Energetics, Rates of Reaction and Chemical Equilibrium

96 questions

Question 1Question

Consider the reversible industrial synthesis of ammonia gas: N2(g)+3H2(g)2NH3(g)ΔH=92 kJ mol1N_{2(g)} + 3H_{2(g)} \rightleftharpoons 2NH_{3(g)} \quad \Delta H = -92\text{ kJ mol}^{-1}. A chemical engineer introduces a finely divided iron catalyst into the reaction vessel while maintaining constant temperature and pressure. Which of the following best describes the effect of adding the catalyst on the system?

Show answer & explanation

Answer: It lowers the activation energy for both the forward and reverse reactions equally, increasing their rates and reducing the time taken to reach equilibrium without altering the final yield of NH3NH_3.

Answer

Adding a catalyst lowers the activation energy for both forward and reverse reactions by equal amounts, increasing their rates and reducing the time needed to reach dynamic equilibrium without altering the equilibrium yield of ammonia.
A catalyst functions by offering an alternative pathway with a lower activation energy barrier. In a reversible system, this reduction in activation energy applies equally to both the forward and reverse directions. Consequently, the rates of both reactions increase by the same proportion, enabling the system to reach dynamic equilibrium faster without changing the equilibrium composition or the yield of products.

Step-by-Step Solution

1
Analyze the function of a catalyst in chemical kinetics.
A catalyst provides an alternative reaction pathway with a lower activation energy (EaE_a).
Lowering EaE_a allows a greater fraction of reactant molecules to possess sufficient energy to undergo effective collisions per unit time.
2
Evaluate the symmetry of activation energy reduction in reversible reactions.
The catalyst lowers the activation energy barrier for both the forward reaction and the reverse reaction by the exact same amount (ΔEaΔ E_a).
Since the initial reactants and final products remain in the same energy states, the difference between the forward and reverse activation energy barriers (ΔHΔ H) is unchanged.
3
Determine the impact of the catalyst on chemical equilibrium and product yield.
The rates of both forward and reverse reactions increase by the same factor, so the equilibrium position and equilibrium constant (KcK_c) remain unchanged; only the time to reach equilibrium decreases.
Equal acceleration of both directions leaves the relative equilibrium concentrations of products and reactants unaffected.

Key Concept

Effect of Catalysts on Reaction Kinetics and Chemical Equilibrium
Estimated Time:1m 30s
Question 2Question

For a reversible gas-phase reaction X(g)+Y(g)Z(g)X_{(g)} + Y_{(g)} \rightleftharpoons Z_{(g)}, the total enthalpy of the reactants is +120 kJ mol1+120\text{ kJ mol}^{-1}. The reaction is exothermic with a standard enthalpy change (ΔH\Delta H) of 45 kJ mol1-45\text{ kJ mol}^{-1}. In the absence of a catalyst, the activation energy for the reverse reaction (Ea,revE_{a,\text{rev}}) is +185 kJ mol1+185\text{ kJ mol}^{-1}. If a catalyst is introduced that lowers the activation energy barrier by 30 kJ mol130\text{ kJ mol}^{-1}, what is the activation energy for the catalyzed forward reaction?

Show answer & explanation

Answer: +110 kJ mol1+110\text{ kJ mol}^{-1}

Answer

+110 kJ mol1+110\text{ kJ mol}^{-1}
The correct answer is +110 kJ mol1+110\text{ kJ mol}^{-1}. For an exothermic reaction with ΔH=45 kJ mol1\Delta H = -45\text{ kJ mol}^{-1} and reverse activation energy Ea,rev=+185 kJ mol1E_{a,\text{rev}} = +185\text{ kJ mol}^{-1}, the uncatalyzed forward activation energy is Ea,fwd=Ea,rev+ΔH=18545=+140 kJ mol1E_{a,\text{fwd}} = E_{a,\text{rev}} + \Delta H = 185 - 45 = +140\text{ kJ mol}^{-1}. Adding a catalyst lowers this activation energy barrier by 30 kJ mol130\text{ kJ mol}^{-1}, yielding 14030=+110 kJ mol1140 - 30 = +110\text{ kJ mol}^{-1}.

Step-by-Step Solution

1
Calculate the uncatalyzed forward activation energy (Ea,fwd, uncatalyzedE_{a,\text{fwd, uncatalyzed}})
Ea,fwd, uncatalyzed=Ea,rev+ΔH=+185 kJ mol1+(45 kJ mol1)=+140 kJ mol1E_{a,\text{fwd, uncatalyzed}} = E_{a,\text{rev}} + \Delta H = +185\text{ kJ mol}^{-1} + (-45\text{ kJ mol}^{-1}) = +140\text{ kJ mol}^{-1}
For any chemical system, the relationship between forward activation energy, reverse activation energy, and enthalpy change is ΔH=Ea,fwdEa,rev\Delta H = E_{a,\text{fwd}} - E_{a,\text{rev}}.
2
Apply the catalyst reduction to the forward activation energy
Ea,fwd, catalyzed=Ea,fwd, uncatalyzed30 kJ mol1=14030=+110 kJ mol1E_{a,\text{fwd, catalyzed}} = E_{a,\text{fwd, uncatalyzed}} - 30\text{ kJ mol}^{-1} = 140 - 30 = +110\text{ kJ mol}^{-1}
A catalyst lowers both forward and reverse activation energies by equal amounts, reducing the energy barrier height.

Key Concept

Relationship between forward activation energy, reverse activation energy, enthalpy change, and catalyst effect in energy profile diagrams

Alternative Method

Calculate the energy levels directly: Reactants = +120 kJ mol1+120\text{ kJ mol}^{-1}. Products = 120+(45)=+75 kJ mol1120 + (-45) = +75\text{ kJ mol}^{-1}. Uncatalyzed Transition State = Products + Ea,rev=75+185=+260 kJ mol1E_{a,\text{rev}} = 75 + 185 = +260\text{ kJ mol}^{-1}. Catalyzed Transition State = 26030=+230 kJ mol1260 - 30 = +230\text{ kJ mol}^{-1}. Catalyzed Ea,fwd=Catalyzed Transition StateReactants=230120=+110 kJ mol1E_{a,\text{fwd}} = \text{Catalyzed Transition State} - \text{Reactants} = 230 - 120 = +110\text{ kJ mol}^{-1}.
Estimated Time:2m 0s
Question 3Question

According to collision theory, which of the following conditions must be satisfied for a collision between reacting particles to result in a chemical reaction?

