Algebraic Exponents and Radicals

31 soru

Soru 1Soru

If b>1b > 1, which of the following expressions are equivalent to b3b23b16\frac{\sqrt{b^3 \cdot \sqrt[3]{b^2}}}{b^{-\frac{1}{6}}}? Select all that apply.

Geçerli olan tümünü seçin

Cevabı ve açıklamayı göster

Cevap: (b3)6(\sqrt[3]{b})^6; b73b13\frac{b^{\frac{7}{3}}}{b^{\frac{1}{3}}}; (b12)4\left(b^{-\frac{1}{2}}\right)^{-4}

Cevap

The equivalent expressions are (b3)6(\sqrt[3]{b})^6, b73b13\frac{b^{\frac{7}{3}}}{b^{\frac{1}{3}}}, and (b12)4\left(b^{-\frac{1}{2}}\right)^{-4}.
Simplifying the original expression yields b3b2/3b1/6=b11/6b1/6=b11/6(1/6)=b12/6=b2\frac{\sqrt{b^3 \cdot b^{2/3}}}{b^{-1/6}} = \frac{b^{11/6}}{b^{-1/6}} = b^{11/6 - (-1/6)} = b^{12/6} = b^2. The expression (b3)6(\sqrt[3]{b})^6 equals b6/3=b2b^{6/3} = b^2. The expression b7/3b1/3\frac{b^{7/3}}{b^{1/3}} equals b7/31/3=b2b^{7/3 - 1/3} = b^2. The expression (b1/2)4\left(b^{-1/2}\right)^{-4} equals b(1/2)(4)=b2b^{(-1/2)(-4)} = b^2. All three equal b2b^2.

Adım Adım Çözüm

1
Simplify the expression inside the square root in the numerator.
b3b23=b3b23=b3+23=b113b^3 \cdot \sqrt[3]{b^2} = b^3 \cdot b^{\frac{2}{3}} = b^{3 + \frac{2}{3}} = b^{\frac{11}{3}}
Convert radical to rational exponent and use product rule for exponents.
2
Apply the square root to the numerator.
b113=(b113)12=b116\sqrt{b^{\frac{11}{3}}} = \left(b^{\frac{11}{3}}\right)^{\frac{1}{2}} = b^{\frac{11}{6}}
Taking the square root is equivalent to raising to the power of 12\frac{1}{2}.
3
Divide by the denominator.
\frac{b^{\frac{11}{6}}}{b^{-\frac{1}{6}}} = b^{\frac{11}{6} - \left(-\frac{1}{6}\right)} = b^{\frac{12}{6}} = b^2
Apply quotient rule for exponents: subtract the exponent of the denominator from the numerator.
4
Evaluate each given option to determine which simplify to b2b^2.
The expressions (b3)6=b2(\sqrt[3]{b})^6 = b^2, b73b13=b2\frac{b^{\frac{7}{3}}}{b^{\frac{1}{3}}} = b^2, and (b12)4=b2\left(b^{-\frac{1}{2}}\right)^{-4} = b^2 are all equivalent.
Matching each simplified candidate expression to the target simplified value b2b^2.

Anahtar Kavram

Simplification of nested algebraic radicals and rational exponents using exponent rules
Tahmini Süre:2m 0s
Soru 2Soru

If xx and yy are positive integers such that 2x+1+2x=3y+23y2^{x+1} + 2^x = 3^{y+2} - 3^y, what is the value of x+yx + y?

Cevabı ve açıklamayı göster

Cevap: 4

Cevap

The value of x+yx + y is 44.
Factoring the left side gives 2x(2+1)=32x2^x(2 + 1) = 3 \cdot 2^x, while factoring the right side gives 3y(91)=83y=233y3^y(9 - 1) = 8 \cdot 3^y = 2^3 \cdot 3^y. Equating the two expressions gives 32x=233y3 \cdot 2^x = 2^3 \cdot 3^y. Rearranging terms to separate bases yields 2x3=3y12^{x-3} = 3^{y-1}. Because 2 and 3 share no common prime factors, this equality holds for integers if and only if both exponents are equal to 0. Solving x3=0x - 3 = 0 gives x=3x = 3, and solving y1=0y - 1 = 0 gives y=1y = 1. Both are positive integers. Thus, x+y=3+1=4x + y = 3 + 1 = 4.

Adım Adım Çözüm

1
Factor out common terms on both sides of the equation.
2x(2+1)=3y(91)    32x=83y2^x(2 + 1) = 3^y(9 - 1) \implies 3 \cdot 2^x = 8 \cdot 3^y
Factoring simplifies sums of powers with identical bases.
2
Rewrite integers using prime factorizations and re-group bases.
32x=233y    2x3=3y13 \cdot 2^x = 2^3 \cdot 3^y \implies 2^{x-3} = 3^{y-1}
Dividing both sides by 2332^3 \cdot 3 separates the base-2 and base-3 exponential terms.
3
Set each exponent to zero using prime independence.
x3=0    x=3x - 3 = 0 \implies x = 3 and y1=0    y=1y - 1 = 0 \implies y = 1
Powers of distinct prime numbers 2 and 3 can only be equal if both powers equal 11 (20=30=12^0 = 3^0 = 1).
4
Calculate the required sum x+yx + y.
3+1=43 + 1 = 4
Evaluates the requested combined value of the variables.

Anahtar Kavram

Solving exponential equations involving distinct prime bases through factoring and exponent properties.
Soru 3Soru
If xx is a real number satisfying the equation
(23x+2+23x)3(42x+142x)2=20009\frac{\left(2^{3x+2} + 2^{3x}\right)^3}{\left(4^{2x+1} - 4^{2x}\right)^2} = \frac{2000}{9}
what is the value of xx?
Cevabı ve açıklamayı göster

Cevap: 4

Cevap

4
Factoring out 23x2^{3x} in the numerator gives 23x(22+1)=523x2^{3x}(2^2 + 1) = 5 \cdot 2^{3x}. Cubing this yields 12529x125 \cdot 2^{9x}. In the denominator, rewriting 42x4^{2x} as 24x2^{4x} and factoring gives 24x(41)=324x2^{4x}(4 - 1) = 3 \cdot 2^{4x}. Squaring this yields 928x9 \cdot 2^{8x}. Taking the quotient gives 12592x\frac{125}{9} \cdot 2^x. Setting this equal to 20009\frac{2000}{9} leads directly to 1252x=2000    2x=16    x=4125 \cdot 2^x = 2000 \implies 2^x = 16 \implies x = 4.

