All practice questions

2789 questions

Question 2061Question

In the equation x2bx+16=0x^2 - bx + 16 = 0, bb is a positive integer. If the equation has no real solutions, what is the greatest possible value of bb?

Show answer & explanation

Answer: 7

Answer

The greatest possible value of bb is 77.
For the quadratic equation x2bx+16=0x^2 - bx + 16 = 0 to have no real solutions, its discriminant must be less than 00. The discriminant is (b)24(1)(16)=b264(-b)^2 - 4(1)(16) = b^2 - 64. Solving the inequality b264<0b^2 - 64 < 0 gives b2<64b^2 < 64. Since bb is a positive integer, taking the square root of both sides gives b<8b < 8. The positive integers less than 88 are 1,2,3,4,5,6,1, 2, 3, 4, 5, 6, and 77. The greatest of these values is 77.

Step-by-Step Solution

1
Set up the inequality for the discriminant to be less than zero.
(b)24(1)(16)<0(-b)^2 - 4(1)(16) < 0
A quadratic equation of the form ax2+bx+c=0ax^2 + bx + c = 0 has no real solutions if and only if its discriminant, D=b24acD = b^2 - 4ac, is negative.
2
Simplify the quadratic inequality.
b2<64b^2 < 64
Squaring b-b yields b2b^2 and calculating 4(1)(16)4(1)(16) yields 6464.
3
Solve for the greatest positive integer value of bb.
b<8b < 8, so the greatest positive integer is 77.
Since bb is a positive integer, the values satisfying b2<64b^2 < 64 are 1,2,3,4,5,6,1, 2, 3, 4, 5, 6, and 77. The largest of these is 77.

Key Concept

Quadratic Discriminant and Number of Solutions
Question 2062Question

What is the complete set of solutions to the inequality 23(6x9)+4>12-\frac{2}{3}(6x - 9) + 4 > 12?

Show answer & explanation

Answer: x<12x < -\frac{1}{2}

Answer

The inequality is satisfied for all values of xx such that x<12x < -\frac{1}{2}.
Distributing 23-\frac{2}{3} across (6x9)(6x - 9) yields 4x+6-4x + 6. Adding 4 gives 4x+10>12-4x + 10 > 12. Subtracting 10 from both sides results in 4x>2-4x > 2. Dividing by 4-4 and reversing the inequality sign yields x<12x < -\frac{1}{2}.

Step-by-Step Solution

1
Distribute 23-\frac{2}{3} to both terms inside the parentheses: (6x9)(6x - 9).
4x+6+4>12-4x + 6 + 4 > 12, which simplifies to 4x+10>12-4x + 10 > 12.
Applying the distributive property removes the parentheses.
2
Subtract 10 from both sides of the inequality to isolate the term with xx.
4x>2-4x > 2
Subtracting 10 from both sides maintains the inequality while simplifying the constant terms.
3
Divide both sides by 4-4 and reverse the inequality sign.
x<12x < -\frac{1}{2}
Dividing both sides of an inequality by a negative number requires reversing the direction of the inequality symbol.

Key Concept

Solving linear inequalities in one variable requires distributing coefficient terms, combining constants, and reversing the inequality sign when multiplying or dividing by a negative number.
Estimated Time:1m 15s
Question 2063Question

A solid right circular cone has a base radius of 6 centimeters6\text{ centimeters} and a height of 8 centimeters8\text{ centimeters}. A sphere is inscribed inside the cone such that it is tangent to the base of the cone and tangent to the lateral surface of the cone. What is the ratio of the volume of the sphere to the volume of the cone?

Show answer & explanation

Answer: 38\frac{3}{8}

Answer

The ratio of the volume of the sphere to the volume of the cone is 38\frac{3}{8}.
The correct answer is found by first determining the radius of the inscribed sphere. By analyzing the 2D cross-section of the cone, which is an isosceles triangle with a base of 1212 and a height of 88, the slant height is found to be 1010 using the Pythagorean theorem. The radius of the inscribed circle (the sphere's radius) is calculated using the area and semiperimeter of the triangle, yielding R=3R = 3. The volume of the sphere is 36π36\pi and the volume of the cone is 96π96\pi. Dividing the sphere's volume by the cone's volume gives the ratio of 38\frac{3}{8}.

