Tüm alıştırma soruları

13931 soru

Soru 7861Soru

A resistor of resistance 15Ω15\,\Omega is connected across a direct-current source. If a steady current of 0.80A0.80\,\text{A} flows through the resistor, what is the potential difference across its terminals?

Cevabı ve açıklamayı göster

Cevap: 12V12\,\text{V}

Cevap

The potential difference across the terminals of the resistor is 12V12\,\text{V}.
According to Ohm's law, the potential difference VV across a resistor is equal to the product of the electric current II passing through it and its resistance RR (V=I×RV = I \times R). Substituting I=0.80AI = 0.80\,\text{A} and R=15ΩR = 15\,\Omega yields V=12VV = 12\,\text{V}.

Adım Adım Çözüm

1
Identify the given physical quantities
Resistance R=15ΩR = 15\,\Omega and electric current I=0.80AI = 0.80\,\text{A}.
These are the given parameters needed to find potential difference.
2
Apply Ohm's Law formula for potential difference
V=I×RV = I \times R
Ohm's law states that potential difference is directly proportional to current for a ohmic resistor of constant resistance.
3
Substitute the values and calculate
V=0.80A×15Ω=12VV = 0.80\,\text{A} \times 15\,\Omega = 12\,\text{V}
Multiplying current by resistance yields potential difference in volts.

Anahtar Kavram

Ohm's Law (V=IRV = IR)
Soru 7862Soru

A progressive wave traveling through a primary medium is represented by the displacement equation y=0.04sin(100πt2.5πx)y = 0.04 \sin\left(100\pi t - 2.5\pi x\right), where xx and yy are in meters and tt is in seconds. If the wave propagates into a secondary medium where its speed increases by 20%20\%, what is the wavelength of the wave in the secondary medium?

Cevabı ve açıklamayı göster

Cevap: 0.96 m0.96\text{ m}

Cevap

The wavelength of the wave in the secondary medium is 0.96 m0.96\text{ m}.
Comparing y=0.04sin(100πt2.5πx)y = 0.04 \sin(100\pi t - 2.5\pi x) to the standard form y=Asin(ωtkx)y = A \sin(\omega t - k x), the wave number is k=2.5π rad/mk = 2.5\pi\text{ rad/m}. The initial wavelength is λ1=2π2.5π=0.8 m\lambda_1 = \frac{2\pi}{2.5\pi} = 0.8\text{ m}. When a wave moves to a new medium, its frequency stays constant, making wavelength directly proportional to wave speed (vλv \propto \lambda). An increase of 20%20\% in wave speed means the new wavelength is λ2=0.8×1.20=0.96 m\lambda_2 = 0.8 \times 1.20 = 0.96\text{ m}.

Adım Adım Çözüm

1
Extract angular frequency ω\omega and wave number kk from the wave equation.
From y=Asin(ωtkx)y = A \sin(\omega t - k x), we identify ω=100π rad/s\omega = 100\pi\text{ rad/s} and k=2.5π rad/mk = 2.5\pi\text{ rad/m}.
Standard wave equation parameters directly define the wave's spatial and temporal frequencies.
2
Calculate the wavelength λ1\lambda_1 in the initial medium.
\(\lambda_1 = \frac{2\pi}{k} = \frac{2\pi}{2.5\pi} = 0.8\text{ m}\).
Wavelength is inversely related to the wave number kk by λ=2πk\lambda = \frac{2\pi}{k}.
3
Apply the boundary conditions of wave refraction across media.
Frequency ff remains constant across boundary; speed vv and wavelength λ\lambda scale proportionally.
The frequency of a wave is determined solely by the source and does not change upon entering a new medium.
4
Determine the new wavelength λ2\lambda_2 in the secondary medium.
\(\lambda_2 = \lambda_1 \times (1 + 0.20) = 0.8\text{ m} \times 1.20 = 0.96\text{ m}\).
Since v=fλv = f \lambda and ff is constant, v2v1=λ2λ1=1.20\frac{v_2}{v_1} = \frac{\lambda_2}{\lambda_1} = 1.20.

Anahtar Kavram

Invariance of Wave Frequency across Media and Wave Equation Parameter Extraction
Tahmini Süre:2m 0s
Soru 7863Soru

A resistance thermometer has a resistance of 4.0Ω4.0\,\Omega at 0C0\,^\circ\text{C} and 6.0Ω6.0\,\Omega at 100C100\,^\circ\text{C}. The thermometer is connected in series with a fixed 10.0Ω10.0\,\Omega resistor across a 24.0V24.0\,\text{V} DC power source having an internal resistance of 1.0Ω1.0\,\Omega. If a steady current of 1.2A1.2\,\text{A} flows through the circuit, what is the temperature of the thermometer's environment?

