Tüm alıştırma soruları

1526 soru

Soru 761Soru

During a quality control inspection at a manufacturing plant, two independent automated scanners, S1S_1 and S2S_2, inspect items along a production line. The probability that scanner S1S_1 detects a surface flaw on a defective item is 0.900.90, and the probability that scanner S2S_2 detects the flaw is 0.800.80. What is the probability that a surface flaw is detected by exactly one of the two scanners?

Cevabı ve açıklamayı göster

Cevap: 0.26

Cevap

The probability that a surface flaw is detected by exactly one of the two scanners is 0.26.
The probability of a surface flaw being detected by exactly one scanner is calculated by combining two mutually exclusive compound events: scanner S1S_1 detects it while scanner S2S_2 fails (0.90×0.20=0.180.90 \times 0.20 = 0.18), and scanner S1S_1 fails while scanner S2S_2 detects it (0.10×0.80=0.080.10 \times 0.80 = 0.08). Adding these two values yields 0.18+0.08=0.260.18 + 0.08 = 0.26.

Adım Adım Çözüm

1
Determine the probabilities of non-detection for each scanner.
P(S_1') = 0.10, P(S_2') = 0.20
The probability of an event's complement is 1 minus the probability of the event.
2
Calculate the probability that scanner S_1 detects the flaw while scanner S_2 misses it.
P(S_1 \cap S_2') = 0.90 \times 0.20 = 0.18
Because the scanners operate independently, joint probability is the product of their individual probabilities.
3
Calculate the probability that scanner S_1 misses the flaw while scanner S_2 detects it.
P(S_1' \cap S_2) = 0.10 \times 0.80 = 0.08
Independence allows multiplication of individual probabilities.
4
Sum the probabilities of the two mutually exclusive outcomes.
P(\text{exactly one}) = 0.18 + 0.08 = 0.26
The addition law applies because detecting the flaw with only S_1 and only S_2 are mutually exclusive events.

Anahtar Kavram

Compound probability laws for independent and mutually exclusive events
Soru 762Soru

The interior angles of a convex polygon form an arithmetic progression. If the smallest interior angle is 120120^\circ and the common difference between consecutive interior angles is 55^\circ, how many sides does the polygon have?

Cevabı ve açıklamayı göster

Cevap: 9

Cevap

The polygon has 9 sides.
Equating the interior angle sum formula (n2)×180(n-2) \times 180^\circ with the sum formula for an arithmetic progression n2[2(120)+(n1)5]\frac{n}{2}[2(120^\circ) + (n-1)5^\circ] yields the quadratic equation n225n+144=0n^2 - 25n + 144 = 0. Solving gives n=9n = 9 and n=16n = 16. For n=16n = 16, the largest angle would be 195195^\circ, which is impossible for a convex polygon. Thus, the only valid number of sides is 9.

Adım Adım Çözüm

1
Formulate expressions for the sum of the interior angles.
The interior angle sum of an nn-sided polygon is S=(n2)×180S = (n-2) \times 180^\circ. As an arithmetic sequence with a=120a = 120^\circ and d=5d = 5^\circ, the sum is S=n2[2(120)+(n1)5]S = \frac{n}{2}[2(120^\circ) + (n-1)5^\circ].
Both methods express the total sum of all interior angles of the polygon.
2
Equate the two sum formulas and simplify into a quadratic equation.
(n2)×180=n2(235+5n)    n225n+144=0(n-2) \times 180 = \frac{n}{2}(235 + 5n) \implies n^2 - 25n + 144 = 0.
Expanding and dividing by 5 reduces the equality to standard quadratic form.
3
Solve for nn and test the validity of the roots based on polygon convexity.
(n9)(n16)=0    n=9(n - 9)(n - 16) = 0 \implies n = 9 or n=16n = 16. Testing n=16n = 16 gives a largest angle of 120+15(5)=195120^\circ + 15(5^\circ) = 195^\circ (invalid as it exceeds 180180^\circ). Testing n=9n = 9 gives a largest angle of 120+8(5)=160120^\circ + 8(5^\circ) = 160^\circ (valid).
A convex polygon cannot have any interior angle greater than or equal to 180180^\circ.

Anahtar Kavram

Polygon interior angle sum and arithmetic progressions
Soru 763Soru

Given the matrix P=(x1230x121)P = \begin{pmatrix} x & 1 & 2 \\ 3 & 0 & x \\ 1 & 2 & 1 \end{pmatrix}, for what positive value of xx is the determinant of PP equal to 33?

Cevabı ve açıklamayı göster

Cevap: 2

Cevap

The positive value of xx is 22.
Expanding the determinant of PP along the first row yields det(P)=2x2+x+9\det(P) = -2x^2 + x + 9. Setting det(P)=3\det(P) = 3 leads to 2x2+x+9=3-2x^2 + x + 9 = 3, which rearranges to 2x2x6=02x^2 - x - 6 = 0. Factoring gives (2x+3)(x2)=0(2x + 3)(x - 2) = 0, leading to roots x=1.5x = -1.5 and x=2x = 2. The positive value is 22.