Step-by-Step Solution

1
Find the slant height of the cone.
Slant height L=10 centimetersL = 10\text{ centimeters}.
The vertical cross-section of the cone is an isosceles triangle with base 2r=122r = 12 and height h=8h = 8. The slant height is the hypotenuse of the right triangle formed by the radius, height, and slant height: L=62+82=10L = \sqrt{6^2 + 8^2} = 10.
2
Calculate the radius of the inscribed sphere.
Sphere radius R=3 centimetersR = 3\text{ centimeters}.
The sphere's radius is the inradius of the cross-sectional isosceles triangle. The area of this triangle is A=12×12×8=48A = \frac{1}{2} \times 12 \times 8 = 48, and its semiperimeter is s=12+10+102=16s = \frac{12 + 10 + 10}{2} = 16. Using the inradius formula R=AsR = \frac{A}{s}, we get R=4816=3R = \frac{48}{16} = 3.
3
Calculate the volume of the cone.
Volume of the cone Vcone=96π cubic centimetersV_{\text{cone}} = 96\pi\text{ cubic centimeters}.
Using the volume of a cone formula, Vcone=13πr2h=13π(62)(8)=96πV_{\text{cone}} = \frac{1}{3}\pi r^2 h = \frac{1}{3}\pi (6^2)(8) = 96\pi.
4
Calculate the volume of the sphere.
Volume of the sphere Vsphere=36π cubic centimetersV_{\text{sphere}} = 36\pi\text{ cubic centimeters}.
Using the volume of a sphere formula, Vsphere=43πR3=43π(33)=36πV_{\text{sphere}} = \frac{4}{3}\pi R^3 = \frac{4}{3}\pi (3^3) = 36\pi.
5
Compute the ratio of the volume of the sphere to the volume of the cone.
Ratio =38= \frac{3}{8}.
Divide the volume of the sphere by the volume of the cone: 36π96π=3696=38\frac{36\pi}{96\pi} = \frac{36}{96} = \frac{3}{8}.

Key Concept

Calculating the volume of spheres and cones, and using 2D cross-sections to find missing geometric dimensions of inscribed solids.
Question 2064Question

A commercial coffee roaster heats a large batch of coffee beans. The temperature TT, in degrees Celsius (C^\circ\text{C}), of the beans mm minutes after heating begins is modeled by the equation T=18m+31T = 18m + 31, where m10m \le 10. Which of the following is the best interpretation of 1818 in this context?

Show answer & explanation

Answer: The increase in the temperature of the beans, in degrees Celsius, for each minute of heating.

Answer

The increase in the temperature of the beans, in degrees Celsius, for each minute of heating.
The equation is in the slope-intercept form T=18m+31T = 18m + 31, where 1818 is the slope and 3131 is the y-intercept. In this context, TT represents the temperature of the beans and mm represents the time in minutes. The slope, 1818, represents the rate of change of the temperature with respect to time, which means the temperature increases by 18C18^\circ\text{C} for each minute of heating.

Step-by-Step Solution

1
Identify the component of the linear equation being questioned.
The number 1818 is the coefficient of the variable mm in the linear equation T=18m+31T = 18m + 31.
We need to determine what role the coefficient of the independent variable plays in a linear model.
2
Determine the mathematical meaning of the coefficient in a linear equation of the form y=mx+by = mx + b.
The coefficient of mm, which is 1818, represents the slope or the rate of change of TT with respect to mm.
In a linear function, the slope represents the change in the dependent variable per unit change in the independent variable.
3
Interpret the rate of change in the context of the problem.
Since TT is the temperature in degrees Celsius (C^\circ\text{C}) and mm is the time in minutes, a rate of change of 1818 means that the temperature increases by 18C18^\circ\text{C} for every 11 minute of heating.
This matches the definition of the slope in the given context.

Key Concept

Interpreting the slope of a linear relationship in context
Estimated Time:1m 0s
Question 2065Question

If 4a182a=1634^{a - 1} \cdot 8^{2a} = 16^3, what is the value of aa?

Show answer & explanation

Answer: frac74\\frac{7}{4}

Answer

frac74\\frac{7}{4}
The correct answer is 74\frac{7}{4}. Rewriting each base in the equation 4a182a=1634^{a - 1} \cdot 8^{2a} = 16^3 as a power of 2 gives (22)a1(23)2a=(24)3(2^2)^{a-1} \cdot (2^3)^{2a} = (2^4)^3. Applying the power of a power rule results in 22a226a=2122^{2a-2} \cdot 2^{6a} = 2^{12}. Using the product rule of exponents to combine the left side yields 22a2+6a=28a2=2122^{2a-2+6a} = 2^{8a-2} = 2^{12}. Setting the exponents equal gives 8a2=128a - 2 = 12, which simplifies to 8a=148a = 14, or a=74a = \frac{7}{4}.

Step-by-Step Solution

1
Rewrite each base in the equation 4a182a=1634^{a - 1} \cdot 8^{2a} = 16^3 as a power of 2.
(22)a1(23)2a=(24)3(2^2)^{a-1} \cdot (2^3)^{2a} = (2^4)^3
To solve an exponential equation with different bases, rewrite the bases so they are identical.
2
Apply the power of a power rule (xm)n=xmn(x^m)^n = x^{m \cdot n} to simplify each term.
22a226a=2122^{2a-2} \cdot 2^{6a} = 2^{12}
This simplifies the exponents by multiplying the inner and outer exponents.
3
Apply the product rule xmxn=xm+nx^m \cdot x^n = x^{m+n} to combine the terms on the left side.
28a2=2122^{8a-2} = 2^{12}
This combines the exponents of the terms with the common base of 2.
4
Set the exponents equal to each other and solve the resulting linear equation for aa.
8a2=128a=14a=frac748a - 2 = 12 \Rightarrow 8a = 14 \Rightarrow a = \\frac{7}{4}
Since the bases are equal, their exponents must be equal.

