Organic Chemistry

102 soru

Soru 1Soru

During the industrial synthesis of a synthetic fiber, hexanedioic acid reacts with hexane-1,6-diamine with the elimination of water molecules to form amide linkages. Which polymer is formed from this process?

Cevabı ve açıklamayı göster

Cevap: Nylon-6,6

Cevap

Nylon-6,6 is the polyamide formed by the condensation polymerization of hexanedioic acid and hexane-1,6-diamine.
The reaction between a dicarboxylic acid containing 6 carbon atoms (hexanedioic acid) and a diamine containing 6 carbon atoms (hexane-1,6-diamine) yields a synthetic polyamide known as Nylon-6,6 via condensation polymerization with the elimination of water.

Adım Adım Çözüm

1
Identify the functional groups of the monomers provided in the prompt.
Hexanedioic acid contains dicarboxylic acid groups (COOH-COOH) and hexane-1,6-diamine contains diamine groups (NH2-NH_2).
The reaction between carboxylic acid and amine functional groups forms peptide/amide bonds (CONH-CONH-).
2
Determine the type of polymerization and the resulting macromolecule class.
The reaction involves the loss of water molecules, which defines condensation polymerization forming a polyamide.
Condensation polymerization links bifunctional monomers together with the elimination of small molecules such as H2OH_2O.
3
Match the specific monomers to the corresponding polymer name.
Hexanedioic acid (6 carbon atoms) and hexane-1,6-diamine (6 carbon atoms) produce Nylon-6,6.
The numbers '6,6' in Nylon-6,6 indicate that both the diamine and dicarboxylic acid monomers contain 6 carbon atoms each.

Anahtar Kavram

Condensation Polymerization and Synthesis of Polyamides (Nylon-6,6)
Soru 2Soru

Propanal and propanone are functional group isomers because they share the same molecular formula, C3H6OC_3H_6O, but belong to different homologous series with distinct functional groups.

Cevabı ve açıklamayı göster

Cevap: True

Cevap

The statement is TRUE. Propanal and propanone share the same molecular formula (C3H6OC_3H_6O) but possess different functional groups (aldehyde vs. ketone), which exemplifies functional group isomerism.
The statement is correct because propanal and propanone both have the molecular formula C3H6OC_3H_6O but contain different functional groups (an aldehyde group and a ketone group, respectively), meeting the exact definition of functional group isomerism.

Adım Adım Çözüm

1
Determine the molecular formula of propanal and propanone.
Propanal (CH3CH2CHOCH_3CH_2CHO) has 3 carbon atoms, 6 hydrogen atoms, and 1 oxygen atom (C3H6OC_3H_6O). Propanone (CH3COCH3CH_3COCH_3) also has 3 carbon atoms, 6 hydrogen atoms, and 1 oxygen atom (C3H6OC_3H_6O).
Isomers must share the exact same molecular formula.
2
Identify the functional groups present in both compounds.
Propanal contains an aldehyde group (CHO-\text{CHO}), whereas propanone contains a ketone group (CO-\text{CO}-).
Structural isomers containing different functional groups belong to different homologous series.
3
Evaluate the relationship against the definition of functional group isomerism.
Since both compounds share the molecular formula C3H6OC_3H_6O but differ in functional groups, the statement is true.
This directly satisfies the criteria for functional group isomerism.

Anahtar Kavram

Functional group isomerism is a form of structural isomerism where compounds have the same molecular formula but different functional groups.
Soru 3Soru

Consider the unsaturated hydrocarbon 2-methylbut-1-en-3-yne, which has the condensed structural formula CH2=C(CH3)CCHCH_2=C(CH_3)C\equiv CH. What is the total number of sigma (σ\sigma) bonds present in one molecule of this compound?

Cevabı ve açıklamayı göster

Cevap: 10; 10 sigma bonds; 10 bonds

Cevap

The total number of sigma (σ\sigma) bonds present in one molecule of 2-methylbut-1-en-3-yne is 10.
In 2-methylbut-1-en-3-yne (CH2=C(CH3)CCHCH_2=C(CH_3)C\equiv CH), there are 6 carbon-hydrogen single bonds (2 from C1, 3 from the methyl group, and 1 from C4) and 4 carbon-carbon sigma bonds (1 from the C1=C2 double bond, 1 connecting C2 to the methyl carbon, 1 connecting C2 to C3, and 1 from the C3\equiv C4 triple bond). Summing these gives 10 sigma bonds in total.

Adım Adım Çözüm

1
Expand the condensed structural formula to identify all individual carbon-hydrogen (C-H) bonds.
The =CH2=CH_2 group contains 2 C-H σ\sigma bonds, the methyl group (CH3-CH_3) contains 3 C-H σ\sigma bonds, and the terminal alkynyl group (CH\equiv CH) contains 1 C-H σ\sigma bond, giving a total of 6 C-H σ\sigma bonds.
Every single bond between carbon and hydrogen is a single sigma bond.
2
Identify all carbon-carbon (C-C) sigma bonds in the backbone and side chain.
The C=CC=C double bond contributes 1 C-C σ\sigma bond, the single bond to the methyl branch contributes 1 C-C σ\sigma bond, the C2-C3 single bond contributes 1 C-C σ\sigma bond, and the CCC\equiv C triple bond contributes 1 C-C σ\sigma bond, giving a total of 4 C-C σ\sigma bonds.
Multiple bonds (double or triple) contain exactly one sigma bond each, with the remaining bonds being pi (π\pi) bonds.
3
Sum the total number of C-H and C-C sigma bonds.
6 (C-H σ bonds)+4 (C-C σ bonds)=10 total σ bonds6 \text{ (C-H } \sigma\text{ bonds)} + 4 \text{ (C-C } \sigma\text{ bonds)} = 10 \text{ total } \sigma \text{ bonds}.
Adding all localized σ\sigma bonds yields the total count for the molecule.