Adım Adım Çözüm

1
Factor out common exponential terms inside the parentheses
Numerator inside becomes 523x5 \cdot 2^{3x} and denominator inside becomes 324x3 \cdot 2^{4x}
Factoring out 23x2^{3x} from 23x+2+23x2^{3x+2} + 2^{3x} isolates the constant multiplier (4+1)(4+1), and expressing 42x4^{2x} as 24x2^{4x} allows base unification.
2
Raise the simplified terms to their respective outer powers
Numerator becomes 12529x125 \cdot 2^{9x} and denominator becomes 928x9 \cdot 2^{8x}
Using power rules (ab)n=anbn(a \cdot b)^n = a^n b^n and (am)n=amn(a^m)^n = a^{m n}.
3
Simplify the fraction by subtracting exponents of like bases
The left side simplifies to 12592x\frac{125}{9} \cdot 2^x
 me29x28x=29x8x=2x\ me{2^{9x}}{2^{8x}} = 2^{9x-8x} = 2^x using the quotient rule for exponents.
4
Solve the resulting single-variable exponential equation
2x=162^x = 16, which yields x=4x = 4
Multiplying both sides by 99 yields 1252x=2000125 \cdot 2^x = 2000, so 2x=16=242^x = 16 = 2^4.

Anahtar Kavram

Factoring exponential expressions and applying power of a power and quotient rules
Soru 4Soru

If xx is a positive real number, which of the following is equivalent to the expression (x3)2x4x8\frac{(x^3)^2 \cdot x^{-4}}{\sqrt{x^8}}?

Cevabı ve açıklamayı göster

Cevap: x2x^{-2}

Cevap

The simplified expression is equivalent to x2x^{-2}.
Applying the rules of exponents systematically yields (x3)2=x6(x^3)^2 = x^6 in the numerator, which combines with x4x^{-4} to give x2x^2. The denominator x8\sqrt{x^8} simplifies to x8/2=x4x^{8/2} = x^4. Dividing x2x^2 by x4x^4 gives x24=x2x^{2-4} = x^{-2}.

Adım Adım Çözüm

1
Simplify the power raised to a power in the numerator.
(x3)2=x32=x6(x^3)^2 = x^{3 \cdot 2} = x^6
When raising a power to a power, multiply the exponents: (am)n=amn(a^m)^n = a^{m \cdot n}.
2
Multiply the terms in the numerator.
x6x4=x6+(4)=x2x^6 \cdot x^{-4} = x^{6 + (-4)} = x^2
When multiplying exponential expressions with the same base, add the exponents: aman=am+na^m \cdot a^n = a^{m+n}.
3
Simplify the radical in the denominator.
x8=(x8)12=x82=x4\sqrt{x^8} = (x^8)^{\frac{1}{2}} = x^{\frac{8}{2}} = x^4
Taking the square root of a non-negative term is equivalent to raising it to the power of 12\frac{1}{2}.
4
Divide the numerator by the denominator.
\frac{x^2}{x^4} = x^{2 - 4} = x^{-2}
When dividing exponential expressions with the same base, subtract the denominator exponent from the numerator exponent: \frac{a^m}{a^n} = a^{m-n}.

Anahtar Kavram

Laws of Exponents and Radical Simplification
Tahmini Süre:45s
Soru 5Soru

If x>0x > 0, which of the following is equivalent to the expression 9x4+16x4\sqrt{9x^4 + 16x^4}?

Cevabı ve açıklamayı göster

Cevap: 5x25x^2

Cevap

The correct answer is 5x25x^2.
First combine the terms under the square root to get 25x4\sqrt{25x^4}. Taking the square root yields 25x4=5x2\sqrt{25} \cdot \sqrt{x^4} = 5x^2. Thus, 5x25x^2 is the correct simplified expression.

Adım Adım Çözüm

1
Combine like terms inside the square root.
9x4+16x4=25x49x^4 + 16x^4 = 25x^4
Since both terms have the same variable factor x4x^4, their coefficients can be added directly.
2
Apply the product rule for radicals: ab=ab\sqrt{a \cdot b} = \sqrt{a} \cdot \sqrt{b}.
25x4=25x4\sqrt{25x^4} = \sqrt{25} \cdot \sqrt{x^4}
The square root of a product is equal to the product of the square roots.
3
Evaluate the square root of the coefficient and the variable term.
5x2=5x25 \cdot x^2 = 5x^2
\sqrt{25} = 5 and and \sqrt{x^4} = (x^4)^{1/2} = x^2 (since (since x > 0$).

Anahtar Kavram

Simplifying algebraic radicals by combining like terms under the square root and applying power rules for exponents.
Soru 6Soru

If x>1x > 1, which of the following expressions are equivalent to x5x3(x2)1\frac{\sqrt{x^5 \cdot x^3}}{(x^{-2})^{-1}}? Select all such expressions.

Geçerli olan tümünü seçin

Cevabı ve açıklamayı göster

Cevap: (x23)3(x^{\frac{2}{3}})^3; x1x3\frac{x^{-1}}{x^{-3}}

Cevap

The expressions equivalent to the target expression are (x23)3(x^{\frac{2}{3}})^3 and x1x3\frac{x^{-1}}{x^{-3}}.
The original expression simplifies step by step to x2x^2. The expression (x2/3)3(x^{2/3})^3 equals x(2/3)3=x2x^{(2/3)\cdot 3} = x^2, and the expression x1x3\frac{x^{-1}}{x^{-3}} equals x1(3)=x2x^{-1 - (-3)} = x^2. Both are equal to x2x^2.