Key Concept

Solving exponential equations by expressing all terms with a common base and applying exponent rules.

Alternative Method

Instead of converting to base 2, all terms can be written in base 4: 4a1(41.5)2a=(42)34^{a - 1} \cdot (4^{1.5})^{2a} = (4^2)^3, which simplifies to 4a1+3a=464^{a - 1 + 3a} = 4^6, leading to 4a1=64a - 1 = 6 and a=frac74a = \\frac{7}{4}.
Estimated Time:1m 30s
Question 2066Question

A circular rug has an area of 16π16\pi square feet. If the radius of the rug is tripled, what is the area, in square feet, of the new rug?

Show answer & explanation

Answer: 144π144\pi

Answer

The area of the new rug is 144π144\pi square feet.
The area of a circle scales with the square of its radius. If the radius is tripled, the area is multiplied by 32=93^2 = 9. Since the original area is 16π16\pi square feet, the area of the new rug is 16π×9=144π16\pi \times 9 = 144\pi square feet.

Step-by-Step Solution

1
Determine the relationship between the linear scale factor and the area scale factor of a circle.
If the radius of a circle is multiplied by a scale factor kk, the area of the circle is multiplied by k2k^2.
The area of a circle is proportional to the square of its radius (A=πr2A = \pi r^2).
2
Find the area scale factor when the radius is tripled.
Since the radius is multiplied by 33, the area scale factor is 32=93^2 = 9.
Squaring the linear scale factor of 3 gives the quadratic scale factor for the area.
3
Calculate the area of the new rug.
The new area is 16π×9=144π16\pi \times 9 = 144\pi square feet.
Multiplying the original area of 16π16\pi square feet by the area scale factor of 9 yields the final scaled area.

Key Concept

Area scaling of two-dimensional shapes
Estimated Time:1m 0s
Question 2067Question

Two straight support beams on a bridge intersect at a single point. One of the angles formed by their intersection measures 7474^\circ. An adjacent angle along the straight line of one of the beams has a measure of (2x+16)(2x + 16)^\circ. What is the value of xx?

Show answer & explanation

Answer: 45

Answer

45
Since the two angles form a linear pair along a straight support beam, their measures must sum to 180180^\circ. We can write the equation as 74+(2x+16)=18074 + (2x + 16) = 180. Combining like terms gives 2x+90=1802x + 90 = 180. Subtracting 9090 from both sides yields 2x=902x = 90. Finally, dividing by 22 gives x=45x = 45.

Step-by-Step Solution

1
Set up the equation using the property of supplementary angles.
74+(2x+16)=18074 + (2x + 16) = 180
Adjacent angles on a straight line form a linear pair, which means they are supplementary and sum to 180180^\circ.
2
Combine the constant terms on the left side of the equation.
2x+90=1802x + 90 = 180
Adding 7474 and 1616 simplifies the constant terms to 9090.
3
Isolate the variable term by subtracting 90 from both sides of the equation.
2x=902x = 90
Subtracting 9090 from 180180 leaves 9090 on the right side.
4
Solve for x by dividing both sides of the equation by 2.
x=45x = 45
Dividing 2x2x and 9090 by 22 isolates the variable xx.

Key Concept

Adjacent angles on a straight line are supplementary and add up to 180 degrees.
Estimated Time:45s
Question 2068Question

If 27x1=35x+127^{x-1} = \sqrt{3^{5x+1}}, what is the value of xx?

Show answer & explanation

Answer: 7

Answer

The correct answer is 7.
The correct answer is 7. By converting the base of 27 to 333^3 and rewriting the radical on the right side as a fractional exponent of 12\frac{1}{2}, the equation becomes 33(x1)=35x+123^{3(x-1)} = 3^{\frac{5x+1}{2}}. Since the bases are equal, their exponents must be equal: 3x3=5x+123x - 3 = \frac{5x+1}{2}. Multiplying both sides by 2 yields 6x6=5x+16x - 6 = 5x + 1. Subtracting 5x5x and adding 6 to both sides isolates xx, giving the solution x=7x = 7.

Step-by-Step Solution

1
Express both sides of the equation with a common base of 3.
(33)x1=(35x+1)12(3^3)^{x-1} = (3^{5x+1})^{\frac{1}{2}}
Expressing terms with a common base allows the exponents to be compared directly.
2
Apply the power of a power exponent rule, (am)n=amn(a^m)^n = a^{mn}, to simplify the exponents on both sides.
33x3=35x+123^{3x-3} = 3^{\frac{5x+1}{2}}
Simplifying the expressions makes it possible to set the exponent expressions equal to each other.
3
Equate the exponents since the bases are identical.
3x3=5x+123x - 3 = \frac{5x+1}{2}
If two exponential expressions with the same positive base (other than 1) are equal, their exponents must also be equal.
4
Solve the linear equation for xx by clearing the fraction and isolating the variable.
x=7x = 7
Multiplying both sides by 2 gives 6x6=5x+16x - 6 = 5x + 1. Subtracting 5x5x from both sides and adding 6 to both sides isolates xx, resulting in x=7x = 7.