Anahtar Kavram

Determination of sigma (\sigma) and pi (\pi) bond counts in complex open-chain hydrocarbons
Soru 4Soru

Which of the following describes the type of orbital overlap that forms the carbon-carbon (CC\text{C}-\text{C}) single bond in an ethane (C2H6C_2H_6) molecule?

Cevabı ve açıklamayı göster

Cevap: Head-on overlap of two sp3sp^3 hybrid orbitals

Cevap

Head-on overlap of two sp3sp^3 hybrid orbitals
The carbon atoms in ethane (C2H6C_2H_6) are each bonded to four other atoms, giving them a tetrahedral arrangement and sp3sp^3 hybridization. The carbon-carbon single bond is a sigma (σ\sigma) bond formed by the direct head-on overlap of one sp3sp^3 hybrid orbital from each carbon atom.

Adım Adım Çözüm

1
Determine the hybridization state of carbon atoms in ethane (C2H6C_2H_6)
Each carbon atom forms 4 single sigma (σ\sigma) bonds, corresponding to sp3sp^3 hybridization with tetrahedral geometry.
Saturated hydrocarbons (alkanes) undergo sp3sp^3 hybridization to accommodate four equivalent single bonds.
2
Identify the mode of overlap for the carbon-carbon single bond
The single bond between the two carbon atoms is a sigma (σ\sigma) bond.
Sigma bonds are always formed by direct end-to-end (head-on) overlap of atomic or hybrid orbitals along the bond axis.

Anahtar Kavram

Orbital overlap and hybridization in tetrahedral carbon (sp3sp^3 sigma bonding)
Soru 5Soru

Arrange the following straight-chain alkanes in order of increasing boiling point, starting with the alkane that has the lowest boiling point:

Öğeleri doğru sıraya koymak için sürükleyin

Cevabı ve açıklamayı göster

Cevap

The correct sequence from lowest to highest boiling point is Methane (CH4CH_4), Ethane (C2H6C_2H_6), Propane (C3H8C_3H_8), and Butane (C4H10C_4H_{10}).
In the unbranched alkane homologous series, boiling point increases progressively with increasing carbon chain length and relative molecular mass due to stronger intermolecular van der Waals forces. Consequently, Methane (CH4CH_4) has the lowest boiling point, followed by Ethane (C2H6C_2H_6), Propane (C3H8C_3H_8), and Butane (C4H10C_4H_{10}) with the highest boiling point.

Adım Adım Çözüm

1
Identify the relationship between molecular size and boiling point in a homologous series
As the number of carbon atoms in straight-chain alkanes increases, the molecular mass increases.
Members of a homologous series share identical functional groups and exhibit a gradual gradation in physical properties.
2
Evaluate the strength of intermolecular forces
Van der Waals (dispersion) forces become stronger with increasing molecular surface area and electron count.
Greater intermolecular attraction requires more thermal energy to separate molecules into the gas phase.
3
Sequence the compounds from smallest to largest carbon chain
Methane (1C) < Ethane (2C) < Propane (3C) < Butane (4C)
Fewer carbon atoms correlate directly with a lower boiling point.

Anahtar Kavram

Physical Property Trends in Homologous Series
Soru 6Soru

Which of the following reagents reacts with propanal to produce a silver mirror, but shows no reaction with propanone?

Cevabı ve açıklamayı göster

Cevap: Ammoniacal silver nitrate solution

Cevap

Ammoniacal silver nitrate solution
Ammoniacal silver nitrate solution (Tollen's reagent) acts as a mild oxidizing agent. It oxidizes propanal to propanoate ions while Ag+Ag^+ ions are reduced to elemental silver, depositing as a silver mirror on the container walls. Propanone resists oxidation by mild oxidizing agents and yields no silver deposit.

Adım Adım Çözüm

1
Identify the functional groups of the given compounds
Propanal (CH3CH2CHOCH_3CH_2CHO) is an alkanal (aldehyde), whereas propanone (CH3COCH3CH_3COCH_3) is an alkanone (ketone).
Alkanals possess a terminal carbonyl group with a hydrogen atom that is easily oxidized, while alkanones lack this hydrogen atom.
2
Determine the specific reagent that yields a silver mirror
Tollen's reagent (ammoniacal silver nitrate solution, [Ag(NH3)2]+[Ag(NH_3)_2]^+) is reduced by alkanals to form metallic silver (Ag(s)Ag(s)), which deposits on the glass wall as a silver mirror.
Alkanones cannot be easily oxidized by mild oxidizing agents like Tollen's reagent under standard conditions.

Anahtar Kavram

Distinction between alkanals and alkanones using Tollen's reagent
Soru 7Soru

Consider the organic compound 3-methylbut-1-yne, which has the condensed structural formula HCCCH(CH3)2HC\equiv C-CH(CH_3)_2. How many carbon atoms in a single molecule of this compound are sp3sp^3 hybridized?

Cevabı ve açıklamayı göster

Cevap: 3; three; 3 carbon atoms; 3 carbons

Cevap

There are 3 sp3sp^3 hybridized carbon atoms in one molecule of 3-methylbut-1-yne.
In 3-methylbut-1-yne (HCCCH(CH3)2HC\equiv C-CH(CH_3)_2), there are 5 total carbon atoms. The two terminal/alkyne carbons (C1C_1 and C2C_2) participate in a triple bond, giving them 2 σ\sigma bonds each and an spsp hybridization state. The central methine carbon (C3C_3) is bonded to four distinct atoms (C2C_2, HH, and two methyl carbons) via single σ\sigma bonds, making it sp3sp^3 hybridized. The two methyl group carbons (C4C_4 and C5C_5) are each single-bonded to three hydrogen atoms and C3C_3, making them sp3sp^3 hybridized as well. Thus, exactly 3 carbon atoms are sp3sp^3 hybridized.

