Tüm alıştırma soruları

13931 soru

Soru 7621Soru

A fruit juice mixture is prepared by combining orange extract and water in the ratio 3:53 : 5. If a bottle contains 40 litres40\text{ litres} of this mixture, how many litres of water does it contain?

Cevabı ve açıklamayı göster

Cevap: 25

Cevap

The volume of water in the mixture is 25 litres.
The mixture ratio of orange extract to water is 3:53 : 5, giving a total of 3+5=83 + 5 = 8 equal parts. Dividing the total volume of 40 litres40\text{ litres} by 88 parts gives 5 litres5\text{ litres} per part. Since water makes up 55 parts of the ratio, its volume is 5×5=25 litres5 \times 5 = 25\text{ litres}.

Adım Adım Çözüm

1
Determine the total number of parts in the ratio.
3 + 5 = 8 parts
The full volume of the mixture is divided into equal portions represented by the sum of the ratio parts.
2
Calculate the volume per ratio part.
40 / 8 = 5 litres per part
Dividing the total volume by the total number of parts gives the size of a single part.
3
Find the quantity of water.
5 * 5 = 25 litres
Water accounts for 5 parts of the ratio, so multiply 5 parts by 5 litres per part.

Anahtar Kavram

Ratio Sharing and Proportional Division
Soru 7622Soru

Given the permutation equation nP4=42nP2{^{n}P_4} = 42 \cdot {^{n}P_2}, what is the positive integer value of nn?

Cevabı ve açıklamayı göster

Cevap: 9

Cevap

The positive integer value of nn is 99.
Expanding nP4{^{n}P_4} as n(n1)(n2)(n3)n(n-1)(n-2)(n-3) and nP2{^{n}P_2} as n(n1)n(n-1) transforms the equation to n(n1)(n2)(n3)=42n(n1)n(n-1)(n-2)(n-3) = 42n(n-1). Dividing both sides by n(n1)n(n-1) gives (n2)(n3)=42(n-2)(n-3) = 42, which simplifies to n25n36=0n^2 - 5n - 36 = 0. Factoring this quadratic gives (n9)(n+4)=0(n-9)(n+4) = 0. Since nn must be a positive integer greater than or equal to 44, the correct answer is 99.

Adım Adım Çözüm

1
Write out the expanded expressions for nP4{^{n}P_4} and nP2{^{n}P_2}.
nP4=n(n1)(n2)(n3){^{n}P_4} = n(n-1)(n-2)(n-3) and nP2=n(n1){^{n}P_2} = n(n-1).
By definition, nPr=n!(nr)!=n(n1)(nr+1){^{n}P_r} = \frac{n!}{(n-r)!} = n(n-1)\dots(n-r+1).
2
Set up the algebraic equation based on the given problem statement.
n(n1)(n2)(n3)=42n(n1)n(n-1)(n-2)(n-3) = 42n(n-1).
Substitute the expanded permutation formulas into the given identity.
3
Simplify the equation by dividing both sides by the non-zero common product n(n1)n(n-1).
(n2)(n3)=42(n-2)(n-3) = 42.
Since n4n \ge 4, n(n1)0n(n-1) \neq 0, so we can cancel these terms from both sides.
4
Expand and rearrange the resulting expression into a standard quadratic equation.
n25n36=0n^2 - 5n - 36 = 0.
Expanding (n2)(n3)(n-2)(n-3) gives n25n+6n^2 - 5n + 6; subtracting 4242 yields n25n36=0n^2 - 5n - 36 = 0.
5
Solve the quadratic equation for nn and discard non-physical roots.
n=9n = 9.
Factoring yields (n9)(n+4)=0(n-9)(n+4) = 0, so n=9n = 9 or n=4n = -4. A permutation requires nn to be a positive integer 4\ge 4, so n=9n = 9.

Anahtar Kavram

Solving algebraic equations involving permutations nPr=n!(nr)!{^{n}P_r} = \frac{n!}{(n-r)!}
Soru 7623Soru

Two independent events AA and BB in a sample space satisfy P(A)=25P(A') = \frac{2}{5} and P(AB)=710P(A \cup B) = \frac{7}{10}, where AA' denotes the complement of event AA. What is the probability that exactly one of the two events occurs?

Cevabı ve açıklamayı göster

Cevap: 1120\frac{11}{20}

Cevap

1120\frac{11}{20}
First, find P(A)=125=35P(A) = 1 - \frac{2}{5} = \frac{3}{5}. Since AA and BB are independent, P(AB)=P(A)P(B)P(A \cap B) = P(A)P(B). Using the addition law P(AB)=P(A)+P(B)P(A)P(B)P(A \cup B) = P(A) + P(B) - P(A)P(B), we substitute the values to get 710=35+P(B)(135)\frac{7}{10} = \frac{3}{5} + P(B)\left(1 - \frac{3}{5}\right), which gives P(B)=14P(B) = \frac{1}{4}. The probability of exactly one event occurring is P(A)P(B)+P(A)P(B)=35×34+25×14=1120P(A)P(B') + P(A')P(B) = \frac{3}{5} \times \frac{3}{4} + \frac{2}{5} \times \frac{1}{4} = \frac{11}{20}.

