Tüm alıştırma soruları

1526 soru

Soru 261Soru

A 10.0 g10.0\text{ g} sample of impure calcium trioxocarbonate(IV), CaCO3\text{CaCO}_3, was strongly heated until decomposition was complete. If the volume of carbon(IV) oxide gas evolved at STP was 1.792 dm31.792\text{ dm}^3, what is the percentage purity of the CaCO3\text{CaCO}_3 sample? [Molar volume of gas at STP = 22.4 dm3mol122.4\text{ dm}^3\text{mol}^{-1}; relative atomic masses: Ca=40,C=12,O=16\text{Ca}=40, \text{C}=12, \text{O}=16]

Cevabı ve açıklamayı göster

Cevap: 80

Cevap

The percentage purity of the calcium trioxocarbonate(IV) sample is 80%80\%.
Thermal decomposition of pure calcium trioxocarbonate(IV) releases carbon(IV) oxide gas according to CaCO3(s)CaO(s)+CO2(g)\text{CaCO}_3(\text{s}) \rightarrow \text{CaO}(\text{s}) + \text{CO}_2(\text{g}). Dividing the gas volume (1.792 dm31.792\text{ dm}^3) by the molar gas volume at STP (22.4 dm3mol122.4\text{ dm}^3\text{mol}^{-1}) yields 0.08 mol0.08\text{ mol} of CO2\text{CO}_2. Due to the 1:1 stoichiometry, 0.08 mol0.08\text{ mol} of pure CaCO3\text{CaCO}_3 reacted. Multiplying by the molar mass of CaCO3\text{CaCO}_3 (100 g/mol100\text{ g/mol}) gives 8.0 g8.0\text{ g} of pure CaCO3\text{CaCO}_3. The percentage purity is calculated as (8.0 g10.0 g)×100%=80%\left(\frac{8.0\text{ g}}{10.0\text{ g}}\right) \times 100\% = 80\%.

Adım Adım Çözüm

1
Write the balanced chemical equation for the thermal decomposition of calcium trioxocarbonate(IV).
CaCO3(s)CaO(s)+CO2(g)\text{CaCO}_3(\text{s}) \rightarrow \text{CaO}(\text{s}) + \text{CO}_2(\text{g})
Establishes the 1:1 stoichiometric mole ratio between CaCO3\text{CaCO}_3 and CO2\text{CO}_2.
2
Calculate the number of moles of CO2\text{CO}_2 gas produced at STP.
Moles of CO2=1.792 dm322.4 dm3mol1=0.08 mol\text{Moles of CO}_2 = \frac{1.792\text{ dm}^3}{22.4\text{ dm}^3\text{mol}^{-1}} = 0.08\text{ mol}
Uses the molar gas volume relationship at standard temperature and pressure (V/VmV / V_m).
3
Calculate the mass of pure CaCO3\text{CaCO}_3 in the original sample.
Mass of CaCO3=0.08 mol×100 g/mol=8.0 g\text{Mass of CaCO}_3 = 0.08\text{ mol} \times 100\text{ g/mol} = 8.0\text{ g}
Because 1 mol1\text{ mol} of CaCO3\text{CaCO}_3 produces 1 mol1\text{ mol} of CO2\text{CO}_2, 0.08 mol0.08\text{ mol} of pure CaCO3\text{CaCO}_3 reacted.
4
Calculate the percentage purity of the sample.
Percentage purity=(8.0 g10.0 g)×100%=80%\text{Percentage purity} = \left(\frac{8.0\text{ g}}{10.0\text{ g}}\right) \times 100\% = 80\%
Compares the mass of active pure reactant to the total mass of the impure sample.

Anahtar Kavram

Stoichiometry of thermal decomposition of trioxocarbonate(IV) salts and gas molar volume calculations at STP.
Soru 262Soru
A 10.0 g10.0\text{ g} sample of impure calcium carbonate (CaCO3\text{CaCO}_3) is completely decomposed by strong heating according to the chemical equation:
CaCO3(s)CaO(s)+CO2(g)\text{CaCO}_3(s) \rightarrow \text{CaO}(s) + \text{CO}_2(g)
The carbon(IV) oxide gas evolved is passed into an excess solution of sodium hydroxide, causing the mass of the solution to increase by 3.52 g3.52\text{ g}. Assuming the impurities present in the sample do not react or produce any gas, what is the percentage purity of the calcium carbonate sample? [Ca=40,C=12,O=16][\text{Ca} = 40, \text{C} = 12, \text{O} = 16]
Cevabı ve açıklamayı göster

Cevap: 80

Cevap

The percentage purity of the calcium carbonate sample is 80%.
Sodium hydroxide absorbs carbon(IV) oxide (CO2\text{CO}_2) gas released during the thermal decomposition of calcium carbonate (CaCO3\text{CaCO}_3). The 3.52 g3.52\text{ g} mass gain of the solution equals the mass of CO2\text{CO}_2 evolved. Dividing this mass by the molar mass of CO2\text{CO}_2 (44 g/mol44\text{ g/mol}) yields 0.08 mol0.08\text{ mol} of CO2\text{CO}_2. According to the 1:1 stoichiometric relationship, 0.08 mol0.08\text{ mol} of pure CaCO3\text{CaCO}_3 decomposed. Multiplying by the molar mass of CaCO3\text{CaCO}_3 (100 g/mol100\text{ g/mol}) gives 8.00 g8.00\text{ g} of pure CaCO3\text{CaCO}_3. The percentage purity is (8.00 g/10.0 g)×100%=80%(8.00\text{ g} / 10.0\text{ g}) \times 100\% = 80\%.