Key Concept

Solving exponential equations by converting to a common base and applying exponent laws.
Question 2069Question

During their annual migration across the North Atlantic Gyre, hatchling loggerhead sea turtles rely on an internal compass known as magnetoreception to navigate. The young turtles detect subtle variations in the intensity and angle of Earth's magnetic field ______ sophisticated sensory ability allows them to maintain their direction in the open ocean where visual cues are completely absent.

Which choice completes the text so that it conforms to the conventions of Standard English?

Show answer & explanation

Answer: ; this

Answer

the option containing a semicolon followed by 'this'
The correct option correctly uses a semicolon to join two independent clauses. The clause before the blank ('The young turtles detect subtle variations in the intensity and angle of Earth's magnetic field') and the clause after the blank ('this sophisticated sensory ability allows them to maintain their direction in the open ocean where visual cues are completely absent') are both complete thoughts that can stand alone. A semicolon is a standard and appropriate way to link two closely related independent clauses without a coordinating conjunction.

Step-by-Step Solution

1
Identify the structure of the two clauses surrounding the blank.
The clause before the blank ('The young turtles detect subtle variations in the intensity and angle of Earth's magnetic field') and the clause after the blank ('this sophisticated sensory ability allows them to maintain their direction...') are both independent clauses because each can stand alone as a complete sentence.
Understanding clause boundaries helps determine the correct punctuation or conjunction needed to link them.
2
Evaluate the choices based on standard punctuation rules for linking independent clauses.
Two independent clauses must be joined by a period, a semicolon, a colon (if the second clause explains/illustrates the first), or a comma followed by a coordinating conjunction.
This narrows down the grammatical options and eliminates choices that cause run-on sentences or comma splices.
3
Analyze the semantic relationship between the two clauses to select the most appropriate option.
The second clause explains how the detection mentioned in the first clause helps the turtles navigate. This is a relationship of explanation or addition, not contrast. A semicolon alone is a grammatically correct way to link these closely related independent clauses.
This ensures the selected option is both grammatically correct and logically coherent.

Key Concept

Clause Boundaries and Linking
Estimated Time:1m 0s
Question 2070Question

An aquarium filter recirculates water at a constant rate of 250250 milliliters per second. The filter cartridge must be replaced after it has processed a total of 540540 cubic meters of water. For how many hours of continuous operation can the filter run before the cartridge must be replaced? (1 cubic meter=1,000 liters1\text{ cubic meter} = 1,000\text{ liters})

Show answer & explanation

Answer: 600

Answer

The filter can run for 600600 hours of continuous operation before the cartridge must be replaced.
To find the number of hours the filter can run, we first convert the flow rate to cubic meters per hour. The flow rate of 250250 milliliters per second is equal to 0.250.25 liters per second. Multiplying by 3,6003,600 seconds per hour gives a flow rate of 900900 liters per hour. Since 1 cubic meter=1,000 liters1\text{ cubic meter} = 1,000\text{ liters}, 900900 liters per hour is equivalent to 0.90.9 cubic meters per hour. Finally, dividing the total capacity of 540540 cubic meters by the flow rate of 0.90.9 cubic meters per hour yields a duration of 600600 hours.

Step-by-Step Solution

1
Convert the water recirculating rate from milliliters per second to liters per second.
0.250.25 liters per second
To express the flow rate in terms of liters before converting to cubic meters.
2
Convert the rate from liters per second to liters per hour.
900900 liters per hour
To align the time unit of the rate with the requested time unit (hours).
3
Convert the rate from liters per hour to cubic meters per hour.
0.90.9 cubic meters per hour
To match the volume unit of the filter cartridge capacity (cubic meters).
4
Divide the total cartridge capacity by the hourly flow rate of the filter.
600600 hours
To find the total duration of continuous operation before replacement.

Key Concept

Unit Conversions
Question 2071Question

If sin(x)=cos(38)\sin(x^\circ) = \cos(38^\circ), where 0<x<900 < x < 90, what is the value of xx?

Show answer & explanation

Answer: 52

Answer

The value of xx is 52.
Applying the co-function identity sin(θ)=cos(90θ)\sin(\theta) = \cos(90^\circ - \theta) allows us to set the argument of the sine function as the complement of the cosine's argument. Thus, x=9038=52x = 90 - 38 = 52.

Step-by-Step Solution

1
Identify the relevant trigonometric identity.
The co-function identity sin(x)=cos(90x)\sin(x^\circ) = \cos(90^\circ - x^\circ) is appropriate here.
We need to relate the sine of one angle to the cosine of another angle.
2
Equate the angle arguments using the identity.
sin(x)=cos(90x)=cos(38)\sin(x^\circ) = \cos(90^\circ - x^\circ) = \cos(38^\circ), which implies 90x=3890 - x = 38.
For acute angles, if their cosine values are equal, the angles themselves must be equal.
3
Solve the linear equation for xx.
x=9038=52x = 90 - 38 = 52.
Isolating xx gives the final answer.