Adım Adım Çözüm

1
Simplify the numerator of the given expression
x5x3=x5+3=x8=x8/2=x4\sqrt{x^5 \cdot x^3} = \sqrt{x^{5+3}} = \sqrt{x^8} = x^{8/2} = x^4
Combine bases using product rule for exponents, then convert radical to fractional exponent.
2
Simplify the denominator of the given expression
(x2)1=x(2)(1)=x2(x^{-2})^{-1} = x^{(-2) \cdot (-1)} = x^2
Multiply exponents when raising a power to a power.
3
Divide the simplified numerator by the simplified denominator
x4x2=x42=x2\frac{x^4}{x^2} = x^{4-2} = x^2
Subtract denominator exponent from numerator exponent using the quotient rule.
4
Evaluate each choice against x2x^2
Only (x2/3)3=x2(x^{2/3})^3 = x^2 and x1x3=x2\frac{x^{-1}}{x^{-3}} = x^2 are equal to x2x^2.
Apply basic exponent rules to each proposed expression.

Anahtar Kavram

Algebraic Exponents and Radicals Rules
Soru 7Soru

Which of the following values of xx are solutions to the equation (x2)435(x2)23+4=0(x - 2)^{\frac{4}{3}} - 5(x - 2)^{\frac{2}{3}} + 4 = 0? Select all that apply.

Geçerli olan tümünü seçin

Cevabı ve açıklamayı göster

Cevap: -6; 1; 10

Cevap

The correct values of xx that satisfy the equation are 6-6, 11, and 1010.
Substituting u=(x2)23u = (x - 2)^{\frac{2}{3}} yields u25u+4=0u^2 - 5u + 4 = 0, which factors as (u1)(u4)=0(u - 1)(u - 4) = 0, giving u=1u = 1 and u=4u = 4. Solving (x2)23=1(x - 2)^{\frac{2}{3}} = 1 gives (x2)2=1    x2=±1(x - 2)^2 = 1 \implies x - 2 = \pm 1, yielding x=3x = 3 and x=1x = 1. Solving (x2)23=4(x - 2)^{\frac{2}{3}} = 4 gives (x2)2=64    x2=±8(x - 2)^2 = 64 \implies x - 2 = \pm 8, yielding x=10x = 10 and x=6x = -6. Thus, the values 6-6, 11, and 1010 are all valid solutions.

Adım Adım Çözüm

1
Perform a substitution to rewrite the equation in quadratic form.
Let u=(x2)23u = (x - 2)^{\frac{2}{3}}. Then u2=(x2)43u^2 = (x - 2)^{\frac{4}{3}}, giving u25u+4=0u^2 - 5u + 4 = 0.
Recognizing quadratic structure simplifies equations with rational exponents.
2
Solve the quadratic equation for uu.
(u1)(u4)=0    u=1(u - 1)(u - 4) = 0 \implies u = 1 or u=4u = 4.
Factoring determines the values of the substituted variable uu.
3
Solve for xx when u=1u = 1.
(x2)23=1    (x2)2=13=1    x2=±1    x=3(x - 2)^{\frac{2}{3}} = 1 \implies (x - 2)^2 = 1^3 = 1 \implies x - 2 = \pm 1 \implies x = 3 or x=1x = 1.
Raising both sides to the power of 32\frac{3}{2} requires taking both positive and negative roots because the numerator of the power is even.
4
Solve for xx when u=4u = 4.
(x2)23=4    (x2)2=43=64    x2=±8    x=10(x - 2)^{\frac{2}{3}} = 4 \implies (x - 2)^2 = 4^3 = 64 \implies x - 2 = \pm 8 \implies x = 10 or x=6x = -6.
Squaring and taking square roots yields two solutions, 1010 and 6-6.
5
Match calculated solutions with the given choices.
The solutions present among the options are 6-6, 11, and 1010.
Comparing all valid algebraic solutions to the available choices identifies all correct options.

Anahtar Kavram

Solving quadratic-form equations with fractional exponents and accounting for negative base branches when taking even roots.
Soru 8Soru

If a>0a > 0, which of the following is equivalent to the expression a8a4a2\sqrt{\frac{a^8 \cdot a^4}{a^{-2}}}?

Cevabı ve açıklamayı göster

Cevap: a7a^7

Cevap

a7a^7
Multiplying the terms in the numerator gives a12a^{12}. Dividing by a2a^{-2} gives a12(2)=a14a^{12 - (-2)} = a^{14}. Taking the square root of a14a^{14} gives (a14)1/2=a7(a^{14})^{1/2} = a^7.

Adım Adım Çözüm

1
Simplify the numerator inside the square root using the product rule aman=am+na^m \cdot a^n = a^{m+n}.
a8a4=a8+4=a12a^8 \cdot a^4 = a^{8+4} = a^{12}
Powers with the same base are multiplied by adding their exponents.
2
Divide by the denominator using the quotient rule aman=amn\frac{a^m}{a^n} = a^{m-n}.
a12a2=a12(2)=a14\frac{a^{12}}{a^{-2}} = a^{12 - (-2)} = a^{14}
Dividing powers with the same base requires subtracting the lower exponent from the upper exponent.
3
Apply the fractional exponent rule for radicals x=x12\sqrt{x} = x^{\frac{1}{2}}.
a14=(a14)12=a1412=a7\sqrt{a^{14}} = (a^{14})^{\frac{1}{2}} = a^{14 \cdot \frac{1}{2}} = a^7
Taking the square root of a power is equivalent to multiplying the exponent by 12\frac{1}{2}.

Anahtar Kavram

Simplifying expressions using exponent laws and fractional radical powers
Soru 9Soru

If 2x+34x1=16x2^{x + 3} \cdot 4^{x - 1} = 16^x, what is the value of xx?