Adım Adım Çözüm

1
Calculate the molar masses of carbon(IV) oxide and calcium carbonate
Molar mass of CO2 = 44 g/mol, Molar mass of CaCO3 = 100 g/mol
Molar masses are required to convert between mass and moles.
2
Determine the moles of carbon(IV) oxide gas evolved
Moles of CO2 = 3.52 g / 44 g/mol = 0.08 mol
Sodium hydroxide reacts with and absorbs acidic carbon(IV) oxide, so mass increase equals the mass of CO2.
3
Determine the mass of pure calcium carbonate in the sample
Mass of pure CaCO3 = 0.08 mol * 100 g/mol = 8.00 g
The mole ratio of CaCO3 to CO2 in the thermal decomposition reaction is 1:1.
4
Calculate the percentage purity of the sample
(8.00 g / 10.0 g) * 100 = 80%
Percentage purity is the ratio of pure reactive substance mass to total sample mass expressed as a percentage.

Anahtar Kavram

Thermal decomposition of trioxocarbonates and percentage purity stoichiometry
Soru 263Soru

Calculate the quantity of electricity, in Coulombs, required to deposit 0.108 g0.108\text{ g} of silver at the cathode during the electrolysis of silver trioxonitrate(V) solution. (Ag=108 g/mol\text{Ag} = 108\text{ g/mol}, 1 F=96,500 C/mol1\text{ F} = 96,500\text{ C/mol})

Cevabı ve açıklamayı göster

Cevap: 96.5

Cevap

The quantity of electricity required is 96.5 C96.5\text{ C}.
Depositing 0.108 g0.108\text{ g} of silver (molar mass 108 g/mol108\text{ g/mol}) requires 0.001 moles0.001\text{ moles} of silver atoms. According to the cathodic reaction Ag++eAg\text{Ag}^+ + \text{e}^- \rightarrow \text{Ag}, 1 mole1\text{ mole} of electrons (96,500 C96,500\text{ C}) is required to deposit 1 mole1\text{ mole} of Ag\text{Ag}. Therefore, the total charge required is 0.001×96,500 C=96.5 C0.001 \times 96,500\text{ C} = 96.5\text{ C}.

Adım Adım Çözüm

1
Calculate the number of moles of silver deposited
Moles of Ag=0.108 g108 g/mol=0.001 mol\text{Moles of Ag} = \frac{0.108\text{ g}}{108\text{ g/mol}} = 0.001\text{ mol}
Number of moles is calculated by dividing mass by molar mass.
2
Determine the quantity of electricity (charge) required
Q=0.001 mol×96,500 C/mol=96.5 CQ = 0.001\text{ mol} \times 96,500\text{ C/mol} = 96.5\text{ C}
The reduction reaction Ag++eAg\text{Ag}^+ + \text{e}^- \rightarrow \text{Ag} shows 1 mole1\text{ mole} of electrons (1 F=96,500 C1\text{ F} = 96,500\text{ C}) deposits 1 mole1\text{ mole} of silver.

Anahtar Kavram

Faraday's First Law of Electrolysis and Quantitative Mass-Charge Relationship
Soru 264Soru

During the electrolytic refining of copper, a steady current of 5.0 A5.0\text{ A} is passed through an aqueous copper(II) tetraoxosulfate(VI) (CuSO4CuSO_4) solution for 965 seconds965\text{ seconds}. What mass of copper, in grams, is deposited at the cathode? (Faraday's constant F=96,500 C mol1F = 96,500\text{ C mol}^{-1}; Molar mass of Cu=64 g mol1Cu = 64\text{ g mol}^{-1})

Cevabı ve açıklamayı göster

Cevap: 1.6

Cevap

1.6 g
Passing a 5.0 A5.0\text{ A} current for 965 s965\text{ s} transfers 4825 C4825\text{ C} of electric charge, corresponding to 0.05 mol0.05\text{ mol} of electrons. Because the deposition of copper from CuSO4CuSO_4 follows Cu2++2eCuCu^{2+} + 2e^- \rightarrow Cu, every 2 moles2\text{ moles} of electrons deposit 1 mole1\text{ mole} of copper metal. Thus, 0.025 mol0.025\text{ mol} of copper is deposited, which corresponds to 0.025 mol×64 g mol1=1.6 g0.025\text{ mol} \times 64\text{ g mol}^{-1} = 1.6\text{ g}.

Adım Adım Çözüm

1
Calculate the total quantity of electricity (QQ) passed through the electrolyte.
Q=I×t=5.0 A×965 s=4825 CQ = I \times t = 5.0\text{ A} \times 965\text{ s} = 4825\text{ C}
Electric charge is the product of current in amperes and time in seconds.
2
Calculate the moles of electrons transferred.
n(e)=QF=4825 C96500 C mol1=0.05 moln(e^-) = \frac{Q}{F} = \frac{4825\text{ C}}{96500\text{ C mol}^{-1}} = 0.05\text{ mol} of electrons
One mole of electrons carries a charge equivalent to 1 Faraday (96,500 C96,500\text{ C}).
3
Use the cathode half-equation to find the moles of deposited copper.
Cathode reaction: Cu(aq)2++2eCu(s)Cu^{2+}_{(aq)} + 2e^- \rightarrow Cu_{(s)}. Moles of Cu=0.05 mol2=0.025 molCu = \frac{0.05\text{ mol}}{2} = 0.025\text{ mol}
Reduction of one mole of copper(II) ions requires two moles of electrons.
4
Convert the moles of deposited copper into mass.
Mass of Cu=n×M=0.025 mol×64 g mol1=1.6 gCu = n \times M = 0.025\text{ mol} \times 64\text{ g mol}^{-1} = 1.6\text{ g}
Multiplying the chemical amount of copper by its molar mass yields the mass in grams.