Adım Adım Çözüm

1
Calculate the determinant of matrix PP in terms of xx
\det(P) = -2x^2 + x + 9
Expanding along the first row gives x(012x)1(31x1)+2(3201)=2x2+x+9x(0 \cdot 1 - 2x) - 1(3 \cdot 1 - x \cdot 1) + 2(3 \cdot 2 - 0 \cdot 1) = -2x^2 + x + 9.
2
Set up the quadratic equation using det(P)=3\det(P) = 3
2x^2 - x - 6 = 0
Subtracting 33 from both sides gives 2x2+x+6=0-2x^2 + x + 6 = 0, which simplifies to 2x2x6=02x^2 - x - 6 = 0.
3
Solve the quadratic equation for xx
x = 2 \text{ or } x = -1.5
Factoring (2x+3)(x2)=0(2x + 3)(x - 2) = 0 yields x=32x = -\frac{3}{2} and x=2x = 2.
4
Select the positive solution as required by the problem statement
x = 2
The problem specifically requests the positive real value of xx.

Anahtar Kavram

3x3 Determinant Evaluation and Quadratic Solving
Soru 764Soru

Given that xx is a positive real number and the determinant of the matrix A=(x102x3014)A = \begin{pmatrix} x & 1 & 0 \\ 2 & x & 3 \\ 0 & 1 & 4 \end{pmatrix} is 22, find the value of xx.

Cevabı ve açıklamayı göster

Cevap: 2

Cevap

The positive value of xx is 22.
Expanding the determinant along the first row yields det(A)=x(4x3)1(80)=4x23x8\det(A) = x(4x - 3) - 1(8 - 0) = 4x^2 - 3x - 8. Equating this to 22 gives 4x23x10=04x^2 - 3x - 10 = 0. Factoring the quadratic gives (4x+5)(x2)=0(4x + 5)(x - 2) = 0, which yields x=2x = 2 or x=1.25x = -1.25. Because xx must be positive, the correct value is 22.

Adım Adım Çözüm

1
Expand the 3×33 \times 3 determinant along the first row
\det(A) = x(4x - 3) - 1(8 - 0) + 0 = 4x^2 - 3x - 8
Expanding along the first row leverages the zero entry to simplify calculation of the determinant.
2
Equate the determinant expression to the given determinant value
4x^2 - 3x - 10 = 0
Setting the calculated determinant equal to 22 creates a quadratic equation in terms of xx.
3
Factor the quadratic equation to find the candidate values for xx
(4x + 5)(x - 2) = 0 \implies x = 2 \text{ or } x = -1.25
Factoring determines all algebraic solutions that satisfy the determinant equation.
4
Apply the positivity constraint given in the problem statement
x = 2
The question restricts xx to positive real numbers, discarding the negative root.

Anahtar Kavram

Determinant of a 3x3 matrix and quadratic equations
Tahmini Süre:2m 0s
Soru 765Soru

What is the value of the definite integral 02(3x2+2)dx\int_{0}^{2} (3x^2 + 2) \, dx?

Cevabı ve açıklamayı göster

Cevap: 12

Cevap

12
To evaluate 02(3x2+2)dx\int_{0}^{2} (3x^2 + 2) \, dx, integrate 3x2+23x^2 + 2 to get x3+2xx^3 + 2x. Substituting the limits gives (23+2(2))(03+2(0))=(8+4)0=12(2^3 + 2(2)) - (0^3 + 2(0)) = (8 + 4) - 0 = 12.

Adım Adım Çözüm

1
Integrate the function term by term
\int (3x^2 + 2) \, dx = x^3 + 2x
By the power rule of integration, \int 3x^2 \, dx = x^3 and \int 2 \, dx = 2x.
2
Apply the limits of integration from 0 to 2
[x^3 + 2x]_0^2 = (2^3 + 2(2)) - (0^3 + 2(0)) = 12 - 0 = 12
Substitute the upper limit 2 into the antiderivative and subtract the value obtained by substituting the lower limit 0.

Anahtar Kavram

Evaluation of Definite Integrals
Soru 766Soru

A fruit juice mixture is prepared by combining orange extract and water in the ratio 3:53 : 5. If a bottle contains 40 litres40\text{ litres} of this mixture, how many litres of water does it contain?

Cevabı ve açıklamayı göster

Cevap: 25

Cevap

The volume of water in the mixture is 25 litres.
The mixture ratio of orange extract to water is 3:53 : 5, giving a total of 3+5=83 + 5 = 8 equal parts. Dividing the total volume of 40 litres40\text{ litres} by 88 parts gives 5 litres5\text{ litres} per part. Since water makes up 55 parts of the ratio, its volume is 5×5=25 litres5 \times 5 = 25\text{ litres}.