Key Concept

Co-function identities relate the sine of an angle to the cosine of its complement: sin(θ)=cos(90θ)\sin(\theta) = \cos(90^\circ - \theta).
Question 2072Question

In right triangle XYZXYZ, the measure of angle YY is 9090^\circ, XY=12XY = 12, and YZ=5YZ = 5. What is the value of cos(X)sin(X)\cos(X) - \sin(X)?

Show answer & explanation

Answer: 713\frac{7}{13}

Answer

713\frac{7}{13}
The length of the hypotenuse XZXZ is first found using the Pythagorean theorem: XZ=122+52=13XZ = \sqrt{12^2 + 5^2} = 13. Using the definitions of the trigonometric ratios, cos(X)=adjacenthypotenuse=1213\cos(X) = \frac{\text{adjacent}}{\text{hypotenuse}} = \frac{12}{13} and sin(X)=oppositehypotenuse=513\sin(X) = \frac{\text{opposite}}{\text{hypotenuse}} = \frac{5}{13}. The difference is cos(X)sin(X)=1213513=713\cos(X) - \sin(X) = \frac{12}{13} - \frac{5}{13} = \frac{7}{13}.

Step-by-Step Solution

1
Find the length of the hypotenuse XZXZ using the Pythagorean theorem.
XZ=XY2+YZ2=122+52=144+25=169=13XZ = \sqrt{XY^2 + YZ^2} = \sqrt{12^2 + 5^2} = \sqrt{144 + 25} = \sqrt{169} = 13.
The hypotenuse is needed as the denominator for the sine and cosine ratios.
2
Determine the values of cos(X)\cos(X) and sin(X)\sin(X).
cos(X)=XYXZ=1213\cos(X) = \frac{XY}{XZ} = \frac{12}{13} and sin(X)=YZXZ=513\sin(X) = \frac{YZ}{XZ} = \frac{5}{13}.
By definition, cos(θ)=adjacenthypotenuse\cos(\theta) = \frac{\text{adjacent}}{\text{hypotenuse}} and sin(θ)=oppositehypotenuse\sin(\theta) = \frac{\text{opposite}}{\text{hypotenuse}}.
3
Calculate the difference cos(X)sin(X)\cos(X) - \sin(X).
cos(X)sin(X)=1213513=713\cos(X) - \sin(X) = \frac{12}{13} - \frac{5}{13} = \frac{7}{13}.
This is the final subtraction requested by the question.

Key Concept

Calculating trigonometric ratios in a right triangle and applying basic operations.
Question 2073Question

In the xyxy-plane, the graph of the quadratic function f(x)=ax2+bx+cf(x) = ax^2 + bx + c, where aa, bb, and cc are constants, has a vertex at (2,3)(2, -3) and passes through the point (4,5)(4, 5). If the graph of a second quadratic function, gg, is obtained by translating the graph of ff horizontally by 33 units to the right and vertically by 55 units up, what is the value of g(5)g(5)?

Show answer & explanation

Answer: 2

Answer

The value of g(5)g(5) is 22.
The vertex of the graph of ff is at (2,3)(2, -3), which means f(2)=3f(2) = -3. The graph of gg is obtained by translating the graph of ff by 33 units to the right and 55 units up, so its equation is g(x)=f(x3)+5g(x) = f(x - 3) + 5. To find g(5)g(5), we substitute x=5x = 5 into this relation, which gives g(5)=f(53)+5=f(2)+5g(5) = f(5 - 3) + 5 = f(2) + 5. Since f(2)=3f(2) = -3, we have g(5)=3+5=2g(5) = -3 + 5 = 2. Alternatively, translating the vertex of ff at (2,3)(2, -3) by 33 units to the right and 55 units up gives the vertex of gg at (2+3,3+5)=(5,2)(2 + 3, -3 + 5) = (5, 2). Since the vertex of the parabola gg occurs at x=5x = 5, the value of g(5)g(5) is the yy-coordinate of the vertex, which is 22.

Step-by-Step Solution

1
Identify the vertex of the function ff and write its vertex form equation.
The vertex of ff is (2,3)(2, -3), so the vertex form of the function is f(x)=a(x2)23f(x) = a(x - 2)^2 - 3.
This allows us to find the specific equation of f(x)f(x) if needed, and also tells us that the value of f(2)f(2) is 3-3.
2
Set up the equation for the translated function g(x)g(x).
A horizontal translation of 33 units to the right and a vertical translation of 55 units up is represented by g(x)=f(x3)+5g(x) = f(x - 3) + 5.
This defines the function gg in terms of the function ff using standard translation rules.
3
Evaluate g(5)g(5) using the relation from step 2.
g(5)=f(53)+5=f(2)+5g(5) = f(5 - 3) + 5 = f(2) + 5.
This simplifies the calculation by using the value of ff at the vertex.
4
Substitute the value of f(2)f(2) to find g(5)g(5).
g(5)=3+5=2g(5) = -3 + 5 = 2.
Since the vertex of ff is at (2,3)(2, -3), we know f(2)=3f(2) = -3, which yields the final result.

Key Concept

Quadratic functions can be analyzed and transformed using their vertex form and function translation rules.
Estimated Time:1m 30s
Question 2074Question

A triangular banner has an area of 3030 square feet. If the height of the banner is 55 feet, what is the length, in feet, of the base of the banner?