Anahtar Kavram

Quantitative electrolysis of copper(II) ions using Faraday's laws of electrolysis
Soru 265Soru
A sample of 0.13 g0.13\text{ g} of zinc granules reacts completely with an excess of dilute hydrochloric acid according to the reaction equation:
Zn(s)+2HCl(aq)ZnCl2(aq)+H2(g)\text{Zn}(s) + 2\text{HCl}(aq) \rightarrow \text{ZnCl}_2(aq) + \text{H}_2(g)
If the reaction takes exactly 40 seconds40\text{ seconds} to reach completion, what is the average rate of consumption of hydrochloric acid in mol s1\text{mol s}^{-1}? (Molar mass of Zn=65 g mol1\text{Zn} = 65\text{ g mol}^{-1})
Cevabı ve açıklamayı göster

Cevap: 0.0001

Cevap

The average rate of consumption of hydrochloric acid is 0.0001 mol s10.0001\text{ mol s}^{-1} (or 1.0×104 mol s11.0 \times 10^{-4}\text{ mol s}^{-1}).
To determine the average rate of consumption of hydrochloric acid, first convert the mass of zinc to moles (0.13 g/65 g mol1=0.002 mol0.13\text{ g} / 65\text{ g mol}^{-1} = 0.002\text{ mol}). According to the stoichiometric coefficients in the balanced equation Zn+2HClZnCl2+H2\text{Zn} + 2\text{HCl} \rightarrow \text{ZnCl}_2 + \text{H}_2, 2 moles2\text{ moles} of HCl\text{HCl} react for every 1 mole1\text{ mole} of Zn\text{Zn}. Therefore, 0.004 mol0.004\text{ mol} of HCl\text{HCl} is consumed. Dividing this quantity by the reaction time (40 seconds40\text{ seconds}) gives an average rate of 0.0001 mol s10.0001\text{ mol s}^{-1}.

Adım Adım Çözüm

1
Calculate the amount in moles of zinc reacted
Moles of Zn=0.13 g65 g mol1=0.002 mol\text{Moles of Zn} = \frac{0.13\text{ g}}{65\text{ g mol}^{-1}} = 0.002\text{ mol}
Mass divided by molar mass yields the quantity in moles.
2
Determine the moles of hydrochloric acid consumed using the mole ratio
Moles of HCl=2×0.002 mol=0.004 mol\text{Moles of HCl} = 2 \times 0.002\text{ mol} = 0.004\text{ mol}
The balanced chemical equation shows a 1:21:2 stoichiometric ratio between Zn\text{Zn} and HCl\text{HCl}.
3
Calculate the average rate of consumption of HCl per unit time
Rate of HCl consumption=0.004 mol40 s=0.0001 mol s1\text{Rate of HCl consumption} = \frac{0.004\text{ mol}}{40\text{ s}} = 0.0001\text{ mol s}^{-1}
Rate of reaction is defined as the change in moles of reactant divided by elapsed time.

Anahtar Kavram

Stoichiometric determination of reaction rate from reactant consumption
Soru 266Soru

What volume of carbon(IV) oxide gas, in dm3\text{dm}^3, measured at STP, is produced by the complete thermal decomposition of 20.0 g20.0\text{ g} of pure calcium trioxocarbonate(IV), CaCO3\text{CaCO}_3? [Ca=40\text{Ca} = 40, C=12\text{C} = 12, O=16\text{O} = 16; Molar volume of gas at STP =22.4 dm3mol1= 22.4\text{ dm}^3\text{mol}^{-1}]

Cevabı ve açıklamayı göster

Cevap: 4.48

Cevap

4.48 dm³
Complete thermal decomposition of 20.0 g of CaCO₃ (molar mass 100 g/mol) generates 0.20 mol of CO₂ gas according to the equation CaCO₃(s) -> CaO(s) + CO₂(g). Since 1 mol of gas at STP occupies 22.4 dm³, 0.20 mol occupies 4.48 dm³.

Adım Adım Çözüm

1
Determine the molar mass and number of moles of calcium trioxocarbonate(IV).
Molar mass of CaCO₃ = 100 g/mol; Moles of CaCO₃ = 20.0 g / 100 g/mol = 0.20 mol
Converting given mass to moles is required to apply stoichiometric ratios.
2
Apply the balanced reaction mole ratio to find moles of carbon(IV) oxide produced.
Moles of CO₂ = 0.20 mol
The equation CaCO₃(s) -> CaO(s) + CO₂(g) shows a 1:1 molar ratio between CaCO₃ and CO₂.
3
Multiply moles of CO₂ by molar gas volume at STP.
Volume of CO₂ = 0.20 mol × 22.4 dm³/mol = 4.48 dm³
At STP, 1 mole of any ideal gas occupies 22.4 dm³.

Anahtar Kavram

Thermal decomposition of trioxocarbonate(IV) salts and gas volume calculations at STP
Tahmini Süre:45s
Soru 267Soru
The hydration of ethene to produce liquid ethanol is represented by the chemical equation:
C2H4(g)+H2O(g)C2H5OH(l)\text{C}_2\text{H}_4(g) + \text{H}_2\text{O}(g) \rightarrow \text{C}_2\text{H}_5\text{OH}(l)

Given the following thermochemical equations:
1. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l)ΔH=1367 kJ mol1\text{C}_2\text{H}_5\text{OH}(l) + 3\text{O}_2(g) \rightarrow 2\text{CO}_2(g) + 3\text{H}_2\text{O}(l) \quad \Delta H^\circ = -1367\text{ kJ mol}^{-1}
2. C2H4(g)+3O2(g)2CO2(g)+2H2O(l)ΔH=1411 kJ mol1\text{C}_2\text{H}_4(g) + 3\text{O}_2(g) \rightarrow 2\text{CO}_2(g) + 2\text{H}_2\text{O}(l) \quad \Delta H^\circ = -1411\text{ kJ mol}^{-1}
3. H2O(g)H2O(l)ΔH=44 kJ mol1\text{H}_2\text{O}(g) \rightarrow \text{H}_2\text{O}(l) \quad \Delta H^\circ = -44\text{ kJ mol}^{-1}

Calculate the standard enthalpy change, ΔH\Delta H^\circ, for the hydration reaction in kJ mol1\text{kJ mol}^{-1}.

