{P} = 31.0, \text{O} = 16.0]
Show answer & explanation

Answer: 4

Answer

The mass of unreacted excess oxygen gas remaining is 4.0 g4.0\text{ g}.
The correct calculation shows that 0.40 mol0.40\text{ mol} of phosphorus requires 0.50 mol0.50\text{ mol} of oxygen gas for complete reaction according to the 4:54:5 mole ratio in 4P+5O2P4O104\text{P} + 5\text{O}_2 \rightarrow \text{P}_4\text{O}_{10}. Subtracting the 0.50 mol0.50\text{ mol} consumed from the initial 0.625 mol0.625\text{ mol} leaves 0.125 mol0.125\text{ mol} of unreacted oxygen gas, which equals 4.0 g4.0\text{ g}.

Step-by-Step Solution

1
Calculate the moles of phosphorus and oxygen gas present initially.
Moles of P=12.4 g31.0 g/mol=0.40 mol\text{Moles of P} = \frac{12.4\text{ g}}{31.0\text{ g/mol}} = 0.40\text{ mol}; Moles of O2=20.0 g32.0 g/mol=0.625 mol\text{Moles of O}_2 = \frac{20.0\text{ g}}{32.0\text{ g/mol}} = 0.625\text{ mol}.
Molar mass of P\text{P} is 31.0 g/mol31.0\text{ g/mol} and molar mass of O2\text{O}_2 is 2×16.0=32.0 g/mol2 \times 16.0 = 32.0\text{ g/mol}.
2
Determine the limiting reactant by comparing the required mole ratio to the available mole ratio.
P\text{P} is the limiting reactant, and O2\text{O}_2 is the excess reactant.
From the balanced equation, 4 moles of P4\text{ moles of P} require 5 moles of O25\text{ moles of O}_2, so 1 mole of P1\text{ mole of P} requires 1.25 moles of O21.25\text{ moles of O}_2. Thus, 0.40 mol0.40\text{ mol} of P\text{P} requires 0.40×1.25=0.50 mol0.40 \times 1.25 = 0.50\text{ mol} of O2\text{O}_2. Since 0.625 mol0.625\text{ mol} of O2\text{O}_2 is available, O2\text{O}_2 is in excess.
3
Calculate the unreacted moles of oxygen gas remaining.
\text{Excess moles of O}_2 = 0.625\text{ mol} - 0.50\text{ mol} = 0.125\text{ mol}.
Subtracting the reacted moles from the initial moles gives the remaining amount.
4
Convert the unreacted moles of oxygen gas to mass in grams.
\text{Mass of remaining O}_2 = 0.125\text{ mol} \times 32.0\text{ g/mol} = 4.0\text{ g}.
Multiplying the excess moles by the molar mass of O2\text{O}_2 (32.0 g/mol32.0\text{ g/mol}) gives the mass in grams.

Key Concept

Limiting and excess reactant stoichiometry
Question 64Question

What is the volume, in dm3\text{dm}^3, occupied by 6.80 g6.80\text{ g} of hydrogen sulfide gas (H2S\text{H}_2\text{S}) measured at standard temperature and pressure (STP)? [H=1.0,S=32.0,Molar volume of gas at STP=22.4 dm3mol1][\text{H} = 1.0, \text{S} = 32.0, \text{Molar volume of gas at STP} = 22.4\text{ dm}^3\text{mol}^{-1}]

Show answer & explanation

Answer: 4.48 dm34.48\text{ dm}^3

Answer

The volume occupied by 6.80 g6.80\text{ g} of hydrogen sulfide gas at STP is 4.48 dm34.48\text{ dm}^3.
To find the volume of gas at STP, first determine the molar mass of H2S\text{H}_2\text{S}: (2×1.0)+32.0=34.0 g mol1(2 \times 1.0) + 32.0 = 34.0\text{ g mol}^{-1}. Next, convert the mass to moles: 6.80 g34.0 g mol1=0.20 mol\frac{6.80\text{ g}}{34.0\text{ g mol}^{-1}} = 0.20\text{ mol}. Finally, multiply the moles by the molar volume at STP (22.4 dm3mol122.4\text{ dm}^3\text{mol}^{-1}): 0.20×22.4=4.48 dm30.20 \times 22.4 = 4.48\text{ dm}^3.

Step-by-Step Solution

1
Calculate the molar mass of hydrogen sulfide (H2S\text{H}_2\text{S})
Molar Mass=(2×1.0)+32.0=34.0 g mol1\text{Molar Mass} = (2 \times 1.0) + 32.0 = 34.0\text{ g mol}^{-1}
Molar mass is required to convert mass to moles.
2
Calculate the number of moles in 6.80 g6.80\text{ g} of H2S\text{H}_2\text{S}
Moles=6.80 g34.0 g mol1=0.20 mol\text{Moles} = \frac{6.80\text{ g}}{34.0\text{ g mol}^{-1}} = 0.20\text{ mol}
Dividing given mass by molar mass yields amount of substance in moles.
3
Calculate the volume occupied at STP
Volume=0.20 mol×22.4 dm3mol1=4.48 dm3\text{Volume} = 0.20\text{ mol} \times 22.4\text{ dm}^3\text{mol}^{-1} = 4.48\text{ dm}^3
1 mole of any ideal gas occupies 22.4 dm322.4\text{ dm}^3 at STP.