Show answer & explanation

Answer: The colliding particles must possess kinetic energy equal to or greater than the activation energy and have proper spatial orientation.

Answer

The colliding particles must possess kinetic energy equal to or greater than the activation energy and have proper spatial orientation.
Collision theory establishes that a reaction occurs only when colliding particles possess energy at least equal to the activation energy (EaE_a) and are oriented properly during impact.

Step-by-Step Solution

1
Identify the basic postulates of Collision Theory.
Not all collisions lead to a chemical reaction; only 'effective' collisions produce products.
Collision theory requires reacting species to meet specific energy and alignment criteria.
2
Analyze the energy requirement.
Colliding molecules must have kinetic energy EEaE \ge E_a (activation energy).
Energy is required to overcome repulsive forces and break existing chemical bonds.
3
Analyze the orientation requirement.
Particles must collide with proper spatial alignment.
Correct alignment ensures reactive sites interact to form the activated complex.

Key Concept

Conditions for Effective Collisions
Estimated Time:45s
Question 4Question

An endothermic reaction has a forward activation energy of 75 kJ mol175\text{ kJ mol}^{-1} and an enthalpy change (ΔH\Delta H) of +30 kJ mol1+30\text{ kJ mol}^{-1}. What is the activation energy of the reverse reaction?

Show answer & explanation

Answer: 45 kJ mol145\text{ kJ mol}^{-1}

Answer

The activation energy of the reverse reaction is 45 kJ mol145\text{ kJ mol}^{-1}.
For an endothermic reaction, the products have higher potential energy than the reactants by an amount equal to ΔH\Delta H. The energy barrier to go from products to the transition state (reverse activation energy) is therefore smaller than the barrier from reactants to the transition state (forward activation energy). Using ΔH=Ea(forward)Ea(reverse)\Delta H = E_{a(\text{forward})} - E_{a(\text{reverse})}, we get 30=75Ea(reverse)30 = 75 - E_{a(\text{reverse})}, giving Ea(reverse)=45 kJ mol1E_{a(\text{reverse})} = 45\text{ kJ mol}^{-1}.

Step-by-Step Solution

1
Identify the given thermodynamic parameters for the endothermic reaction.
Forward activation energy Ea(forward)=75 kJ mol1E_{a(\text{forward})} = 75\text{ kJ mol}^{-1} and enthalpy change ΔH=+30 kJ mol1\Delta H = +30\text{ kJ mol}^{-1}.
Establishing the known energy levels from the problem stem.
2
Apply the relationship between forward activation energy, reverse activation energy, and enthalpy change.
ΔH=Ea(forward)Ea(reverse)\Delta H = E_{a(\text{forward})} - E_{a(\text{reverse})}.
The difference between the energy barrier of the forward reaction and reverse reaction determines the net heat content change.
3
Substitute the values and solve for Ea(reverse)E_{a(\text{reverse})}.
Ea(reverse)=75 kJ mol130 kJ mol1=45 kJ mol1E_{a(\text{reverse})} = 75\text{ kJ mol}^{-1} - 30\text{ kJ mol}^{-1} = 45\text{ kJ mol}^{-1}.
Rearranging the equation yields the activation energy needed for the reverse process.

Key Concept

Relationship between forward activation energy, reverse activation energy, and enthalpy change in energy profile diagrams.
Estimated Time:45s
Question 5Question
A sample of 0.13 g0.13\text{ g} of zinc granules reacts completely with an excess of dilute hydrochloric acid according to the reaction equation:
Zn(s)+2HCl(aq)ZnCl2(aq)+H2(g)\text{Zn}(s) + 2\text{HCl}(aq) \rightarrow \text{ZnCl}_2(aq) + \text{H}_2(g)
If the reaction takes exactly 40 seconds40\text{ seconds} to reach completion, what is the average rate of consumption of hydrochloric acid in mol s1\text{mol s}^{-1}? (Molar mass of Zn=65 g mol1\text{Zn} = 65\text{ g mol}^{-1})
Show answer & explanation

Answer: 0.0001

Answer

The average rate of consumption of hydrochloric acid is 0.0001 mol s10.0001\text{ mol s}^{-1} (or 1.0×104 mol s11.0 \times 10^{-4}\text{ mol s}^{-1}).
To determine the average rate of consumption of hydrochloric acid, first convert the mass of zinc to moles (0.13 g/65 g mol1=0.002 mol0.13\text{ g} / 65\text{ g mol}^{-1} = 0.002\text{ mol}). According to the stoichiometric coefficients in the balanced equation Zn+2HClZnCl2+H2\text{Zn} + 2\text{HCl} \rightarrow \text{ZnCl}_2 + \text{H}_2, 2 moles2\text{ moles} of HCl\text{HCl} react for every 1 mole1\text{ mole} of Zn\text{Zn}. Therefore, 0.004 mol0.004\text{ mol} of HCl\text{HCl} is consumed. Dividing this quantity by the reaction time (40 seconds40\text{ seconds}) gives an average rate of 0.0001 mol s10.0001\text{ mol s}^{-1}.

Step-by-Step Solution

1
Calculate the amount in moles of zinc reacted
Moles of Zn=0.13 g65 g mol1=0.002 mol\text{Moles of Zn} = \frac{0.13\text{ g}}{65\text{ g mol}^{-1}} = 0.002\text{ mol}
Mass divided by molar mass yields the quantity in moles.
2
Determine the moles of hydrochloric acid consumed using the mole ratio
Moles of HCl=2×0.002 mol=0.004 mol\text{Moles of HCl} = 2 \times 0.002\text{ mol} = 0.004\text{ mol}
The balanced chemical equation shows a 1:21:2 stoichiometric ratio between Zn\text{Zn} and HCl\text{HCl}.
3
Calculate the average rate of consumption of HCl per unit time
Rate of HCl consumption=0.004 mol40 s=0.0001 mol s1\text{Rate of HCl consumption} = \frac{0.004\text{ mol}}{40\text{ s}} = 0.0001\text{ mol s}^{-1}
Rate of reaction is defined as the change in moles of reactant divided by elapsed time.