Cevabı ve açıklamayı göster

Cevap: -88

Cevap

The standard enthalpy change for the hydration reaction is -88 kJ/mol.
According to Hess's law, the standard enthalpy change of a net reaction can be determined by algebraically combining component reactions and their enthalpy values. Adding Equation 2 as written, Equation 3 as written, and the reverse of Equation 1 cancels out intermediate species (carbon dioxide, oxygen, and liquid water), leaving the net hydration reaction. Summing their respective enthalpy values gives -1411 kJ/mol + (-44 kJ/mol) + 1367 kJ/mol = -88 kJ/mol.

Adım Adım Çözüm

1
Identify the required target thermochemical equation
Target: C2H4(g)+H2O(g)C2H5OH(l)\text{C}_2\text{H}_4(g) + \text{H}_2\text{O}(g) \rightarrow \text{C}_2\text{H}_5\text{OH}(l)
This establishes the stoichiometry and physical states required for reactants and products.
2
Apply Hess's law to reverse and combine the given thermochemical equations
Keep Equation 2: ΔH2=1411 kJ mol1\Delta H_2 = -1411\text{ kJ mol}^{-1}
Keep Equation 3: ΔH3=44 kJ mol1\Delta H_3 = -44\text{ kJ mol}^{-1}
Reverse Equation 1: ΔH1=+1367 kJ mol1\Delta H_1' = +1367\text{ kJ mol}^{-1}
Reversing Equation 1 places liquid ethanol on the product side, requiring the sign of its enthalpy change to be inverted.
3
Sum the enthalpy changes of the modified reaction steps
ΔH=(1411)+(44)+(+1367)=88 kJ mol1\Delta H^\circ = (-1411) + (-44) + (+1367) = -88\text{ kJ mol}^{-1}
According to Hess's law, the total enthalpy change of an overall reaction equals the sum of the enthalpy changes for individual component steps.

Anahtar Kavram

Hess's Law of Constant Heat Summation
Soru 268Soru

During the industrial extraction of aluminium using the Hall-Héroult process, a steady current of 96.5 A96.5\text{ A} is passed through an electrolytic cell containing molten alumina (Al2O3Al_2O_3) dissolved in molten cryolite for 5.0 hours5.0\text{ hours}. What is the mass of pure aluminium, in grams, deposited at the cathode?

(Take 1 Faraday=96,500 C mol11\text{ Faraday} = 96,500\text{ C mol}^{-1}, Relative atomic mass: Al=27\text{Al} = 27)

Cevabı ve açıklamayı göster

Cevap: 162

Cevap

The mass of pure aluminium deposited at the cathode is 162 g162\text{ g}.
Using Q=I×tQ = I \times t, a current of 96.5 A96.5\text{ A} for 5.0 hours5.0\text{ hours} (18,000 s18,000\text{ s}) yields a total charge of 1,737,000 C1,737,000\text{ C}, which equals 18 Faradays18\text{ Faradays} (18 moles of electrons18\text{ moles of electrons}). Since the reduction of Al3+\text{Al}^{3+} to Al\text{Al} requires 3 electrons per atom (Al3++3eAl\text{Al}^{3+} + 3e^- \rightarrow \text{Al}), 18 moles18\text{ moles} of electrons liberate 6 moles6\text{ moles} of aluminium metal. Multiplying by the molar mass of aluminium (27 g mol127\text{ g mol}^{-1}) gives 162 g162\text{ g}.

Adım Adım Çözüm

1
Convert time to seconds and calculate total electric charge transferred
Q=96.5 A×(5.0×3600 s)=1,737,000 CQ = 96.5\text{ A} \times (5.0 \times 3600\text{ s}) = 1,737,000\text{ C}
Electric charge is defined as current multiplied by time in seconds (Q=I×tQ = I \times t).
2
Calculate the moles of electrons transferred using Faraday's constant
Moles of e=1,737,000 C96,500 C mol1=18 molese^- = \frac{1,737,000\text{ C}}{96,500\text{ C mol}^{-1}} = 18\text{ moles}
One Faraday (96,500 C96,500\text{ C}) corresponds to the charge carried by one mole of electrons.
3
Relate moles of electrons to moles of aluminium deposited using the half-equation
Al3++3eAl(s)\text{Al}^{3+} + 3e^- \rightarrow \text{Al}_{(s)}, so 3 mol e3\text{ mol } e^- produces 1 mol Al1\text{ mol Al}. Moles of Al=183=6 moles\text{Al} = \frac{18}{3} = 6\text{ moles}
Aluminium ion Al3+\text{Al}^{3+} requires three electrons for reduction to metallic aluminium.
4
Multiply moles of aluminium by its relative atomic mass
Mass=6 mol×27 g mol1=162 g\text{Mass} = 6\text{ mol} \times 27\text{ g mol}^{-1} = 162\text{ g}
Mass equals molar amount multiplied by molar mass.

Anahtar Kavram

Quantitative application of Faraday's laws of electrolysis in the extraction of metals
Soru 269Soru

During a chemical reaction between dilute hydrochloric acid and calcium carbonate, 60 cm360\text{ cm}^3 of carbon dioxide gas is collected over a period of 30 seconds30\text{ seconds}. What is the average rate of evolution of the gas in cm3 s1\text{cm}^3\text{ s}^{-1}?

Cevabı ve açıklamayı göster

Cevap: 2

Cevap

The average rate of gas evolution is 2.0 cm3 s12.0\text{ cm}^3\text{ s}^{-1}.
The average rate of a reaction yielding a gas is given by dividing the total volume of gas produced by the total time taken. Dividing 60 cm360\text{ cm}^3 by 30 seconds30\text{ seconds} gives an average rate of 2.0 cm3 s12.0\text{ cm}^3\text{ s}^{-1}.