Cevabı ve açıklamayı göster

Cevap: 250C250\,^\circ\text{C}

Cevap

The temperature of the thermometer environment is 250C250\,^\circ\text{C}.
By applying the complete circuit equation E=I(Rθ+Rfixed+r)E = I(R_\theta + R_{\text{fixed}} + r), the total circuit resistance is found to be 20.0Ω20.0\,\Omega. Subtracting the fixed resistance of 10.0Ω10.0\,\Omega and the cell internal resistance of 1.0Ω1.0\,\Omega yields the thermometer resistance Rθ=9.0ΩR_\theta = 9.0\,\Omega. Substituting this into the thermometric relation θ=RθR0R100R0×100C\theta = \frac{R_\theta - R_0}{R_{100} - R_0} \times 100\,^\circ\text{C} gives 9.04.06.04.0×100=250C\frac{9.0 - 4.0}{6.0 - 4.0} \times 100 = 250\,^\circ\text{C}.

Adım Adım Çözüm

1
Calculate total circuit resistance using Ohm's Law and internal resistance equation
Rtotal=EI=24.0V1.2A=20.0ΩR_{\text{total}} = \frac{E}{I} = \frac{24.0\,\text{V}}{1.2\,\text{A}} = 20.0\,\Omega
The electromotive force (e.m.f) of the source equals total current multiplied by total resistance including internal resistance.
2
Determine the resistance of the thermometer at the unknown temperature (RθR_\theta)
Rθ=RtotalRfixedr=20.0Ω10.0Ω1.0Ω=9.0ΩR_\theta = R_{\text{total}} - R_{\text{fixed}} - r = 20.0\,\Omega - 10.0\,\Omega - 1.0\,\Omega = 9.0\,\Omega
The circuit components are in series, so total resistance is the sum of external resistances and internal resistance.
3
Apply the linear resistance thermometer temperature scale formula
\(\theta = \frac{R_\theta - R_0}{R_{100} - R_0} \times 100\,^\circ\text{C} = \frac{9.0 - 4.0}{6.0 - 4.0} \times 100 = \frac{5.0}{2.0} \times 100 = 250\,^\circ\text{C}\)
Resistance varies linearly with temperature between the ice point (0C0\,^\circ\text{C}) and steam point (100C100\,^\circ\text{C}).

Anahtar Kavram

Integration of Ohm's Law, internal resistance of a cell, and resistance thermometry
Tahmini Süre:2m 0s
Soru 7864Soru

Find the real value of xx that satisfies the logarithmic equation log5(x24)log5(x2)=2\log_5(x^2 - 4) - \log_5(x - 2) = 2.

Cevabı ve açıklamayı göster

Cevap: 23

Cevap

The value of xx that satisfies the equation is 23.
Applying the logarithmic quotient rule gives log5(x24x2)=2\log_5 \left(\frac{x^2 - 4}{x - 2}\right) = 2. Factoring the numerator gives log5((x2)(x+2)x2)=log5(x+2)=2\log_5 \left(\frac{(x - 2)(x + 2)}{x - 2}\right) = \log_5(x + 2) = 2. Converting to exponential form yields x+2=52=25x + 2 = 5^2 = 25, which simplifies to x=23x = 23.

Adım Adım Çözüm

1
Apply the logarithmic quotient rule
\log_5\left(\frac{x^2 - 4}{x - 2}\right) = 2
The difference of two logarithms of the same base equals the logarithm of their quotient.
2
Factor the numerator and simplify the expression
log5(x+2)=2\log_5(x + 2) = 2
Factoring x24x^2 - 4 into (x2)(x+2)(x-2)(x+2) allows canceling the common factor (x2)(x-2) in the denominator.
3
Convert the logarithmic equation into exponential form
x + 2 = 5^2 = 25
By definition, logb(y)=c\log_b(y) = c is equivalent to bc=yb^c = y.
4
Solve the linear equation for xx
x = 23
Subtracting 2 from both sides gives x=23x = 23.

Anahtar Kavram

Logarithmic Quotient Rule and Logarithm-to-Exponent Conversion
Soru 7865Soru

The speed of sound vv in a gas depends on the gas pressure PP and density ρ\rho according to the relation v=kPaρbv = k P^a \rho^b, where kk is a dimensionless constant. What is the numerical value of the exponent aa?

Cevabı ve açıklamayı göster

Cevap: 0.5

Cevap

The numerical value of the exponent aa is 0.50.5.
Applying dimensional homogeneity to the relation v=kPaρbv = k P^a \rho^b yields [M0L1T1]=[ML1T2]a[ML3]b[M^0 L^1 T^{-1}] = [M L^{-1} T^{-2}]^a [M L^{-3}]^b. Equating the powers of time TT gives 2a=1-2a = -1, which simplifies to a=0.5a = 0.5.