Adım Adım Çözüm

1
Expand the condensed structural formula to identify every carbon atom and its bonding environment.
The expanded structure is HC1C2C3H(C4H3)(C5H3)H-C_1 \equiv C_2 - C_3H(C_4H_3)(C_5H_3), containing a total of 5 carbon atoms.
Expanding the formula clarifies the number of single (σ\sigma) and multiple bonds connected to each carbon atom.
2
Determine the hybridization state of the triply bonded carbon atoms (C1C_1 and C2C_2).
C1C_1 and C2C_2 are each involved in one triple bond and one single bond, forming 2 σ\sigma bonds and 2 π\pi bonds. Thus, both C1C_1 and C2C_2 are spsp hybridized.
A carbon atom with 2 steric domains (linear geometry) uses spsp hybrid orbitals.
3
Determine the hybridization state of the methine carbon atom (C3C_3) and the two methyl carbon atoms (C4C_4 and C5C_5).
C3C_3 forms four single σ\sigma bonds (one to C2C_2, one to HH, and two to methyl carbons). C4C_4 and C5C_5 each form four single σ\sigma bonds (one to C3C_3 and three to HH). Therefore, C3C_3, C4C_4, and C5C_5 are all sp3sp^3 hybridized.
A carbon atom bonded to 4 separate atoms via single σ\sigma bonds has 4 steric domains (tetrahedral geometry) and undergoes sp3sp^3 hybridization.
4
Count the total number of sp3sp^3 hybridized carbon atoms.
3 carbon atoms (C3C_3, C4C_4, and C5C_5) are sp3sp^3 hybridized.
Combining the results from steps 2 and 3 gives 2 spsp carbons and 3 sp3sp^3 carbons.

Anahtar Kavram

Identification of carbon hybridization states (sp3,sp2,spsp^3, sp^2, sp) in aliphatic molecules
Tahmini Süre:1m 30s
Soru 8Soru

Match each homologous series of organic compounds listed on the left with its correct general molecular formula on the right.

Soldaki öğeye tıklayın, sonra eşleşen sağdaki öğeye tıklayın

Öğeler

Alkanals (Aldehydes)
Alkanoic acids (Carboxylic acids)
Alkynes
Alkanols (Alcohols)

Eşleşmeler

Cevabı ve açıklamayı göster

Cevap

Alkanals match with CnH2nOC_n H_{2n}O; Alkanoic acids match with CnH2nO2C_n H_{2n}O_2; Alkynes match with CnH2n2C_n H_{2n-2}; Alkanols match with CnH2n+2OC_n H_{2n+2}O.
Each class of organic compound is defined by its characteristic functional group and degree of unsaturation. Alkanols are saturated single-oxygen compounds (CnH2n+2OC_n H_{2n+2}O), Alkanals feature one carbonyl double bond (CnH2nOC_n H_{2n}O), Alkanoic acids feature a carboxyl group (CnH2nO2C_n H_{2n}O_2), and Alkynes contain a triple bond reducing hydrogen content to CnH2n2C_n H_{2n-2}.

Adım Adım Çözüm

1
Determine the general formula for aliphatic monohydric alkanols.
Alkanols consist of an alkyl group (CnH2n+1C_n H_{2n+1}) bonded to a hydroxyl group (OH-\text{OH}), giving the molecular formula CnH2n+2OC_n H_{2n+2}O.
Saturated aliphatic monohydric alcohols have the maximum possible hydrogen-to-carbon ratio for oxygenated single-bonded species.
2
Determine the general formula for alkanals.
Alkanals contain a terminal carbonyl group (CHO-\text{CHO}), introducing one double bond (C=O\text{C=O}) which reduces the hydrogen atom count by two compared to alkanols, giving CnH2nOC_n H_{2n}O.
Each site of unsaturation (such as a π\pi-bond) decreases the hydrogen atom count by two.
3
Determine the general formula for alkanoic acids.
Alkanoic acids contain a carboxyl group (COOH-\text{COOH}), giving two oxygen atoms and one carbon-oxygen double bond, yielding CnH2nO2C_n H_{2n}O_2.
Carboxylic acids are functional group isomers of esters and share the general formula CnH2nO2C_n H_{2n}O_2.
4
Determine the general formula for alkynes.
Alkynes possess one carbon-carbon triple bond (two π\pi-bonds), reducing the hydrogen count by four relative to alkanes (CnH2n+2C_n H_{2n+2}), resulting in CnH2n2C_n H_{2n-2}.
A triple bond accounts for two degrees of unsaturation.

Anahtar Kavram

General Molecular Formulas of Organic Homologous Series
Tahmini Süre:1m 15s
Soru 9Soru

For an organic compound to exhibit optical isomerism, it must possess a chiral carbon atom bonded to four different groups or atoms. Which of the following compounds possesses a chiral carbon atom and exhibits optical activity?

Cevabı ve açıklamayı göster

Cevap: 2-chlorobutane

Cevap

2-chlorobutane is the correct answer because its second carbon atom is attached to four distinct groups, forming a chiral center that exhibits optical isomerism.
The correct answer, 2-chlorobutane, has a central carbon atom (C-2) bonded to four completely distinct substituents: a hydrogen atom, a chlorine atom, a methyl group, and an ethyl group. Because all four attached groups are unique, the molecule lacks internal symmetry and displays optical isomerism (enantiomerism).