Key Concept

Stoichiometric determination of reaction rate from reactant consumption
Question 6Question

In a 1.0 dm31.0\text{ dm}^3 rigid reaction vessel, 4.0 moles4.0\text{ moles} of gas AA and 3.0 moles3.0\text{ moles} of gas BB are mixed and allowed to reach equilibrium at a constant temperature according to the equation:

2A(g)+B(g)C(g)2A_{(g)} + B_{(g)} \rightleftharpoons C_{(g)}

If analysis shows that 1.0 mole1.0\text{ mole} of gas CC is present at equilibrium, what is the value of the equilibrium constant, KcK_c, for this reaction?

Show answer & explanation

Answer: 0.125 dm6mol20.125\text{ dm}^6\text{mol}^{-2}

Answer

The equilibrium constant KcK_c is 0.125 dm6mol20.125\text{ dm}^6\text{mol}^{-2}.
To find KcK_c, set up an equilibrium concentration table. Producing 1.0 mole1.0\text{ mole} of product CC consumes 2.0 moles2.0\text{ moles} of AA and 1.0 mole1.0\text{ mole} of BB per dm3\text{dm}^3. The equilibrium concentrations are [A]=2.0 mol dm3[A] = 2.0\text{ mol dm}^{-3}, [B]=2.0 mol dm3[B] = 2.0\text{ mol dm}^{-3}, and [C]=1.0 mol dm3[C] = 1.0\text{ mol dm}^{-3}. Substituting these values into Kc=[C][A]2[B]K_c = \frac{[C]}{[A]^2[B]} yields 1.02.02×2.0=1.08.0=0.125 dm6mol2\frac{1.0}{2.0^2 \times 2.0} = \frac{1.0}{8.0} = 0.125\text{ dm}^6\text{mol}^{-2}.

Step-by-Step Solution

1
Determine initial molar concentrations
Since container volume is 1.0 dm31.0\text{ dm}^3, initial concentrations are [A]0=4.0 mol dm3[A]_0 = 4.0\text{ mol dm}^{-3}, [B]0=3.0 mol dm3[B]_0 = 3.0\text{ mol dm}^{-3}, and [C]0=0 mol dm3[C]_0 = 0\text{ mol dm}^{-3}.
Concentration is moles divided by volume in dm3\text{dm}^3.
2
Calculate equilibrium concentrations using stoichiometry (ICE Table)
At equilibrium, [C]eq=1.0 mol dm3[C]_{eq} = 1.0\text{ mol dm}^{-3}.
According to 2A+BC2A + B \rightleftharpoons C:
Moles of AA consumed = 2×1.0=2.0 mol dm3    [A]eq=4.02.0=2.0 mol dm32 \times 1.0 = 2.0\text{ mol dm}^{-3} \implies [A]_{eq} = 4.0 - 2.0 = 2.0\text{ mol dm}^{-3}.
Moles of BB consumed = 1×1.0=1.0 mol dm3    [B]eq=3.01.0=2.0 mol dm31 \times 1.0 = 1.0\text{ mol dm}^{-3} \implies [B]_{eq} = 3.0 - 1.0 = 2.0\text{ mol dm}^{-3}.
Stoichiometric coefficients govern the mole ratio of reactants consumed to products formed.
3
Write the KcK_c expression and substitute equilibrium concentrations
Kc=[C][A]2[B]=1.0(2.0)2×2.0=1.04.0×2.0=1.08.0=0.125 dm6mol2K_c = \frac{[C]}{[A]^2[B]} = \frac{1.0}{(2.0)^2 \times 2.0} = \frac{1.0}{4.0 \times 2.0} = \frac{1.0}{8.0} = 0.125\text{ dm}^6\text{mol}^{-2}
The equilibrium constant expression raises each concentration to the power of its stoichiometric coefficient.

Key Concept

Equilibrium constant KcK_c expression and stoichiometric calculations
Estimated Time:2m 0s
Question 7Question
Given the following thermochemical equations:
I. 2Fe(s)+32O2(g)Fe2O3(s)ΔH=824.2 kJ mol1\text{I. } 2\text{Fe}(s) + \frac{3}{2}\text{O}_2(g) \rightarrow \text{Fe}_2\text{O}_3(s) \quad \Delta H^\circ = -824.2\text{ kJ mol}^{-1}
II. CO(g)+12O2(g)CO2(g)ΔH=283.0 kJ mol1\text{II. } \text{CO}(g) + \frac{1}{2}\text{O}_2(g) \rightarrow \text{CO}_2(g) \quad \Delta H^\circ = -283.0\text{ kJ mol}^{-1}
What is the standard enthalpy change, ΔH\Delta H^\circ, for the reduction of iron(III) oxide by carbon monoxide according to the following reaction?
Fe2O3(s)+3CO(g)2Fe(s)+3CO2(g)\text{Fe}_2\text{O}_3(s) + 3\text{CO}(g) \rightarrow 2\text{Fe}(s) + 3\text{CO}_2(g)
Show answer & explanation

Answer: 24.8 kJ mol1-24.8\text{ kJ mol}^{-1}

Answer

24.8 kJ mol1-24.8\text{ kJ mol}^{-1}
According to Hess's Law, the total enthalpy change for a reaction is the sum of the enthalpy changes for individual intermediate steps. Reversing the formation equation of Fe2O3(s)\text{Fe}_2\text{O}_3(s) flips its enthalpy sign from 824.2 kJ mol1-824.2\text{ kJ mol}^{-1} to +824.2 kJ mol1+824.2\text{ kJ mol}^{-1}. Multiplying the oxidation reaction of CO(g)\text{CO}(g) by 3 scales its enthalpy from 283.0 kJ mol1-283.0\text{ kJ mol}^{-1} to 849.0 kJ mol1-849.0\text{ kJ mol}^{-1}. Adding both modified values yields +824.2 kJ mol1849.0 kJ mol1=24.8 kJ mol1+824.2\text{ kJ mol}^{-1} - 849.0\text{ kJ mol}^{-1} = -24.8\text{ kJ mol}^{-1}.