Adım Adım Çözüm

1
Calculate the probability of event A
P(A)=1P(A)=125=35P(A) = 1 - P(A') = 1 - \frac{2}{5} = \frac{3}{5}
The sum of the probabilities of an event and its complement equals 1.
2
Apply the addition law for independent events to find P(B)
P(AB)=P(A)+P(B)P(A)P(B)    710=35+P(B)(135)    P(B)=14P(A \cup B) = P(A) + P(B) - P(A)P(B) \implies \frac{7}{10} = \frac{3}{5} + P(B)\left(1 - \frac{3}{5}\right) \implies P(B) = \frac{1}{4}
For independent events, the intersection probability is P(AB)=P(A)P(B)P(A \cap B) = P(A)P(B).
3
Calculate the complement of event B
P(B)=1P(B)=114=34P(B') = 1 - P(B) = 1 - \frac{1}{4} = \frac{3}{4}
The complement of event B represents the event that B does not occur.
4
Compute the probability that exactly one event occurs
P(exactly one)=P(AB)+P(AB)=P(A)P(B)+P(A)P(B)=(35×34)+(25×14)=920+220=1120P(\text{exactly one}) = P(A \cap B') + P(A' \cap B) = P(A)P(B') + P(A')P(B) = \left(\frac{3}{5} \times \frac{3}{4}\right) + \left(\frac{2}{5} \times \frac{1}{4}\right) = \frac{9}{20} + \frac{2}{20} = \frac{11}{20}
The occurrence of exactly one event means either A occurs and B does not, or A does not occur and B occurs.

Anahtar Kavram

Compound Probability and Probability Laws for Independent Events
Tahmini Süre:2m 0s
Soru 7624Soru

A trader bought a quantity of palm oil. He sold 13\frac{1}{3} of the total quantity at a profit of 20%20\%, 12\frac{1}{2} of the remaining palm oil at a loss of 10%10\%, and the rest of the palm oil at a profit of x%x\%. If his overall profit on the entire transaction was 15%15\%, what is the value of xx?

Cevabı ve açıklamayı göster

Cevap: 35

Cevap

The value of xx is 3535.
The palm oil is divided into three equal portions of 13\frac{1}{3} each. The first portion contributes 203%\frac{20}{3}\% profit, the second portion contributes a loss of 103%-\frac{10}{3}\%, and the final portion contributes x3%\frac{x}{3}\% profit. Summing these contributions yields 10+x3%\frac{10 + x}{3}\%. Equating this to the target overall profit of 15%15\% gives 10+x=4510 + x = 45, which solves to x=35x = 35.

Adım Adım Çözüm

1
Determine the fractional portion of palm oil sold at each stage.
First portion = 13\frac{1}{3}. Remaining after first sale = 113=231 - \frac{1}{3} = \frac{2}{3}. Second portion = 12×23=13\frac{1}{2} \times \frac{2}{3} = \frac{1}{3}. Final portion = 1(13+13)=131 - \left(\frac{1}{3} + \frac{1}{3}\right) = \frac{1}{3}.
Finding the exact fraction of the total quantity sold at each step is necessary to weight their respective profit/loss rates correctly.
2
Formulate the net percentage profit equation.
\text{Net Profit } \% = \left(\frac{1}{3} \times 20\%\right) + \left(\frac{1}{3} \times (-10\%)\right) + \left(\frac{1}{3} \times x\%\right) = \frac{20 - 10 + x}{3}\% = \frac{10 + x}{3}\%
The overall profit percentage is the sum of individual fractional contributions, treating loss as a negative percentage.
3
Set the net profit equal to 15%15\% and solve for xx.
\frac{10 + x}{3} = 15 \implies 10 + x = 45 \implies x = 35
Solving this linear equation gives the required profit percentage for the final portion.

Anahtar Kavram

Weighted Average Profit and Loss across fractional components of an asset
Tahmini Süre:2m 0s
Soru 7625Soru

The physical quantity work is defined as the product of force and displacement. What are the dimensional exponents aa, bb, and cc for mass, length, and time respectively in the dimensional formula for work, [MaLbTc][M^a L^b T^c]?

Cevabı ve açıklamayı göster

Cevap: 1,2,21, 2, -2

Cevap

The dimensional exponents for mass, length, and time in the expression for work are a=1a = 1, b=2b = 2, and c=2c = -2.
Work is calculated as force multiplied by displacement. Since force has dimensions [MLT2][M L T^{-2}] and displacement has dimension [L][L], the resulting dimensional formula for work is [M1L2T2][M^1 L^2 T^{-2}]. The exponents of MM, LL, and TT are therefore 11, 22, and 2-2 respectively.

Adım Adım Çözüm

1
Express the dimensions of force using base quantities
\text{Force} = \text{mass} \times \text{acceleration} = [M] \times [L T^{-2}] = [M L T^{-2}]
Acceleration has the dimensions of length divided by time squared.
2
Multiply force dimensions by displacement dimension to find the dimensions of work
\text{Work} = \text{Force} \times \text{Displacement} = [M L T^{-2}] \times [L] = [M^1 L^2 T^{-2}]
Displacement is a measure of length, contributing an additional factor of [L][L].
3
Extract the exponents aa, bb, and cc
a = 1, b = 2, c = -2
Comparing [MaLbTc][M^a L^b T^c] to [M1L2T2][M^1 L^2 T^{-2}] gives the values of aa, bb, and cc.

