Soru

Zorluk: OrtaAlkanes: Properties, Reactions, and Petroleum Refining

What volume of oxygen at STP is required for the complete combustion of 10 dm310\text{ dm}^3 of propane gas (C3H8C_3H_8) measured at the same temperature and pressure?

  1. A
    10 dm310\text{ dm}^3
  2. B
    30 dm330\text{ dm}^3
  3. 50 dm350\text{ dm}^3Cevap
  4. D
    22.4 dm322.4\text{ dm}^3

Cevap

The volume of oxygen required at STP for the complete combustion of 10 dm310\text{ dm}^3 of propane is 50 dm350\text{ dm}^3.
According to the balanced chemical equation C3H8(g)+5O2(g)3CO2(g)+4H2O(l)C_3H_8(g) + 5O_2(g) \rightarrow 3CO_2(g) + 4H_2O(l), 1 dm31\text{ dm}^3 of propane requires 5 dm35\text{ dm}^3 of oxygen for complete combustion at the same temperature and pressure. Therefore, 10 dm310\text{ dm}^3 of propane requires 10×5=50 dm310 \times 5 = 50\text{ dm}^3 of oxygen.

Adım Adım Çözüm

1
Write and balance the chemical equation for the complete combustion of propane gas.
C3H8(g)+5O2(g)3CO2(g)+4H2O(l)C_3H_8(g) + 5O_2(g) \rightarrow 3CO_2(g) + 4H_2O(l)
A balanced chemical equation provides the correct mole and volume ratios of reactants and products.
2
Apply Gay-Lussac's Law of Combining Volumes for gases at the same temperature and pressure.
1 volume of C3H8 reacts with 5 volumes of O21\text{ volume of } C_3H_8 \text{ reacts with } 5\text{ volumes of } O_2
The volume ratio of gaseous reactants equals the ratio of their stoichiometric coefficients.
3
Multiply the given volume of propane by the volume ratio coefficient.
Volume of O2=10 dm3×5=50 dm3\text{Volume of } O_2 = 10\text{ dm}^3 \times 5 = 50\text{ dm}^3
Calculating 10×510 \times 5 gives the total volume of oxygen required.

Anahtar Kavram

Combustion Stoichiometry and Gay-Lussac's Law of Combining Volumes
Bu soruyu puanla