Step-by-Step Solution

1
Reverse Equation I so that Fe2O3(s)\text{Fe}_2\text{O}_3(s) becomes a reactant.
Fe2O3(s)2Fe(s)+32O2(g)ΔH1=+824.2 kJ mol1\text{Fe}_2\text{O}_3(s) \rightarrow 2\text{Fe}(s) + \frac{3}{2}\text{O}_2(g) \quad \Delta H_1^\circ = +824.2\text{ kJ mol}^{-1}
Reversing a thermochemical equation changes the sign of its standard enthalpy change, ΔH\Delta H^\circ.
2
Multiply Equation II by 3 so that the stoichiometric coefficient of CO(g)\text{CO}(g) matches the target reaction.
3CO(g)+32O2(g)3CO2(g)ΔH2=3×(283.0 kJ mol1)=849.0 kJ mol13\text{CO}(g) + \frac{3}{2}\text{O}_2(g) \rightarrow 3\text{CO}_2(g) \quad \Delta H_2^\circ = 3 \times (-283.0\text{ kJ mol}^{-1}) = -849.0\text{ kJ mol}^{-1}
Enthalpy change is an extensive property, so multiplying reaction coefficients requires multiplying ΔH\Delta H^\circ by the same factor.
3
Sum the modified thermochemical equations according to Hess's Law.
Fe2O3(s)+3CO(g)2Fe(s)+3CO2(g)\text{Fe}_2\text{O}_3(s) + 3\text{CO}(g) \rightarrow 2\text{Fe}(s) + 3\text{CO}_2(g)
ΔH=ΔH1+ΔH2=+824.2 kJ mol1+(849.0 kJ mol1)=24.8 kJ mol1\Delta H^\circ = \Delta H_1^\circ + \Delta H_2^\circ = +824.2\text{ kJ mol}^{-1} + (-849.0\text{ kJ mol}^{-1}) = -24.8\text{ kJ mol}^{-1}
Hess's Law states that the overall enthalpy change for a chemical reaction is independent of the pathway taken.

Key Concept

Hess's Law of Constant Heat Summation
Estimated Time:2m 0s
Question 8Question

When the temperature of a reacting system is increased, the rate of reaction increases. According to collision theory, which of the following best explains this increase?

Show answer & explanation

Answer: The fraction of colliding particles with kinetic energy equal to or greater than the activation energy increases significantly.

Answer

The rate of reaction increases because higher temperature increases the fraction of colliding particles possessing kinetic energy equal to or exceeding the activation energy.
According to collision theory, increasing temperature increases the average kinetic energy of the molecules. This results in a much larger fraction of colliding molecules having energy equal to or greater than the activation energy (EaE_a), thereby dramatically increasing the rate of successful collisions.

Step-by-Step Solution

1
Recall the two main requirements for an effective collision according to collision theory.
Effective collisions require particles to collide with correct orientation and with energy greater than or equal to the activation energy (EaE_a).
Collision theory states that not all collisions produce products.
2
Analyze the impact of increasing temperature on molecular kinetic energy.
Higher temperature increases the average kinetic energy of reactant particles, broadening the Maxwell-Boltzmann energy distribution curve.
Temperature is a measure of the average kinetic energy of particles.
3
Determine why this leads to a faster reaction rate.
A significantly larger fraction of collisions now possess energy EEaE \ge E_a, leading to a higher frequency of successful (effective) collisions.
This exponential increase in effective collisions is the primary reason for the increased rate of reaction.

Key Concept

Effect of Temperature on Kinetic Energy and Activation Energy in Collision Theory
Question 9Question
The hydration of ethene to produce liquid ethanol is represented by the chemical equation:
C2H4(g)+H2O(g)C2H5OH(l)\text{C}_2\text{H}_4(g) + \text{H}_2\text{O}(g) \rightarrow \text{C}_2\text{H}_5\text{OH}(l)

Given the following thermochemical equations:
1. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l)ΔH=1367 kJ mol1\text{C}_2\text{H}_5\text{OH}(l) + 3\text{O}_2(g) \rightarrow 2\text{CO}_2(g) + 3\text{H}_2\text{O}(l) \quad \Delta H^\circ = -1367\text{ kJ mol}^{-1}
2. C2H4(g)+3O2(g)2CO2(g)+2H2O(l)ΔH=1411 kJ mol1\text{C}_2\text{H}_4(g) + 3\text{O}_2(g) \rightarrow 2\text{CO}_2(g) + 2\text{H}_2\text{O}(l) \quad \Delta H^\circ = -1411\text{ kJ mol}^{-1}
3. H2O(g)H2O(l)ΔH=44 kJ mol1\text{H}_2\text{O}(g) \rightarrow \text{H}_2\text{O}(l) \quad \Delta H^\circ = -44\text{ kJ mol}^{-1}

Calculate the standard enthalpy change, ΔH\Delta H^\circ, for the hydration reaction in kJ mol1\text{kJ mol}^{-1}.

Show answer & explanation

Answer: -88

Answer

The standard enthalpy change for the hydration reaction is -88 kJ/mol.
According to Hess's law, the standard enthalpy change of a net reaction can be determined by algebraically combining component reactions and their enthalpy values. Adding Equation 2 as written, Equation 3 as written, and the reverse of Equation 1 cancels out intermediate species (carbon dioxide, oxygen, and liquid water), leaving the net hydration reaction. Summing their respective enthalpy values gives -1411 kJ/mol + (-44 kJ/mol) + 1367 kJ/mol = -88 kJ/mol.

Step-by-Step Solution

1
Identify the required target thermochemical equation
Target: C2H4(g)+H2O(g)C2H5OH(l)\text{C}_2\text{H}_4(g) + \text{H}_2\text{O}(g) \rightarrow \text{C}_2\text{H}_5\text{OH}(l)
This establishes the stoichiometry and physical states required for reactants and products.
2
Apply Hess's law to reverse and combine the given thermochemical equations
Keep Equation 2: ΔH2=1411 kJ mol1\Delta H_2 = -1411\text{ kJ mol}^{-1}
Keep Equation 3: ΔH3=44 kJ mol1\Delta H_3 = -44\text{ kJ mol}^{-1}
Reverse Equation 1: ΔH1=+1367 kJ mol1\Delta H_1' = +1367\text{ kJ mol}^{-1}
Reversing Equation 1 places liquid ethanol on the product side, requiring the sign of its enthalpy change to be inverted.
3
Sum the enthalpy changes of the modified reaction steps
ΔH=(1411)+(44)+(+1367)=88 kJ mol1\Delta H^\circ = (-1411) + (-44) + (+1367) = -88\text{ kJ mol}^{-1}
According to Hess's law, the total enthalpy change of an overall reaction equals the sum of the enthalpy changes for individual component steps.

Key Concept

Hess's Law of Constant Heat Summation
Question 10Question

Match each chemical process on the left with its corresponding thermodynamic energy classification and enthalpy characteristics on the right.