Cevabı ve açıklamayı göster

Cevap: 1

Cevap

The value of xx is 1.
Rewriting 4x14^{x-1} as 22x22^{2x-2} and 16x16^x as 24x2^{4x} transforms the left side into 2x+322x2=23x+12^{x+3} \cdot 2^{2x-2} = 2^{3x+1}. Setting exponents equal gives 3x+1=4x3x + 1 = 4x, which simplifies to x=1x = 1.

Adım Adım Çözüm

1
Express all terms with a common base of 2
2x+3(22)x1=(24)x2^{x+3} \cdot (2^2)^{x-1} = (2^4)^x
Converting 44 to 222^2 and 1616 to 242^4 allows all terms to share the base 2.
2
Apply the power of a power rule (am)n=amn(a^m)^n = a^{m \cdot n} and the product rule aman=am+na^m \cdot a^n = a^{m+n}
23x+1=24x2^{3x+1} = 2^{4x}
Multiplying exponents gives (22)x1=22x2(2^2)^{x-1} = 2^{2x-2} and (24)x=24x(2^4)^x = 2^{4x}. Adding exponents on the left gives (x+3)+(2x2)=3x+1(x+3) + (2x-2) = 3x+1.
3
Equate the exponents and solve for xx
x=1x = 1
Since 2A=2B2^A = 2^B implies A=BA = B, setting 3x+1=4x3x + 1 = 4x directly yields x=1x = 1.

Anahtar Kavram

Solving exponential equations using common bases and exponent properties
Soru 10Soru

For all x>1x > 1, which of the following expressions is equivalent to x3x23(x1/3)2\frac{\sqrt{x^3 \cdot \sqrt[3]{x^2}}}{(x^{-1/3})^2}?

Cevabı ve açıklamayı göster

Cevap: x5/2x^{5/2}

Cevap

x5/2x^{5/2}
Converting all radical expressions into rational exponent form simplifies the numerator to (x11/3)1/2=x11/6(x^{11/3})^{1/2} = x^{11/6} and the denominator to x2/3x^{-2/3}. Applying the quotient rule x11/6/x2/3=x11/6(2/3)x^{11/6} / x^{-2/3} = x^{11/6 - (-2/3)} yields x15/6=x5/2x^{15/6} = x^{5/2}.

Adım Adım Çözüm

1
Convert radicals in the numerator to fractional exponents and combine terms inside the square root
x3x23=x3x2/3=x3+2/3=x11/3x^3 \cdot \sqrt[3]{x^2} = x^3 \cdot x^{2/3} = x^{3 + 2/3} = x^{11/3}
When multiplying exponential expressions with the same base, add the exponents.
2
Apply the outer square root to the simplified expression in the numerator
x11/3=(x11/3)1/2=x11/6\sqrt{x^{11/3}} = (x^{11/3})^{1/2} = x^{11/6}
Taking the square root is equivalent to raising an expression to the power of 1/21/2.
3
Simplify the denominator using the power of a power rule
(x1/3)2=x(1/3)2=x2/3(x^{-1/3})^2 = x^{(-1/3) \cdot 2} = x^{-2/3}
When raising a power to another power, multiply the exponents.
4
Divide the simplified numerator by the simplified denominator
x11/6x2/3=x11/6(2/3)=x11/6+4/6=x15/6=x5/2\frac{x^{11/6}}{x^{-2/3}} = x^{11/6 - (-2/3)} = x^{11/6 + 4/6} = x^{15/6} = x^{5/2}
When dividing exponential expressions with the same base, subtract the denominator exponent from the numerator exponent.

Anahtar Kavram

Simplifying nested algebraic radicals using rational exponent laws
Tahmini Süre:1m 30s
Soru 11Soru

For all positive real numbers xx and yy, which of the following expressions are equivalent to (x2y3/2x4y1)1/2\left(\frac{x^{-2} y^{3/2}}{\sqrt{x^4 y^{-1}}}\right)^{-1/2}? Select all that apply.

Geçerli olan tümünü seçin

Cevabı ve açıklamayı göster

Cevap: x2y1x^2 y^{-1}; x4y2\sqrt{\frac{x^4}{y^2}}; x3yx2y4\frac{x^3 y}{\sqrt{x^2 y^4}}

Cevap

The expressions equivalent to the given expression are x2y1x^2 y^{-1}, x4y2\sqrt{\frac{x^4}{y^2}}, and x3yx2y4\frac{x^3 y}{\sqrt{x^2 y^4}}.
Simplifying the original expression step-by-step yields x2y\frac{x^2}{y}, which is equal to x2y1x^2 y^{-1}. Taking the square root of x4y2\frac{x^4}{y^2} gives x2y\frac{x^2}{y}, and simplifying x3yx2y4=x3yxy2\frac{x^3 y}{\sqrt{x^2 y^4}} = \frac{x^3 y}{x y^2} also gives x2y\frac{x^2}{y}. Thus, these three choices are equivalent to the target expression.

Adım Adım Çözüm

1
Simplify the denominator inside the parentheses
x4y1=(x4y1)1/2=x2y1/2\sqrt{x^4 y^{-1}} = (x^4 y^{-1})^{1/2} = x^2 y^{-1/2}
Apply the power of a product rule and principal square root properties for positive variables.
2
Simplify the fraction inside the parentheses
x2y3/2x2y1/2=x22y3/2(1/2)=x4y2\frac{x^{-2} y^{3/2}}{x^2 y^{-1/2}} = x^{-2 - 2} y^{3/2 - (-1/2)} = x^{-4} y^2
Subtract exponents of like bases when dividing.
3
Apply the outer exponent 1/2-1/2
(x4y2)1/2=x(4)(1/2)y(2)(1/2)=x2y1=x2y(x^{-4} y^2)^{-1/2} = x^{(-4)(-1/2)} y^{(2)(-1/2)} = x^2 y^{-1} = \frac{x^2}{y}
Multiply exponents when raising a power to a power.
4
Evaluate each option against x2y\frac{x^2}{y}
x2y1x^2 y^{-1}, x4y2\sqrt{\frac{x^4}{y^2}}, and x3yx2y4\frac{x^3 y}{\sqrt{x^2 y^4}} all simplify to x2y\frac{x^2}{y}.
Check algebraic equivalence for each provided choice.