Adım Adım Çözüm

1
Recall the condition for optical isomerism
A molecule must contain at least one chiral (asymmetric) carbon atom, which is a carbon atom bonded to four completely different atoms or groups.
Chirality prevents the mirror image of the molecule from being superimposable on the original structure.
2
Analyze the carbon environments for each compound
For 2-chlorobutane: CH3CH(Cl)CH2CH3\text{CH}_3-\text{C}^* \text{H(Cl)}-\text{CH}_2\text{CH}_3. The starred carbon (C\text{C}^*) is attached to H-\text{H}, Cl-\text{Cl}, CH3-\text{CH}_3, and CH2CH3-\text{CH}_2\text{CH}_3.
All four groups attached to carbon-2 are unique, creating a chiral center.
3
Check the remaining options for symmetry
1-chlorobutane has CH2-\text{CH}_2- groups; 2-chloropropane has two identical CH3-\text{CH}_3 groups on C-2; 2-methylpropan-2-ol has three identical CH3-\text{CH}_3 groups on C-2.
Molecules containing identical groups attached to the same carbon atom are achiral and optically inactive.

Anahtar Kavram

Optical Isomerism and Chirality
Soru 10Soru

What volume of oxygen at STP is required for the complete combustion of 10 dm310\text{ dm}^3 of propane gas (C3H8C_3H_8) measured at the same temperature and pressure?

Cevabı ve açıklamayı göster

Cevap: 50 dm350\text{ dm}^3

Cevap

The volume of oxygen required at STP for the complete combustion of 10 dm310\text{ dm}^3 of propane is 50 dm350\text{ dm}^3.
According to the balanced chemical equation C3H8(g)+5O2(g)3CO2(g)+4H2O(l)C_3H_8(g) + 5O_2(g) \rightarrow 3CO_2(g) + 4H_2O(l), 1 dm31\text{ dm}^3 of propane requires 5 dm35\text{ dm}^3 of oxygen for complete combustion at the same temperature and pressure. Therefore, 10 dm310\text{ dm}^3 of propane requires 10×5=50 dm310 \times 5 = 50\text{ dm}^3 of oxygen.

Adım Adım Çözüm

1
Write and balance the chemical equation for the complete combustion of propane gas.
C3H8(g)+5O2(g)3CO2(g)+4H2O(l)C_3H_8(g) + 5O_2(g) \rightarrow 3CO_2(g) + 4H_2O(l)
A balanced chemical equation provides the correct mole and volume ratios of reactants and products.
2
Apply Gay-Lussac's Law of Combining Volumes for gases at the same temperature and pressure.
1 volume of C3H8 reacts with 5 volumes of O21\text{ volume of } C_3H_8 \text{ reacts with } 5\text{ volumes of } O_2
The volume ratio of gaseous reactants equals the ratio of their stoichiometric coefficients.
3
Multiply the given volume of propane by the volume ratio coefficient.
Volume of O2=10 dm3×5=50 dm3\text{Volume of } O_2 = 10\text{ dm}^3 \times 5 = 50\text{ dm}^3
Calculating 10×510 \times 5 gives the total volume of oxygen required.

Anahtar Kavram

Combustion Stoichiometry and Gay-Lussac's Law of Combining Volumes
Soru 11Soru

Which of the following open-chain isomeric alkenes with the molecular formula C5H10C_5H_{10} exhibits geometric (cis-trans) isomerism?

Cevabı ve açıklamayı göster

Cevap: Pent-2-ene

Cevap

Pent-2-ene is the correct answer because neither of its double-bonded carbon atoms carries two identical attached groups.
Geometric (cis-trans) isomerism requires restricted rotation around a carbon-carbon double bond (C=CC=C) along with two different substituents attached to each of the double-bonded carbon atoms. In pent-2-ene (CH3CH=CHCH2CH3CH_3-CH=CH-CH_2-CH_3), C2 is bonded to H-H and CH3-CH_3, while C3 is bonded to H-H and CH2CH3-CH_2CH_3. Because neither carbon carries identical groups, pent-2-ene can form distinct cis and trans stereoisomers.

Adım Adım Çözüm

1
Identify the structural condition required for geometric (cis-trans) isomerism in alkenes.
For an alkene R1R2C=CR3R4R_1R_2C=CR_3R_4 to exhibit geometric isomerism, R1R2R_1 \neq R_2 and R3R4R_3 \neq R_4 must hold for both carbon atoms involved in the double bond.
If either carbon atom in the double bond is bonded to two identical atoms or groups, rotating structural representation does not create distinct non-superimposable stereoisomers.
2
Analyze the structural formula of Pent-1-ene.
Pent-1-ene is CH2=CHCH2CH2CH3CH_2=CH-CH_2-CH_2-CH_3. C1 is attached to two hydrogen atoms (H-H and H-H).
Since C1 has identical hydrogen atoms, it cannot exhibit cis-trans isomerism.
3
Analyze the structural formula of Pent-2-ene.
Pent-2-ene is CH3CH=CHCH2CH3CH_3-CH=CH-CH_2-CH_3. C2 is bonded to H-H and CH3-CH_3. C3 is bonded to H-H and CH2CH3-CH_2CH_3.
Both double-bonded carbons have two distinct attached groups, permitting the existence of cis-pent-2-ene and trans-pent-2-ene.
4
Analyze the structural formulas of 2-Methylbut-2-ene and 3-Methylbut-1-ene.
2-Methylbut-2-ene has two methyl groups on C2 ((CH3)2C=CHCH3(CH_3)_2C=CH-CH_3), and 3-Methylbut-1-ene has two hydrogen atoms on C1 (CH2=CHCH(CH3)2CH_2=CH-CH(CH_3)_2).
Both compounds violate the condition of having distinct groups on each doubly bonded carbon atom.