Click a left item, then click its matching right item

Items

Dissolution of ammonium chloride in water (NH4Cl(s)H2ONH4(aq)++Cl(aq)NH_4Cl_{(s)} \xrightarrow{H_2O} NH_{4(aq)}^+ + Cl_{(aq)}^-)
Combustion of methane gas (CH4(g)+2O2(g)CO2(g)+2H2O(l)CH_{4(g)} + 2O_{2(g)} \rightarrow CO_{2(g)} + 2H_2O_{(l)})
Neutralization of hydrochloric acid with sodium hydroxide (HCl(aq)+NaOH(aq)NaCl(aq)+H2O(l)HCl_{(aq)} + NaOH_{(aq)} \rightarrow NaCl_{(aq)} + H_2O_{(l)})
Thermal decomposition of calcium carbonate (CaCO3(s)ΔCaO(s)+CO2(g)CaCO_{3(s)} \xrightarrow{\Delta} CaO_{(s)} + CO_{2(g)})

Matches

Show answer & explanation

Answer

Dissolution of ammonium chloride matches Endothermic dissolution (absorbs heat causing solution temperature drop); Combustion of methane matches Exothermic combustion (releases heat energy into surroundings); Neutralization of acid and base matches Exothermic neutralization (releases heat during water formation); Thermal decomposition of calcium carbonate matches Endothermic thermal decomposition (requires continuous external heat input).
The pairs are assigned based on thermodynamic principles: reactions that absorb energy from their surroundings (ammonium chloride dissolution and calcium carbonate breakdown) are endothermic (ΔH>0\Delta H > 0), whereas reactions that release heat to their surroundings (methane combustion and acid-base neutralization) are exothermic (ΔH<0\Delta H < 0).

Step-by-Step Solution

1
Identify whether each reaction absorbs or releases energy from its surroundings.
Dissolution of NH4ClNH_4Cl and decomposition of CaCO3CaCO_3 absorb heat (ΔH>0\Delta H > 0). Combustion of CH4CH_4 and neutralization of HCl/NaOHHCl/NaOH evolve heat (ΔH<0\Delta H < 0).
Endothermic processes absorb heat from surroundings (ΔH>0\Delta H > 0), while exothermic processes release heat to surroundings (ΔH<0\Delta H < 0).
2
Pair dissolution of ammonium chloride with its thermodynamic behavior.
Matches 'Endothermic dissolution (ΔH>0\Delta H > 0), where heat is absorbed from the surroundings, resulting in a temperature drop of the solution.'
Lattice dissociation energy exceeds hydration energy in NH4ClNH_4Cl dissolution, causing a cooling effect in the solution.
3
Pair combustion of methane gas with its thermodynamic behavior.
Matches 'Exothermic combustion (ΔH<0\Delta H < 0), where bond formation in products releases substantial thermal energy to the surroundings.'
Energy released upon forming C=OC=O and OHO-H bonds is greater than energy required to break CHC-H and O=OO=O bonds.
4
Pair acid-base neutralization with its thermodynamic behavior.
Matches 'Exothermic neutralization (ΔH<0\Delta H < 0), releasing heat as hydrogen ions react with hydroxide ions to form liquid water.'
The reaction H(aq)++OH(aq)H2O(l)H^+_{(aq)} + OH^-_{(aq)} \rightarrow H_2O_{(l)} has a standard enthalpy change of approximately 57.3 kJ mol1-57.3\text{ kJ mol}^{-1}.
5
Pair thermal decomposition of calcium carbonate with its thermodynamic behavior.
Matches 'Endothermic thermal decomposition (ΔH>0\Delta H > 0), requiring continuous thermal energy input to break chemical bonds in the reactant.'
Thermal breakdown of limestone into calcium oxide and carbon dioxide requires continuous high-temperature heat input.

Key Concept

Classification and Enthalpy Changes of Exothermic and Endothermic Reactions
Question 11Question

An exothermic reversible reaction P(g)+Q(g)R(g)P_{(g)} + Q_{(g)} \rightleftharpoons R_{(g)} has an enthalpy change (ΔH\Delta H) of 40 kJ mol1-40\text{ kJ mol}^{-1} and an uncatalyzed forward activation energy of 65 kJ mol165\text{ kJ mol}^{-1}. In the presence of a catalyst, the activation energy for the forward reaction is lowered by 25 kJ mol125\text{ kJ mol}^{-1}. What is the activation energy for the reverse catalyzed reaction?

Show answer & explanation

Answer: 80 kJ mol180\text{ kJ mol}^{-1}

Answer

The activation energy for the reverse catalyzed reaction is 80 kJ mol180\text{ kJ mol}^{-1}.
In an exothermic reaction with ΔH=40 kJ mol1\Delta H = -40\text{ kJ mol}^{-1}, the products reside at a lower energy level than the reactants. The catalyzed forward activation energy is 6525=40 kJ mol165 - 25 = 40\text{ kJ mol}^{-1}. To go from products back to the activated complex, reactants must gain the 40 kJ mol140\text{ kJ mol}^{-1} lost during the forward reaction plus the 40 kJ mol140\text{ kJ mol}^{-1} required to reach the transition state. Thus, the reverse catalyzed activation energy is 40(40)=80 kJ mol140 - (-40) = 80\text{ kJ mol}^{-1}.

Step-by-Step Solution

1
Calculate the forward catalyzed activation energy
Ea,f(cat)=65 kJ mol125 kJ mol1=40 kJ mol1E_{a,\text{f(cat)}} = 65\text{ kJ mol}^{-1} - 25\text{ kJ mol}^{-1} = 40\text{ kJ mol}^{-1}
A catalyst lowers the forward activation energy by the given reduction amount.
2
Relate reverse activation energy to forward activation energy and reaction enthalpy
Ea,r=Ea,fΔHE_{a,\text{r}} = E_{a,\text{f}} - \Delta H
For any reaction step, the energy barrier in the reverse direction equals the forward energy barrier minus the enthalpy change.
3
Calculate the reverse catalyzed activation energy using the catalyzed forward value and enthalpy change
Ea,r(cat)=40 kJ mol1(40 kJ mol1)=80 kJ mol1E_{a,\text{r(cat)}} = 40\text{ kJ mol}^{-1} - (-40\text{ kJ mol}^{-1}) = 80\text{ kJ mol}^{-1}
Substituting Ea,f(cat)=40 kJ mol1E_{a,\text{f(cat)}} = 40\text{ kJ mol}^{-1} and ΔH=40 kJ mol1\Delta H = -40\text{ kJ mol}^{-1} yields the energy required to convert products back to the transition state under catalysis.