Key Concept

Molar Volume of Gases at STP
Estimated Time:1m 30s
Question 65Question
Calcium carbide reacts with water according to the balanced chemical equation:
CaC2(s)+2H2O(l)Ca(OH)2(aq)+C2H2(g)\text{CaC}_{2(s)} + 2\text{H}_2\text{O}_{(l)} \rightarrow \text{Ca(OH)}_{2(aq)} + \text{C}_2\text{H}_{2(g)}
If 32.0 g32.0\text{ g} of CaC2\text{CaC}_2 is reacted with 21.6 g21.6\text{ g} of H2O\text{H}_2\text{O}, calculate the mass of the excess reactant remaining unreacted upon completion of the reaction. [Relative atomic masses: Ca=40,C=12,O=16,H=1][\text{Relative atomic masses: } \text{Ca} = 40, \text{C} = 12, \text{O} = 16, \text{H} = 1]
Show answer & explanation

Answer: 3.6

Answer

3.6 g
Converting initial masses to mole values yields 0.50 mol of CaC₂ and 1.20 mol of H₂O. Based on the 1:2 mole ratio in the balanced equation, 0.50 mol of CaC₂ requires 1.00 mol of H₂O to react completely. This leaves 0.20 mol of H₂O unreacted. Converting 0.20 mol of H₂O to mass gives 0.20 mol × 18 g/mol = 3.6 g of excess reactant remaining.

Step-by-Step Solution

1
Calculate molar masses of CaC₂ and H₂O
Molar mass of CaC₂ = 64 g/mol; Molar mass of H₂O = 18 g/mol
Molar mass is required to convert given mass values into mole quantities.
2
Convert initial masses to moles
Moles of CaC₂ = 0.50 mol; Moles of H₂O = 1.20 mol
Stoichiometric relationships depend strictly on mole ratios rather than direct mass ratios.
3
Determine limiting and excess reactants using mole ratios
CaC₂ is the limiting reactant; H₂O is in excess
According to the balanced equation coefficient ratio (1:2), 0.50 mol of CaC₂ requires 1.00 mol of H₂O. Because 1.20 mol of H₂O is present, H₂O is in excess.
4
Calculate remaining unreacted mass of excess reactant
3.6 g of excess H₂O remaining
Unreacted moles of H₂O = 1.20 - 1.00 = 0.20 mol. Mass = 0.20 mol × 18 g/mol = 3.6 g.

Key Concept

Determining limiting and excess reagents in chemical reactions and calculating unreacted leftover mass using mole ratios from balanced equations.
Estimated Time:2m 0s
Question 66Question

An atom of an element QQ has a mass equal to 2.52.5 times the mass of a single carbon-12 atom (12C^{12}\text{C}). What is the relative atomic mass of element QQ on the carbon-12 scale?

Show answer & explanation

Answer: 3030

Answer

The relative atomic mass of element QQ on the carbon-12 scale is 30.
On the carbon-12 scale, 1 atomic mass unit (amu)1\text{ atomic mass unit (amu)} is defined as 112\frac{1}{12} of the mass of a single carbon-12 atom (12C^{12}\text{C}). This gives a single 12C^{12}\text{C} atom a relative mass of 1212. If an atom of element QQ is 2.52.5 times as heavy as one 12C^{12}\text{C} atom, its relative atomic mass is 2.5×12=302.5 \times 12 = 30.

Step-by-Step Solution

1
Define atomic mass unit on the carbon-12 scale
1 atomic mass unit (amu) = 112\frac{1}{12} of the mass of one carbon-12 atom
The standard reference point for relative atomic masses is defined as 112th\frac{1}{12}\text{th} the mass of a single 12C^{12}\text{C} atom, which means one carbon-12 atom equals 12 amu12\text{ amu}.
2
Calculate the atomic mass of element QQ in amu
Mass of Q=2.5×12 amu=30 amu\text{Mass of } Q = 2.5 \times 12\text{ amu} = 30\text{ amu}
Since one atom of element QQ has a mass 2.52.5 times that of a carbon-12 atom, its absolute atomic mass relative to 1 amu1\text{ amu} is 2.5×122.5 \times 12.
3
Determine the relative atomic mass
RAM=30 amu1 amu=30\text{RAM} = \frac{30\text{ amu}}{1\text{ amu}} = 30
Relative atomic mass is a dimensionless ratio comparing the average mass of an atom to 112th\frac{1}{12}\text{th} the mass of carbon-12.