Adım Adım Çözüm

1
Determine the base dimensions of all physical quantities in the relationship
[v]=M0LT1[v] = M^0 L T^{-1}, [P]=ML1T2[P] = M L^{-1} T^{-2}, and [ρ]=ML3[\rho] = M L^{-3}
Physical quantities must be expressed in fundamental dimensions (M,L,TM, L, T) to apply dimensional analysis.
2
Formulate the dimensional balance equation
M0L1T1=Ma+bLa3bT2aM^0 L^1 T^{-1} = M^{a+b} L^{-a-3b} T^{-2a}
By the principle of dimensional homogeneity, the total dimensions on the left side must equal those on the right side.
3
Equate exponents of TT to solve for aa
2a=1    a=0.5-2a = -1 \implies a = 0.5
Comparing powers of time TT directly isolates the variable aa.

Anahtar Kavram

Dimensional Homogeneity and Derivation of Exponents
Soru 7866Soru

For a normal good, the substitution effect and the income effect operate in opposite directions following a change in the price of the good.

Cevabı ve açıklamayı göster

Cevap: False

Cevap

The statement is False. For a normal good, the substitution effect and the income effect operate in the same direction.
The statement is false because for any normal good, a price decrease creates a substitution effect and an income effect that both work in the same direction to increase total quantity demanded.

Adım Adım Çözüm

1
Examine the substitution effect direction upon a price decrease.
The substitution effect always induces a consumer to purchase more of a good when its relative price falls.
The good becomes relatively less expensive compared to alternative substitute goods.
2
Examine the income effect direction for a normal good.
The increase in real purchasing power leads to an increase in the quantity demanded of the normal good.
By definition, the demand for a normal good rises as real income increases.
3
Combine both effects to determine their directional relationship.
Both the substitution effect and the income effect push quantity demanded in the same upward direction.
Because both effects act constructively together, they do not oppose each other for normal goods.

Anahtar Kavram

Directional interaction of income and substitution effects for normal goods
Soru 7867Soru

During an investigation on electrical circuits, a student measures electric current, potential difference, time, and thermodynamic temperature. Which of the measured physical quantities is a derived quantity?

Cevabı ve açıklamayı göster

Cevap: Potential difference

Cevap

Potential difference
Potential difference is a derived physical quantity because it is derived from work (energy) and electric charge (V=WQ=WItV = \frac{W}{Q} = \frac{W}{I \cdot t}), unlike electric current, time, and thermodynamic temperature which are fundamental SI quantities.

Adım Adım Çözüm

1
Identify fundamental (base) physical quantities
The seven SI fundamental quantities are mass, length, time, electric current, thermodynamic temperature, amount of substance, and luminous intensity.
Fundamental quantities are basic quantities that do not depend on any other physical quantity.
2
Classify the given quantities
Electric current, time, and thermodynamic temperature are base quantities. Potential difference (V=WQV = \frac{W}{Q}) is derived from work and electric charge.
Derived quantities are physical quantities defined by combining fundamental quantities.

Anahtar Kavram

Fundamental and Derived Quantities
Tahmini Süre:1m 0s
Soru 7868Soru

In a sports academy of 120 athletes, 70 play football, 60 play basketball, and 50 play tennis. If 10 athletes play none of these three sports and 15 athletes play all three sports, how many athletes play exactly two of these sports?

Cevabı ve açıklamayı göster

Cevap: 40

Cevap

40 athletes play exactly two of the sports.
The correct answer is 40. Subtracting the 10 athletes who play no sports from the total of 120 leaves 110 athletes playing at least one sport. Using inclusion-exclusion, the sum of pairwise intersections is S2=70+60+50+15110=85S_2 = 70 + 60 + 50 + 15 - 110 = 85. Since S2S_2 contains the region of all three sports counted three times, subtracting 3×15=453 \times 15 = 45 gives 40 athletes who play exactly two sports.

Adım Adım Çözüm

1
Determine the cardinality of the union of all three sets
n(FBT)=12010=110n(F \cup B \cup T) = 120 - 10 = 110
Athletes who play none of the three sports are excluded from the total universal set.
2
Apply the Principle of Inclusion-Exclusion for three sets to find the sum of 2-set intersections
S2=n(F)+n(B)+n(T)+n(FBT)n(FBT)=70+60+50+15110=85S_2 = n(F) + n(B) + n(T) + n(F \cap B \cap T) - n(F \cup B \cup T) = 70 + 60 + 50 + 15 - 110 = 85
The formula relates the total union, individual set cardinalities, pairwise intersections, and triple intersection.
3
Subtract three times the triple intersection from S2S_2 to isolate regions corresponding to exactly two sports
Exactly two sports = S23×n(FBT)=853(15)=40S_2 - 3 \times n(F \cap B \cap T) = 85 - 3(15) = 40
Each pairwise intersection sum S2S_2 includes the triple intersection region three times.

Anahtar Kavram

Three-set inclusion-exclusion principle and region cardinality decomposition
Tahmini Süre:1m 30s
Soru 7869Soru

In Rutherford's α\alpha-particle scattering experiment, most of the α\alpha-particles passed straight through the gold foil with negligible deflection, while a very small fraction was scattered through angles greater than 9090^\circ. Which fundamental deduction about atomic structure was directly established by these rare, large-angle scatterings?