Key Concept

Relationship between forward activation energy, reverse activation energy, enthalpy change, and catalytic lowering in reaction profile diagrams
Question 12Question

During a chemical reaction between dilute hydrochloric acid and calcium carbonate, 60 cm360\text{ cm}^3 of carbon dioxide gas is collected over a period of 30 seconds30\text{ seconds}. What is the average rate of evolution of the gas in cm3 s1\text{cm}^3\text{ s}^{-1}?

Show answer & explanation

Answer: 2

Answer

The average rate of gas evolution is 2.0 cm3 s12.0\text{ cm}^3\text{ s}^{-1}.
The average rate of a reaction yielding a gas is given by dividing the total volume of gas produced by the total time taken. Dividing 60 cm360\text{ cm}^3 by 30 seconds30\text{ seconds} gives an average rate of 2.0 cm3 s12.0\text{ cm}^3\text{ s}^{-1}.

Step-by-Step Solution

1
Identify the volume of gas evolved and the time duration.
Volume = 60 cm360\text{ cm}^3, Time = 30 seconds30\text{ seconds}.
These are the measured parameters required to calculate the average rate of reaction.
2
Calculate the average rate of reaction.
Rate=60 cm330 s=2.0 cm3 s1\text{Rate} = \frac{60\text{ cm}^3}{30\text{ s}} = 2.0\text{ cm}^3\text{ s}^{-1}.
The reaction rate measures the change in concentration or amount of a reactant or product per unit time.

Key Concept

Rate of Reaction Calculation
Question 13Question
Consider the thermochemical equations below:
I. C(s)+O2(g)CO2(g)ΔH=393.5 kJ mol1\text{I. } \text{C}(s) + \text{O}_2(g) \rightarrow \text{CO}_2(g) \quad \Delta H = -393.5\text{ kJ mol}^{-1}
II. CO(g)+12O2(g)CO2(g)ΔH=283.0 kJ mol1\text{II. } \text{CO}(g) + \frac{1}{2}\text{O}_2(g) \rightarrow \text{CO}_2(g) \quad \Delta H = -283.0\text{ kJ mol}^{-1}

What is the standard enthalpy of formation of carbon(II) oxide, CO(g)\text{CO}(g)?

Show answer & explanation

Answer: 110.5 kJ mol1-110.5\text{ kJ mol}^{-1}

Answer

110.5 kJ mol1-110.5\text{ kJ mol}^{-1}
To find the enthalpy of formation of CO(g)\text{CO}(g) from C(s)\text{C}(s) and O2(g)\text{O}_2(g), Equation I is kept as written (ΔH1=393.5 kJ mol1\Delta H_1 = -393.5\text{ kJ mol}^{-1}) while Equation II is reversed so that CO(g)\text{CO}(g) appears on the product side (changing ΔH2\Delta H_2 from 283.0 kJ mol1-283.0\text{ kJ mol}^{-1} to +283.0 kJ mol1+283.0\text{ kJ mol}^{-1}). Summing both steps gives 393.5+283.0=110.5 kJ mol1-393.5 + 283.0 = -110.5\text{ kJ mol}^{-1}.

Step-by-Step Solution

1
Write the target equation for the standard enthalpy of formation of CO(g)\text{CO}(g)
C(s)+12O2(g)CO(g)ΔHf=?\text{C}(s) + \frac{1}{2}\text{O}_2(g) \rightarrow \text{CO}(g) \quad \Delta H_f^\circ = ?
The standard enthalpy of formation is the heat change when 1 mole of a substance is formed from its constituent elements in their standard states.
2
Manipulate the given equations so their sum yields the target equation
Keep Equation I as written:
C(s)+O2(g)CO2(g)ΔH1=393.5 kJ mol1\text{C}(s) + \text{O}_2(g) \rightarrow \text{CO}_2(g) \quad \Delta H_1 = -393.5\text{ kJ mol}^{-1}
Reverse Equation II:
CO2(g)CO(g)+12O2(g)ΔH2=+283.0 kJ mol1\text{CO}_2(g) \rightarrow \text{CO}(g) + \frac{1}{2}\text{O}_2(g) \quad \Delta H_2' = +283.0\text{ kJ mol}^{-1}
Reversing a reaction changes the sign of its enthalpy change according to Hess's Law.
3
Sum the manipulated equations and their corresponding ΔH\Delta H values
C(s)+12O2(g)CO(g)\text{C}(s) + \frac{1}{2}\text{O}_2(g) \rightarrow \text{CO}(g)
ΔHf=393.5 kJ mol1+283.0 kJ mol1=110.5 kJ mol1\Delta H_f^\circ = -393.5\text{ kJ mol}^{-1} + 283.0\text{ kJ mol}^{-1} = -110.5\text{ kJ mol}^{-1}
Hess's Law states that the overall enthalpy change of a reaction is equal to the sum of the enthalpy changes for each step.

Key Concept

Hess's Law and Standard Enthalpy of Formation
Estimated Time:1m 30s
Question 14Question

Which of the following statements correctly describes the effect of adding a positive catalyst to a chemical reaction?

Show answer & explanation

Answer: It lowers the activation energy barrier by providing an alternative reaction pathway.

Answer

A catalyst lowers the activation energy barrier by providing an alternative reaction pathway.
A positive catalyst increases the rate of reaction by providing an alternative pathway with a lower activation energy barrier, allowing more colliding particles to possess energy equal to or exceeding the activation energy.

Step-by-Step Solution

1
Identify the role of a catalyst in chemical kinetics.
A catalyst speeds up a reaction without being consumed.
By introducing an alternative mechanism, the activation energy (EaE_a) peak on the energy profile diagram is lowered.
2
Distinguish between kinetic effects and thermodynamic properties.
Thermodynamic properties like enthalpy change (ΔH\Delta H) and equilibrium position remain unaffected.
The initial energy of reactants and final energy of products remain constant regardless of whether a catalyst is present.