Key Concept

Relative Atomic Mass on the Carbon-12 Scale
Question 67Question
A mixture containing 10.8 g10.8\text{ g} of aluminium powder is reacted with 16.0 g16.0\text{ g} of oxygen gas according to the balanced chemical equation:
4Al(s)+3O2(g)2Al2O3(s)4\text{Al}_{(s)} + 3\text{O}_{2(g)} \rightarrow 2\text{Al}_2\text{O}_{3(s)}
What is the mass in grams of the excess reactant remaining unreacted at the end of the reaction? [Al=27,O=16][\text{Al} = 27, \text{O} = 16]
Show answer & explanation

Answer: 6.4

Answer

The mass of the excess reactant (oxygen gas) remaining unreacted is 6.4 g.
To determine the unreacted mass of the excess reactant, first convert given masses to moles: 10.8 g of Al corresponds to 0.40 mol and 16.0 g of O₂ corresponds to 0.50 mol. Using the mole ratio from the balanced equation (4 moles Al : 3 moles O₂), 0.40 mol of Al reacts completely with 0.30 mol of O₂. Thus, Al is the limiting reactant and O₂ is in excess. The unreacted amount of O₂ is 0.50 mol - 0.30 mol = 0.20 mol. Converting 0.20 mol of O₂ back to mass using its molar mass of 32 g/mol yields 6.4 g.

Step-by-Step Solution

1
Calculate the mole amounts of reactants provided
n(Al) = 0.40 mol, n(O₂) = 0.50 mol
Converting masses to moles using molar masses (Al = 27 g/mol, O₂ = 32 g/mol) is necessary for stoichiometric comparison.
2
Determine the theoretical moles of oxygen needed to react with all aluminium
n(O₂) required = 0.30 mol
From the balanced equation, 4 moles of Al require 3 moles of O₂, so 0.40 mol Al requires 0.40 × (3/4) = 0.30 mol O₂.
3
Identify the excess reactant and compute remaining moles
O₂ is in excess by 0.20 mol
Available O₂ (0.50 mol) exceeds required O₂ (0.30 mol), leaving 0.50 - 0.30 = 0.20 mol of O₂ unreacted.
4
Convert remaining moles of excess reactant back to mass
Mass of excess O₂ = 6.4 g
Multiplying 0.20 mol by the molar mass of O₂ (32 g/mol) gives the unreacted mass of oxygen.

Key Concept

Limiting and excess reactant calculations based on stoichiometric coefficients and mole conversions
Estimated Time:2m 0s
Question 68Question
A 4.20 g4.20\text{ g} sample of impure sodium hydrogentrioxocarbonate(IV), NaHCO3\text{NaHCO}_3, was thermally decomposed according to the equation:
2NaHCO3(s)Na2CO3(s)+H2O(g)+CO2(g)2\text{NaHCO}_3\text{(s)} \rightarrow \text{Na}_2\text{CO}_3\text{(s)} + \text{H}_2\text{O(g)} + \text{CO}_2\text{(g)}
If 0.448 dm30.448\text{ dm}^3 of carbon(IV) oxide gas was collected at s.t.p., what is the percentage purity of the NaHCO3\text{NaHCO}_3 sample? [Na=23,H=1,C=12,O=16,molar volume of gas at s.t.p.=22.4 dm3 mol1][\text{Na} = 23, \text{H} = 1, \text{C} = 12, \text{O} = 16, \text{molar volume of gas at s.t.p.} = 22.4\text{ dm}^3\text{ mol}^{-1}]
Show answer & explanation

Answer: 80

Answer

The percentage purity of the sodium hydrogentrioxocarbonate(IV) sample is 80.0%.
The volume of CO₂ gas collected (0.448 dm30.448\text{ dm}^3) corresponds to 0.020 mol0.020\text{ mol} at s.t.p. According to the balanced equation, 2 mol2\text{ mol} of NaHCO3\text{NaHCO}_3 decompose to form 1 mol1\text{ mol} of CO2\text{CO}_2, meaning 0.040 mol0.040\text{ mol} of pure NaHCO3\text{NaHCO}_3 reacted. Multiplying by the molar mass of NaHCO3\text{NaHCO}_3 (84 g mol184\text{ g mol}^{-1}) gives 3.36 g3.36\text{ g} of pure compound, which represents 80.0%80.0\% of the original 4.20 g4.20\text{ g} sample.

Step-by-Step Solution

1
Calculate the moles of carbon(IV) oxide gas evolved at s.t.p.
0.020 mol of CO₂
Dividing the volume of gas collected by the molar volume of a gas at s.t.p. gives the chemical amount in moles.
2
Determine the moles of pure NaHCO₃ using the mole ratio from the balanced chemical equation.
0.040 mol of NaHCO₃
The reaction stoichiometry shows a 2:1 mole ratio between NaHCO₃ and CO₂.
3
Calculate the mass of pure NaHCO₃ by multiplying its moles by its molar mass (84 g/mol).
3.36 g of pure NaHCO₃
Mass is obtained by converting moles to grams using molar mass.
4
Divide the mass of pure NaHCO₃ by the initial mass of the impure sample (4.20 g) and multiply by 100%.
80.0%
Percentage purity expresses the proportion of active compound relative to the total mass of the sample.