Anahtar Kavram

Geometric (cis-trans) Isomerism in Alkenes
Tahmini Süre:1m 30s
Soru 12Soru

A triglyceride derived from a single saturated alkanoic acid undergoes complete saponification with excess aqueous NaOH\text{NaOH}, yielding glycerol and a sodium soap salt. When the isolated soap salt is acidified with excess dilute HCl\text{HCl}, a pure saturated alkanoic acid XX is liberated. Neutralization of 10.24 g10.24\text{ g} of acid XX requires exactly 40.0 cm340.0\text{ cm}^3 of a 1.00 mol dm31.00\text{ mol dm}^{-3} NaOH\text{NaOH} solution. What is the correct IUPAC name of the alkanoic acid XX? (Atomic masses: H=1\text{H} = 1, C=12\text{C} = 12, O=16\text{O} = 16)

Cevabı ve açıklamayı göster

Cevap: Hexadecanoic acid

Cevap

Hexadecanoic acid
The acid XX reacts with NaOH\text{NaOH} in a 1:1 stoichiometry. 0.0400 mol0.0400\text{ mol} of NaOH\text{NaOH} neutralizes 0.0400 mol0.0400\text{ mol} of XX, giving a molar mass of 256 g mol1256\text{ g mol}^{-1}. Setting the general formula for saturated alkanoic acids CnH2nO2\text{C}_n\text{H}_{2n}\text{O}_2 equal to 256256 yields 14n+32=25614n + 32 = 256, which solves to n=16n = 16. The 16-carbon saturated carboxylic acid is Hexadecanoic acid.

Adım Adım Çözüm

1
Calculate the number of moles of NaOH used in the neutralization reaction
Moles of NaOH=Concentration×Volume in dm3=1.00 mol dm3×40.01000 dm3=0.0400 mol\text{Moles of NaOH} = \text{Concentration} \times \text{Volume in dm}^3 = 1.00\text{ mol dm}^{-3} \times \frac{40.0}{1000}\text{ dm}^3 = 0.0400\text{ mol}
Neutralization uses volume and molarity to determine mole quantity.
2
Determine the molar mass of the monocarboxylic acid X
Since monocarboxylic acid reacts with NaOH in a 1:1 mole ratio (R-COOH+NaOHR-COONa+H2O\text{R-COOH} + \text{NaOH} \rightarrow \text{R-COONa} + \text{H}_2\text{O}), moles of X=0.0400 molX = 0.0400\text{ mol}. Thus, Molar mass of X=10.24 g0.0400 mol=256 g mol1\text{Molar mass of } X = \frac{10.24\text{ g}}{0.0400\text{ mol}} = 256\text{ g mol}^{-1}.
Molar mass is the mass divided by the amount in moles.
3
Use the general formula for a saturated alkanoic acid to find the number of carbon atoms (n)
The general formula for a saturated monocarboxylic acid is CnH2nO2\text{C}_n\text{H}_{2n}\text{O}_2. Molar mass =12n+2n+32=14n+32=256    14n=224    n=16= 12n + 2n + 32 = 14n + 32 = 256 \implies 14n = 224 \implies n = 16.
Determining nn gives the total number of carbon atoms in the IUPAC parent chain.
4
Assign the official IUPAC name for a 16-carbon saturated alkanoic acid
C16H32O2\text{C}_{16}\text{H}_{32}\text{O}_2 is named Hexadecanoic acid.
The IUPAC suffix for a 16-carbon alkanoic acid is hexadecanoic acid.

Anahtar Kavram

Determination of alkanoic acid stoichiometry from saponification and neutralization data
Tahmini Süre:3m 0s
Soru 13Soru

A 45.0 g45.0\text{ g} sample of impure glucose containing 80.0%80.0\% pure glucose (C6H12O6C_6H_{12}O_6) by mass undergoes complete fermentation in the presence of zymase enzyme at suitable conditions. What is the volume of carbon dioxide gas, in dm3\text{dm}^3, released at standard temperature and pressure (STP)?

(Relative atomic masses: C=12.0C = 12.0, H=1.0H = 1.0, O=16.0O = 16.0; Molar volume of gas at STP =22.4 dm3mol1= 22.4\text{ dm}^3\text{mol}^{-1})

Cevabı ve açıklamayı göster

Cevap: 8.96

Cevap

The volume of carbon dioxide gas released at STP is 8.96 dm38.96\text{ dm}^3.
The complete fermentation of glucose is represented by the equation C6H12O6zymase2C2H5OH+2CO2C_6H_{12}O_6 \xrightarrow{\text{zymase}} 2C_2H_5OH + 2CO_2. Taking into account the 80.0%80.0\% purity, the mass of active glucose is 0.800×45.0 g=36.0 g0.800 \times 45.0\text{ g} = 36.0\text{ g}, which corresponds to 36.0180.0=0.200 mol\frac{36.0}{180.0} = 0.200\text{ mol}. Because 1 mol1\text{ mol} of glucose yields 2 mol2\text{ mol} of CO2CO_2, 0.400 mol0.400\text{ mol} of CO2CO_2 is produced. At STP, 0.400 mol×22.4 dm3mol1=8.96 dm30.400\text{ mol} \times 22.4\text{ dm}^3\text{mol}^{-1} = 8.96\text{ dm}^3.

Adım Adım Çözüm

1
Determine the mass of pure glucose in the impure sample
36.0 g of pure glucose
Only the active pure glucose undergoes fermentation.
2
Calculate the molar mass of glucose (C6H12O6C_6H_{12}O_6)
180.0 g/mol
Needed to convert mass of reactant into molar amount.
3
Calculate the number of moles of glucose fermented
0.200 mol of glucose
Moles = Mass / Molar mass.
4
Determine moles of CO2 evolved using reaction stoichiometry
0.400 mol of CO2
Fermentation of 1 mole of hexose sugar produces 2 moles of ethanol and 2 moles of carbon dioxide.
5
Calculate the volume of CO2 gas at STP
8.96 dm^3
Volume = Moles × Molar volume at STP.