Adım Adım Çözüm

1
Determine the total number of parts in the ratio.
3 + 5 = 8 parts
The full volume of the mixture is divided into equal portions represented by the sum of the ratio parts.
2
Calculate the volume per ratio part.
40 / 8 = 5 litres per part
Dividing the total volume by the total number of parts gives the size of a single part.
3
Find the quantity of water.
5 * 5 = 25 litres
Water accounts for 5 parts of the ratio, so multiply 5 parts by 5 litres per part.

Anahtar Kavram

Ratio Sharing and Proportional Division
Soru 767Soru

Given the permutation equation nP4=42nP2{^{n}P_4} = 42 \cdot {^{n}P_2}, what is the positive integer value of nn?

Cevabı ve açıklamayı göster

Cevap: 9

Cevap

The positive integer value of nn is 99.
Expanding nP4{^{n}P_4} as n(n1)(n2)(n3)n(n-1)(n-2)(n-3) and nP2{^{n}P_2} as n(n1)n(n-1) transforms the equation to n(n1)(n2)(n3)=42n(n1)n(n-1)(n-2)(n-3) = 42n(n-1). Dividing both sides by n(n1)n(n-1) gives (n2)(n3)=42(n-2)(n-3) = 42, which simplifies to n25n36=0n^2 - 5n - 36 = 0. Factoring this quadratic gives (n9)(n+4)=0(n-9)(n+4) = 0. Since nn must be a positive integer greater than or equal to 44, the correct answer is 99.

Adım Adım Çözüm

1
Write out the expanded expressions for nP4{^{n}P_4} and nP2{^{n}P_2}.
nP4=n(n1)(n2)(n3){^{n}P_4} = n(n-1)(n-2)(n-3) and nP2=n(n1){^{n}P_2} = n(n-1).
By definition, nPr=n!(nr)!=n(n1)(nr+1){^{n}P_r} = \frac{n!}{(n-r)!} = n(n-1)\dots(n-r+1).
2
Set up the algebraic equation based on the given problem statement.
n(n1)(n2)(n3)=42n(n1)n(n-1)(n-2)(n-3) = 42n(n-1).
Substitute the expanded permutation formulas into the given identity.
3
Simplify the equation by dividing both sides by the non-zero common product n(n1)n(n-1).
(n2)(n3)=42(n-2)(n-3) = 42.
Since n4n \ge 4, n(n1)0n(n-1) \neq 0, so we can cancel these terms from both sides.
4
Expand and rearrange the resulting expression into a standard quadratic equation.
n25n36=0n^2 - 5n - 36 = 0.
Expanding (n2)(n3)(n-2)(n-3) gives n25n+6n^2 - 5n + 6; subtracting 4242 yields n25n36=0n^2 - 5n - 36 = 0.
5
Solve the quadratic equation for nn and discard non-physical roots.
n=9n = 9.
Factoring yields (n9)(n+4)=0(n-9)(n+4) = 0, so n=9n = 9 or n=4n = -4. A permutation requires nn to be a positive integer 4\ge 4, so n=9n = 9.

Anahtar Kavram

Solving algebraic equations involving permutations nPr=n!(nr)!{^{n}P_r} = \frac{n!}{(n-r)!}
Soru 768Soru

A trader bought a quantity of palm oil. He sold 13\frac{1}{3} of the total quantity at a profit of 20%20\%, 12\frac{1}{2} of the remaining palm oil at a loss of 10%10\%, and the rest of the palm oil at a profit of x%x\%. If his overall profit on the entire transaction was 15%15\%, what is the value of xx?

Cevabı ve açıklamayı göster

Cevap: 35

Cevap

The value of xx is 3535.
The palm oil is divided into three equal portions of 13\frac{1}{3} each. The first portion contributes 203%\frac{20}{3}\% profit, the second portion contributes a loss of 103%-\frac{10}{3}\%, and the final portion contributes x3%\frac{x}{3}\% profit. Summing these contributions yields 10+x3%\frac{10 + x}{3}\%. Equating this to the target overall profit of 15%15\% gives 10+x=4510 + x = 45, which solves to x=35x = 35.

Adım Adım Çözüm

1
Determine the fractional portion of palm oil sold at each stage.
First portion = 13\frac{1}{3}. Remaining after first sale = 113=231 - \frac{1}{3} = \frac{2}{3}. Second portion = 12×23=13\frac{1}{2} \times \frac{2}{3} = \frac{1}{3}. Final portion = 1(13+13)=131 - \left(\frac{1}{3} + \frac{1}{3}\right) = \frac{1}{3}.
Finding the exact fraction of the total quantity sold at each step is necessary to weight their respective profit/loss rates correctly.
2
Formulate the net percentage profit equation.
\text{Net Profit } \% = \left(\frac{1}{3} \times 20\%\right) + \left(\frac{1}{3} \times (-10\%)\right) + \left(\frac{1}{3} \times x\%\right) = \frac{20 - 10 + x}{3}\% = \frac{10 + x}{3}\%
The overall profit percentage is the sum of individual fractional contributions, treating loss as a negative percentage.
3
Set the net profit equal to 15%15\% and solve for xx.
\frac{10 + x}{3} = 15 \implies 10 + x = 45 \implies x = 35
Solving this linear equation gives the required profit percentage for the final portion.