Key Concept

Percentage purity calculation based on gas stoichiometry
Estimated Time:1m 30s
Question 69Question
A 2.50 g2.50\text{ g} sample of impure iron(III) oxide, Fe2O3\text{Fe}_2\text{O}_3, was completely reduced by excess carbon(II) oxide gas to yield 1.40 g1.40\text{ g} of pure iron metal according to the equation:
Fe2O3(s)+3CO(g)2Fe(s)+3CO2(g)\text{Fe}_2\text{O}_3(s) + 3\text{CO}(g) \rightarrow 2\text{Fe}(s) + 3\text{CO}_2(g)
What is the percentage purity of the iron(III) oxide sample? [Fe=56,O=16,C=12\text{Fe} = 56, \text{O} = 16, \text{C} = 12]
Show answer & explanation

Answer: 80.0%80.0\%

Answer

The percentage purity of the iron(III) oxide sample is 80.0%.
According to the balanced chemical equation, 1 mole1\text{ mole} of Fe2O3\text{Fe}_2\text{O}_3 (160 g160\text{ g}) yields 2 moles2\text{ moles} of Fe\text{Fe} (112 g112\text{ g}). To obtain 1.40 g1.40\text{ g} of pure iron metal, the mass of pure Fe2O3\text{Fe}_2\text{O}_3 required is 1.40×160112=2.00 g1.40 \times \frac{160}{112} = 2.00\text{ g}. The percentage purity is calculated by taking the mass of pure Fe2O3\text{Fe}_2\text{O}_3 divided by the total sample mass (2.50 g2.50\text{ g}) multiplied by 100100, yielding 80.0%80.0\%.

Step-by-Step Solution

1
Calculate the molar mass of iron(III) oxide (Fe2O3\text{Fe}_2\text{O}_3) and total mass of iron produced per mole.
Molar mass of Fe2O3=2(56)+3(16)=112+48=160 g/mol\text{Fe}_2\text{O}_3 = 2(56) + 3(16) = 112 + 48 = 160\text{ g/mol}. Mass of 2 moles2\text{ moles} of Fe=2×56=112 g\text{Fe} = 2 \times 56 = 112\text{ g}.
Stoichiometry shows 1 mole1\text{ mole} of Fe2O3\text{Fe}_2\text{O}_3 (160 g160\text{ g}) produces 2 moles2\text{ moles} of Fe\text{Fe} (112 g112\text{ g}).
2
Determine the mass of pure Fe2O3\text{Fe}_2\text{O}_3 in the sample required to produce 1.40 g1.40\text{ g} of Fe\text{Fe}.
Mass of pure Fe2O3=1.40 g Fe×160 g Fe2O3112 g Fe=2.00 g\text{Mass of pure Fe}_2\text{O}_3 = 1.40\text{ g Fe} \times \frac{160\text{ g Fe}_2\text{O}_3}{112\text{ g Fe}} = 2.00\text{ g}.
Mass proportions allow determination of the mass of reacting pure compound.
3
Calculate the percentage purity of the sample.
Percentage purity=(2.00 g2.50 g)×100=80.0%\text{Percentage purity} = \left(\frac{2.00\text{ g}}{2.50\text{ g}}\right) \times 100 = 80.0\%.
Percentage purity is the ratio of pure component mass to total sample mass expressed as a percentage.

Key Concept

Determining percentage purity using stoichiometric mass calculations
Estimated Time:1m 30s
Question 70Question
Zinc metal reacts with hydrochloric acid according to the balanced chemical equation:
Zn(s)+2HCl(aq)ZnCl2(aq)+H2(g)\text{Zn}_{(s)} + 2\text{HCl}_{(aq)} \rightarrow \text{ZnCl}_{2(aq)} + \text{H}_{2(g)}
If 13.0 g13.0\text{ g} of zinc is added to a solution containing 7.3 g7.3\text{ g} of hydrochloric acid, what mass of zinc remains unreacted after the reaction goes to completion?
(Zn=65.0, H=1.0, Cl=35.5\text{Zn} = 65.0,\text{ H} = 1.0,\text{ Cl} = 35.5)
Show answer & explanation

Answer: 6.5 g6.5\text{ g}

Answer

The mass of zinc remaining unreacted is 6.5 g6.5\text{ g}.
Converting the given masses into moles shows that 0.20 mol of zinc and 0.20 mol of hydrochloric acid are present. Since 1 mole of zinc requires 2 moles of hydrochloric acid, 0.20 mol of hydrochloric acid reacts with only 0.10 mol of zinc. Hydrochloric acid is completely consumed, leaving 0.10 mol (6.5 g) of zinc unreacted.