Show answer & explanation

Answer: 12

Answer

The length of the base of the banner is 1212 feet.
To find the base of the triangular banner, apply the formula for the area of a triangle: A=12bhA = \frac{1}{2} b h. Substituting 3030 for the area AA and 55 for the height hh yields 30=12b(5)30 = \frac{1}{2} b (5), or 30=2.5b30 = 2.5b. Dividing both sides of the equation by 2.52.5 gives b=12b = 12. Therefore, the length of the base of the banner is 1212 feet.

Step-by-Step Solution

1
Recall the formula for the area of a triangle.
A=12bhA = \frac{1}{2} b h
The area of a triangle is equal to half the product of its base and height.
2
Substitute the given values into the area formula.
30=12×b×530 = \frac{1}{2} \times b \times 5
The problem provides the area (3030 square feet) and the height (55 feet).
3
Solve for the base bb.
b=12b = 12
Multiply both sides of the equation by 22 to clear the fraction, giving 60=5b60 = 5b. Then, divide both sides by 55 to find that b=12b = 12.

Key Concept

Area of a triangle
Question 2075Question

A scientist measures the density of a core sample of ice as a function of depth. The density dd, in grams per cubic centimeter (g/cm3\text{g/cm}^3), of the ice at a depth of xx meters below the glacier surface is modeled by the equation d=0.0004x+0.917d = 0.0004x + 0.917. According to the model, what is the depth, in meters, at which the ice density is 0.935 g/cm30.935\text{ g/cm}^3?

Show answer & explanation

Answer: 45

Answer

The depth is 45 meters.
To find the depth at which the density is 0.935 g/cm30.935\text{ g/cm}^3, substitute 0.9350.935 for the density dd in the model equation, yielding 0.935=0.0004x+0.9170.935 = 0.0004x + 0.917. Subtracting 0.9170.917 from both sides gives 0.018=0.0004x0.018 = 0.0004x. Dividing both sides by 0.00040.0004 results in x=45x = 45. Therefore, the depth is 45 meters.

Step-by-Step Solution

1
Substitute the target density of 0.935 g/cm30.935\text{ g/cm}^3 for dd in the given model equation.
0.935=0.0004x+0.9170.935 = 0.0004x + 0.917
This sets up the linear equation to solve for the corresponding depth xx.
2
Subtract 0.9170.917 from both sides of the equation.
0.018=0.0004x0.018 = 0.0004x
This isolates the term containing the variable xx on one side of the equation.
3
Divide both sides of the equation by 0.00040.0004 to find the value of xx.
x=45x = 45
Dividing 0.0180.018 by 0.00040.0004 solves for the depth xx in meters.

Key Concept

Solving linear relationships in context for the independent variable given a value of the dependent variable.
Question 2076Question

A group of 2525 students took a history quiz, and their scores are summarized in the frequency table below.

ScoreFrequency
62
74
810
96
103

The teacher decides to remove the scores of the 22 students who scored 66 because they were absent on the day of the quiz and took it later under different conditions. Which of the following statements describes the effect of removing these two scores on the mean, median, and standard deviation of the quiz scores?

Show answer & explanation

Answer: The mean increases, the median remains unchanged, and the standard deviation decreases.

Answer

The mean increases, the median remains unchanged, and the standard deviation decreases.
The correct answer is the statement indicating that the mean increases, the median remains unchanged, and the standard deviation decreases. Removing the two lowest scores (66) eliminates the values that pull the average down, resulting in an increased mean. The median remains at 88 because the middle position of the sorted scores still lies within the class of 88 s. The standard deviation decreases because the overall spread of the data is reduced when the lowest and most distant values are removed.

Step-by-Step Solution

1
Calculate the original mean and locate the original median.
Original Mean = 8.168.16; Original Median = 88.
The original sum of scores is (2×6)+(4×7)+(10×8)+(6×9)+(3×10)=204(2 \times 6) + (4 \times 7) + (10 \times 8) + (6 \times 9) + (3 \times 10) = 204. With 2525 students, the mean is 204/25=8.16204 / 25 = 8.16. The median is the 13th13\text{th} value in the sorted list of 2525 scores. Looking at the cumulative frequencies, the first 22 scores are 66, the next 44 are 77 (cumulative 66), and the next 1010 are 88 (cumulative 1616). Thus, the 13th13\text{th} value is 88.
2
Calculate the new mean and locate the new median after removing the two scores of 66.
New Mean 8.35\approx 8.35; New Median = 88.
Removing the two scores of 66 reduces the sum by 1212 (new sum = 192192) and the count of students to 2323. The new mean is 192/238.35192 / 23 \approx 8.35, which is an increase. The new median is the 12th12\text{th} value of the remaining 2323 sorted scores. The first 44 scores are 77, and the next 1010 are 88 (cumulative 1414). The 12th12\text{th} value is still 88, so the median remains unchanged.
3
Analyze the change in the standard deviation.
The standard deviation decreases.
Standard deviation measures the spread of the data. The scores of 66 are the minimum scores and are the furthest from the mean of the distribution. Removing these extreme values reduces the variability and concentrates the remaining scores closer to the mean, which decreases the standard deviation.