Anahtar Kavram

Fermentation Stoichiometry and Molar Yield of Alkanols
Soru 14Soru

An acyclic hydrocarbon XX with the molecular formula C5H8C_5H_8 rapidly decolourises bromine water. However, when XX is treated with ammoniacal silver nitrate solution, no precipitate is observed. Upon complete catalytic hydrogenation in the presence of a nickel catalyst, XX is converted into pentane. What is the IUPAC name of hydrocarbon XX?

Cevabı ve açıklamayı göster

Cevap: pent-2-yne; 2-pentyne; Pent-2-yne; 2-Pentyne

Cevap

Pent-2-yne (or 2-pentyne)
Hydrocarbon XX has the molecular formula C5H8C_5H_8, corresponding to two degrees of unsaturation. Complete hydrogenation to pentane confirms an unbranched five-carbon chain. Decolourisation of bromine water verifies unsaturation. Because XX yields no precipitate with ammoniacal silver nitrate solution, it lacks acidic terminal acetylenic hydrogens (RCCHR-C \equiv C-H). Therefore, the triple bond must be located internally between carbon-2 and carbon-3, making the compound pent-2-yne.

Adım Adım Çözüm

1
Determine the degree of unsaturation and carbon skeleton of hydrocarbon XX.
Degree of unsaturation is 2, and the carbon skeleton is a straight 5-carbon chain.
The molecular formula C5H8C_5H_8 corresponds to CnH2n2C_nH_{2n-2}, indicating two degrees of unsaturation (an alkyne or alkadiene). Complete catalytic hydrogenation yields pentane (C5H12C_5H_{12}), proving an unbranched five-carbon chain.
2
Analyze the reaction with bromine water.
Hydrocarbon XX contains carbon-carbon multiple bonds.
Decolourisation of bromine water confirms the presence of unsaturation.
3
Evaluate the test with ammoniacal silver nitrate solution.
Hydrocarbon XX is an internal (non-terminal) alkyne.
Terminal alkynes possess acidic acetylenic hydrogen atoms (RCCHR-C \equiv C-H) that react with ammoniacal silver nitrate to form a characteristic white silver acetylide precipitate. The absence of a precipitate rules out pent-1-yne and confirms that the triple bond is located internally at C-2.
4
Deduce the final IUPAC name of hydrocarbon XX.
pent-2-yne
Combining a straight 5-carbon chain with an internal triple bond between carbon-2 and carbon-3 gives pent-2-yne.

Anahtar Kavram

Distinction between terminal and non-terminal alkynes using ammoniacal silver nitrate test and carbon skeleton determination via hydrogenation
Tahmini Süre:2m 0s
Soru 15Soru

An unknown gaseous hydrocarbon XX decolorizes acidified potassium tetraoxomanganate(VII) solution and produces a reddish-brown precipitate when bubbled into an ammoniacal solution of copper(I) chloride. Which of the following IUPAC structural formulas represents hydrocarbon XX?

Cevabı ve açıklamayı göster

Cevap: CH3CH2CCH\text{CH}_3\text{CH}_2\text{C}\equiv\text{CH}

Cevap

The correct structural formula is CH3CH2CCH\text{CH}_3\text{CH}_2\text{C}\equiv\text{CH} (but-1-yne).
The compound CH3CH2CCH\text{CH}_3\text{CH}_2\text{C}\equiv\text{CH} (but-1-yne) contains a carbon-carbon triple bond which decolorizes acidified KMnO4\text{KMnO}_4 via oxidation. Furthermore, because it is a terminal alkyne with a hydrogen atom directly bonded to an spsp-hybridized carbon, it reacts with ammoniacal copper(I) chloride solution to yield a reddish-brown precipitate of copper(I) acetylide.

Adım Adım Çözüm

1
Analyze the reaction with acidified potassium tetraoxomanganate(VII) (\text{KMnO}_4) solution.
The decolorization of acidified KMnO4\text{KMnO}_4 proves that hydrocarbon XX is unsaturated (contains carbon-carbon double or triple bonds). This eliminates saturated alkanes like butane.
Unsaturated hydrocarbons undergo oxidation addition across carbon-carbon multiple bonds.
2
Analyze the reaction with ammoniacal copper(I) chloride (\text{Cu}_2\text{Cl}_2) solution.
Formation of a reddish-brown precipitate (copper(I) diallylide/acetylide) confirms the presence of a terminal alkyne carrying an acidic acetylenic hydrogen attached to an spsp-hybridized carbon atom (CCH-\text{C}\equiv\text{C}-\text{H}).
Only terminal alkynes have sufficiently acidic hydrogen atoms to be substituted by copper(I) or silver ions in ammoniacal solutions.
3
Differentiate between terminal alkynes, internal alkynes, and alkenes based on structural formulas.
CH3CH2CCH\text{CH}_3\text{CH}_2\text{C}\equiv\text{CH} is but-1-yne (a terminal alkyne) which fulfills both conditions. CH3CCCH3\text{CH}_3\text{C}\equiv\text{CCH}_3 is an internal alkyne lacking a terminal acidic hydrogen.
Internal alkynes and alkenes fail the ammoniacal copper(I) chloride test despite being unsaturated.

Anahtar Kavram

Distinction between general unsaturation tests and terminal alkyne confirmation tests.
Tahmini Süre:1m 30s
Soru 16Soru

An organic compound XX with the molecular formula C4H8O2\text{C}_4\text{H}_8\text{O}_2 does not react with sodium hydrogentrioxocarbonate(IV) solution to liberate gas. Upon refluxing XX with dilute sodium hydroxide solution, two organic products, YY and ZZ, are formed. Acidification of product ZZ yields ethanoic acid, while mild oxidation of product YY yields an alkanal that gives a positive Tollen's test. Which of the following correctly identifies the IUPAC name of compound XX and the chemical nature of its reaction with dilute sodium hydroxide?