Adım Adım Çözüm

1
Identify the volume of gas evolved and the time duration.
Volume = 60 cm360\text{ cm}^3, Time = 30 seconds30\text{ seconds}.
These are the measured parameters required to calculate the average rate of reaction.
2
Calculate the average rate of reaction.
Rate=60 cm330 s=2.0 cm3 s1\text{Rate} = \frac{60\text{ cm}^3}{30\text{ s}} = 2.0\text{ cm}^3\text{ s}^{-1}.
The reaction rate measures the change in concentration or amount of a reactant or product per unit time.

Anahtar Kavram

Rate of Reaction Calculation
Soru 270Soru

Adamu and Zainab are partners in a firm. They agree to value the firm's goodwill on the basis of 33 years' purchase of the average super profit of the past 44 years. The net profits of the firm for the last 44 years were N45,000\mathcal{N}45,000, N55,000\mathcal{N}55,000, N60,000\mathcal{N}60,000, and N80,000\mathcal{N}80,000. The capital employed in the business is N400,000\mathcal{N}400,000, and the normal rate of return expected on capital employed in a similar business is 10%10\%. What is the value of the firm's goodwill in Naira?

Cevabı ve açıklamayı göster

Cevap: 60000

Cevap

The value of the firm's goodwill is 60,000 Naira.
Goodwill under the super profit method is obtained by taking the excess of average annual profits over normal expected profits and multiplying by the number of years' purchase. The average profit is 60,000 Naira and normal profit is 40,000 Naira (10% of 400,000 Naira). The super profit is 20,000 Naira, which when multiplied by 3 years' purchase gives 60,000 Naira.

Adım Adım Çözüm

1
Calculate the average annual profit of the firm over the 4-year period
Average profit = 60,000 Naira
Sum the total profits of the four years (240,000 Naira) and divide by 4.
2
Calculate the normal profit expected from the capital employed
Normal profit = 40,000 Naira
Multiply the capital employed (400,000 Naira) by the normal rate of return (10%).
3
Determine the super profit of the firm
Super profit = 20,000 Naira
Subtract normal profit (40,000 Naira) from average annual profit (60,000 Naira).
4
Compute goodwill using the 3 years' purchase multiplier
Goodwill = 60,000 Naira
Multiply the super profit (20,000 Naira) by the agreed 3 years' purchase.

Anahtar Kavram

Valuation of Goodwill using the Super Profit Method
Tahmini Süre:1m 30s
Soru 271Soru
In an industrial Contact Process plant, sulfur(IV) oxide (SO2SO_2) gas is catalytically oxidized to sulfur(VI) oxide (SO3SO_3) according to the equation:
2SO2(g)+O2(g)2SO3(g)2SO_2(g) + O_2(g) \rightleftharpoons 2SO_3(g)
If 67.2 dm367.2\text{ dm}^3 of SO2SO_2 measured at STP is reacted with excess oxygen gas, and the reaction achieves a 90%90\% conversion yield of SO3SO_3, what is the mass in grams of tetraoxosulfate(VI) acid (H2SO4H_2SO_4) produced when all the formed SO3SO_3 is absorbed in concentrated H2SO4H_2SO_4 and subsequently diluted with water? (Molar mass of H2SO4=98 g/molH_2SO_4 = 98\text{ g/mol}, molar volume of gas at STP =22.4 dm3/mol= 22.4\text{ dm}^3\text{/mol})
Cevabı ve açıklamayı göster

Cevap: 264.6

Cevap

264.6 g
The molar volume at STP (22.4 dm3/mol22.4\text{ dm}^3\text{/mol}) converts 67.2 dm367.2\text{ dm}^3 of SO2SO_2 into 3.0 moles3.0\text{ moles}. Accounting for the 90%90\% conversion efficiency yields 2.7 moles2.7\text{ moles} of SO3SO_3. Absorption of SO3SO_3 into concentrated H2SO4H_2SO_4 to form oleum (H2S2O7H_2S_2O_7) followed by dilution with water yields a 1:11:1 molar ratio of H2SO4H_2SO_4 relative to SO3SO_3. Multiplying 2.7 moles2.7\text{ moles} by the molar mass of H2SO4H_2SO_4 (98 g/mol98\text{ g/mol}) gives the correct mass of 264.6 g264.6\text{ g}.

Adım Adım Çözüm

1
Calculate the moles of SO2SO_2 gas at STP.
n(SO2)=67.2 dm322.4 dm3/mol=3.0 molesn(SO_2) = \frac{67.2\text{ dm}^3}{22.4\text{ dm}^3\text{/mol}} = 3.0\text{ moles}
Molar volume of any ideal gas at STP is 22.4 dm3/mol22.4\text{ dm}^3\text{/mol}.
2
Apply the 90%90\% conversion efficiency to find the moles of SO3SO_3 produced.
n(SO3)=3.0 mol×0.90=2.7 molesn(SO_3) = 3.0\text{ mol} \times 0.90 = 2.7\text{ moles}
Only 90%90\% of the reacted SO2SO_2 is converted to SO3SO_3 under operating conditions.
3
Relate the moles of SO3SO_3 to the moles of H2SO4H_2SO_4 produced.
n(H2SO4)=n(SO3)=2.7 molesn(H_2SO_4) = n(SO_3) = 2.7\text{ moles}
The absorption of SO3SO_3 into concentrated H2SO4H_2SO_4 forms oleum (H2S2O7H_2S_2O_7), which upon dilution with water yields H2SO4H_2SO_4 with an overall 1:11:1 stoichiometric molar equivalence to SO3SO_3.
4
Calculate the total mass of H2SO4H_2SO_4 formed.
Mass=2.7 mol×98 g/mol=264.6 g\text{Mass} = 2.7\text{ mol} \times 98\text{ g/mol} = 264.6\text{ g}
Mass equals number of moles multiplied by molar mass.