Key Concept

Effect of a Catalyst on Activation Energy and Energy Profile Diagrams
Question 15Question
Calculate the standard enthalpy of combustion of liquid carbon disulfide (CS2(l)\text{CS}_2(l)) in kJ mol1\text{kJ mol}^{-1}, given the following standard enthalpies of formation:
ΔHf[CS2(l)]=+88 kJ mol1\Delta H_f^\circ[\text{CS}_2(l)] = +88\text{ kJ mol}^{-1}
ΔHf[CO2(g)]=394 kJ mol1\Delta H_f^\circ[\text{CO}_2(g)] = -394\text{ kJ mol}^{-1}
ΔHf[SO2(g)]=297 kJ mol1\Delta H_f^\circ[\text{SO}_2(g)] = -297\text{ kJ mol}^{-1}
The balanced chemical equation for the combustion process is:
CS2(l)+3O2(g)CO2(g)+2SO2(g)\text{CS}_2(l) + 3\text{O}_2(g) \rightarrow \text{CO}_2(g) + 2\text{SO}_2(g)

What is the standard enthalpy change of combustion in kJ mol1\text{kJ mol}^{-1}?

Show answer & explanation

Answer: -1076

Answer

The standard enthalpy of combustion of liquid carbon disulfide is -1076 kJ mol^-1.
Applying Hess's law using standard enthalpies of formation gives ΔH=ΔHf(products)ΔHf(reactants)\Delta H^\circ = \sum \Delta H_f^\circ(\text{products}) - \sum \Delta H_f^\circ(\text{reactants}). For the combustion of carbon disulfide, this evaluates to [(394)+2(297)](+88)=98888=1076 kJ mol1[(-394) + 2(-297)] - (+88) = -988 - 88 = -1076\text{ kJ mol}^{-1}.

Step-by-Step Solution

1
Formulate the standard enthalpy of reaction equation using standard enthalpies of formation.
\Delta H^\circ = \sum n\Delta H_f^\circ(\text{products}) - \sum m\Delta H_f^\circ(\text{reactants})
According to Hess's Law, the net standard enthalpy change for a chemical process equals the sum of standard formation enthalpies of products minus reactants.
2
Substitute the provided standard enthalpy of formation values into the expression, taking into account stoichiometry.
\Delta H^\circ = [-394 + 2(-297)] - [88] = -1076\text{ kJ mol}^{-1}
Sulfur dioxide is formed with a mole ratio of 2, so its formation enthalpy must be doubled; oxygen gas has a formation enthalpy of zero.

Key Concept

Standard Enthalpy Changes and Hess's Law
Question 16Question

Consider the reversible industrial reaction represented by the thermochemical equation below:

2SO2(g)+O2(g)2SO3(g)ΔH=197 kJ mol12SO_2(g) + O_2(g) \rightleftharpoons 2SO_3(g) \quad \Delta H = -197\text{ kJ mol}^{-1}

If finely divided vanadium(V) oxide (V2O5V_2O_5) catalyst is introduced into the reaction vessel at constant volume while the temperature of the system is lowered, which of the following best describes the combined effect on the equilibrium yield of SO3(g)SO_3(g) and the rate of reaching equilibrium?

Show answer & explanation

Answer: The yield of SO3(g)SO_3(g) increases because the exothermic forward reaction is favored by cooling, and the equilibrium state is reached more rapidly due to the catalyst lowering activation energy.

Answer

The yield of SO3(g)SO_3(g) increases because the exothermic forward reaction is favored by cooling, and the equilibrium state is reached more rapidly due to the catalyst lowering activation energy.
Lowering the temperature favors the heat-producing (exothermic) forward reaction because \(\Delta H < 0\), resulting in an increased equilibrium yield of SO3(g)SO_3(g). Simultaneously, adding vanadium(V) oxide provides an alternative reaction pathway with lower activation energy, speeding up the attainment of dynamic equilibrium without altering the equilibrium position.

Step-by-Step Solution

1
Analyze the thermochemical equation for enthalpy change (\(\Delta H\)).
\(\Delta H = -197\text{ kJ mol}^{-1}\), which confirms the forward reaction is exothermic (releases heat).
Determining whether the forward reaction is exothermic or endothermic is necessary to predict the impact of temperature changes according to Le Chatelier's principle.
2
Apply Le Chatelier's principle to the temperature decrease.
Lowering the temperature shifts the equilibrium in the heat-producing (exothermic forward) direction, increasing the yield of SO3(g)SO_3(g).
The system counteracts the loss of thermal energy by shifting toward the side that produces heat.
3
Evaluate the effect of adding a catalyst (V2O5V_2O_5).
The catalyst lowers activation energy for both forward and reverse pathways, accelerating the rate at which equilibrium is attained without affecting the position of equilibrium or yield.
Catalysts increase reaction rates equally in both directions and have zero effect on thermodynamic equilibrium position.

Key Concept

Effect of temperature and catalysts on dynamic equilibrium (Le Chatelier's Principle)
Estimated Time:1m 30s
Question 17Question

A chemical reaction has an enthalpy change (ΔH\Delta H) of +40.0 kJ mol1+40.0\text{ kJ mol}^{-1} and an entropy change (ΔS\Delta S) of +100 J K1 mol1+100\text{ J K}^{-1}\text{ mol}^{-1}. Above what minimum temperature, in degrees Celsius (C^\circ\text{C}), will the reaction become spontaneous?

Show answer & explanation

Answer: 127C127^\circ\text{C}

Answer

The minimum temperature above which the reaction becomes spontaneous is 127C127^\circ\text{C}.
According to the Gibbs free energy relationship ΔG=ΔHTΔS\Delta G = \Delta H - T\Delta S, a reaction is spontaneous when ΔG<0\Delta G < 0. At the transition temperature between spontaneous and non-spontaneous states, ΔG=0\Delta G = 0. Substituting ΔH=40,000 J mol1\Delta H = 40,000\text{ J mol}^{-1} and ΔS=100 J K1 mol1\Delta S = 100\text{ J K}^{-1}\text{ mol}^{-1} gives T=40000100=400 KT = \frac{40000}{100} = 400\text{ K}. Converting to degrees Celsius by subtracting 273273 yields 127C127^\circ\text{C}. Therefore, above 127C127^\circ\text{C}, the reaction becomes spontaneous.