Anahtar Kavram

Algebraic Exponents and Radicals
Soru 12Soru
If xx and yy are positive real numbers satisfying the system of exponential radical equations
xy=3\sqrt{x\sqrt{y}} = 3
yx=9\sqrt{y\sqrt{x}} = 9
which of the following statements must be true? Select all that apply.

Geçerli olan tümünü seçin

Cevabı ve açıklamayı göster

Cevap: xy=81xy = 81; x1/2+y1/2=10x^{1/2} + y^{1/2} = 10; yxxy=80y^x - x^y = 80

Cevap

The statements asserting that xy=81xy = 81, x1/2+y1/2=10x^{1/2} + y^{1/2} = 10, and yxxy=80y^x - x^y = 80 are true.
Solving the system of radical equations gives the unique positive solution pair x=1x = 1 and y=81y = 81. Substituting these values into the statements shows that xy=181=81xy = 1 \cdot 81 = 81, x1/2+y1/2=1+81=10x^{1/2} + y^{1/2} = \sqrt{1} + \sqrt{81} = 10, and yxxy=811181=80y^x - x^y = 81^1 - 1^{81} = 80 are all mathematically valid.

Adım Adım Çözüm

1
Square both sides of each equation to remove the outer radicals
xy=9    x2y=81x\sqrt{y} = 9 \implies x^2 y = 81 and yx=81    y2x=6561y\sqrt{x} = 81 \implies y^2 x = 6561
Squaring A=B\sqrt{A} = B yields A=B2A = B^2, and rewriting radicals as rational powers gives xy1/2=9x y^{1/2} = 9 and yx1/2=81y x^{1/2} = 81.
2
Express yy in terms of xx from the first equation and substitute into the second
y=81x2    (81x2)2x=6561    6561x3=6561y = \frac{81}{x^2} \implies \left(\frac{81}{x^2}\right)^2 x = 6561 \implies \frac{6561}{x^3} = 6561
Substituting yy eliminates the variable yy, leaving a single equation in terms of xx.
3
Solve for xx and yy
x3=1    x=1x^3 = 1 \implies x = 1, which gives y=8112=81y = \frac{81}{1^2} = 81
Since x>0x > 0 is a positive real number, x=1x = 1 is the unique real solution, yielding y=81y = 81.
4
Evaluate each given statement using x=1x = 1 and y=81y = 81
xy=81xy = 81 (True), x1/2+y1/2=1+9=10x^{1/2} + y^{1/2} = 1 + 9 = 10 (True), xy=927\sqrt{xy} = 9 \neq 27 (False), x=1x = -1 is invalid (False), 811181=8081^1 - 1^{81} = 80 (True)
Direct calculation confirms which individual statements hold.

Anahtar Kavram

Simplifying nested radical equations using fractional exponent rules
Tahmini Süre:2m 0s
Soru 13Soru

If xx is a real number such that 2x+1+2x1=402^{x+1} + 2^{x-1} = 40, what is the value of the expression (x+1)x1(x+1)^{x-1}?

Cevabı ve açıklamayı göster

Cevap: 125

Cevap

125
Factoring out 2x2^x from the given equation yields 2x(2+0.5)=402^x(2 + 0.5) = 40, which gives 2.52x=402.5 \cdot 2^x = 40 and 2x=162^x = 16. This determines that x=4x = 4. Substituting x=4x = 4 into (x+1)x1(x+1)^{x-1} gives (4+1)3=53=125(4+1)^{3} = 5^3 = 125.

Adım Adım Çözüm

1
Rewrite the given exponential terms with a common power of 2.
2x+1=2x212^{x+1} = 2^x \cdot 2^1 and 2x1=2x21=2x22^{x-1} = 2^x \cdot 2^{-1} = \frac{2^x}{2}.
Applying product rule for exponents allows factoring out 2x2^x.
2
Factor out 2x2^x and solve for xx.
2x(2+12)=40    2x52=40    2x=16    x=42^x \left(2 + \frac{1}{2}\right) = 40 \implies 2^x \cdot \frac{5}{2} = 40 \implies 2^x = 16 \implies x = 4.
Combining fractional coefficients isolates the exponential term 2x2^x.
3
Substitute x=4x = 4 into the target expression (x+1)x1(x+1)^{x-1}.
(4+1)41=53=125(4+1)^{4-1} = 5^3 = 125.
Simplifying the base and exponent yields the final numerical value.

Anahtar Kavram

Solving exponential equations using power distribution rules and factoring.
Soru 14Soru

What value of xx satisfies the exponential equation 25x45x+1=12525^x - 4 \cdot 5^{x+1} = 125?

Cevabı ve açıklamayı göster

Cevap: 2

Cevap

The correct answer is 22.
Rewriting 25x25^x as (5x)2(5^x)^2 and 45x+14 \cdot 5^{x+1} as 205x20 \cdot 5^x transforms the equation into (5x)220(5x)125=0(5^x)^2 - 20(5^x) - 125 = 0. Substituting u=5xu = 5^x produces u220u125=0u^2 - 20u - 125 = 0, which factors into (u25)(u+5)=0(u - 25)(u + 5) = 0. Because 5x5^x must be greater than zero for all real values of xx, u=5u = -5 yields no valid real solution. Thus, 5x=25=525^x = 25 = 5^2, giving x=2x = 2.