Anahtar Kavram

Dimensional analysis of work
Soru 7626Soru

Two point charges produce mutually perpendicular electric fields at a point PP in a vacuum. If the magnitudes of the electric field intensities at PP due to the charges individually are 30 N C130\text{ N C}^{-1} and 40 N C140\text{ N C}^{-1}, what is the magnitude of the net electric field intensity at point PP?

Cevabı ve açıklamayı göster

Cevap: 50 N C150\text{ N C}^{-1}

Cevap

The magnitude of the net electric field intensity at point PP is 50 N C150\text{ N C}^{-1}.
Because electric field intensity is a vector quantity, two mutually perpendicular electric fields E1=30 N C1E_1 = 30\text{ N C}^{-1} and E2=40 N C1E_2 = 40\text{ N C}^{-1} combine vectorially according to Enet=E12+E22=302+402=50 N C1E_{\text{net}} = \sqrt{E_1^2 + E_2^2} = \sqrt{30^2 + 40^2} = 50\text{ N C}^{-1}.

Adım Adım Çözüm

1
Identify the vector nature and orientation of the given electric fields.
The two component fields E1=30 N C1E_1 = 30\text{ N C}^{-1} and E2=40 N C1E_2 = 40\text{ N C}^{-1} are perpendicular to each other (θ=90\theta = 90^\circ).
Electric field intensity is a vector quantity, so perpendicular vectors must be combined using vector addition.
2
Apply the Pythagorean theorem to calculate the resultant vector magnitude.
Enet=E12+E22=302+402=900+1600=2500=50 N C1E_{\text{net}} = \sqrt{E_1^2 + E_2^2} = \sqrt{30^2 + 40^2} = \sqrt{900 + 1600} = \sqrt{2500} = 50\text{ N C}^{-1}.
When two vectors meet at a right angle, the magnitude of their resultant is the hypotenuse of the right-angled triangle formed by the vector components.

Anahtar Kavram

Vector Addition of Electric Fields (Superposition Principle)
Tahmini Süre:1m 0s
Soru 7627Soru

What is the canonical non-negative remainder when 345113^{45} - 11 is divided by 77?

Cevabı ve açıklamayı göster

Cevap: 2

Cevap

The correct answer is 2.
Using modular exponentiation, 33=271(mod7)3^3 = 27 \equiv -1 \pmod{7}, so 345=(33)15(1)15=1(mod7)3^{45} = (3^3)^{15} \equiv (-1)^{15} = -1 \pmod{7}. Subtracting 11 yields 111=12(mod7)-1 - 11 = -12 \pmod{7}. Adding 14 (a multiple of 7) gives 12+14=2-12 + 14 = 2, which is the canonical non-negative remainder.

Adım Adım Çözüm

1
Evaluate 345(mod7)3^{45} \pmod{7} using power rules
3451(mod7)3^{45} \equiv -1 \pmod{7}
Since 33=271(mod7)3^3 = 27 \equiv -1 \pmod{7}, raising both sides to the power of 15 gives (33)15(1)15=1(mod7)(3^3)^{15} \equiv (-1)^{15} = -1 \pmod{7}.
2
Subtract 11 from the modular result
-12 \pmod{7}
Replacing 3453^{45} with 1-1 gives 111=12-1 - 11 = -12.
3
Reduce -12 to its canonical non-negative remainder in [0,6][0, 6]
2
Adding the smallest multiple of 7 that makes the result non-negative gives 12+14=2-12 + 14 = 2.

Anahtar Kavram

Modular Exponentiation and Negative Remainder Reduction
Soru 7628Soru

In a survey of 120120 tech entrepreneurs at an innovation hub, 6565 secured Angel Investment (AA), 5555 received Venture Capital (VV), and 5050 obtained Government Grants (GG). Furthermore, 2525 received both AA and VV, 2020 received both VV and GG, 2222 received both AA and GG, while 1212 received no funding from any of these three sources. How many entrepreneurs secured funding from exactly two of these sources?

Cevabı ve açıklamayı göster

Cevap: 52

Cevap

The number of entrepreneurs who secured funding from exactly two sources is 52.
Subtracting the 1212 unfunded entrepreneurs from the total 120120 yields 108108 funded entrepreneurs. Applying inclusion-exclusion gives 108=65+55+50(25+20+22)+n(AVG)108 = 65 + 55 + 50 - (25 + 20 + 22) + n(A \cap V \cap G), which gives n(AVG)=5n(A \cap V \cap G) = 5. Subtracting 55 from each pairwise intersection yields 2020, 1515, and 1717 for entrepreneurs receiving funding from exactly two sources. Summing these gives 5252.