Cevabı ve açıklamayı göster

Cevap: Ethyl ethanoate; an irreversible alkaline hydrolysis reaction

Cevap

The IUPAC name of compound XX is ethyl ethanoate, and its reaction with dilute sodium hydroxide is an irreversible alkaline hydrolysis reaction.
Compound XX does not evolve carbon(IV) oxide gas with sodium hydrogentrioxocarbonate(IV), ruling out alkanoic acids and establishing that XX is an ester. Alkaline hydrolysis of XX yields sodium ethanoate (ZZ) and ethanol (YY), because acidification of ZZ produces ethanoic acid (22 carbons) and oxidation of ethanol (YY) yields ethanal, an alkanal that gives a silver mirror with Tollen's reagent. Therefore, XX is ethyl ethanoate (CH3COOCH2CH3\text{CH}_3\text{COOCH}_2\text{CH}_3). Base hydrolysis of esters converts the carboxyl moiety into a resonance-stabilized carboxylate ion, preventing the reverse reaction and rendering the hydrolysis irreversible.

Adım Adım Çözüm

1
Determine the functional group class of compound XX
Compound XX is an ester.
Isomers with formula C4H8O2\text{C}_4\text{H}_8\text{O}_2 can be alkanoic acids or esters. Since XX does not react with NaHCO3\text{NaHCO}_3 to evolve CO2\text{CO}_2 gas, it lacks the free carboxyl acid group (COOH-\text{COOH}) and must be an ester.
2
Deduce the structure of the alkanoate (acid) portion of the ester
The alkanoate part is ethanoate (CH3COO\text{CH}_3\text{COO}^-).
Alkaline hydrolysis of ester XX produces carboxylate salt ZZ. Acidification of ZZ yields ethanoic acid (CH3COOH\text{CH}_3\text{COOH}), which contains 2 carbon atoms.
3
Deduce the structure of the alkyl (alcohol) portion of the ester
The alkyl group is ethyl (C2H5-\text{C}_2\text{H}_5), making YY ethanol (CH3CH2OH\text{CH}_3\text{CH}_2\text{OH}).
The total number of carbon atoms in XX is 4. Subtracting 2 carbons from the acid part leaves 2 carbons for the alcohol YY (ethanol). Mild oxidation of ethanol yields ethanal (an alkanal), which reduces Tollen's reagent.
4
Identify the reaction type with dilute NaOH\text{NaOH}
Irreversible alkaline hydrolysis (saponification).
Hydrolysis of an ester with alkali consumes hydroxyl ions (OH\text{OH}^-) to form an unreactive carboxylate anion (CH3COO\text{CH}_3\text{COO}^-), driving the reaction to completion irreversibly.

Anahtar Kavram

Chemical differentiation between carboxylic acids and esters, ester hydrolysis kinetics, and structural deduction.
Soru 17Soru

Match each chemical reaction or process involving alkanoic acids, esters, fats, or oils on the left with its corresponding chemical outcome or product description on the right.

Soldaki öğeye tıklayın, sonra eşleşen sağdaki öğeye tıklayın

Öğeler

Acid-catalyzed esterification of propane-1,2,3-triol with hexadecanoic acid
Alkaline hydrolysis of glyceryl tristearate using excess aqueous sodium hydroxide
High-pressure catalytic hydrogenation of glyceryl trioleate in the presence of nickel
Acid-catalyzed reflux of ethyl ethanoate with an excess of water

Eşleşmeler

Cevabı ve açıklamayı göster

Cevap

The correct pairings match: (1) Acid-catalyzed esterification of propane-1,2,3-triol with hexadecanoic acid to producing tripalmitin fat and water; (2) Alkaline hydrolysis of glyceryl tristearate with aqueous NaOH to yielding propane-1,2,3-triol and sodium octadecanoate soap; (3) Catalytic hydrogenation of glyceryl trioleate to converting an unsaturated liquid triacylglycerol into a saturated solid fat; and (4) Acid-catalyzed reflux of ethyl ethanoate with water to reversibly producing ethanoic acid and ethanol.
The correct pairings logically connect each organic process to its definitive product or reaction characteristic: esterification of hexadecanoic acid with glycerol yields tripalmitin; saponification of glyceryl tristearate using NaOH irreversibly yields glycerol and sodium octadecanoate soap; catalytic hydrogenation saturates double bonds in glyceryl trioleate turning liquid oil into solid fat; and acid hydrolysis of ethyl ethanoate is a reversible equilibrium yielding ethanoic acid and ethanol.

Adım Adım Çözüm

1
Analyze the reaction of propane-1,2,3-triol (glycerol) with hexadecanoic acid (palmitic acid).
Identified as esterification forming tripalmitin and water.
Hexadecanoic acid (C15H31COOHC_{15}H_{31}COOH) esterifies with glycerol to form glyceryl tripalmitin (C51H98O6C_{51}H_{98}O_6), a saturated fat.
2
Analyze the alkaline hydrolysis of glyceryl tristearate using aqueous NaOHNaOH.
Identified as saponification yielding glycerol and sodium octadecanoate.
Base hydrolysis of fats irreversibly converts ester groups into glycerol and carboxylate salts (soap).
3
Analyze the catalytic hydrogenation of glyceryl trioleate.
Identified as hardening of oils.
Addition of H2H_2 across the C=CC=C double bonds of unsaturated oleic acid residues converts liquid oil into saturated solid fat.
4
Analyze the acid-catalyzed reaction of ethyl ethanoate with water.
Identified as reversible ester hydrolysis.
Acid hydrolysis of esters is reversible, establishing an equilibrium mixture of the parent alkanoic acid (ethanoic acid) and alkanol (ethanol).