Adım Adım Çözüm

1
Convert exponential expressions to a common base of 5.
25x=(52)x=(5x)225^x = (5^2)^x = (5^x)^2 and 45x+1=455x=205x4 \cdot 5^{x+1} = 4 \cdot 5 \cdot 5^x = 20 \cdot 5^x.
Applying exponent laws am+n=amana^{m+n} = a^m \cdot a^n and (am)n=amn(a^m)^n = a^{mn} expresses terms in quadratic form with respect to 5x5^x.
2
Formulate and factor the quadratic equation in terms of u=5xu = 5^x.
u220u125=0    (u25)(u+5)=0u^2 - 20u - 125 = 0 \implies (u - 25)(u + 5) = 0, yielding u=25u = 25 or u=5u = -5.
The equation reduces to standard quadratic form, which factors easily.
3
Solve for xx while rejecting non-viable real roots.
5x=25=52    x=25^x = 25 = 5^2 \implies x = 2. 5x=55^x = -5 has no real solution.
An exponential function with a positive base produces strictly positive output values for all real domain inputs.

Anahtar Kavram

Solving exponential equations reducible to quadratic form using exponent laws
Soru 15Soru

If xx is a real number satisfying the exponential equation 4x+14x1=1204^{x+1} - 4^{x-1} = 120, what is the value of 22x+12^{2x + 1}?

Cevabı ve açıklamayı göster

Cevap: 64

Cevap

The value of 22x+12^{2x + 1} is 64.
Factoring 4x14^{x-1} from 4x+14x14^{x+1} - 4^{x-1} gives 4x1(161)=154x1=1204^{x-1}(16 - 1) = 15 \cdot 4^{x-1} = 120. Dividing by 15 yields 4x1=84^{x-1} = 8. Rewriting with base 2 gives (22)x1=22x2=23(2^2)^{x-1} = 2^{2x-2} = 2^3, so 2x2=32x - 2 = 3, meaning 2x=52x = 5. Substituting 2x=52x = 5 into 22x+12^{2x+1} gives 25+1=26=642^{5+1} = 2^6 = 64.

Adım Adım Çözüm

1
Factor out 4x14^{x-1} from the left side of the equation 4x+14x1=1204^{x+1} - 4^{x-1} = 120.
4x1(421)=1204^{x-1}(4^2 - 1) = 120, which simplifies to 4x1(15)=1204^{x-1}(15) = 120.
Factoring out the lowest power of 4 allows simplification of the terms on the left side.
2
Divide both sides by 15 to isolate 4x14^{x-1}.
4x1=12015=84^{x-1} = \frac{120}{15} = 8.
Isolating the exponential expression is necessary to solve for xx.
3
Express both sides with a common base of 2.
(22)x1=23    22(x1)=23    22x2=23(2^2)^{x-1} = 2^3 \implies 2^{2(x-1)} = 2^3 \implies 2^{2x - 2} = 2^3.
Converting to a common prime base allows equating the exponents.
4
Equate exponents to solve for 2x2x.
2x2=3    2x=52x - 2 = 3 \implies 2x = 5.
Since the bases are equal and positive, their exponents must be equal.
5
Substitute 2x=52x = 5 into the target expression 22x+12^{2x + 1}.
25+1=26=642^{5 + 1} = 2^6 = 64.
Evaluating the exact expression requested in the stem.

Anahtar Kavram

Factoring exponential expressions with variable exponents and converting bases
Tahmini Süre:1m 30s
Soru 16Soru

If xx is a real number that satisfies the equation xx+2=4x - \sqrt{x + 2} = 4, what is the value of (x+2)32(x + 2)^{\frac{3}{2}}?

Cevabı ve açıklamayı göster

Cevap: 2727

Cevap

27
Isolating the radical gives x4=x+2x - 4 = \sqrt{x + 2}. Squaring both sides yields (x4)2=x+2(x - 4)^2 = x + 2, which expands to x28x+16=x+2x^2 - 8x + 16 = x + 2, or x29x+14=0x^2 - 9x + 14 = 0. Factoring yields (x7)(x2)=0(x - 7)(x - 2) = 0, giving solutions x=7x = 7 and x=2x = 2. Testing x=7x = 7 in the original equation gives 79=47 - \sqrt{9} = 4, which is valid. Testing x=2x = 2 gives 24=042 - \sqrt{4} = 0 \neq 4, which is extraneous. Substituting the valid root x=7x = 7 into (x+2)32(x + 2)^{\frac{3}{2}} gives (7+2)32=932=(9)3=33=27(7 + 2)^{\frac{3}{2}} = 9^{\frac{3}{2}} = (\sqrt{9})^3 = 3^3 = 27.

Adım Adım Çözüm

1
Isolate the radical term in the given equation.
x4=x+2x - 4 = \sqrt{x + 2}
Isolating the radical allows both sides to be squared cleanly.
2
Square both sides to eliminate the square root and form a quadratic equation.
(x4)2=x+2    x28x+16=x+2    x29x+14=0(x - 4)^2 = x + 2 \implies x^2 - 8x + 16 = x + 2 \implies x^2 - 9x + 14 = 0
Squaring eliminates the radical and allows standard quadratic solving techniques.
3
Factor the quadratic equation to find candidate solutions.
(x7)(x2)=0    x=7 or x=2(x - 7)(x - 2) = 0 \implies x = 7 \text{ or } x = 2
Factoring provides potential real roots.
4
Check candidate solutions in the original equation to eliminate extraneous roots.
For x=7x = 7: 77+2=73=47 - \sqrt{7 + 2} = 7 - 3 = 4 (valid).
For x=2x = 2: 22+2=22=042 - \sqrt{2 + 2} = 2 - 2 = 0 \neq 4 (extraneous).
Squaring both sides can introduce false solutions that fail the original radical equation.
5
Evaluate the target expression (x+2)32(x + 2)^{\frac{3}{2}} using x=7x = 7.
(7+2)32=932=(912)3=33=27(7 + 2)^{\frac{3}{2}} = 9^{\frac{3}{2}} = (9^{\frac{1}{2}})^3 = 3^3 = 27
Applying exponent rules (amn=(an)ma^{\frac{m}{n}} = (\sqrt[n]{a})^m) gives the exact required value.