Adım Adım Çözüm

1
Determine the cardinality of the union of all three funding sets
n(AVG)=108n(A \cup V \cup G) = 108
Subtracting the 12 unfunded entrepreneurs from the universal set of 120 gives the total number of entrepreneurs who received at least one form of funding.
2
Solve for the number of entrepreneurs who received funding from all three sources using inclusion-exclusion
n(AVG)=5n(A \cap V \cap G) = 5
Using n(AVG)=n(A)+n(V)+n(G)n(AV)n(VG)n(AG)+n(AVG)n(A \cup V \cup G) = n(A) + n(V) + n(G) - n(A \cap V) - n(V \cap G) - n(A \cap G) + n(A \cap V \cap G), we get 108=65+55+50252022+x108 = 65 + 55 + 50 - 25 - 20 - 22 + x, which simplifies to 108=103+x108 = 103 + x, giving x=5x = 5.
3
Calculate the count for each region representing exactly two funding sources
Only AV=20A \cap V = 20, Only VG=15V \cap G = 15, Only AG=17A \cap G = 17
Subtracting the 3-set intersection (x=5x = 5) from each pairwise intersection isolates the elements belonging to strictly two sets.
4
Sum the three strictly two-set regions
20+15+17=5220 + 15 + 17 = 52
Adding the individual counts for the three disjoint regions gives the total number of entrepreneurs who received funding from exactly two sources.

Anahtar Kavram

Principle of Inclusion-Exclusion for three sets and cardinal partitioning of Venn diagrams
Soru 7629Soru

The frequency table below shows the fuel efficiency, measured in km/L\text{km/L}, for a fleet of 5050 delivery vans operated by a logistics company:

Fuel Efficiency (km/L)Frequency (ff)
10 – 148
15 – 1912
20 – 2420
25 – 2910

What is the mean fuel efficiency of the fleet, in km/L\text{km/L}?

Cevabı ve açıklamayı göster

Cevap: 20.2

Cevap

The mean fuel efficiency of the fleet is 20.2 km/L.
The estimated mean is found by calculating the midpoint of each class interval, multiplying each midpoint by its class frequency, summing these products to get 1010, and dividing by the total frequency of 50, resulting in 20.2 km/L.

Adım Adım Çözüm

1
Determine the midpoint (x) for each class interval.
Midpoints are 12 for 10–14, 17 for 15–19, 22 for 20–24, and 27 for 25���29.
For grouped frequency data, each class interval is represented by its midpoint x = (lower limit + upper limit) / 2.
2
Compute the product of frequency and midpoint (f * x) for each interval.
Products: (8 * 12) = 96, (12 * 17) = 204, (20 * 22) = 440, (10 * 27) = 270.
To calculate the total contribution of values from each class interval.
3
Sum all products (sum of f * x) and divide by the total number of delivery vans (sum of f).
sum of f * x = 96 + 204 + 440 + 270 = 1010. sum of f = 50. Mean = 1010 / 50 = 20.2.
The formula for the estimated mean of grouped data is mean = (sum of f * x) / (sum of f).

Anahtar Kavram

Measures of Central Tendency for Grouped Data (Grouped Mean)
Soru 7630Soru

Using differentiation from first principles, which expression represents the derivative dydx\frac{\mathrm{d}y}{\mathrm{d}x} of the function f(x)=2xf(x) = \frac{2}{x}, where x0x \neq 0?

Cevabı ve açıklamayı göster

Cevap: 2x2-\frac{2}{x^2}

Cevap

2x2-\frac{2}{x^2}
The option stating 2x2-\frac{2}{x^2} is correct because applying the first principles limit formula limh02x+h2xh\lim_{h \to 0} \frac{\frac{2}{x+h} - \frac{2}{x}}{h} gives limh02hhx(x+h)=limh02x(x+h)=2x2\lim_{h \to 0} \frac{-2h}{h x(x+h)} = \lim_{h \to 0} \frac{-2}{x(x+h)} = -\frac{2}{x^2}.

Adım Adım Çözüm

1
Set up the difference quotient definition of derivative from first principles.
dydx=limh0f(x+h)f(x)h\frac{\mathrm{d}y}{\mathrm{d}x} = \lim_{h \to 0} \frac{f(x+h) - f(x)}{h}
First principles definition states that the derivative is the limit of the rate of change as hh approaches zero.
2
Substitute f(x)=2xf(x) = \frac{2}{x} and f(x+h)=2x+hf(x+h) = \frac{2}{x+h} into the formula.
\frac{f(x+h) - f(x)}{h} = \frac{\frac{2}{x+h} - \frac{2}{x}}{h}
Replacing the function expressions yields the explicit algebraic fraction.
3
Combine the fractions in the numerator over a common denominator.
\frac{2x - 2(x+h)}{x(x+h) \cdot h} = \frac{2x - 2x - 2h}{h x(x+h)} = \frac{-2h}{h x(x+h)}
Simplifying the numerator yields a factor of hh that can be cancelled with the denominator.
4
Cancel the common factor hh and evaluate the limit as h0h \to 0.
\lim_{h \to 0} \frac{-2}{x(x+h)} = \frac{-2}{x(x+0)} = -\frac{2}{x^2}
Dividing out hh allows direct substitution of h=0h = 0 without producing an indeterminate form.

Anahtar Kavram

Differentiation from First Principles for Reciprocal Functions
Tahmini Süre:1m 30s
Soru 7631Soru

A car moves 80 km80\text{ km} due East along a straight highway and then turns to travel 60 km60\text{ km} due North. What is the magnitude of the displacement of the car from its starting position?