Anahtar Kavram

Weighted Average Profit and Loss across fractional components of an asset
Tahmini Süre:2m 0s
Soru 769Soru

What is the canonical non-negative remainder when 345113^{45} - 11 is divided by 77?

Cevabı ve açıklamayı göster

Cevap: 2

Cevap

The correct answer is 2.
Using modular exponentiation, 33=271(mod7)3^3 = 27 \equiv -1 \pmod{7}, so 345=(33)15(1)15=1(mod7)3^{45} = (3^3)^{15} \equiv (-1)^{15} = -1 \pmod{7}. Subtracting 11 yields 111=12(mod7)-1 - 11 = -12 \pmod{7}. Adding 14 (a multiple of 7) gives 12+14=2-12 + 14 = 2, which is the canonical non-negative remainder.

Adım Adım Çözüm

1
Evaluate 345(mod7)3^{45} \pmod{7} using power rules
3451(mod7)3^{45} \equiv -1 \pmod{7}
Since 33=271(mod7)3^3 = 27 \equiv -1 \pmod{7}, raising both sides to the power of 15 gives (33)15(1)15=1(mod7)(3^3)^{15} \equiv (-1)^{15} = -1 \pmod{7}.
2
Subtract 11 from the modular result
-12 \pmod{7}
Replacing 3453^{45} with 1-1 gives 111=12-1 - 11 = -12.
3
Reduce -12 to its canonical non-negative remainder in [0,6][0, 6]
2
Adding the smallest multiple of 7 that makes the result non-negative gives 12+14=2-12 + 14 = 2.

Anahtar Kavram

Modular Exponentiation and Negative Remainder Reduction
Soru 770Soru

In a survey of 120120 tech entrepreneurs at an innovation hub, 6565 secured Angel Investment (AA), 5555 received Venture Capital (VV), and 5050 obtained Government Grants (GG). Furthermore, 2525 received both AA and VV, 2020 received both VV and GG, 2222 received both AA and GG, while 1212 received no funding from any of these three sources. How many entrepreneurs secured funding from exactly two of these sources?

Cevabı ve açıklamayı göster

Cevap: 52

Cevap

The number of entrepreneurs who secured funding from exactly two sources is 52.
Subtracting the 1212 unfunded entrepreneurs from the total 120120 yields 108108 funded entrepreneurs. Applying inclusion-exclusion gives 108=65+55+50(25+20+22)+n(AVG)108 = 65 + 55 + 50 - (25 + 20 + 22) + n(A \cap V \cap G), which gives n(AVG)=5n(A \cap V \cap G) = 5. Subtracting 55 from each pairwise intersection yields 2020, 1515, and 1717 for entrepreneurs receiving funding from exactly two sources. Summing these gives 5252.

Adım Adım Çözüm

1
Determine the cardinality of the union of all three funding sets
n(AVG)=108n(A \cup V \cup G) = 108
Subtracting the 12 unfunded entrepreneurs from the universal set of 120 gives the total number of entrepreneurs who received at least one form of funding.
2
Solve for the number of entrepreneurs who received funding from all three sources using inclusion-exclusion
n(AVG)=5n(A \cap V \cap G) = 5
Using n(AVG)=n(A)+n(V)+n(G)n(AV)n(VG)n(AG)+n(AVG)n(A \cup V \cup G) = n(A) + n(V) + n(G) - n(A \cap V) - n(V \cap G) - n(A \cap G) + n(A \cap V \cap G), we get 108=65+55+50252022+x108 = 65 + 55 + 50 - 25 - 20 - 22 + x, which simplifies to 108=103+x108 = 103 + x, giving x=5x = 5.
3
Calculate the count for each region representing exactly two funding sources
Only AV=20A \cap V = 20, Only VG=15V \cap G = 15, Only AG=17A \cap G = 17
Subtracting the 3-set intersection (x=5x = 5) from each pairwise intersection isolates the elements belonging to strictly two sets.
4
Sum the three strictly two-set regions
20+15+17=5220 + 15 + 17 = 52
Adding the individual counts for the three disjoint regions gives the total number of entrepreneurs who received funding from exactly two sources.

Anahtar Kavram

Principle of Inclusion-Exclusion for three sets and cardinal partitioning of Venn diagrams
Soru 771Soru

The frequency table below shows the fuel efficiency, measured in km/L\text{km/L}, for a fleet of 5050 delivery vans operated by a logistics company:

Fuel Efficiency (km/L)Frequency (ff)
10 – 148
15 – 1912
20 – 2420
25 – 2910

What is the mean fuel efficiency of the fleet, in km/L\text{km/L}?