Anahtar Kavram

Reactivity and Interconversion of Alkanoic Acids, Esters, Fats, and Oils
Soru 18Soru

An organic compound XX with the molecular formula C4H10O\text{C}_4\text{H}_{10}\text{O} resists oxidation when treated with acidified potassium dichromate(VI) (K2Cr2O7/H+\text{K}_2\text{Cr}_2\text{O}_7/\text{H}^+). When compound XX is heated with concentrated tetraoxosulfate(VI) acid (H2SO4\text{H}_2\text{SO}_4) at 170C170^\circ\text{C}, it undergoes dehydration to produce a major organic product YY. What is the IUPAC name of compound YY?

Cevabı ve açıklamayı göster

Cevap: 2-methylpropene

Cevap

2-methylpropene
The compound resisting oxidation must be a tertiary alkanol because the hydroxyl-bearing carbon lacks an alpha-hydrogen atom. The only tertiary alkanol with formula C4H10O\text{C}_4\text{H}_{10}\text{O} is 2-methylpropan-2-ol. Subjecting 2-methylpropan-2-ol to intra-molecular dehydration using concentrated tetraoxosulfate(VI) acid at 170C170^\circ\text{C} removes water to form 2-methylpropene as the major alkene product.

Adım Adım Çözüm

1
Determine the structural class of compound X from its resistance to oxidation.
Compound X is a tertiary alkanol.
Primary and secondary alkanols are readily oxidized by acidified potassium dichromate(VI), whereas tertiary alkanols resist mild oxidation because the carbon atom bonded to the hydroxyl group (OH-OH) carries no hydrogen atoms.
2
Identify the specific isomer of formula C4H10O\text{C}_4\text{H}_{10}\text{O} corresponding to a tertiary alkanol.
Compound X is 2-methylpropan-2-ol, (CH3)3C-OH(\text{CH}_3)_3\text{C-OH}.
Among the four structural isomers of C4H10O\text{C}_4\text{H}_{10}\text{O} alkanols, only 2-methylpropan-2-ol is tertiary.
3
Determine the elimination product when 2-methylpropan-2-ol undergoes acid-catalyzed dehydration.
Dehydration yields 2-methylpropene, (CH3)2C=CH2(\text{CH}_3)_2\text{C=CH}_2.
Heating with concentrated H2SO4\text{H}_2\text{SO}_4 at 170C170^\circ\text{C} removes a molecule of water (the OH-OH group and a hydrogen atom from an adjacent methyl group), forming an alkene.

Anahtar Kavram

Classification of alkanols based on oxidation behavior and acid-catalyzed dehydration to alkenes
Tahmini Süre:2m 0s
Soru 19Soru

What is the correct IUPAC name for the organic compound with the condensed structural formula CH3CH2CH(CH2CH3)CH3\text{CH}_3-\text{CH}_2-\text{CH}(\text{CH}_2\text{CH}_3)-\text{CH}_3?

Cevabı ve açıklamayı göster

Cevap: 3-methylpentane

Cevap

3-methylpentane
The correct IUPAC name is determined by finding the longest continuous chain of carbon atoms. Expanding the condensed formula CH3CH2CH(CH2CH3)CH3\text{CH}_3-\text{CH}_2-\text{CH}(\text{CH}_2\text{CH}_3)-\text{CH}_3 shows that the longest continuous chain contains 5 carbons (pentane). The remaining branch is a methyl group at carbon-3, making the systematic name 3-methylpentane.

Adım Adım Çözüm

1
Identify the longest continuous carbon chain in the structure.
Expanding CH3CH2CH(CH2CH3)CH3\text{CH}_3-\text{CH}_2-\text{CH}(\text{CH}_2\text{CH}_3)-\text{CH}_3 shows a continuous chain of 5 carbon atoms (pentane).
IUPAC nomenclature rules dictate that the parent chain must be the longest continuous chain of carbon atoms.
2
Identify substituents and number the parent chain.
A methyl group (CH3-\text{CH}_3) is attached at carbon-3.
Numbering the 5-carbon chain from either end places the substituent at position 3.
3
Combine the substituent locant, substituent name, and parent alkane name.
The correct IUPAC name is 3-methylpentane.
Combining the locant (3), substituent (methyl), and parent (pentane) yields 3-methylpentane.

Anahtar Kavram

Identification of the longest continuous carbon chain in IUPAC organic nomenclature
Tahmini Süre:45s
Soru 20Soru

Match each organic functional group class on the left with its characteristic IUPAC naming suffix on the right.

Soldaki öğeye tıklayın, sonra eşleşen sağdaki öğeye tıklayın

Öğeler

Alkanol (Alcohol)
Alkanal (Aldehyde)
Alkanone (Ketone)
Alkanoic acid (Carboxylic acid)

Eşleşmeler

Cevabı ve açıklamayı göster

Cevap

Alkanol (Alcohol) matches with '-ol', Alkanal (Aldehyde) matches with '-al', Alkanone (Ketone) matches with '-one', and Alkanoic acid (Carboxylic acid) matches with '-oic acid'.
Each organic functional group family corresponds to a specific IUPAC naming suffix: Alkanols take '-ol', Alkanals take '-al', Alkanones take '-one', and Alkanoic acids take '-oic acid'.

Adım Adım Çözüm

1
Identify the primary functional group present in each class of organic compound.
Alkanols possess hydroxyl groups, alkanals possess aldehyde groups, alkanones possess ketone carbonyl groups, and alkanoic acids possess carboxyl groups.
The characteristic functional group determines both the homologous series and the IUPAC suffix rules.
2
Assign the standard IUPAC nomenclature suffix corresponding to each functional group.
Alkanol \rightarrow '-ol', Alkanal \rightarrow '-al', Alkanone \rightarrow '-one', Alkanoic acid \rightarrow '-oic acid'.
Standard IUPAC rules modify the parent alkane name by replacing the terminal '-e' with the designated functional group suffix.

Anahtar Kavram

IUPAC Suffixes for Functional Groups
Sayfa 1 / 6Sonraki
Organic Chemistry Alıştırma Soruları — JAMB UTME | Examkin