Cevabı ve açıklamayı göster

Cevap: 100 km100\text{ km}

Cevap

The magnitude of the displacement is 100 km100\text{ km}.
Because displacement is a vector quantity, perpendicular components must be combined vectorially using the Pythagorean theorem rather than scalar addition. The calculation 802+602=100 km\sqrt{80^2 + 60^2} = 100\text{ km} correctly yields the magnitude of the net displacement vector.

Adım Adım Çözüm

1
Identify the vector components and their directions.
Eastward displacement x=80 kmx = 80\text{ km}, Northward displacement y=60 kmy = 60\text{ km}. The directions are mutually perpendicular (9090^\circ to each other).
Displacement is a vector quantity, so direction must be accounted for when combining components.
2
Apply the Pythagorean theorem to calculate the resultant vector magnitude.
R=x2+y2=802+602=6400+3600=10000=100 kmR = \sqrt{x^2 + y^2} = \sqrt{80^2 + 60^2} = \sqrt{6400 + 3600} = \sqrt{10000} = 100\text{ km}.
When two vector components act at right angles (9090^\circ), the magnitude of their resultant is given by the hypotenuse of the right-angled triangle formed by the vectors.

Anahtar Kavram

Vector Addition of Perpendicular Components
Soru 7632Soru

What are the coordinates of the point on the curve y=2x25x+1y = 2x^2 - 5x + 1 where the tangent line is perpendicular to the line x+3y4=0x + 3y - 4 = 0?

Cevabı ve açıklamayı göster

Cevap: (2,1)(2, -1)

Cevap

The point on the curve is (2,1)(2, -1).
Rearranging the line equation x+3y4=0x + 3y - 4 = 0 gives a gradient of 13-\frac{1}{3}. The tangent line is perpendicular, so its gradient must be 33. Differentiating y=2x25x+1y = 2x^2 - 5x + 1 gives dydx=4x5\frac{dy}{dx} = 4x - 5. Setting 4x5=34x - 5 = 3 gives x=2x = 2. Substituting x=2x = 2 into the curve equation yields y=2(2)25(2)+1=1y = 2(2)^2 - 5(2) + 1 = -1. Thus, the point is (2,1)(2, -1).

Adım Adım Çözüm

1
Determine the gradient of the given line.
Rearranging x+3y4=0x + 3y - 4 = 0 into slope-intercept form gives y=13x+43y = -\frac{1}{3}x + \frac{4}{3}, so the gradient is m1=13m_1 = -\frac{1}{3}.
The slope of a linear equation Ax+By+C=0Ax + By + C = 0 is AB-\frac{A}{B}.
2
Calculate the gradient of the tangent line.
Since the tangent line is perpendicular to the given line, its gradient is mT=1m1=3m_T = -\frac{1}{m_1} = 3.
Perpendicular lines have gradients whose product is 1-1 (m1m2=1m_1 \cdot m_2 = -1).
3
Find the derivative of the curve and set it equal to the tangent gradient.
dydx=ddx(2x25x+1)=4x5\frac{dy}{dx} = \frac{d}{dx}(2x^2 - 5x + 1) = 4x - 5. Setting 4x5=34x - 5 = 3 yields 4x=8    x=24x = 8 \implies x = 2.
The derivative dydx\frac{dy}{dx} gives the gradient of the tangent to the curve at any point xx.
4
Substitute the xx-coordinate into the original curve equation to find yy.
y=2(2)25(2)+1=810+1=1y = 2(2)^2 - 5(2) + 1 = 8 - 10 + 1 = -1.
The point lies on the curve, so its coordinates must satisfy the curve's equation.

Anahtar Kavram

Tangents and Normals to Curves
Soru 7633Soru

Two identical point charges, q1=+5.0×106 Cq_1 = +5.0 \times 10^{-6}\text{ C} and q2=+5.0×106 Cq_2 = +5.0 \times 10^{-6}\text{ C}, are fixed in a vacuum at Cartesian coordinates (0 m,3.0 m)(0\text{ m}, 3.0\text{ m}) and (0 m,3.0 m)(0\text{ m}, -3.0\text{ m}), respectively. A third point charge q3=+2.0×106 Cq_3 = +2.0 \times 10^{-6}\text{ C} is placed on the x-axis at (4.0 m,0 m)(4.0\text{ m}, 0\text{ m}). Taking Coulomb's constant k=9.0×109 N m2 C2k = 9.0 \times 10^9\text{ N m}^2\text{ C}^{-2}, what is the magnitude of the net electrostatic force exerted on q3q_3?

Cevabı ve açıklamayı göster

Cevap: 5.76×103 N5.76 \times 10^{-3}\text{ N}

Cevap

The magnitude of the net electrostatic force exerted on q3q_3 is 5.76×103 N5.76 \times 10^{-3}\text{ N}.
Each charge exerts a repulsive force of magnitude 3.60×103 N3.60 \times 10^{-3}\text{ N} along the line connecting it to the test charge at (4.0 m,0 m)(4.0\text{ m}, 0\text{ m}). Because of symmetry, the y-components of the two forces cancel out completely while their x-components add constructively. Multiplying the individual force magnitude by the cosine of the angle with the x-axis (cosθ=0.8\cos\theta = 0.8) and doubling for both charges gives a net force of 5.76×103 N5.76 \times 10^{-3}\text{ N}.

