Soru

Zorluk: ZorStandard Enthalpy Changes and Hess's Law
The hydration of ethene to produce liquid ethanol is represented by the chemical equation:
C2H4(g)+H2O(g)C2H5OH(l)\text{C}_2\text{H}_4(g) + \text{H}_2\text{O}(g) \rightarrow \text{C}_2\text{H}_5\text{OH}(l)

Given the following thermochemical equations:
1. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l)ΔH=1367 kJ mol1\text{C}_2\text{H}_5\text{OH}(l) + 3\text{O}_2(g) \rightarrow 2\text{CO}_2(g) + 3\text{H}_2\text{O}(l) \quad \Delta H^\circ = -1367\text{ kJ mol}^{-1}
2. C2H4(g)+3O2(g)2CO2(g)+2H2O(l)ΔH=1411 kJ mol1\text{C}_2\text{H}_4(g) + 3\text{O}_2(g) \rightarrow 2\text{CO}_2(g) + 2\text{H}_2\text{O}(l) \quad \Delta H^\circ = -1411\text{ kJ mol}^{-1}
3. H2O(g)H2O(l)ΔH=44 kJ mol1\text{H}_2\text{O}(g) \rightarrow \text{H}_2\text{O}(l) \quad \Delta H^\circ = -44\text{ kJ mol}^{-1}

Calculate the standard enthalpy change, ΔH\Delta H^\circ, for the hydration reaction in kJ mol1\text{kJ mol}^{-1}.

Cevap: -88 kJ/mol

Cevap

The standard enthalpy change for the hydration reaction is -88 kJ/mol.
According to Hess's law, the standard enthalpy change of a net reaction can be determined by algebraically combining component reactions and their enthalpy values. Adding Equation 2 as written, Equation 3 as written, and the reverse of Equation 1 cancels out intermediate species (carbon dioxide, oxygen, and liquid water), leaving the net hydration reaction. Summing their respective enthalpy values gives -1411 kJ/mol + (-44 kJ/mol) + 1367 kJ/mol = -88 kJ/mol.

Adım Adım Çözüm

1
Identify the required target thermochemical equation
Target: C2H4(g)+H2O(g)C2H5OH(l)\text{C}_2\text{H}_4(g) + \text{H}_2\text{O}(g) \rightarrow \text{C}_2\text{H}_5\text{OH}(l)
This establishes the stoichiometry and physical states required for reactants and products.
2
Apply Hess's law to reverse and combine the given thermochemical equations
Keep Equation 2: ΔH2=1411 kJ mol1\Delta H_2 = -1411\text{ kJ mol}^{-1}
Keep Equation 3: ΔH3=44 kJ mol1\Delta H_3 = -44\text{ kJ mol}^{-1}
Reverse Equation 1: ΔH1=+1367 kJ mol1\Delta H_1' = +1367\text{ kJ mol}^{-1}
Reversing Equation 1 places liquid ethanol on the product side, requiring the sign of its enthalpy change to be inverted.
3
Sum the enthalpy changes of the modified reaction steps
ΔH=(1411)+(44)+(+1367)=88 kJ mol1\Delta H^\circ = (-1411) + (-44) + (+1367) = -88\text{ kJ mol}^{-1}
According to Hess's law, the total enthalpy change of an overall reaction equals the sum of the enthalpy changes for individual component steps.

Anahtar Kavram

Hess's Law of Constant Heat Summation
Bu soruyu puanla