Anahtar Kavram

Stoichiometry of the Contact Process including STP gas conversion and oleum dilution stoichiometry
Soru 272Soru
Calculate the standard enthalpy of combustion of liquid carbon disulfide (CS2(l)\text{CS}_2(l)) in kJ mol1\text{kJ mol}^{-1}, given the following standard enthalpies of formation:
ΔHf[CS2(l)]=+88 kJ mol1\Delta H_f^\circ[\text{CS}_2(l)] = +88\text{ kJ mol}^{-1}
ΔHf[CO2(g)]=394 kJ mol1\Delta H_f^\circ[\text{CO}_2(g)] = -394\text{ kJ mol}^{-1}
ΔHf[SO2(g)]=297 kJ mol1\Delta H_f^\circ[\text{SO}_2(g)] = -297\text{ kJ mol}^{-1}
The balanced chemical equation for the combustion process is:
CS2(l)+3O2(g)CO2(g)+2SO2(g)\text{CS}_2(l) + 3\text{O}_2(g) \rightarrow \text{CO}_2(g) + 2\text{SO}_2(g)

What is the standard enthalpy change of combustion in kJ mol1\text{kJ mol}^{-1}?

Cevabı ve açıklamayı göster

Cevap: -1076

Cevap

The standard enthalpy of combustion of liquid carbon disulfide is -1076 kJ mol^-1.
Applying Hess's law using standard enthalpies of formation gives ΔH=ΔHf(products)ΔHf(reactants)\Delta H^\circ = \sum \Delta H_f^\circ(\text{products}) - \sum \Delta H_f^\circ(\text{reactants}). For the combustion of carbon disulfide, this evaluates to [(394)+2(297)](+88)=98888=1076 kJ mol1[(-394) + 2(-297)] - (+88) = -988 - 88 = -1076\text{ kJ mol}^{-1}.

Adım Adım Çözüm

1
Formulate the standard enthalpy of reaction equation using standard enthalpies of formation.
\Delta H^\circ = \sum n\Delta H_f^\circ(\text{products}) - \sum m\Delta H_f^\circ(\text{reactants})
According to Hess's Law, the net standard enthalpy change for a chemical process equals the sum of standard formation enthalpies of products minus reactants.
2
Substitute the provided standard enthalpy of formation values into the expression, taking into account stoichiometry.
\Delta H^\circ = [-394 + 2(-297)] - [88] = -1076\text{ kJ mol}^{-1}
Sulfur dioxide is formed with a mole ratio of 2, so its formation enthalpy must be doubled; oxygen gas has a formation enthalpy of zero.

Anahtar Kavram

Standard Enthalpy Changes and Hess's Law
Soru 273Soru
Consider the standard reduction potentials for the following two half-cell reactions:
Zn2+(aq)+2eZn(s)E=0.76 V\text{Zn}^{2+}(aq) + 2e^- \rightarrow \text{Zn}(s) \quad E^\circ = -0.76\text{ V}
Fe3+(aq)+3eFe(s)E=0.04 V\text{Fe}^{3+}(aq) + 3e^- \rightarrow \text{Fe}(s) \quad E^\circ = -0.04\text{ V}
What is the standard cell potential (EcellE^\circ_{\text{cell}}), in volts, for the spontaneous redox reaction represented by the balanced chemical equation:
3Zn(s)+2Fe3+(aq)3Zn2+(aq)+2Fe(s)3\text{Zn}(s) + 2\text{Fe}^{3+}(aq) \rightarrow 3\text{Zn}^{2+}(aq) + 2\text{Fe}(s)
Cevabı ve açıklamayı göster

Cevap: 0.72

Cevap

The standard cell potential for the spontaneous reaction is +0.72 V.
To calculate the standard cell potential (EcellE^\circ_{\text{cell}}), identify the cathode (reduction) and anode (oxidation) processes from the balanced chemical equation. Iron(III) ions are reduced to iron metal at the cathode (E=0.04 VE^\circ = -0.04\text{ V}), while zinc metal is oxidized to zinc ions at the anode (E=0.76 VE^\circ = -0.76\text{ V}). Using Ecell=EcathodeEanodeE^\circ_{\text{cell}} = E^\circ_{\text{cathode}} - E^\circ_{\text{anode}}, we calculate Ecell=0.04 V(0.76 V)=+0.72 VE^\circ_{\text{cell}} = -0.04\text{ V} - (-0.76\text{ V}) = +0.72\text{ V}. Because standard electrode potential is an intensive property, the stoichiometric coefficients (3 for Zn and 2 for Fe³⁺) do not alter the half-cell potentials.

Adım Adım Çözüm

1
Determine the oxidation and reduction species from the overall equation
Zinc is oxidized at the anode (ZnZn2++2e\text{Zn} \rightarrow \text{Zn}^{2+} + 2e^-), and Fe3+\text{Fe}^{3+} is reduced at the cathode (Fe3++3eFe\text{Fe}^{3+} + 3e^- \rightarrow \text{Fe}).
The equation shows elemental Zn losing electrons to form Zn2+\text{Zn}^{2+} and Fe3+\text{Fe}^{3+} gaining electrons to form Fe.
2
Recall that standard electrode potential is an intensive property
The values E(Zn2+/Zn)=0.76 VE^\circ(\text{Zn}^{2+}/\text{Zn}) = -0.76\text{ V} and E(Fe3+/Fe)=0.04 VE^\circ(\text{Fe}^{3+}/\text{Fe}) = -0.04\text{ V} remain unchanged regardless of stoichiometric coefficients.
Potential measures electrical potential energy per unit charge, which does not depend on the total amount of substance reacting.
3
Calculate the standard cell potential using Ecell=EcathodeEanodeE^\circ_{\text{cell}} = E^\circ_{\text{cathode}} - E^\circ_{\text{anode}}
Ecell=0.04 V(0.76 V)=+0.72 VE^\circ_{\text{cell}} = -0.04\text{ V} - (-0.76\text{ V}) = +0.72\text{ V}.
Subtracting the anode reduction potential from the cathode reduction potential yields the net electromotive force of the spontaneous cell.