Adım Adım Çözüm

1
Calculate the straight-line distance rr from q1q_1 (or q2q_2) to q3q_3.
r=(4.00)2+(03.0)2=16+9=5.0 mr = \sqrt{(4.0 - 0)^2 + (0 - 3.0)^2} = \sqrt{16 + 9} = 5.0\text{ m}.
Coulomb's Law requires the straight-line separation distance between interacting point charges.
2
Calculate the magnitude of the electrostatic force F1F_1 exerted on q3q_3 by q1q_1.
F1=kq1q3r2=(9.0×109)(5.0×106)(2.0×106)5.02=9.0×10225=3.60×103 NF_1 = \frac{k \cdot q_1 \cdot q_3}{r^2} = \frac{(9.0 \times 10^9) \cdot (5.0 \times 10^{-6}) \cdot (2.0 \times 10^{-6})}{5.0^2} = \frac{9.0 \times 10^{-2}}{25} = 3.60 \times 10^{-3}\text{ N}.
By symmetry, the force magnitude F2F_2 from q2q_2 on q3q_3 is also equal to 3.60×103 N3.60 \times 10^{-3}\text{ N}.
3
Determine the vector components of the forces along the axes.
The cosine of the angle θ\theta with the positive x-axis is cosθ=4.05.0=0.8\cos\theta = \frac{4.0}{5.0} = 0.8. The sine is sinθ=3.05.0=0.6\sin\theta = \frac{3.0}{5.0} = 0.6. The vertical y-components are equal in magnitude and opposite in direction (F1y=F2yF_{1y} = -F_{2y}), canceling to zero.
Forces are vector quantities; symmetrically placed identical charges produce opposing vertical components and reinforcing horizontal components.
4
Sum the horizontal x-components to obtain the net force.
Fnet=F1x+F2x=2F1cosθ=2(3.60×103 N)0.8=5.76×103 NF_{\text{net}} = F_{1x} + F_{2x} = 2 \cdot F_1 \cos\theta = 2 \cdot (3.60 \times 10^{-3}\text{ N}) \cdot 0.8 = 5.76 \times 10^{-3}\text{ N}.
Both x-components point along the positive x-axis, so their magnitudes add directly.

Anahtar Kavram

Vector superposition of electric forces
Soru 7634Soru

What is the determinant of the matrix A=(6321)A = \begin{pmatrix} 6 & -3 \\ 2 & 1 \end{pmatrix}?

Cevabı ve açıklamayı göster

Cevap: 12

Cevap

12
For any 2×22 \times 2 matrix (abcd)\begin{pmatrix} a & b \\ c & d \end{pmatrix}, the determinant is given by adbcad - bc. Substituting a=6a = 6, b=3b = -3, c=2c = 2, and d=1d = 1 yields (6)(1)(3)(2)=6(6)=12(6)(1) - (-3)(2) = 6 - (-6) = 12.

Adım Adım Çözüm

1
Identify the elements of the 2x2 matrix A=(abcd)A = \begin{pmatrix} a & b \\ c & d \end{pmatrix}
a=6a = 6, b=3b = -3, c=2c = 2, d=1d = 1
Standard entries for determinant formula det(A)=adbc\det(A) = ad - bc.
2
Compute the product of the main diagonal elements (adad) and off-diagonal elements (bcbc)
ad=(6)(1)=6ad = (6)(1) = 6 and bc=(3)(2)=6bc = (-3)(2) = -6
These form the components of the 2x2 determinant formula.
3
Subtract bcbc from adad
det(A)=6(6)=6+6=12\det(A) = 6 - (-6) = 6 + 6 = 12
Subtracting a negative quantity is equivalent to addition.

Anahtar Kavram

Determinant of a 2x2 Matrix
Tahmini Süre:45s
Soru 7635Soru

A laboratory technician recorded the temperature changes (in °C) of a chemical reaction across five trials as 33, 66, 77, 99, and 1515. What is the variance of this set of data?

Cevabı ve açıklamayı göster

Cevap: 16

Cevap

The variance of the temperature changes is 16.
The mean of the given numbers is xˉ=3+6+7+9+155=8\bar{x} = \frac{3 + 6 + 7 + 9 + 15}{5} = 8. The squared deviations from the mean are (38)2=25(3-8)^2 = 25, (68)2=4(6-8)^2 = 4, (78)2=1(7-8)^2 = 1, (98)2=1(9-8)^2 = 1, and (158)2=49(15-8)^2 = 49. Summing these squared deviations gives 25+4+1+1+49=8025 + 4 + 1 + 1 + 49 = 80. Dividing by the number of observations N=5N = 5 yields the variance: 805=16\frac{80}{5} = 16.