Key Concept

Analyzing the effects of removing extreme data values on the mean, median, and standard deviation of a dataset.
Question 2077Question

A laboratory uses two types of equipment, Instrument A and Instrument B, which both have an initial value of VV dollars when purchased at the same time (t=0t = 0 years). The value of Instrument A decreases linearly at a constant rate over time. At t=3t = 3 years, the value of Instrument A is $12,000\$12,000, and at t=6t = 6 years, its value is $8,000\$8,000. The value of Instrument B decreases exponentially at a constant annual rate. At t=2t = 2 years, the value of Instrument B is $4,000\$4,000. What is the value, in dollars, of Instrument B at t=4t = 4 years?

Show answer & explanation

Answer: 1000

Answer

1000
The correct answer is 1000. By defining the value of Instrument A linearly, we obtain the system V3d=12000V - 3d = 12000 and V6d=8000V - 6d = 8000. Solving this system yields an initial value of V=16000V = 16000. Instrument B decreases exponentially with the model VB(t)=16000btV_B(t) = 16000 \cdot b^t. Given VB(2)=4000V_B(2) = 4000, we have 16000b2=400016000 \cdot b^2 = 4000, which gives b2=0.25b^2 = 0.25. The value at t=4t = 4 is then calculated as VB(4)=VB(2)b2=40000.25=1000V_B(4) = V_B(2) \cdot b^2 = 4000 \cdot 0.25 = 1000.

Step-by-Step Solution

1
Set up a system of linear equations for Instrument A's value.
V3d=12000V - 3d = 12000 and V6d=8000V - 6d = 8000
Instrument A decreases linearly, meaning its value is modeled by VA(t)=VdtV_A(t) = V - dt.
2
Solve for the constant annual rate of decrease, dd, and the initial purchase value, VV.
d=40003d = \frac{4000}{3} and V=16000V = 16000
Subtracting the two linear equations eliminates VV, allowing us to solve for dd and subsequently substitute it back to find VV.
3
Apply the initial value V=16000V = 16000 to Instrument B's exponential decay model at t=2t = 2.
16000b2=400016000 \cdot b^2 = 4000
Instrument B decreases exponentially starting from the same initial value VV, so its model is VB(t)=VbtV_B(t) = V \cdot b^t.
4
Solve for the 2-year decay factor, b2b^2.
b2=0.25b^2 = 0.25
Dividing both sides of the equation by 1600016000 isolates the term representing the growth or decay factor over a two-year interval.
5
Calculate the value of Instrument B at t=4t = 4 years.
10001000
Multiply the value at t=2t = 2 by the 2-year decay factor b2b^2, which yields 40000.25=10004000 \cdot 0.25 = 1000.

Key Concept

Distinguishing between linear decay (constant absolute rate of change) and exponential decay (constant percentage rate of change) to set up and solve coupled system models.
Question 2078Question

A retail store models its weekly profit, P(d)P(d), in dollars, from selling a certain product at a discount of dd dollars using the function P(d)=5(d8)2+2,500P(d) = -5(d - 8)^2 + 2,500, where 0d200 \leq d \leq 20. Which of the following is the best interpretation of the value 8 in this context?

Show answer & explanation

Answer: The discount, in dollars, that results in the maximum weekly profit.

Answer

The discount, in dollars, that results in the maximum weekly profit.
The quadratic function P(d)=5(d8)2+2,500P(d) = -5(d - 8)^2 + 2,500 is given in vertex form, P(d)=a(dh)2+kP(d) = a(d - h)^2 + k, where (h,k)(h, k) is the vertex of the parabola. In this equation, the vertex is (8,2500)(8, 2500). The leading coefficient is 5-5, which is negative, meaning the parabola opens downward and the vertex represents the maximum point of the function. In this context, dd is the discount in dollars and P(d)P(d) is the weekly profit. Therefore, the value 8 represents the discount of 8 dollars that results in the maximum weekly profit.

Step-by-Step Solution

1
Identify the form of the quadratic function.
The function P(d)=5(d8)2+2,500P(d) = -5(d - 8)^2 + 2,500 is in vertex form, P(d)=a(dh)2+kP(d) = a(d - h)^2 + k, where (h,k)(h, k) represents the vertex of the parabola.
Recognizing the vertex form allows us to directly identify the vertex coordinates without expanding the equation.
2
Determine the vertex and the direction the parabola opens.
The vertex is (8,2,500)(8, 2,500). Since the leading coefficient a=5a = -5 is negative, the parabola opens downward, meaning the vertex represents a maximum point.
The sign of the leading coefficient determines whether the vertex represents a maximum or a minimum.
3
Interpret the coordinates of the vertex in context.
The variable dd is the discount in dollars, and P(d)P(d) is the weekly profit in dollars. Thus, at the vertex, the discount is 8 dollars, which corresponds to the maximum profit of 2,500 dollars.
Matching the coordinates of the vertex to the variables in the context gives the correct real-world meaning.