Anahtar Kavram

Standard Cell Potential Calculation and Independence of E° from Stoichiometric Coefficients
Soru 274Soru

In an experiment to measure the rate of a chemical reaction, 0.50 g0.50\text{ g} of calcium carbonate reacts completely with excess dilute hydrochloric acid in 25 seconds25\text{ seconds}. What is the average rate of reaction with respect to the loss of mass of calcium carbonate in g s1\text{g s}^{-1}?

Cevabı ve açıklamayı göster

Cevap: 0.02

Cevap

The average rate of reaction with respect to the mass of calcium carbonate consumed is 0.02 g s10.02\text{ g s}^{-1}.
The average rate of a reaction is calculated as the ratio of the change in amount of reactant or product to the time taken. Substituting the given values gives Rate=0.50 g25 s=0.02 g s1\text{Rate} = \frac{0.50\text{ g}}{25\text{ s}} = 0.02\text{ g s}^{-1}.

Adım Adım Çözüm

1
Extract the given values from the problem statement.
Mass of CaCO3=0.50 g\text{CaCO}_3 = 0.50\text{ g}, Time =25 s= 25\text{ s}.
These parameters define the total change in quantity and the time interval for the reaction.
2
Calculate the average rate of reaction by dividing the change in mass by the time elapsed.
Rate=0.50 g25 s=0.02 g s1\text{Rate} = \frac{0.50\text{ g}}{25\text{ s}} = 0.02\text{ g s}^{-1}.
The rate of a chemical reaction measures how rapidly a reactant is consumed per unit time.

Anahtar Kavram

Rate of Reaction Calculation
Tahmini Süre:1m 0s
Soru 275Soru

Calculate the quantity of electricity, in Coulombs, transferred when a steady electric current of 5.0 A5.0\text{ A} is passed through an electrolytic cell for 20 minutes20\text{ minutes}.

Cevabı ve açıklamayı göster

Cevap: 6000

Cevap

The quantity of electricity transferred is 6000 C6000\text{ C}.
According to Faraday's laws of electrolysis, the total charge QQ passed through an electrolyte is calculated by Q=I×tQ = I \times t. Converting 20 minutes20\text{ minutes} to seconds gives 20×60=1200 s20 \times 60 = 1200\text{ s}. Multiplying by the current 5.0 A5.0\text{ A} gives Q=5.0×1200=6000 CQ = 5.0 \times 1200 = 6000\text{ C}.

Adım Adım Çözüm

1
Convert time from minutes to seconds
t=1200 st = 1200\text{ s}
Electric current in Amperes measures charge per second, so time must be converted to seconds.
2
Calculate electric charge using Q=I×tQ = I \times t
Q=6000 CQ = 6000\text{ C}
The quantity of electricity (QQ) in Coulombs equals current (II) in Amperes multiplied by time (tt) in seconds.

Anahtar Kavram

Calculation of Quantity of Electricity (Q=I×tQ = I \times t)
Soru 276Soru

An economy records a Gross Domestic Product (GDP) of 850 million Naira. The factor income earned by citizens from abroad is 30 million Naira, while factor income paid to foreigners within the domestic economy is 70 million Naira. If the capital consumption allowance (depreciation) is 65 million Naira, what is the Net National Product (NNP) of the country in million Naira?

Cevabı ve açıklamayı göster

Cevap: 745

Cevap

The Net National Product (NNP) of the country is 745 million Naira.
To determine the Net National Product (NNP), first calculate Net Factor Income from Abroad (NFIA) as factor income from abroad (3030 million Naira) minus factor income paid abroad (7070 million Naira), yielding 40-40 million Naira. Gross National Product (GNP) is then calculated as GDP+NFIA=850+(40)=810\text{GDP} + \text{NFIA} = 850 + (-40) = 810 million Naira. Finally, subtract capital consumption allowance (6565 million Naira) from GNP to get NNP=81065=745\text{NNP} = 810 - 65 = 745 million Naira.

Adım Adım Çözüm

1
Calculate Net Factor Income from Abroad (NFIA)
NFIA = 3070=4030 - 70 = -40 million Naira
Net Factor Income from Abroad is the difference between income received from abroad by residents and income paid to non-residents domestically.
2
Calculate Gross National Product (GNP)
GNP = 850+(40)=810850 + (-40) = 810 million Naira
GNP is obtained by adjusting GDP for Net Factor Income from Abroad.
3
Calculate Net National Product (NNP)
NNP = 81065=745810 - 65 = 745 million Naira
NNP is obtained by subtracting capital consumption allowance (depreciation) from GNP.

Anahtar Kavram

Calculation of Net National Product (NNP) from GDP, Net Factor Income from Abroad, and Depreciation
Soru 277Soru

In an energy profile diagram for a reversible chemical reaction, the potential energy of the reactants is 85 kJ mol185\text{ kJ mol}^{-1}, the potential energy of the products is 150 kJ mol1150\text{ kJ mol}^{-1}, and the peak potential energy of the activated complex is 235 kJ mol1235\text{ kJ mol}^{-1}. What is the activation energy of the reverse reaction in kJ mol1\text{kJ mol}^{-1}?

Cevabı ve açıklamayı göster

Cevap: 85

Cevap

The activation energy of the reverse reaction is 85 kJ mol185\text{ kJ mol}^{-1}.
The activation energy for the reverse reaction is the difference in potential energy between the activated complex at the peak and the products. Subtracting the potential energy of the products (150 kJ mol1150\text{ kJ mol}^{-1}) from the peak energy (235 kJ mol1235\text{ kJ mol}^{-1}) gives 85 kJ mol185\text{ kJ mol}^{-1}.