Adım Adım Çözüm

1
Calculate the arithmetic mean (\bar{x}) of the dataset.
\bar{x} = \frac{3 + 6 + 7 + 9 + 15}{5} = 8
The mean is required to determine the deviation of each individual value from the central value.
2
Compute the square of the deviation for each data point from the mean.
(3-8)^2 = 25, (6-8)^2 = 4, (7-8)^2 = 1, (9-8)^2 = 1, (15-8)^2 = 49
Squaring deviations ensures all values are positive and emphasizes larger departures from the mean.
3
Sum the squared deviations and divide by the total number of observations (N = 5).
\text{Variance} = \frac{25 + 4 + 1 + 1 + 49}{5} = \frac{80}{5} = 16
Variance measures the average of the squared deviations from the mean.

Anahtar Kavram

Population Variance for Ungrouped Data
Soru 7636Soru

In a survey of 100100 book club members regarding their reading preferences among Science Fiction (SS), Mystery (MM), and Historical Fiction (HH), it was found that 4848 read Science Fiction, 4242 read Mystery, and 3838 read Historical Fiction. Furthermore, 1818 read both Science Fiction and Mystery, 1515 read both Science Fiction and Historical Fiction, 1414 read both Mystery and Historical Fiction, and 88 read all three genres. How many of the members read exactly one of these three genres?

Cevabı ve açıklamayı göster

Cevap: 58

Cevap

The number of members who read exactly one of the three genres is 5858.
By isolating the disjoint regions of the 3-set Venn diagram, the number of members reading only Science Fiction is 2323, only Mystery is 1818, and only Historical Fiction is 1717. Adding these disjoint sets yields 5858.

Adım Adım Çözüm

1
Determine exclusive two-set intersection regions
n(SM only)=10n(S \cap M \text{ only}) = 10, n(SH only)=7n(S \cap H \text{ only}) = 7, n(MH only)=6n(M \cap H \text{ only}) = 6
The given pairwise totals include members who read all three genres, so subtracting n(SMH)=8n(S \cap M \cap H) = 8 isolates those in exactly two sets.
2
Determine exclusive single-set regions
n(S only)=23n(S \text{ only}) = 23, n(M only)=18n(M \text{ only}) = 18, n(H only)=17n(H \text{ only}) = 17
Subtracting all overlapping regions within each set's boundary gives the number of members reading only that specific genre.
3
Sum the single-set regions
23+18+17=5823 + 18 + 17 = 58
The set of members reading exactly one genre is the disjoint union of the three exclusive single-set regions.

Anahtar Kavram

3-Set Venn Diagram Cardinality and Disjoint Region Analysis
Soru 7637Soru

A fair six-sided die is rolled 150150 times in a probability experiment. If the number 44 lands face up 3535 times, what is the positive difference between the experimental probability and the theoretical probability of rolling a 44?

Cevabı ve açıklamayı göster

Cevap: 115\frac{1}{15}

Cevap

The positive difference between the experimental probability and the theoretical probability is 115\frac{1}{15}.
The theoretical probability of getting a 4 on a fair die is 16\frac{1}{6}, which simplifies to 530\frac{5}{30}. The experimental probability from 3535 successes out of 150150 trials is 35150=730\frac{35}{150} = \frac{7}{30}. Taking the positive difference yields 730530=230=115\frac{7}{30} - \frac{5}{30} = \frac{2}{30} = \frac{1}{15}.

Adım Adım Çözüm

1
Calculate the theoretical probability of rolling a 4 on a fair six-sided die
P(theoretical)=16P(\text{theoretical}) = \frac{1}{6}
A fair six-sided die has 6 equally likely outcomes, and exactly one outcome is 4.
2
Calculate the experimental probability based on the experiment results
P(experimental)=35150=730P(\text{experimental}) = \frac{35}{150} = \frac{7}{30}
Experimental probability is the ratio of successful trials (35) to the total number of trials (150).
3
Subtract the theoretical probability from the experimental probability to find the positive difference
Difference=73016=730530=230=115\text{Difference} = \frac{7}{30} - \frac{1}{6} = \frac{7}{30} - \frac{5}{30} = \frac{2}{30} = \frac{1}{15}
Converting to a common denominator of 30 allows straightforward subtraction.

Anahtar Kavram

Comparing experimental probability (relative frequency from trials) to theoretical probability (expected frequency based on equally likely outcomes).
Soru 7638Soru

Find the smallest positive value of θ\theta, in degrees, that satisfies the trigonometric equation 2sin(3θ30)=32\sin(3\theta - 30^\circ) = \sqrt{3}.

Cevabı ve açıklamayı göster

Cevap: 30

Cevap

The smallest positive angle θ\theta is 3030^\circ.
To find the smallest positive value of θ\theta, first isolate the sine function by dividing both sides by 2 to obtain sin(3θ30)=32\sin(3\theta - 30^\circ) = \frac{\sqrt{3}}{2}. The smallest positive angle with a sine of 32\frac{\sqrt{3}}{2} is 6060^\circ. Setting 3θ30=603\theta - 30^\circ = 60^\circ yields 3θ=903\theta = 90^\circ, which gives θ=30\theta = 30^\circ.