Cevabı ve açıklamayı göster

Cevap: 20.2

Cevap

The mean fuel efficiency of the fleet is 20.2 km/L.
The estimated mean is found by calculating the midpoint of each class interval, multiplying each midpoint by its class frequency, summing these products to get 1010, and dividing by the total frequency of 50, resulting in 20.2 km/L.

Adım Adım Çözüm

1
Determine the midpoint (x) for each class interval.
Midpoints are 12 for 10–14, 17 for 15–19, 22 for 20–24, and 27 for 25���29.
For grouped frequency data, each class interval is represented by its midpoint x = (lower limit + upper limit) / 2.
2
Compute the product of frequency and midpoint (f * x) for each interval.
Products: (8 * 12) = 96, (12 * 17) = 204, (20 * 22) = 440, (10 * 27) = 270.
To calculate the total contribution of values from each class interval.
3
Sum all products (sum of f * x) and divide by the total number of delivery vans (sum of f).
sum of f * x = 96 + 204 + 440 + 270 = 1010. sum of f = 50. Mean = 1010 / 50 = 20.2.
The formula for the estimated mean of grouped data is mean = (sum of f * x) / (sum of f).

Anahtar Kavram

Measures of Central Tendency for Grouped Data (Grouped Mean)
Soru 772Soru

A laboratory technician recorded the temperature changes (in °C) of a chemical reaction across five trials as 33, 66, 77, 99, and 1515. What is the variance of this set of data?

Cevabı ve açıklamayı göster

Cevap: 16

Cevap

The variance of the temperature changes is 16.
The mean of the given numbers is xˉ=3+6+7+9+155=8\bar{x} = \frac{3 + 6 + 7 + 9 + 15}{5} = 8. The squared deviations from the mean are (38)2=25(3-8)^2 = 25, (68)2=4(6-8)^2 = 4, (78)2=1(7-8)^2 = 1, (98)2=1(9-8)^2 = 1, and (158)2=49(15-8)^2 = 49. Summing these squared deviations gives 25+4+1+1+49=8025 + 4 + 1 + 1 + 49 = 80. Dividing by the number of observations N=5N = 5 yields the variance: 805=16\frac{80}{5} = 16.

Adım Adım Çözüm

1
Calculate the arithmetic mean (\bar{x}) of the dataset.
\bar{x} = \frac{3 + 6 + 7 + 9 + 15}{5} = 8
The mean is required to determine the deviation of each individual value from the central value.
2
Compute the square of the deviation for each data point from the mean.
(3-8)^2 = 25, (6-8)^2 = 4, (7-8)^2 = 1, (9-8)^2 = 1, (15-8)^2 = 49
Squaring deviations ensures all values are positive and emphasizes larger departures from the mean.
3
Sum the squared deviations and divide by the total number of observations (N = 5).
\text{Variance} = \frac{25 + 4 + 1 + 1 + 49}{5} = \frac{80}{5} = 16
Variance measures the average of the squared deviations from the mean.

Anahtar Kavram

Population Variance for Ungrouped Data
Soru 773Soru

In a survey of 100100 book club members regarding their reading preferences among Science Fiction (SS), Mystery (MM), and Historical Fiction (HH), it was found that 4848 read Science Fiction, 4242 read Mystery, and 3838 read Historical Fiction. Furthermore, 1818 read both Science Fiction and Mystery, 1515 read both Science Fiction and Historical Fiction, 1414 read both Mystery and Historical Fiction, and 88 read all three genres. How many of the members read exactly one of these three genres?

Cevabı ve açıklamayı göster

Cevap: 58

Cevap

The number of members who read exactly one of the three genres is 5858.
By isolating the disjoint regions of the 3-set Venn diagram, the number of members reading only Science Fiction is 2323, only Mystery is 1818, and only Historical Fiction is 1717. Adding these disjoint sets yields 5858.

Adım Adım Çözüm

1
Determine exclusive two-set intersection regions
n(SM only)=10n(S \cap M \text{ only}) = 10, n(SH only)=7n(S \cap H \text{ only}) = 7, n(MH only)=6n(M \cap H \text{ only}) = 6
The given pairwise totals include members who read all three genres, so subtracting n(SMH)=8n(S \cap M \cap H) = 8 isolates those in exactly two sets.
2
Determine exclusive single-set regions
n(S only)=23n(S \text{ only}) = 23, n(M only)=18n(M \text{ only}) = 18, n(H only)=17n(H \text{ only}) = 17
Subtracting all overlapping regions within each set's boundary gives the number of members reading only that specific genre.
3
Sum the single-set regions
23+18+17=5823 + 18 + 17 = 58
The set of members reading exactly one genre is the disjoint union of the three exclusive single-set regions.