Step-by-Step Solution

1
Calculate the molar masses of the reactants
Molar mass of Zn=65.0 g/mol\text{Zn} = 65.0\text{ g/mol}; Molar mass of HCl=1.0+35.5=36.5 g/mol\text{HCl} = 1.0 + 35.5 = 36.5\text{ g/mol}.
Molar masses are required to convert the given masses to mole quantities.
2
Determine the initial mole quantities of each reactant
Moles of Zn=13.0 g65.0 g/mol=0.20 mol\text{Zn} = \frac{13.0\text{ g}}{65.0\text{ g/mol}} = 0.20\text{ mol}; Moles of HCl=7.3 g36.5 g/mol=0.20 mol\text{HCl} = \frac{7.3\text{ g}}{36.5\text{ g/mol}} = 0.20\text{ mol}.
Chemical reactions occur according to mole ratios, not mass ratios.
3
Identify the limiting reactant and calculate the moles of zinc consumed
From the equation, 1 mol of Zn1\text{ mol of Zn} reacts with 2 mol of HCl2\text{ mol of HCl}. Thus, 0.20 mol of HCl0.20\text{ mol of HCl} requires 0.202=0.10 mol of Zn\frac{0.20}{2} = 0.10\text{ mol of Zn}. HCl\text{HCl} is the limiting reactant.
The limiting reactant determines the extent of the reaction.
4
Calculate the unreacted moles and mass of zinc
Unreacted moles of Zn=0.20 mol0.10 mol=0.10 mol\text{Zn} = 0.20\text{ mol} - 0.10\text{ mol} = 0.10\text{ mol}. Unreacted mass of Zn=0.10 mol×65.0 g/mol=6.5 g\text{Zn} = 0.10\text{ mol} \times 65.0\text{ g/mol} = 6.5\text{ g}.
Subtracting consumed moles from initial moles gives the remaining amount.

Key Concept

Limiting and Excess Reactants
Question 71Question
Propane burns completely in oxygen gas according to the following balanced chemical equation:
C3H8(g)+5O2(g)3CO2(g)+4H2O(l)C_3H_8(g) + 5O_2(g) \rightarrow 3CO_2(g) + 4H_2O(l)
What volume of oxygen gas, measured at STP, is required for the complete combustion of 4.4 g4.4\text{ g} of propane?
[H=1.0,C=12.0;Molar volume of gas at STP=22.4 dm3 mol1][\text{H} = 1.0, \text{C} = 12.0; \text{Molar volume of gas at STP} = 22.4\text{ dm}^3\text{ mol}^{-1}]
Show answer & explanation

Answer: 11.2 dm311.2\text{ dm}^3

Answer

The volume of oxygen gas required at STP is 11.2 dm311.2\text{ dm}^3.
The option stating 11.2 dm311.2\text{ dm}^3 is correct. 4.4 g4.4\text{ g} of propane corresponds to 0.10 mol0.10\text{ mol}. According to the balanced equation, 1 mol1\text{ mol} of C3H8C_3H_8 reacts with 5 mol5\text{ mol} of O2O_2, so 0.10 mol0.10\text{ mol} of propane requires 0.50 mol0.50\text{ mol} of O2O_2. At STP, 0.50 mol×22.4 dm3 mol1=11.2 dm30.50\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 11.2\text{ dm}^3.

Step-by-Step Solution

1
Calculate the molar mass of propane (C3H8C_3H_8).
Molar mass of C3H8=(3×12.0)+(8×1.0)=36.0+8.0=44.0 g mol1C_3H_8 = (3 \times 12.0) + (8 \times 1.0) = 36.0 + 8.0 = 44.0\text{ g mol}^{-1}.
Molar mass is needed to convert the given mass of reactant into moles.
2
Determine the number of moles of propane in 4.4 g4.4\text{ g}.
Moles of C3H8=4.4 g44.0 g mol1=0.10 molC_3H_8 = \frac{4.4\text{ g}}{44.0\text{ g mol}^{-1}} = 0.10\text{ mol}.
Stoichiometric calculations rely on mole ratios from the balanced chemical equation.
3
Use the mole ratio from the balanced equation to find the required moles of O2O_2.
Mole ratio C3H8:O2=1:5C_3H_8 : O_2 = 1 : 5. Moles of O2=0.10 mol×5=0.50 molO_2 = 0.10\text{ mol} \times 5 = 0.50\text{ mol}.
Every 1 mole1\text{ mole} of propane requires 5 moles5\text{ moles} of oxygen gas for complete combustion.
4
Calculate the volume of O2O_2 gas at STP.
Volume of O2=0.50 mol×22.4 dm3 mol1=11.2 dm3O_2 = 0.50\text{ mol} \times 22.4\text{ dm}^3\text{ mol}^{-1} = 11.2\text{ dm}^3.
Multiply the calculated number of moles of gas by the molar volume at STP (22.4 dm3 mol122.4\text{ dm}^3\text{ mol}^{-1}).

Key Concept

Mass-Volume Stoichiometric Calculations at STP
Estimated Time:1m 30s
Question 72Question

A sample of a pure iron oxide synthesized in a laboratory contains 5.60 g5.60\text{ g} of iron and 2.40 g2.40\text{ g} of oxygen. According to the Law of Definite Proportions, what is the mass of iron, in grams, present in a 20.0 g20.0\text{ g} sample of the same iron oxide collected from a natural deposit?