Anahtar Kavram

Solving radical equations requires isolating the radical, squaring both sides, checking for extraneous solutions introduced by squaring, and evaluating fractional exponents via roots and integer powers.
Tahmini Süre:2m 0s
Soru 17Soru

If x>0x > 0 and x12+x12=3x^{\frac{1}{2}} + x^{-\frac{1}{2}} = 3, what is the value of x2+x2x^2 + x^{-2}?

Cevabı ve açıklamayı göster

Cevap: 47

Cevap

47
Squaring both sides of x12+x12=3x^{\frac{1}{2}} + x^{-\frac{1}{2}} = 3 gives x+2+x1=9x + 2 + x^{-1} = 9, which simplifies to x+x1=7x + x^{-1} = 7. Squaring both sides of x+x1=7x + x^{-1} = 7 gives x2+2+x2=49x^2 + 2 + x^{-2} = 49, which yields x2+x2=47x^2 + x^{-2} = 47.

Adım Adım Çözüm

1
Square both sides of the given equation x12+x12=3x^{\frac{1}{2}} + x^{-\frac{1}{2}} = 3.
(x12+x12)2=32    x+2(x12)(x12)+x1=9(x^{\frac{1}{2}} + x^{-\frac{1}{2}})^2 = 3^2 \implies x + 2(x^{\frac{1}{2}})(x^{-\frac{1}{2}}) + x^{-1} = 9
Applying the binomial expansion identity (a+b)2=a2+2ab+b2(a+b)^2 = a^2 + 2ab + b^2.
2
Simplify the middle term and solve for x+x1x + x^{-1}.
x+2(1)+x1=9    x+x1=7x + 2(1) + x^{-1} = 9 \implies x + x^{-1} = 7
Since x12x12=x0=1x^{\frac{1}{2}} \cdot x^{-\frac{1}{2}} = x^0 = 1, subtracting 2 from both sides isolates x+x1x + x^{-1}.
3
Square both sides of x+x1=7x + x^{-1} = 7.
(x+x1)2=72    x2+2(x)(x1)+x2=49(x + x^{-1})^2 = 7^2 \implies x^2 + 2(x)(x^{-1}) + x^{-2} = 49
Squaring x+x1x + x^{-1} generates the terms x2x^2 and x2x^{-2}.
4
Simplify the middle term and solve for x2+x2x^2 + x^{-2}.
x2+2+x2=49    x2+x2=47x^2 + 2 + x^{-2} = 49 \implies x^2 + x^{-2} = 47
Subtracting 2 from both sides isolates the desired expression x2+x2x^2 + x^{-2}.

Anahtar Kavram

Algebraic Exponents and Binomial Expansion
Soru 18Soru

If xx is a real number that satisfies the equation x+6x9+x6x9=10\sqrt{x + 6\sqrt{x - 9}} + \sqrt{x - 6\sqrt{x - 9}} = 10, what is the value of xx?

Cevabı ve açıklamayı göster

Cevap: 34

Cevap

34
Using the substitution u=x90u = \sqrt{x - 9} \ge 0, we have x=u2+9x = u^2 + 9. The expressions under the square roots become x+6x9=u2+6u+9=(u+3)2x + 6\sqrt{x - 9} = u^2 + 6u + 9 = (u + 3)^2 and x6x9=u26u+9=(u3)2x - 6\sqrt{x - 9} = u^2 - 6u + 9 = (u - 3)^2. Taking square roots gives (u+3)2+(u3)2=(u+3)+u3=10\sqrt{(u + 3)^2} + \sqrt{(u - 3)^2} = (u + 3) + |u - 3| = 10. For u3u \ge 3, this simplifies to (u+3)+(u3)=10    2u=10    u=5(u + 3) + (u - 3) = 10 \implies 2u = 10 \implies u = 5. Finally, substituting u=5u = 5 back yields x=52+9=34x = 5^2 + 9 = 34.

Adım Adım Çözüm

1
Define a variable substitution to simplify the nested radical structure.
Let u=x9u = \sqrt{x - 9} where u0u \ge 0. Squaring both sides gives u2=x9u^2 = x - 9, so x=u2+9x = u^2 + 9.
This substitution allows the expressions inside the outer square roots to be rewritten as polynomials in terms of uu.
2
Rewrite the expressions under each square root as perfect square trinomials.
x+6x9=(u2+9)+6u=(u+3)2x + 6\sqrt{x - 9} = (u^2 + 9) + 6u = (u + 3)^2 and x6x9=(u2+9)6u=(u3)2x - 6\sqrt{x - 9} = (u^2 + 9) - 6u = (u - 3)^2.
Expressing terms as perfect squares allows the outer radicals to be simplified.
3
Simplify the square root expressions using absolute values.
(u+3)2+(u3)2=(u+3)+u3=10\sqrt{(u + 3)^2} + \sqrt{(u - 3)^2} = (u + 3) + |u - 3| = 10.
For any real number aa, a2=a\sqrt{a^2} = |a|. Since u0u \ge 0, u+3>0u + 3 > 0, so u+3=u+3|u + 3| = u + 3.
4
Solve the absolute value equation across valid domain intervals.
If u3u \ge 3, u3=u3|u - 3| = u - 3, giving (u+3)+(u3)=10    2u=10    u=5(u + 3) + (u - 3) = 10 \implies 2u = 10 \implies u = 5. If 0u<30 \le u < 3, u3=3u|u - 3| = 3 - u, giving (u+3)+(3u)=610(u + 3) + (3 - u) = 6 \neq 10 (no solution). Thus, u=5u = 5.
Splitting into cases based on the definition of absolute value isolates the valid root.
5
Substitute u=5u = 5 back into the expression for xx.
x=52+9=25+9=34x = 5^2 + 9 = 25 + 9 = 34.
Converting from uu back to xx provides the solution to the original equation.

Anahtar Kavram

Simplifying nested radicals by completing the square under the radical sign and applying the identity a2=a\sqrt{a^2} = |a|.
Soru 19Soru

If xx and yy are positive integers satisfying 3x3y=7023^x - 3^y = 702 and x+y=3\sqrt{x + y} = 3, what is the value of x2y2x^2 - y^2?