Cevabı ve açıklamayı göster

Cevap: The positive charge and nearly all the atomic mass are concentrated in an extremely small, dense central region called the nucleus.

Cevap

The positive charge and nearly all the atomic mass are concentrated in an extremely small, dense central region called the nucleus.
Large-angle deflection (>90>90^\circ) requires an immense repulsive Coulomb force, which can only occur if the entire positive charge and virtually all atomic mass are concentrated in a tiny central region (the nucleus). If positive charge were spread out over the entire atomic volume, the maximum electric field would be far too weak to turn back high-velocity alpha particles.

Adım Adım Çözüm

1
Analyze the experimental observations from Rutherford's alpha-scattering experiment.
Most α\alpha-particles pass undeflected (indicating mostly empty space), while a tiny fraction scatter at angles >90>90^\circ.
Understanding the physical cause of large-angle electrostatic deflection.
2
Relate electrostatic repulsive force to mass and charge distribution.
To turn around a fast-moving positive α\alpha-particle (He2+He^{2+}), it must experience a intense Coulomb repulsion F=14πε0q1q2r2F = \frac{1}{4\pi\varepsilon_0}\frac{q_1 q_2}{r^2} at very small distance rr.
A diffuse charge distribution (Thomson model) yields weak electric fields that cannot cause wide-angle scattering.
3
Identify the structural conclusion drawn by Rutherford.
The entire positive charge and mass must reside in a massive, concentrated center (the nucleus).
Directly matches the core physical takeaway of the nuclear atomic model.

Anahtar Kavram

Rutherford Nuclear Model and Alpha Scattering Deduction
Soru 7870Soru

According to Newton's law of universal gravitation, the gravitational force FF between two masses m1m_1 and m2m_2 separated by a distance rr is given by F=Gm1m2r2F = \frac{G m_1 m_2}{r^2}. Which of the following correctly expresses the derived SI unit of the universal gravitational constant, GG, in terms of fundamental (base) units?

Cevabı ve açıklamayı göster

Cevap: kg1m3s2\text{kg}^{-1}\cdot\text{m}^3\cdot\text{s}^{-2}

Cevap

The SI unit of the universal gravitational constant GG expressed in fundamental base units is kg1m3s2\text{kg}^{-1}\cdot\text{m}^3\cdot\text{s}^{-2}.
The expression kg1m3s2\text{kg}^{-1}\cdot\text{m}^3\cdot\text{s}^{-2} is correct because rearranging F=Gm1m2r2F = \frac{G m_1 m_2}{r^2} yields G=Fr2m1m2G = \frac{F r^2}{m_1 m_2}. Replacing FF with its base equivalent kgms2\text{kg}\cdot\text{m}\cdot\text{s}^{-2}, rr with m\text{m}, and m1,m2m_1, m_2 with kg\text{kg} gives (kgms2)m2kg2=kg1m3s2\frac{(\text{kg}\cdot\text{m}\cdot\text{s}^{-2})\cdot\text{m}^2}{\text{kg}^2} = \text{kg}^{-1}\cdot\text{m}^3\cdot\text{s}^{-2}.

Adım Adım Çözüm

1
Rearrange the gravitational formula to solve for GG
G=Fr2m1m2G = \frac{F \cdot r^2}{m_1 \cdot m_2}
To express the unit of GG, we need it in terms of quantities with known units.
2
Substitute the SI unit for force in fundamental base units
\text{Unit of } F = \text{N} = \text{kg}\cdot\text{m}\cdot\text{s}^{-2}
Force is mass times acceleration (F=maF = ma), so its base unit is kgms2\text{kg}\cdot\text{m}\cdot\text{s}^{-2}.
3
Substitute all base units into the formula for GG
\text{Unit of } G = \frac{(\text{kg}\cdot\text{m}\cdot\text{s}^{-2}) \cdot \text{m}^2}{\text{kg} \cdot \text{kg}} = \frac{\text{kg}\cdot\text{m}^3\cdot\text{s}^{-2}}{\text{kg}^2}
Combining length terms (mm2=m3\text{m} \cdot \text{m}^2 = \text{m}^3) and mass terms in the denominator.
4
Simplify the mass exponent using laws of indices
\text{Unit of } G = \text{kg}^{1 - 2}\cdot\text{m}^3\cdot\text{s}^{-2} = \text{kg}^{-1}\cdot\text{m}^3\cdot\text{s}^{-2}
Dividing by kg2\text{kg}^2 subtracts 2 from the mass exponent.

Anahtar Kavram

Derivation of Derived Units in Base SI Units
Tahmini Süre:1m 15s
Soru 7871Soru

The rate of change of a function f(x)f(x) with respect to xx is defined by f(x)=3x24x+6sin(3x)f'(x) = 3x^2 - 4x + 6\sin(3x). If f(0)=7f(0) = 7, determine the value of the constant of integration, CC.