Show answer & explanation

Answer: 14

Answer

The mass of iron present in the 20.0 g sample of iron oxide is 14.0 g.
According to the Law of Definite Proportions, a pure chemical compound always contains the same elements combined together in the exact same proportion by mass, regardless of its source or method of preparation. In the laboratory sample, 8.00 g8.00\text{ g} of iron oxide contains 5.60 g5.60\text{ g} of iron, giving an iron mass composition of 70%70\%. Therefore, a 20.0 g20.0\text{ g} natural sample of the same compound must also contain 70%70\% iron by mass, which equals 14.0 g14.0\text{ g}.

Step-by-Step Solution

1
Calculate total mass of the laboratory sample
5.60 g+2.40 g=8.00 g5.60\text{ g} + 2.40\text{ g} = 8.00\text{ g}
The total mass of the compound is the sum of the constituent element masses (Law of Conservation of Mass).
2
Find the mass percentage/fraction of iron
5.60 g8.00 g=0.70\frac{5.60\text{ g}}{8.00\text{ g}} = 0.70 (or 70%70\%)
By the Law of Definite Proportions, the mass ratio of elements in a pure compound is constant.
3
Calculate mass of iron in the 20.0 g natural sample
0.70×20.0 g=14.0 g0.70 \times 20.0\text{ g} = 14.0\text{ g}
Applying the constant mass composition percentage to the new sample mass.

Key Concept

Law of Definite Proportions (Constant Composition)
Estimated Time:1m 30s
Question 73Question

A mixture of 15 cm315\text{ cm}^3 of ethene (C2H4C_2H_4) and 50 cm350\text{ cm}^3 of oxygen gas was exploded at constant temperature and pressure. If the resulting mixture was cooled to room temperature, what is the total volume of the residual gas in cm3\text{cm}^3?

Show answer & explanation

Answer: 35

Answer

35 cm³
According to Gay-Lussac's Law, 15 cm315\text{ cm}^3 of ethene reacts with 45 cm345\text{ cm}^3 of oxygen to produce 30 cm330\text{ cm}^3 of carbon(IV) oxide gas. Since 50 cm350\text{ cm}^3 of oxygen was initially present, 5 cm35\text{ cm}^3 of unreacted oxygen gas remains. Upon cooling to room temperature, water condenses to liquid, leaving a total residual gaseous volume of 5 cm3+30 cm3=35 cm35\text{ cm}^3 + 30\text{ cm}^3 = 35\text{ cm}^3.

Step-by-Step Solution

1
Write the balanced equation for the complete combustion of ethene gas.
C2H4(g)+3O2(g)2CO2(g)+2H2O(l)C_2H_4(g) + 3O_2(g) \rightarrow 2CO_2(g) + 2H_2O(l)
By Gay-Lussac's Law of Combining Volumes, gases react in simple whole-number volume ratios equal to their stoichiometric coefficients at constant temperature and pressure.
2
Determine the volume of oxygen required and the unreacted excess volume.
Volume of O2O_2 consumed = 3×15 cm3=45 cm33 \times 15\text{ cm}^3 = 45\text{ cm}^3. Remaining unreacted O2=50 cm345 cm3=5 cm3O_2 = 50\text{ cm}^3 - 45\text{ cm}^3 = 5\text{ cm}^3.
Since 15 cm315\text{ cm}^3 of C2H4C_2H_4 requires only 45 cm345\text{ cm}^3 of O2O_2, oxygen is in excess and ethene is the limiting reactant.
3
Calculate the volume of carbon(IV) oxide gas produced.
Volume of CO2CO_2 produced = 2×15 cm3=30 cm32 \times 15\text{ cm}^3 = 30\text{ cm}^3.
1 volume of C2H4C_2H_4 produces 2 volumes of CO2CO_2 gas.
4
Calculate the total volume of the residual gaseous mixture after cooling to room temperature.
Total residual gaseous volume = 5 cm3 (excess O2)+30 cm3 (produced CO2)=35 cm35\text{ cm}^3 \text{ (excess } O_2\text{)} + 30\text{ cm}^3 \text{ (produced } CO_2\text{)} = 35\text{ cm}^3.
Water formed is in the liquid state at room temperature and contributes negligible volume to the gaseous mixture.

Key Concept

Gay-Lussac's Law of Combining Volumes and Residual Gas Volume Calculations
Estimated Time:1m 30s
Question 74Question
A mixture of 10 cm310\text{ cm}^3 of hydrogen sulfide (H2SH_2S) gas and 40 cm340\text{ cm}^3 of oxygen gas was sparked to react completely at constant temperature and pressure according to the equation:
2H2S(g)+3O2(g)2SO2(g)+2H2O(l)2H_2S(g) + 3O_2(g) \rightarrow 2SO_2(g) + 2H_2O(l)
Assuming the water formed condenses into liquid, what is the total volume of the residual gas mixture?
Show answer & explanation

Answer: 35 cm335\text{ cm}^3

Answer

The total volume of the residual gas mixture is 35 cm335\text{ cm}^3.
According to Gay-Lussac's law, 2 cm32\text{ cm}^3 of H2SH_2S reacts with 3 cm33\text{ cm}^3 of O2O_2 to form 2 cm32\text{ cm}^3 of SO2SO_2 gas. Thus, 10 cm310\text{ cm}^3 of H2SH_2S consumes 15 cm315\text{ cm}^3 of O2O_2 and yields 10 cm310\text{ cm}^3 of SO2SO_2. The remaining excess O2O_2 is 40 cm315 cm3=25 cm340\text{ cm}^3 - 15\text{ cm}^3 = 25\text{ cm}^3. Combining the unreacted oxygen (25 cm325\text{ cm}^3) and produced sulfur(IV) oxide (10 cm310\text{ cm}^3) gives a total residual gas volume of 35 cm335\text{ cm}^3.