Key Concept

Interpreting the vertex of a quadratic function in vertex form within a real-world context.
Estimated Time:1m 0s
Question 2079Question

A group of 1515 students recorded the number of books they read over the summer. The table below shows the distribution of the number of books read.

Number of booksNumber of students
1111
2233
3355
4455
181811

If the student who read 1818 books is removed from the dataset, which of the following statements best describes the effect on the mean and the median of the dataset?

Show answer & explanation

Answer: The mean decreases by 11, and the median remains the same.

Answer

The mean decreases by 11, and the median remains the same.
The correct answer states that the mean decreases by 11 and the median remains the same. Removing the outlier of 1818 reduces the sum from 6060 to 4242 and the number of terms from 1515 to 1414, resulting in a new mean of 33 (down from 44). The median is determined by the middle values of the dataset; both the 8th8\text{th} value of the 1515-element set and the average of the 7th7\text{th} and 8th8\text{th} values of the 1414-element set are 33, meaning the median does not change.

Step-by-Step Solution

1
Calculate the mean of the original dataset containing 1515 students.
The sum of the books read is (1×1)+(2×3)+(3×5)+(4×5)+(18×1)=1+6+15+20+18=60(1 \times 1) + (2 \times 3) + (3 \times 5) + (4 \times 5) + (18 \times 1) = 1 + 6 + 15 + 20 + 18 = 60. The mean is 6015=4\frac{60}{15} = 4.
To find the initial baseline mean before the outlier is removed.
2
Find the median of the original dataset.
With 1515 data points, the median is the 8th8\text{th} value when ordered. Counting from the smallest value, the first value is 11, the next 33 values are 22, and the next 55 values are 33 (covering the 5th5\text{th} through 9th9\text{th} positions). Thus, the 8th8\text{th} value is 33, so the median is 33.
To find the initial baseline median before the outlier is removed.
3
Calculate the new mean after removing the student who read 1818 books.
The new number of students is 1414. The new sum of books read is 6018=4260 - 18 = 42. The new mean is 4214=3\frac{42}{14} = 3. The mean decreased by 43=14 - 3 = 1.
To determine the change in the mean.
4
Find the new median after removing the student who read 1818 books.
With 1414 data points, the median is the average of the 7th7\text{th} and 8th8\text{th} values. Both the 7th7\text{th} and 8th8\text{th} values are in the group of 33 s (covering the 5th5\text{th} through 9th9\text{th} positions). Therefore, the new median is 3+32=3\frac{3 + 3}{2} = 3, meaning the median remains the same.
To determine the change in the median.

Key Concept

Understanding how outliers affect measures of center, specifically the mean (which is sensitive to outliers) and the median (which is resistant to outliers).
Question 2080Question

If sin(θ)=53\sin(\theta) = \frac{\sqrt{5}}{3} and θ\theta is an acute angle, what is the value of tan2(θ)\tan^2(\theta)?

Show answer & explanation

Answer: 1.25

Answer

The correct answer is 1.25 (or the equivalent fraction 5/4).
Using the Pythagorean identity sin2(θ)+cos2(θ)=1\sin^2(\theta) + \cos^2(\theta) = 1, we find cos2(θ)=159=49\cos^2(\theta) = 1 - \frac{5}{9} = \frac{4}{9}. Since tan(θ)=sin(θ)cos(θ)\tan(\theta) = \frac{\sin(\theta)}{\cos(\theta)}, it follows that tan2(θ)=sin2(θ)cos2(θ)=5/94/9=1.25\tan^2(\theta) = \frac{\sin^2(\theta)}{\cos^2(\theta)} = \frac{5/9}{4/9} = 1.25.

Step-by-Step Solution

1
Calculate the square of the cosine of the angle using the Pythagorean identity.
cos2(θ)=1sin2(θ)=1(53)2=159=49\cos^2(\theta) = 1 - \sin^2(\theta) = 1 - \left(\frac{\sqrt{5}}{3}\right)^2 = 1 - \frac{5}{9} = \frac{4}{9}
The Pythagorean identity states that sin2(θ)+cos2(θ)=1\sin^2(\theta) + \cos^2(\theta) = 1 for any angle θ\theta.
2
Express the tangent squared in terms of sine squared and cosine squared.
tan2(θ)=sin2(θ)cos2(θ)\tan^2(\theta) = \frac{\sin^2(\theta)}{\cos^2(\theta)}
By definition, the tangent function is the ratio of sine to cosine, so tan(θ)=sin(θ)cos(θ)\tan(\theta) = \frac{\sin(\theta)}{\cos(\theta)}.
3
Substitute the values of sin2(θ)\sin^2(\theta) and cos2(θ)\cos^2(\theta) to solve for tan2(θ)\tan^2(\theta).
tan2(θ)=5/94/9=54=1.25\tan^2(\theta) = \frac{5/9}{4/9} = \frac{5}{4} = 1.25
Plugging in the squared ratios and simplifying gives the final evaluation.

Key Concept

Pythagorean trigonometric identity and quotient identity of tangent
PreviousPage 104 / 140Next
All practice questions — SAT | Examkin