Cevabı ve açıklamayı göster

Cevap: 9

Cevap

The constant of integration CC is equal to 9.
Integrating f(x)=3x24x+6sin(3x)f'(x) = 3x^2 - 4x + 6\sin(3x) gives f(x)=x32x22cos(3x)+Cf(x) = x^3 - 2x^2 - 2\cos(3x) + C. Substituting x=0x = 0 and f(0)=7f(0) = 7 leads to 7=002(1)+C7 = 0 - 0 - 2(1) + C, which simplifies to C=9C = 9.

Adım Adım Çözüm

1
Integrate the rate of change function f(x)=3x24x+6sin(3x)f'(x) = 3x^2 - 4x + 6\sin(3x) with respect to xx.
f(x)=x32x22cos(3x)+Cf(x) = x^3 - 2x^2 - 2\cos(3x) + C
Using the power rule xndx=xn+1n+1\int x^n dx = \frac{x^{n+1}}{n+1} and trigonometric integration rule sin(kx)dx=1kcos(kx)\int \sin(kx) dx = -\frac{1}{k}\cos(kx).
2
Substitute the initial condition x=0x = 0 and f(0)=7f(0) = 7 into the expression for f(x)f(x).
7=(0)32(0)22cos(30)+C7 = (0)^3 - 2(0)^2 - 2\cos(3 \cdot 0) + C
The curve passes through x=0x = 0 with value y=7y = 7.
3
Evaluate the trigonometric term at zero and solve for CC.
7=2(1)+C    C=97 = -2(1) + C \implies C = 9
Since cos(0)=1\cos(0) = 1, the expression simplifies to 7=2+C7 = -2 + C, yielding C=9C = 9.

Anahtar Kavram

Indefinite Integration of Polynomial and Trigonometric Functions with Boundary Conditions
Soru 7872Soru

A sound transmitter and a projectile launcher are co-located at a distance of 210 m210\text{ m} directly in front of a tall, flat vertical cliff. At time t=0 st = 0\text{ s}, a projectile is launched directly away from the cliff at a constant speed of 60 m s160\text{ m s}^{-1}, while a sound pulse is emitted simultaneously towards the cliff. The sound wave reflects off the cliff face and travels back to overtake the moving projectile. Assuming the speed of sound in air is 340 m s1340\text{ m s}^{-1}, calculate the distance from the cliff face, in meters, to the position where the reflected sound wave intercepts the projectile.

Cevabı ve açıklamayı göster

Cevap: 300

Cevap

The distance of the projectile from the cliff face at the instant of interception is 300 m300\text{ m}.
The correct calculation accounts for both the two-part path of the sound wave (forward to cliff + back to projectile) and the displacement of the projectile moving away from the cliff over the same time interval, yielding an interception distance of 300 m300\text{ m} from the cliff.

Adım Adım Çözüm

1
Set up the total distance expression for the sound wave from the cliff face
Total sound path = 210 m+x210\text{ m} + x
The sound pulse must travel 210 m210\text{ m} forward to hit the cliff face, plus an additional distance xx away from the cliff face after reflection to reach the projectile.
2
Set up the distance expression for the projectile from its starting point
Projectile path = x210 mx - 210\text{ m}
The projectile starts 210 m210\text{ m} away from the cliff and moves farther away to position xx.
3
Equate the time elapsed for both sound propagation and projectile movement
210+x340=x21060\frac{210 + x}{340} = \frac{x - 210}{60}
Both events happen simultaneously over the exact same time interval tt.
4
Solve the linear equation for xx
x=300 mx = 300\text{ m}
Cross-multiplying yields 60(210+x)=340(x210)60(210 + x) = 340(x - 210), which simplifies to 28x=840028x = 8400, giving x=300 mx = 300\text{ m}.

Anahtar Kavram

Echo reflection path combined with relative linear kinematics
Soru 7873Soru

A progressive wave traveling along a stretched string is represented by the equation y=0.02sin(120πt3πx)y = 0.02 \sin(120\pi t - 3\pi x), where xx and yy are in meters and tt is in seconds. What is the velocity of the wave in m s1\text{m s}^{-1}?

Cevabı ve açıklamayı göster

Cevap: 40

Cevap

The velocity of the wave is 40 m s140 \text{ m s}^{-1}.
The standard progressive wave equation is y=Asin(ωtkx)y = A \sin(\omega t - kx), where ω\omega is the angular frequency and kk is the wave number (wave vector). Comparing the given equation y=0.02sin(120πt3πx)y = 0.02 \sin(120\pi t - 3\pi x) with the standard form yields ω=120π rad s1\omega = 120\pi \text{ rad s}^{-1} and k=3π m1k = 3\pi \text{ m}^{-1}. The velocity of propagation of the wave is given by v=ωk=120π3π=40 m s1v = \frac{\omega}{k} = \frac{120\pi}{3\pi} = 40 \text{ m s}^{-1}.