Step-by-Step Solution

1
Determine the stoichiometric volume ratios from the balanced chemical equation
2 volumes of H2S(g)H_2S(g) react with 3 volumes of O2(g)O_2(g) to produce 2 volumes of SO2(g)SO_2(g).
According to Gay-Lussac's Law of Combining Volumes, gases react in simple whole-number volume ratios at constant temperature and pressure.
2
Calculate the volume of oxygen required to react with 10 cm310\text{ cm}^3 of H2SH_2S
Volume of O2O_2 used = 10 cm3×32=15 cm310\text{ cm}^3 \times \frac{3}{2} = 15\text{ cm}^3.
Since 10 cm310\text{ cm}^3 of H2SH_2S is available, it is the limiting reactant and requires 15 cm315\text{ cm}^3 of O2O_2.
3
Find the volume of unreacted excess oxygen
Unreacted O2=40 cm315 cm3=25 cm3O_2 = 40\text{ cm}^3 - 15\text{ cm}^3 = 25\text{ cm}^3.
Subtracting the reacted oxygen volume from the initial volume gives the excess.
4
Calculate the volume of gaseous SO2SO_2 produced
Volume of SO2=10 cm3×22=10 cm3SO_2 = 10\text{ cm}^3 \times \frac{2}{2} = 10\text{ cm}^3.
The mole ratio of H2SH_2S to SO2SO_2 is 2:22:2, so 10 cm310\text{ cm}^3 of H2SH_2S produces 10 cm310\text{ cm}^3 of SO2SO_2 gas. Water is liquid so its volume is neglected.
5
Calculate total residual gas volume
Total residual volume = 25 cm3 (excess O2)+10 cm3 (produced SO2)=35 cm325\text{ cm}^3 \text{ (excess } O_2) + 10\text{ cm}^3 \text{ (produced } SO_2) = 35\text{ cm}^3.
The residual gas consists of both unreacted excess reactant and gaseous product.

Key Concept

Gay-Lussac's Law of Combining Volumes
Question 75Question

Fill in the blanks with the correct numerical values based on volume stoichiometry at constant temperature and pressure.

Fill in the blanks below

When 40 cm340\text{ cm}^3 of nitrogen(II) oxide gas (NONO) is reacted with 30 cm330\text{ cm}^3 of oxygen gas (O2O_2) according to the equation 2NO(g)+O2(g)2NO2(g)2NO_{(g)} + O_{2(g)} \rightarrow 2NO_{2(g)}, the volume of unreacted oxygen gas remaining is cm3\text{cm}^3 and the total volume of the resulting gaseous mixture is cm3\text{cm}^3.
Show answer & explanation

Answer

The volume of unreacted oxygen gas remaining is 10 cm310\text{ cm}^3 and the total volume of the resulting gaseous mixture is 50 cm350\text{ cm}^3.
According to Gay-Lussac's Law of Combining Volumes, 2 volumes2\text{ volumes} of NONO react with 1 volume1\text{ volume} of O2O_2 to yield 2 volumes2\text{ volumes} of NO2NO_2. Therefore, 40 cm340\text{ cm}^3 of NONO reacts with 20 cm320\text{ cm}^3 of O2O_2, leaving 10 cm310\text{ cm}^3 of unreacted O2O_2 (30 cm320 cm330\text{ cm}^3 - 20\text{ cm}^3). The reaction produces 40 cm340\text{ cm}^3 of NO2NO_2 gas. Summing the product volume (40 cm340\text{ cm}^3) and unreacted excess gas (10 cm310\text{ cm}^3) gives a total residual gas volume of 50 cm350\text{ cm}^3.

Step-by-Step Solution

1
Determine combining volume ratios from the balanced chemical equation.
The mole/volume ratio is 2 vol NO:1 vol O2:2 vol NO22\text{ vol } NO : 1\text{ vol } O_2 : 2\text{ vol } NO_2.
By Gay-Lussac's Law of Combining Volumes, gases at the same temperature and pressure react in volumes that bear simple whole-number ratios to one another and to gaseous products.
2
Identify the limiting reactant and calculate volumes consumed and produced.
40 cm340\text{ cm}^3 of NONO requires 12×40=20 cm3\frac{1}{2} \times 40 = 20\text{ cm}^3 of O2O_2, producing 40 cm340\text{ cm}^3 of NO2NO_2. NONO is completely used up.
40 cm340\text{ cm}^3 of NONO is the limiting reactant because 30 cm330\text{ cm}^3 of O2O_2 is available, which is more than the required 20 cm320\text{ cm}^3.
3
Calculate remaining unreacted oxygen and total residual gas volume.
Excess O2=30 cm320 cm3=10 cm3O_2 = 30\text{ cm}^3 - 20\text{ cm}^3 = 10\text{ cm}^3. Total residual volume = 40 cm3(NO2)+10 cm3(O2)=50 cm340\text{ cm}^3\,(NO_2) + 10\text{ cm}^3\,(O_2) = 50\text{ cm}^3.
The total final volume equals the volume of gaseous product formed plus any unreacted excess gas.