Adım Adım Çözüm

1
Identify key energy values from the reaction energy profile
Energy of activated complex = 235 kJ mol1235\text{ kJ mol}^{-1}, Energy of products = 150 kJ mol1150\text{ kJ mol}^{-1}.
The activation energy of the reverse reaction is defined as the energy required for products to reach the transition state (activated complex).
2
Calculate the reverse activation energy (Ea,reverseE_{a,\text{reverse}})
Ea,reverse=235 kJ mol1150 kJ mol1=85 kJ mol1E_{a,\text{reverse}} = 235\text{ kJ mol}^{-1} - 150\text{ kJ mol}^{-1} = 85\text{ kJ mol}^{-1}.
Subtracting the potential energy of the products from the peak potential energy yields the minimum energy barrier for the backward process.

Anahtar Kavram

Calculating reverse activation energy from potential energy levels
Soru 278Soru

The daily agricultural output (in tonnes) of a cassava farm over five consecutive days was recorded as 12, 15, 18, 15, and 20. What is the mean daily output of the farm in tonnes?

Cevabı ve açıklamayı göster

Cevap: 16

Cevap

The mean daily output of the farm is 16 tonnes.
The arithmetic mean is computed by adding all data values together (12+15+18+15+20=8012 + 15 + 18 + 15 + 20 = 80) and dividing by the total number of data points (55), which gives 80÷5=1680 \div 5 = 16 tonnes.

Adım Adım Çözüm

1
Calculate the total output by summing all daily figures.
12 + 15 + 18 + 15 + 20 = 80 tonnes
Finding the arithmetic mean requires calculating the aggregate total of all observations.
2
Divide the total output by the number of observations (days).
80 / 5 = 16 tonnes
The formula for the arithmetic mean of a sample is the sum of all values divided by the total number of values.

Anahtar Kavram

Arithmetic Mean of Ungrouped Data
Tahmini Süre:45s
Soru 279Soru

A commercial farm in Kaduna operates with fixed total resources of 1010 hectares of arable land and 120120 worker-hours of labor per day. Producing 11 ton of maize requires 11 hectare of land and 1212 worker-hours of labor. Producing 11 ton of yams requires 0.50.5 hectares of land and 2020 worker-hours of labor. Initially, the farm devotes all its resources to maximize maize production, harvesting 1010 tons of maize per day. If the farm owner decides to reallocate resources to produce 33 tons of yams per day, what is the opportunity cost of this decision expressed in tons of maize foregone?

Cevabı ve açıklamayı göster

Cevap: 5

Cevap

The opportunity cost of producing 3 tons of yams is 5 tons of maize.
Producing 3 tons of yams absorbs 60 worker-hours out of the total 120 worker-hours available. The remaining 60 worker-hours can only produce 5 tons of maize. Since initial maize production was 10 tons, the farm gives up 5 tons of maize (10 - 5 = 5 tons).

Adım Adım Çözüm

1
Calculate resources consumed by the production of 3 tons of yams.
Land consumed = 3×0.5=1.53 \times 0.5 = 1.5 hectares. Labor consumed = 3×20=603 \times 20 = 60 worker-hours.
Opportunity cost depends on the amount of productive inputs diverted away from maize production.
2
Determine the remaining inputs available for maize production.
Remaining land = 101.5=8.510 - 1.5 = 8.5 hectares. Remaining labor = 12060=60120 - 60 = 60 worker-hours.
Maize can only be produced using the unallocated land and labor inputs.
3
Identify the binding constraint for maize output.
Labor restricts maize output to 6012=5\frac{60}{12} = 5 tons (since land would permit 8.58.5 tons). Thus, maximum feasible maize output is 55 tons.
Production is restricted by the scarcest resource (labor).
4
Subtract the new maximum maize output from the initial maize output to find the opportunity cost.
10 tons5 tons=5 tons of maize foregone10 \text{ tons} - 5 \text{ tons} = 5 \text{ tons of maize foregone}.
Opportunity cost is defined as the quantity of the alternative good given up.

Anahtar Kavram

Opportunity cost with constrained multi-resource allocation
Soru 280Soru

A commercial farming enterprise in Oyo State uses its fixed land and labor resources to produce Cassava and Yam. The table below presents its monthly production possibility schedule:

CombinationCassava (bags)Yam (bags)
P1200
Q9045
R5080
S0100

What is the opportunity cost of increasing Yam production from 4545 bags to 8080 bags, expressed in bags of Cassava foregone?

Cevabı ve açıklamayı göster

Cevap: 40

Cevap

The opportunity cost of increasing Yam production from 45 bags to 80 bags is 40 bags of Cassava.
Increasing Yam production from 4545 bags to 8080 bags requires moving from Combination Q to Combination R. At Combination Q, Cassava production is 9090 bags, whereas at Combination R, Cassava production decreases to 5050 bags. The opportunity cost is the foregone Cassava production, calculated as 9050=4090 - 50 = 40 bags of Cassava.

Adım Adım Çözüm

1
Locate the initial production combination
At Combination Q, the firm produces 45 bags of Yam and 90 bags of Cassava.
Opportunity cost measures what must be sacrificed when shifting resources from one alternative to another.
2
Locate the target production combination
At Combination R, the firm produces 80 bags of Yam and 50 bags of Cassava.
Increasing Yam production from 45 to 80 bags requires moving along the schedule from Q to R.
3
Calculate the quantity of the sacrificed commodity (Cassava)
Opportunity Cost = 90 - 50 = 40 bags of Cassava.
The opportunity cost is the explicit quantity of Cassava sacrificed to gain the additional 35 bags of Yam.

Anahtar Kavram

Opportunity Cost from Production Schedule
ÖncekiSayfa 14 / 77Sonraki
Tüm alıştırma soruları — JAMB UTME | Examkin