Adım Adım Çözüm

1
Compare given equation with the standard progressive wave equation
Matching y=0.02sin(120πt3πx)y = 0.02 \sin(120\pi t - 3\pi x) to y=Asin(ωtkx)y = A \sin(\omega t - kx) gives ω=120π rad s1\omega = 120\pi \text{ rad s}^{-1} and k=3π rad m1k = 3\pi \text{ rad m}^{-1}.
Direct parameter identification from the wave function gives the angular frequency and wave number.
2
Calculate wave velocity
Wave velocity v=ωk=120π3π=40 m s1v = \frac{\omega}{k} = \frac{120\pi}{3\pi} = 40 \text{ m s}^{-1}.
The ratio of angular frequency to wave number equals the phase velocity of the wave.

Anahtar Kavram

Extracting wave parameters (angular frequency and wave number) from the mathematical wave equation to determine wave velocity.
Soru 7874Soru

A particle is projected from ground level at an angle to the horizontal. At its highest point of trajectory, which of the following statements correctly describes its velocity and acceleration?

Cevabı ve açıklamayı göster

Cevap: The vertical component of velocity is zero, the horizontal component of velocity is non-zero, and the acceleration is directed downward.

Cevap

At the highest point of projectile motion, the vertical velocity component is zero, the horizontal velocity component is non-zero, and acceleration due to gravity acts downward.
At the peak of a projectile trajectory, vertical upward velocity is fully decelerated by gravity to zero. However, horizontal velocity is maintained because there is no horizontal acceleration. Acceleration due to gravity continues to act constantly downward.

Adım Adım Çözüm

1
Analyze vertical velocity at the highest point
vy=0v_y = 0
At maximum height, the upward vertical component of motion reduces to zero before the particle begins descending.
2
Analyze horizontal velocity throughout motion
vx=ucosθ0v_x = u \cos\theta \neq 0
In the absence of air resistance, no horizontal force acts on the projectile, keeping horizontal velocity constant throughout flight.
3
Determine the direction of acceleration
a=ga = g acting vertically downward
Gravity is the only force acting on a projectile in motion, providing continuous downward acceleration.

Anahtar Kavram

Velocity components and acceleration at the apex of projectile motion
Tahmini Süre:45s
Soru 7875Soru

In an X-ray tube operated at a fixed accelerating potential, replacing the target anode with a metal of higher atomic number decreases the cut-off (minimum) wavelength λmin\lambda_{\text{min}} of the continuous X-ray spectrum.

Cevabı ve açıklamayı göster

Cevap: False

Cevap

False
The statement is false because, by the Duane-Hunt law (eV=hcλmineV = \frac{hc}{\lambda_{\text{min}}}), the minimum cut-off wavelength depends strictly on the accelerating potential VV applied across the tube and fundamental physical constants. It is completely independent of the target material's atomic number ZZ.

Adım Adım Çözüm

1
Identify the relationship governing the minimum (cut-off) wavelength of continuous X-rays.
By the Duane-Hunt law, the maximum energy of an emitted X-ray photon equals the total kinetic energy of an accelerating electron: Emax=eV=hcλminE_{\text{max}} = eV = \frac{hc}{\lambda_{\text{min}}}.
The continuous X-ray spectrum is produced via Bremsstrahlung (braking radiation) when high-speed electrons are decelerated by the electric fields of target nuclei.
2
Express the minimum wavelength λmin\lambda_{\text{min}} in terms of operational variables.
Rearranging the equation yields λmin=hceV\lambda_{\text{min}} = \frac{hc}{eV}, where hh is Planck's constant, cc is the speed of light, ee is the elementary charge, and VV is the tube potential.
This formula establishes that λmin\lambda_{\text{min}} depends exclusively on the accelerating voltage VV and physical constants.
3
Analyze the effect of altering the target material's atomic number ZZ at constant voltage VV.
Changing the atomic number ZZ shifts characteristic spectral line wavelengths (via Moseley's law) and increases overall Bremsstrahlung intensity, but leaves λmin\lambda_{\text{min}} entirely unchanged.
Since ZZ does not enter the Duane-Hunt expression for λmin\lambda_{\text{min}}, varying ZZ has zero effect on the shortest emitted wavelength.

Anahtar Kavram

Duane-Hunt Law and Cut-off Wavelength Independence from Target Material
Soru 7876Soru

An X-ray tube operates at an initial potential difference of V1V_1. When the potential difference is increased by 20.0 kV20.0\text{ kV}, the minimum cutoff wavelength of the emitted X-rays is reduced to one-third of its initial value. What is the initial operating potential difference V1V_1 of the X-ray tube?