Step-by-Step Solution

1
Convert the enthalpy change from kilojoules to joules to ensure consistent units with entropy change.
ΔH=+40.0 kJ mol1=+40,000 J mol1\Delta H = +40.0\text{ kJ mol}^{-1} = +40,000\text{ J mol}^{-1}
ΔS\Delta S is given in J K1 mol1\text{J K}^{-1}\text{ mol}^{-1}, so ΔH\Delta H must be expressed in Joules.
2
Determine the threshold temperature (TT) at equilibrium where ΔG=0\Delta G = 0 using the Gibbs free energy equation ΔG=ΔHTΔS\Delta G = \Delta H - T\Delta S.
0=ΔHTΔS    T=ΔHΔS=40000 J mol1100 J K1 mol1=400 K0 = \Delta H - T\Delta S \implies T = \frac{\Delta H}{\Delta S} = \frac{40000\text{ J mol}^{-1}}{100\text{ J K}^{-1}\text{ mol}^{-1}} = 400\text{ K}
A reaction is spontaneous when ΔG<0\Delta G < 0, which occurs when temperature exceeds the threshold temperature T=ΔHΔST = \frac{\Delta H}{\Delta S} for endothermic reactions with positive entropy change.
3
Convert the temperature from Kelvin (K\text{K}) to degrees Celsius (C^\circ\text{C}).
T(C)=400 K273=127CT(^\circ\text{C}) = 400\text{ K} - 273 = 127^\circ\text{C}
The question specifically requests the temperature in degrees Celsius.

Key Concept

Gibbs Free Energy Equation and Temperature Dependence of Spontaneity
Question 18Question

What is the correct equilibrium constant expression, KcK_c, for the reaction 2NO2(g)N2O4(g)2\text{NO}_2(g) \rightleftharpoons \text{N}_2\text{O}_4(g)?

Show answer & explanation

Answer: Kc=[N2O4][NO2]2K_c = \frac{[\text{N}_2\text{O}_4]}{[\text{NO}_2]^2}

Answer

The correct equilibrium constant expression is Kc=[N2O4][NO2]2K_c = \frac{[\text{N}_2\text{O}_4]}{[\text{NO}_2]^2}.
According to the Law of Mass Action, the equilibrium constant expression KcK_c for a general reversible reaction aA+bBcC+dDaA + bB \rightleftharpoons cC + dD is given by Kc=[C]c[D]d[A]a[B]bK_c = \frac{[C]^c[D]^d}{[A]^a[B]^b}. For the reaction 2NO2(g)N2O4(g)2\text{NO}_2(g) \rightleftharpoons \text{N}_2\text{O}_4(g), the concentration of the product N2O4\text{N}_2\text{O}_4 is raised to the power of 1 in the numerator, and the concentration of the reactant NO2\text{NO}_2 is raised to the power of 2 in the denominator, yielding Kc=[N2O4][NO2]2K_c = \frac{[\text{N}_2\text{O}_4]}{[\text{NO}_2]^2}.

Step-by-Step Solution

1
Identify the products and reactants along with their stoichiometric coefficients from the balanced equation.
Reactant: NO2\text{NO}_2 with coefficient 2; Product: N2O4\text{N}_2\text{O}_4 with coefficient 1.
Equilibrium constant expressions require product concentrations in the numerator and reactant concentrations in the denominator, each raised to the power of its stoichiometric coefficient.
2
Formulate the equilibrium constant ratio Kc=[Products]coefficients[Reactants]coefficientsK_c = \frac{[\text{Products}]^{\text{coefficients}}}{[\text{Reactants}]^{\text{coefficients}}}.
Kc=[N2O4]1[NO2]2K_c = \frac{[\text{N}_2\text{O}_4]^1}{[\text{NO}_2]^2}.
Placing [N2O4][\text{N}_2\text{O}_4] in the numerator and [NO2]2[\text{NO}_2]^2 in the denominator satisfies the law of mass action.

Key Concept

Equilibrium Constant Expression (KcK_c)
Question 19Question

In an experiment to measure the rate of a chemical reaction, 0.50 g0.50\text{ g} of calcium carbonate reacts completely with excess dilute hydrochloric acid in 25 seconds25\text{ seconds}. What is the average rate of reaction with respect to the loss of mass of calcium carbonate in g s1\text{g s}^{-1}?

Show answer & explanation

Answer: 0.02

Answer

The average rate of reaction with respect to the mass of calcium carbonate consumed is 0.02 g s10.02\text{ g s}^{-1}.
The average rate of a reaction is calculated as the ratio of the change in amount of reactant or product to the time taken. Substituting the given values gives Rate=0.50 g25 s=0.02 g s1\text{Rate} = \frac{0.50\text{ g}}{25\text{ s}} = 0.02\text{ g s}^{-1}.

Step-by-Step Solution

1
Extract the given values from the problem statement.
Mass of CaCO3=0.50 g\text{CaCO}_3 = 0.50\text{ g}, Time =25 s= 25\text{ s}.
These parameters define the total change in quantity and the time interval for the reaction.
2
Calculate the average rate of reaction by dividing the change in mass by the time elapsed.
Rate=0.50 g25 s=0.02 g s1\text{Rate} = \frac{0.50\text{ g}}{25\text{ s}} = 0.02\text{ g s}^{-1}.
The rate of a chemical reaction measures how rapidly a reactant is consumed per unit time.

Key Concept

Rate of Reaction Calculation
Estimated Time:1m 0s
Question 20Question

According to collision theory, which of the following best explains why adding a positive catalyst increases the rate of a chemical reaction?

Show answer & explanation

Answer: It provides an alternative reaction pathway with a lower activation energy, increasing the proportion of effective collisions.

Answer

A catalyst increases the reaction rate by providing an alternative pathway with a lower activation energy, thereby increasing the fraction of colliding particles with energy EEaE \ge E_a.
The correct option explains that a positive catalyst lowers the activation energy (EaE_a) by providing an alternative mechanism. Consequently, a greater percentage of molecular collisions possess the requisite energy to overcome the energy barrier, resulting in a higher rate of effective collisions.

Step-by-Step Solution

1
Define collision theory criteria for effective collisions
For a collision to result in a chemical reaction, colliding particles must possess minimum activation energy (EaE_a) and correct molecular orientation.
Establishing the essential requirements for a successful chemical transformation.
2
Analyze the action of a positive catalyst
A positive catalyst offers an alternative reaction mechanism featuring an activated complex of lower energy.
Determining how the energy barrier is modified in the presence of a catalyst.
3
Evaluate the effect on reaction rate and equilibrium
Lowering EaE_a means a higher fraction of reactant particles have kinetic energy EEaE \ge E_a, increasing collision frequency successfully without shifting equilibrium or changing overall ΔH\Delta H.
Connecting activation energy reduction directly to rate increase.

Key Concept

Role of Catalysts in Collision Theory
Estimated Time:1m 0s
Page 1 / 5Next
Energetics, Rates of Reaction and Chemical Equilibrium Practice Questions — JAMB UTME | Examkin