Adım Adım Çözüm

1
Isolate the trigonometric ratio
sin(3θ30)=32\sin(3\theta - 30^\circ) = \frac{\sqrt{3}}{2}
Dividing both sides of 2sin(3θ30)=32\sin(3\theta - 30^\circ) = \sqrt{3} by 2 simplifies the equation into standard form.
2
Determine the primary angle solution
3θ30=603\theta - 30^\circ = 60^\circ
The smallest positive angle whose sine equals 32\frac{\sqrt{3}}{2} is 6060^\circ.
3
Solve the linear equation for θ\theta
θ=30\theta = 30^\circ
Adding 3030^\circ to both sides gives 3θ=903\theta = 90^\circ, and dividing by 3 yields θ=30\theta = 30^\circ.

Anahtar Kavram

Solving Trigonometric Equations with Linear Argument Transformations
Soru 7639Soru

Three point charges q1=+2.0×106 Cq_1 = +2.0 \times 10^{-6}\text{ C}, q2=+2.0×106 Cq_2 = +2.0 \times 10^{-6}\text{ C}, and q3=4.0×106 Cq_3 = -4.0 \times 10^{-6}\text{ C} are placed along a straight line at positions x=0 mx = 0\text{ m}, x=0.30 mx = 0.30\text{ m}, and x=0.60 mx = 0.60\text{ m}, respectively. Taking Coulomb's constant k=9.0×109 N m2 C2k = 9.0 \times 10^9\text{ N m}^2\text{ C}^{-2}, calculate the magnitude of the net electrostatic force acting on charge q2q_2 in newtons.

Cevabı ve açıklamayı göster

Cevap: 1.2

Cevap

The magnitude of the net electrostatic force acting on charge q2q_2 is 1.20 N1.20\text{ N}.
The force exerted on q2q_2 by q1q_1 is repulsive (0.40 N0.40\text{ N} directed to the right) because both charges are positive. The force exerted on q2q_2 by q3q_3 is attractive (0.80 N0.80\text{ N} directed to the right) because q2q_2 is positive and q3q_3 is negative. Since both component forces act in the same direction, the total net force magnitude is 0.40 N+0.80 N=1.20 N0.40\text{ N} + 0.80\text{ N} = 1.20\text{ N}.

Adım Adım Çözüm

1
Calculate the repulsive force exerted by q1q_1 on q2q_2
F12=0.40 NF_{12} = 0.40\text{ N} pointing to the right
Like charges repel each other, so q1q_1 pushes q2q_2 away along the +x+x-axis.
2
Calculate the attractive force exerted by q3q_3 on q2q_2
F32=0.80 NF_{32} = 0.80\text{ N} pointing to the right
Unlike charges attract each other, so q3q_3 pulls q2q_2 towards itself along the +x+x-axis.
3
Sum the component electrostatic forces acting on q2q_2
Fnet=0.40 N+0.80 N=1.20 NF_{\text{net}} = 0.40\text{ N} + 0.80\text{ N} = 1.20\text{ N}
Because both forces act in the exact same direction along the line, their magnitudes add directly.

Anahtar Kavram

Coulomb's Law and Principle of Superposition for Electrostatic Forces
Soru 7640Soru

A binary operation Δ\Delta is defined on the set of real numbers R\mathbb{R} by aΔb=a+3b2aba \Delta b = a + 3b - 2ab. If (3Δx)Δ1=7(3 \Delta x) \Delta 1 = 7, what is the value of xx?

Cevabı ve açıklamayı göster

Cevap: 73\frac{7}{3}

Cevap

73\frac{7}{3}
Evaluating 3Δx3 \Delta x gives 33x3 - 3x. Then operating (33x)Δ1(3 - 3x) \Delta 1 yields (33x)+32(33x)=3x(3 - 3x) + 3 - 2(3 - 3x) = 3x. Equating 3x=73x = 7 gives x=73x = \frac{7}{3}.

Adım Adım Çözüm

1
Evaluate the inner expression 3Δx3 \Delta x using the definition aΔb=a+3b2aba \Delta b = a + 3b - 2ab.
3Δx=3+3x2(3)(x)=3+3x6x=33x3 \Delta x = 3 + 3x - 2(3)(x) = 3 + 3x - 6x = 3 - 3x.
Substitute a=3a = 3 and b=xb = x into the operation rule.
2
Substitute the result (33x)(3 - 3x) as the first operand in the outer expression (33x)Δ1(3 - 3x) \Delta 1.
(33x)Δ1=(33x)+3(1)2(33x)(1)(3 - 3x) \Delta 1 = (3 - 3x) + 3(1) - 2(3 - 3x)(1).
Apply the binary operation definition with a=33xa = 3 - 3x and b=1b = 1.
3
Expand and simplify the algebraic expression.
(33x)Δ1=33x+36+6x=3x(3 - 3x) \Delta 1 = 3 - 3x + 3 - 6 + 6x = 3x.
Distribute 2-2 across (33x)(3 - 3x) to get 6+6x-6 + 6x, then collect like terms.
4
Set the simplified expression equal to 77 and solve for xx.
3x=7    x=733x = 7 \implies x = \frac{7}{3}.
Divide both sides by 33 to isolate xx.

Anahtar Kavram

Non-commutative binary operation composition and algebraic equation solving
ÖncekiSayfa 382 / 697Sonraki
Tüm alıştırma soruları — JAMB UTME | Examkin