Cevabı ve açıklamayı göster

Cevap: 10.0 kV10.0\text{ kV}

Cevap

The initial operating potential difference of the tube is 10.0 kV10.0\text{ kV}.
The Duane-Hunt law states that λmin=hceV\lambda_{\text{min}} = \frac{hc}{eV}. Because minimum wavelength is inversely proportional to potential difference, reducing the minimum wavelength to one-third requires the operating potential to increase by a factor of three (V2=3V1V_2 = 3V_1). Given that V2=V1+20.0 kVV_2 = V_1 + 20.0\text{ kV}, setting V1+20.0 kV=3V1V_1 + 20.0\text{ kV} = 3V_1 gives 2V1=20.0 kV2V_1 = 20.0\text{ kV}, which solves to V1=10.0 kVV_1 = 10.0\text{ kV}.

Adım Adım Çözüm

1
Relate the minimum cutoff wavelength to potential difference using the Duane-Hunt law.
λmin=hceV\lambda_{\text{min}} = \frac{hc}{eV}, which implies λmin1V\lambda_{\text{min}} \propto \frac{1}{V}.
The maximum photon energy equals the kinetic energy of the incident electrons.
2
Set up the ratio between initial and final conditions.
Since λ2=13λ1\lambda_2 = \frac{1}{3}\lambda_1, the new voltage must be three times the initial voltage: V2=3V1V_2 = 3V_1.
Cutoff wavelength is inversely proportional to accelerating voltage.
3
Substitute V2=V1+20.0 kVV_2 = V_1 + 20.0\text{ kV} into the equation V2=3V1V_2 = 3V_1 and solve for V1V_1.
V1+20.0 kV=3V1    2V1=20.0 kV    V1=10.0 kVV_1 + 20.0\text{ kV} = 3V_1 \implies 2V_1 = 20.0\text{ kV} \implies V_1 = 10.0\text{ kV}.
Solving the linear algebraic equation yields the initial potential difference.

Anahtar Kavram

Duane-Hunt Law and Inverse Relationship between Minimum Wavelength and Accelerating Potential
Tahmini Süre:2m 0s
Soru 7877Soru

The sum of the first 44 terms of a geometric progression (GP) with a common ratio of 22 is 4545. What is the 6th6^{\text{th}} term of the progression?

Cevabı ve açıklamayı göster

Cevap: 96

Cevap

The 6th6^{\text{th}} term of the geometric progression is 9696.
Using the sum formula S4=a(241)21=45S_4 = \frac{a(2^4 - 1)}{2 - 1} = 45 gives 15a=4515a = 45, so the first term aa is 33. Substituting a=3a = 3 and r=2r = 2 into the term formula T6=ar5T_6 = a r^5 gives 3×32=963 \times 32 = 96.

Adım Adım Çözüm

1
Express the sum of the first 4 terms using the GP sum formula to find the first term aa.
Setting up 45=a(241)2145 = \frac{a(2^4 - 1)}{2 - 1} yields 15a=4515a = 45, so a=3a = 3.
The sum formula Sn=a(rn1)r1S_n = \frac{a(r^n - 1)}{r - 1} allows us to isolate the unknown initial term aa when S4S_4 and rr are given.
2
Calculate the 6th6^{\text{th}} term T6T_6 using the nthn^{\text{th}} term formula Tn=arn1T_n = a r^{n-1}.
T6=3×261=3×32=96T_6 = 3 \times 2^{6-1} = 3 \times 32 = 96.
The exponent for the common ratio in the nthn^{\text{th}} term formula is n1n - 1, giving 55 as the exponent.

Anahtar Kavram

Sum and nthn^{\text{th}} term of a Geometric Progression
Soru 7878Soru

What is the value of the definite integral 0π2(3sinx+2cosx)dx\int_{0}^{\frac{\pi}{2}} (3\sin x + 2\cos x) \, dx?

Cevabı ve açıklamayı göster

Cevap: 55

Cevap

The value of the definite integral is 55.
The antiderivative of 3sinx+2cosx3\sin x + 2\cos x is 3cosx+2sinx-3\cos x + 2\sin x. Evaluating this expression at the upper limit x=π2x = \frac{\pi}{2} gives 22, and at the lower limit x=0x = 0 gives 3-3. Applying the Fundamental Theorem of Calculus gives 2(3)=52 - (-3) = 5.

Adım Adım Çözüm

1
Find the indefinite integral of 3sinx+2cosx3\sin x + 2\cos x
(3sinx+2cosx)dx=3cosx+2sinx\int (3\sin x + 2\cos x) \, dx = -3\cos x + 2\sin x
The antiderivative of sinx\sin x is cosx-\cos x and the antiderivative of cosx\cos x is sinx\sin x.
2
Evaluate the antiderivative at the upper limit x=π2x = \frac{\pi}{2}
-3\cos\left(\frac{\pi}{2}\right) + 2\sin\left(\frac{\pi}{2}\right) = -3(0) + 2(1) = 2
Substitute x=π2x = \frac{\pi}{2} into the antiderivative expression.
3
Evaluate the antiderivative at the lower limit x=0x = 0
-3\cos(0) + 2\sin(0) = -3(1) + 2(0) = -3
Substitute x=0x = 0 into the antiderivative expression.
4
Subtract the lower limit value from the upper limit value
2 - (-3) = 2 + 3 = 5
By the Fundamental Theorem of Calculus, abf(x)dx=F(b)F(a)\int_{a}^{b} f(x)\,dx = F(b) - F(a).