Anahtar Kavram

3-Set Venn Diagram Cardinality and Disjoint Region Analysis
Soru 774Soru

Find the smallest positive value of θ\theta, in degrees, that satisfies the trigonometric equation 2sin(3θ30)=32\sin(3\theta - 30^\circ) = \sqrt{3}.

Cevabı ve açıklamayı göster

Cevap: 30

Cevap

The smallest positive angle θ\theta is 3030^\circ.
To find the smallest positive value of θ\theta, first isolate the sine function by dividing both sides by 2 to obtain sin(3θ30)=32\sin(3\theta - 30^\circ) = \frac{\sqrt{3}}{2}. The smallest positive angle with a sine of 32\frac{\sqrt{3}}{2} is 6060^\circ. Setting 3θ30=603\theta - 30^\circ = 60^\circ yields 3θ=903\theta = 90^\circ, which gives θ=30\theta = 30^\circ.

Adım Adım Çözüm

1
Isolate the trigonometric ratio
sin(3θ30)=32\sin(3\theta - 30^\circ) = \frac{\sqrt{3}}{2}
Dividing both sides of 2sin(3θ30)=32\sin(3\theta - 30^\circ) = \sqrt{3} by 2 simplifies the equation into standard form.
2
Determine the primary angle solution
3θ30=603\theta - 30^\circ = 60^\circ
The smallest positive angle whose sine equals 32\frac{\sqrt{3}}{2} is 6060^\circ.
3
Solve the linear equation for θ\theta
θ=30\theta = 30^\circ
Adding 3030^\circ to both sides gives 3θ=903\theta = 90^\circ, and dividing by 3 yields θ=30\theta = 30^\circ.

Anahtar Kavram

Solving Trigonometric Equations with Linear Argument Transformations
Soru 775Soru

Three point charges q1=+2.0×106 Cq_1 = +2.0 \times 10^{-6}\text{ C}, q2=+2.0×106 Cq_2 = +2.0 \times 10^{-6}\text{ C}, and q3=4.0×106 Cq_3 = -4.0 \times 10^{-6}\text{ C} are placed along a straight line at positions x=0 mx = 0\text{ m}, x=0.30 mx = 0.30\text{ m}, and x=0.60 mx = 0.60\text{ m}, respectively. Taking Coulomb's constant k=9.0×109 N m2 C2k = 9.0 \times 10^9\text{ N m}^2\text{ C}^{-2}, calculate the magnitude of the net electrostatic force acting on charge q2q_2 in newtons.

Cevabı ve açıklamayı göster

Cevap: 1.2

Cevap

The magnitude of the net electrostatic force acting on charge q2q_2 is 1.20 N1.20\text{ N}.
The force exerted on q2q_2 by q1q_1 is repulsive (0.40 N0.40\text{ N} directed to the right) because both charges are positive. The force exerted on q2q_2 by q3q_3 is attractive (0.80 N0.80\text{ N} directed to the right) because q2q_2 is positive and q3q_3 is negative. Since both component forces act in the same direction, the total net force magnitude is 0.40 N+0.80 N=1.20 N0.40\text{ N} + 0.80\text{ N} = 1.20\text{ N}.

Adım Adım Çözüm

1
Calculate the repulsive force exerted by q1q_1 on q2q_2
F12=0.40 NF_{12} = 0.40\text{ N} pointing to the right
Like charges repel each other, so q1q_1 pushes q2q_2 away along the +x+x-axis.
2
Calculate the attractive force exerted by q3q_3 on q2q_2
F32=0.80 NF_{32} = 0.80\text{ N} pointing to the right
Unlike charges attract each other, so q3q_3 pulls q2q_2 towards itself along the +x+x-axis.
3
Sum the component electrostatic forces acting on q2q_2
Fnet=0.40 N+0.80 N=1.20 NF_{\text{net}} = 0.40\text{ N} + 0.80\text{ N} = 1.20\text{ N}
Because both forces act in the exact same direction along the line, their magnitudes add directly.

Anahtar Kavram

Coulomb's Law and Principle of Superposition for Electrostatic Forces
Soru 776Soru

A vibrating tuning fork generates a longitudinal sound wave in air. The fork completes 120120 full oscillations in 0.40 s0.40\text{ s}. If the wavelength of the sound wave in air is 1.15 m1.15\text{ m}, what is the speed of propagation of the wave in m/s\text{m/s}?

Cevabı ve açıklamayı göster

Cevap: 345

Cevap

The speed of propagation of the sound wave in air is 345 m/s345\text{ m/s}.
The frequency of oscillation is determined by dividing the number of oscillations by the total time taken: f=1200.40 s=300 Hzf = \frac{120}{0.40\text{ s}} = 300\text{ Hz}. Substituting the frequency and given wavelength into the wave equation v=fλv = f \lambda yields v=300 Hz×1.15 m=345 m/sv = 300\text{ Hz} \times 1.15\text{ m} = 345\text{ m/s}.