Cevabı ve açıklamayı göster

Cevap: 2727

Cevap

The correct value of x2y2x^2 - y^2 is 27.
Squaring x+y=3\sqrt{x + y} = 3 gives x+y=9x + y = 9. Factoring 3x3y=7023^x - 3^y = 702 gives 3y(3xy1)=7023^y(3^{x-y} - 1) = 702. Since 702=33×26702 = 3^3 \times 26 and (3xy1)(3^{x-y} - 1) is coprime to 3, we deduce 3y=33    y=33^y = 3^3 \implies y = 3, and 3x31=26    3x3=27    x=63^{x-3} - 1 = 26 \implies 3^{x-3} = 27 \implies x = 6. Substituting x=6x = 6 and y=3y = 3 into x2y2x^2 - y^2 gives 369=2736 - 9 = 27.

Adım Adım Çözüm

1
Eliminate the radical from the given linear equation.
Squaring both sides of x+y=3\sqrt{x + y} = 3 gives x+y=9x + y = 9.
Squaring both sides removes the square root operator to establish a linear relationship between xx and yy.
2
Factor out the common exponential term 3y3^y from 3x3y=7023^x - 3^y = 702.
3y(3xy1)=7023^y(3^{x-y} - 1) = 702.
Since xx and yy are positive integers and 702>0702 > 0, it must be true that x>yx > y, allowing factoring by exponent rules 3x=3y3xy3^x = 3^y \cdot 3^{x-y}.
3
Find the prime factorization of 702 and match the power of 3.
702=27×26=33×26702 = 27 \times 26 = 3^3 \times 26, so 3y(3xy1)=33×263^y(3^{x-y} - 1) = 3^3 \times 26.
The factor (3xy1)(3^{x-y} - 1) is not divisible by 3 because 3xy3^{x-y} is a multiple of 3 for x>yx > y. Therefore, all powers of 3 in 702 must belong to 3y3^y.
4
Solve for the values of yy and xx.
y=3y = 3 and 3x31=26    3x3=27=33    x3=3    x=63^{x-3} - 1 = 26 \implies 3^{x-3} = 27 = 3^3 \implies x - 3 = 3 \implies x = 6.
Equating prime component bases yields y=3y = 3 and x=6x = 6, which satisfies x+y=6+3=9x + y = 6 + 3 = 9.
5
Calculate the target expression x2y2x^2 - y^2.
x2y2=6232=369=27x^2 - y^2 = 6^2 - 3^2 = 36 - 9 = 27.
Substituting x=6x = 6 and y=3y = 3 into x2y2x^2 - y^2 yields 27 (or using (x+y)(xy)=9×3=27(x+y)(x-y) = 9 \times 3 = 27).

Anahtar Kavram

Factoring exponential expressions using prime factorization, radical simplification, and difference of squares.
Soru 20Soru

For all real numbers x>0x > 0, which of the following expressions are equivalent to (x3/2x3x1/6)2\left(\frac{x^{3/2} \cdot \sqrt[3]{x}}{x^{1/6}}\right)^2? Select all such expressions.

Geçerli olan tümünü seçin

Cevabı ve açıklamayı göster

Cevap: x103\sqrt[3]{x^{10}}; x3x3x^3 \sqrt[3]{x}; (x53)2\left(\sqrt[3]{x^5}\right)^2

Cevap

The expressions equivalent to the given expression are x103\sqrt[3]{x^{10}}, x3x3x^3 \sqrt[3]{x}, and (x53)2\left(\sqrt[3]{x^5}\right)^2.
Simplifying the given expression by converting all radical forms to fractional exponents yields x10/3x^{10/3}. The three expressions x103\sqrt[3]{x^{10}}, x3x3x^3 \sqrt[3]{x}, and (x53)2\left(\sqrt[3]{x^5}\right)^2 each rewrite to x10/3x^{10/3} when evaluated using standard power laws.

Adım Adım Çözüm

1
Convert radical expressions to fractional exponent form inside the parentheses.
x3=x1/3\sqrt[3]{x} = x^{1/3}, so the numerator becomes x3/2x1/3x^{3/2} \cdot x^{1/3}.
Converting all terms to exponent notation allows applying standard exponent addition and subtraction rules.
2
Simplify the numerator by adding exponents.
x3/2+1/3=x9/6+2/6=x11/6x^{3/2 + 1/3} = x^{9/6 + 2/6} = x^{11/6}.
When multiplying exponential terms with the same base, add their exponents using a common denominator.
3
Divide by the denominator by subtracting exponents.
x11/6x1/6=x11/61/6=x10/6=x5/3\frac{x^{11/6}}{x^{1/6}} = x^{11/6 - 1/6} = x^{10/6} = x^{5/3}.
When dividing exponential terms with the same base, subtract the denominator's exponent from the numerator's exponent.
4
Apply the outer exponent of 2.
(x5/3)2=x(5/3)2=x10/3\left(x^{5/3}\right)^2 = x^{(5/3) \cdot 2} = x^{10/3}.
When raising a power to another power, multiply the inner and outer exponents.
5
Compare x10/3x^{10/3} to each option.
x103=x10/3\sqrt[3]{x^{10}} = x^{10/3}, x3x3=x3+1/3=x10/3x^3 \sqrt[3]{x} = x^{3 + 1/3} = x^{10/3}, and (x53)2=(x5/3)2=x10/3\left(\sqrt[3]{x^5}\right)^2 = (x^{5/3})^2 = x^{10/3} are all equivalent.
Matching each candidate expression in fractional exponent form identifies all equivalent choices.

Anahtar Kavram

Simplification of algebraic expressions using rules of fractional exponents and radicals
Tahmini Süre:1m 30s
Sayfa 1 / 2Sonraki
Algebraic Exponents and Radicals Alıştırma Soruları — GRE General Test | Examkin