Anahtar Kavram

Definite Integration of Trigonometric Functions
Tahmini Süre:1m 30s
Soru 7879Soru

The sum of the first nn terms of an arithmetic progression (A.P.) is given by Sn=2n2+3nS_n = 2n^2 + 3n. What is the 5th5^{\text{th}} term of the progression?

Cevabı ve açıklamayı göster

Cevap: 2121

Cevap

The 5th5^{\text{th}} term of the arithmetic progression is 2121.
The nthn^{\text{th}} term of a sequence can be determined from its sum formula using Tn=SnSn1T_n = S_n - S_{n-1}. Evaluating S5=2(5)2+3(5)=65S_5 = 2(5)^2 + 3(5) = 65 and S4=2(4)2+3(4)=44S_4 = 2(4)^2 + 3(4) = 44, the difference T5=6544=21T_5 = 65 - 44 = 21 gives the correct value of the 5th5^{\text{th}} term.

Adım Adım Çözüm

1
Calculate the sum of the first 5 terms (S5S_5)
S5=2(5)2+3(5)=2(25)+15=65S_5 = 2(5)^2 + 3(5) = 2(25) + 15 = 65
To find the sum up to the 5th5^{\text{th}} term using the given formula Sn=2n2+3nS_n = 2n^2 + 3n.
2
Calculate the sum of the first 4 terms (S4S_4)
S4=2(4)2+3(4)=2(16)+12=44S_4 = 2(4)^2 + 3(4) = 2(16) + 12 = 44
To find the cumulative total of all terms prior to the 5th5^{\text{th}} term.
3
Subtract S4S_4 from S5S_5 to isolate the 5th5^{\text{th}} term (T5T_5)
T5=S5S4=6544=21T_5 = S_5 - S_4 = 65 - 44 = 21
The nthn^{\text{th}} term of any sequence is given by the relation Tn=SnSn1T_n = S_n - S_{n-1}.

Anahtar Kavram

Relationship between the sum of nn terms (SnS_n) and the nthn^{\text{th}} term (TnT_n) in an Arithmetic Progression
Tahmini Süre:1m 30s
Soru 7880Soru

The energy of an electron in the first excited state of a hydrogen atom is 3.4 eV-3.4\text{ eV}. What is the minimum energy, in joules (J\text{J}), required to completely remove the electron from this state to ionize the atom? (1 eV=1.6×1019 J1\text{ eV} = 1.6 \times 10^{-19}\text{ J})

Cevabı ve açıklamayı göster

Cevap: 5.44e-19

Cevap

The minimum energy required to ionize the atom from its first excited state is 5.44×1019 J5.44 \times 10^{-19}\text{ J}.
Ionization energy is defined as the minimum energy necessary to completely remove an electron from its bound atomic energy level to infinity (E=0 eVE_{\infty} = 0\text{ eV}). For an electron at E=3.4 eVE = -3.4\text{ eV}, the required energy change is ΔE=0(3.4 eV)=3.4 eV\Delta E = 0 - (-3.4\text{ eV}) = 3.4\text{ eV}. Converting this to joules using 1 eV=1.6×1019 J1\text{ eV} = 1.6 \times 10^{-19}\text{ J} gives 3.4×1.6×1019=5.44×1019 J3.4 \times 1.6 \times 10^{-19} = 5.44 \times 10^{-19}\text{ J}.

Adım Adım Çözüm

1
Determine the energy required for ionization in electron-volts (eV)
ΔE=EE2=0 eV(3.4 eV)=3.4 eV\Delta E = E_{\infty} - E_2 = 0\text{ eV} - (-3.4\text{ eV}) = 3.4\text{ eV}
Ionization requires supplying sufficient energy to raise the electron from its bound energy state (E2=3.4 eVE_2 = -3.4\text{ eV}) to the ionization limit where it is free (E=0 eVE_{\infty} = 0\text{ eV}).
2
Convert the ionization energy from electron-volts to joules
E=3.4 eV×1.6×1019 J/eV=5.44×1019 JE = 3.4\text{ eV} \times 1.6 \times 10^{-19}\text{ J/eV} = 5.44 \times 10^{-19}\text{ J}
To convert energy from electron-volts (eV) to joules (J), multiply the value in eV by the elementary charge conversion factor 1.6×1019 J/eV1.6 \times 10^{-19}\text{ J/eV}.

Anahtar Kavram

Ionization Energy and Energy Level Transitions
Tahmini Süre:1m 30s
ÖncekiSayfa 394 / 697Sonraki
Tüm alıştırma soruları — JAMB UTME | Examkin