Adım Adım Çözüm

1
Determine the frequency of the longitudinal wave.
f=300 Hzf = 300\text{ Hz}
Frequency is the number of complete oscillations per unit time: f=Nt=1200.40 s=300 Hzf = \frac{N}{t} = \frac{120}{0.40\text{ s}} = 300\text{ Hz}.
2
Calculate the wave propagation speed using the wave equation.
v=345 m/sv = 345\text{ m/s}
The speed of a progressive wave is given by v=fλ=300 Hz×1.15 m=345 m/sv = f \lambda = 300\text{ Hz} \times 1.15\text{ m} = 345\text{ m/s}.

Anahtar Kavram

Relationship between frequency, wavelength, and wave propagation speed in a mechanical medium
Soru 777Soru

Given the 3×33 \times 3 matrix M=(k213k12141)M = \begin{pmatrix} k & 2 & 1 \\ 3 & k-1 & 2 \\ 1 & 4 & 1 \end{pmatrix}, where k>5k > 5. If det(M2)=100\det(M^2) = 100 and det(M)<0\det(M) < 0, what is the value of kk?

Cevabı ve açıklamayı göster

Cevap: 7

Cevap

7
Using the matrix determinant power identity det(M2)=(det(M))2=100\det(M^2) = (\det(M))^2 = 100 and the condition det(M)<0\det(M) < 0, we find det(M)=10\det(M) = -10. Expanding det(M)\det(M) along the first row yields det(M)=k(k9)2(1)+1(13k)=k210k+11\det(M) = k(k-9) - 2(1) + 1(13-k) = k^2 - 10k + 11. Setting this equal to 10-10 gives the quadratic equation k210k+21=0k^2 - 10k + 21 = 0, which factors as (k3)(k7)=0(k-3)(k-7) = 0. Given k>5k > 5, the unique solution is k=7k = 7.

Adım Adım Çözüm

1
Apply determinant properties for matrix powers
det(M)=10\det(M) = -10
Because det(M2)=(det(M))2=100\det(M^2) = (\det(M))^2 = 100 and it is given that det(M)<0\det(M) < 0, taking the negative square root gives det(M)=10\det(M) = -10.
2
Evaluate the determinant of matrix MM using first-row expansion
det(M)=k210k+11\det(M) = k^2 - 10k + 11
Expanding along row 1 gives k((k1)(1)8)2(3(1)2(1))+1(3(4)(k1)(1))=k29k2+13k=k210k+11k((k-1)(1) - 8) - 2(3(1) - 2(1)) + 1(3(4) - (k-1)(1)) = k^2 - 9k - 2 + 13 - k = k^2 - 10k + 11.
3
Set up and simplify the quadratic equation for kk
k210k+21=0k^2 - 10k + 21 = 0
Equating k210k+11k^2 - 10k + 11 to 10-10 yields k210k+21=0k^2 - 10k + 21 = 0.
4
Solve the quadratic equation and enforce the inequality condition k>5k > 5
k=7k = 7
Factoring (k3)(k7)=0(k-3)(k-7) = 0 gives k=3k = 3 or k=7k = 7. Applying the restriction k>5k > 5 selects k=7k = 7.

Anahtar Kavram

Determinant Properties of Matrix Powers and 3x3 Matrix Expansion
Soru 778Soru

A binary operation * defined on the set of real numbers R\mathbb{R} is given by ab=a2+2b5a * b = a^2 + 2b - 5. If 3x=123 * x = 12, what is the value of xx?

Cevabı ve açıklamayı göster

Cevap: 4

Cevap

The value of xx is 4.
Applying the binary operation definition ab=a2+2b5a * b = a^2 + 2b - 5 to 3x3 * x gives 32+2x5=2x+43^2 + 2x - 5 = 2x + 4. Equating 2x+4=122x + 4 = 12 yields 2x=82x = 8, so x=4x = 4.

Adım Adım Çözüm

1
Substitute a=3a = 3 and b=xb = x into the operational rule ab=a2+2b5a * b = a^2 + 2b - 5.
3x=32+2x5=9+2x5=2x+43 * x = 3^2 + 2x - 5 = 9 + 2x - 5 = 2x + 4
To express the operation 3x3 * x as an algebraic expression in terms of xx.
2
Set the simplified algebraic expression equal to the given value of 12.
2x+4=122x + 4 = 12
The question states that 3x=123 * x = 12.
3
Solve the linear equation for xx.
2x=8    x=42x = 8 \implies x = 4
Subtract 4 from both sides and divide by 2.