Key Concept

Gay-Lussac's Law of Combining Volumes and Avogadro's Law
Estimated Time:1m 30s
Question 76Question

An element XX forms two distinct gaseous oxides, Oxide A and Oxide B. Quantitative analysis reveals that 14.0 g14.0\text{ g} of XX combines with 16.0 g16.0\text{ g} of oxygen in Oxide A, whereas 14.0 g14.0\text{ g} of XX combines with 32.0 g32.0\text{ g} of oxygen in Oxide B. What is the ratio of the masses of oxygen combining with a fixed mass of element XX, and which law of chemical combination does this illustrate?

Show answer & explanation

Answer: 1:21:2; Law of Multiple Proportions

Answer

The ratio of oxygen masses is 1:21:2, which illustrates the Law of Multiple Proportions.
For a constant mass of element XX (14.0 g14.0\text{ g}), the mass of oxygen in Oxide A (16.0 g16.0\text{ g}) and Oxide B (32.0 g32.0\text{ g}) forms a simple whole-number ratio of 16:32=1:216:32 = 1:2. This directly satisfies John Dalton's Law of Multiple Proportions.

Step-by-Step Solution

1
Identify the fixed mass of element XX in both compounds
Mass of element X=14.0 gX = 14.0\text{ g} in both Oxide A and Oxide B
To apply the Law of Multiple Proportions, the mass of one element must be held constant
2
Determine the masses of oxygen combined with the fixed mass of element XX
Oxide A has 16.0 g16.0\text{ g} of oxygen, Oxide B has 32.0 g32.0\text{ g} of oxygen
These are the given masses of oxygen reacting with 14.0 g14.0\text{ g} of XX
3
Calculate the simple ratio between the masses of oxygen
\frac{16.0}{32.0} = \frac{1}{2} \text{ or } 1:2
Dividing both masses by the common factor 16.0 g16.0\text{ g} yields a simple whole-number ratio
4
Match the observed phenomenon to the appropriate chemical law
Law of Multiple Proportions
When two elements combine to form more than one compound, the masses of one element that combine with a fixed mass of the other are in a ratio of small whole numbers

Key Concept

Law of Multiple Proportions
Estimated Time:1m 30s
Question 77Question

Phosphorus forms two distinct chlorides, X and Y. Analysis shows that 3.10 g3.10\text{ g} of phosphorus combines with 10.65 g10.65\text{ g} of chlorine to form compound X, whereas 3.10 g3.10\text{ g} of phosphorus combines with 17.75 g17.75\text{ g} of chlorine to form compound Y. Which law of chemical combination is illustrated by these experimental data, and what is the simple mass ratio of chlorine reacting with the fixed mass of phosphorus?

Show answer & explanation

Answer: Law of Multiple Proportions with a ratio of 3 : 5

Answer

Law of Multiple Proportions with a ratio of 3 : 5
The option specifying the Law of Multiple Proportions with a ratio of 3 : 5 is correct because the mass of phosphorus is held constant at 3.10 g3.10\text{ g}, while the masses of chlorine in compounds X and Y are 10.65 g10.65\text{ g} and 17.75 g17.75\text{ g} respectively. Simplifying the ratio 10.6517.75\frac{10.65}{17.75} yields 35\frac{3}{5} (3:53 : 5). Because two elements form different compounds whose mass ratios reduce to simple integers, the observation demonstrates John Dalton's Law of Multiple Proportions.

Step-by-Step Solution

1
Identify the fixed mass and variable mass values from the given data.
Fixed mass of phosphorus = 3.10 g3.10\text{ g} in both compounds. Mass of chlorine in compound X = 10.65 g10.65\text{ g}. Mass of chlorine in compound Y = 17.75 g17.75\text{ g}.
The Law of Multiple Proportions compares the varying masses of one element combining with a constant mass of another.
2
Calculate the simple whole-number ratio of the masses of chlorine.
\frac{10.65}{17.75} = \frac{3}{5} \implies 3 : 5
Dividing both chlorine masses by their greatest common factor (3.553.55) gives the integer ratio 3:53 : 5.
3
Determine which law of chemical combination corresponds to this relationship.
Law of Multiple Proportions
When two elements form more than one compound, the masses of one element combining with a fixed mass of the other are in a ratio of small whole numbers.

Key Concept

Law of Multiple Proportions
PreviousPage 4 / 4
Chemical Combination and Stoichiometry Practice Questions — JAMB UTME — Page 4 | Examkin