Anahtar Kavram

Evaluating binary operations and solving algebraic equations involving defined operational rules.
Soru 779Soru

The acoustic intensity SS (defined as power per unit area) of a sound wave propagating through a medium of density ρ\rho at speed vv is given by the empirical relationship S=kAxω2ρvwS = k A^x \omega^2 \rho v^w, where AA is the wave displacement amplitude, ω\omega is the angular frequency, and kk is a dimensionless constant. Using the principles of dimensional analysis, calculate the numerical value of the exponent xx.

Cevabı ve açıklamayı göster

Cevap: 2

Cevap

The numerical value of the exponent xx is 2.
By applying the principle of dimensional homogeneity, the dimensions of intensity [S]=MT3[S] = M T^{-3} are equated to [A]x[ω]2[ρ][v]w=MLx3+wT2w[A]^x [\omega]^2 [\rho] [v]^w = M L^{x - 3 + w} T^{-2 - w}. Equating time exponents yields 3=2w    w=1-3 = -2 - w \implies w = 1. Equating length exponents yields 0=x3+w    x=20 = x - 3 + w \implies x = 2.

Adım Adım Çözüm

1
Determine the fundamental dimensions of acoustic intensity SS
[S]=[Power][Area]=ML2T3L2=ML0T3[S] = \frac{[\text{Power}]}{[\text{Area}]} = \frac{M L^2 T^{-3}}{L^2} = M L^0 T^{-3}
Intensity is defined as power delivered per unit surface area perpendicular to the direction of propagation.
2
Write the dimensional formulas for all variables in the given equation S=kAxω2ρ1vwS = k A^x \omega^2 \rho^1 v^w
[A]=L[A] = L, [ω]=T1[\omega] = T^{-1}, [ρ]=ML3[\rho] = M L^{-3}, [v]=LT1[v] = L T^{-1}
Each physical quantity must be resolved into fundamental SI dimensions of Mass (MM), Length (LL), and Time (TT).
3
Formulate the dimensional balance equation
M1L0T3=LxT2M1L3LwTw=M1Lx3+wT2wM^1 L^0 T^{-3} = L^x \cdot T^{-2} \cdot M^1 L^{-3} \cdot L^w T^{-w} = M^1 L^{x - 3 + w} T^{-2 - w}
For physical validity, the dimensions on both sides of an equation must be identical (principle of dimensional homogeneity).
4
Equate the exponents of Time (TT) to solve for ww
3=2w    w=1-3 = -2 - w \implies w = 1
The power of TT on the left side must equal the sum of powers of TT on the right side.
5
Equate the exponents of Length (LL) to find xx
0=x3+w    0=x3+1    x=20 = x - 3 + w \implies 0 = x - 3 + 1 \implies x = 2
Substituting w=1w = 1 into the length exponent balance yields the value of xx.

Anahtar Kavram

Principle of Dimensional Homogeneity
Tahmini Süre:2m 0s
Soru 780Soru

A binary operation \ast on the set of real numbers R{2}\mathbb{R} \setminus \{2\} is defined by ab=2a+2bab2a \ast b = 2a + 2b - ab - 2. If y1y^{-1} represents the inverse of an element yy under the operation \ast, find the value of xx such that (x3)41=5(x \ast 3) \ast 4^{-1} = 5.

Cevabı ve açıklamayı göster

Cevap: 8

Cevap

The value of x is 8.
To solve for x, first find the identity element by solving a * e = a, yielding e = 1. Next, compute 4^{-1} from 4 * 4^{-1} = 1, which gives 4^{-1} = 2.5. Then simplify x * 3 to 4 - x. Finally, substitute into (4 - x) * 2.5 = 5 and solve for x to get 8.

Adım Adım Çözüm

1
Find the identity element e of the operation
e = 1
By definition, a * e = a. Substituting into the operation gives 2a + 2e - ae - 2 = a, which simplifies to (a - 2)(1 - e) = 0. Since a != 2, e must equal 1.
2
Calculate the inverse element 4^{-1}
4^{-1} = 2.5
By definition of an inverse element, 4 * 4^{-1} = e = 1. Applying the operation formula yields 2(4) + 2(4^{-1}) - 4(4^{-1}) - 2 = 1, which simplifies to 6 - 2(4^{-1}) = 1, so 4^{-1} = 2.5.
3
Express x * 3 in terms of x
x * 3 = 4 - x
Evaluating x * 3 using the operational definition gives 2x + 2(3) - 3x - 2 = 4 - x.
4
Solve the main equation (x * 3) * 4^{-1} = 5 for x
x = 8
Substituting x * 3 = 4 - x and 4^{-1} = 2.5 into the equation yields (4 - x) * 2.5 = 5. Applying the operation gives 2(4 - x) + 2(2.5) - 2.5(4 - x) - 2 = 5, which simplifies to 1 + 0.5x = 5, giving x = 8.

Anahtar Kavram

Identity and Inverse Elements in Binary Operations
ÖncekiSayfa 39 / 77Sonraki
Tüm alıştırma soruları — JAMB UTME | Examkin