Tüm alıştırma soruları

2789 soru

Soru 101Soru

In right triangle ABCABC, the measure of angle CC is 9090^\circ. If sin(A)cos(A)=15\sin(A) - \cos(A) = \frac{1}{5}, what is the value of sin(A)sin(B)\sin(A)\sin(B)?

Cevabı ve açıklamayı göster

Cevap: 1225\frac{12}{25}

Cevap

1225\frac{12}{25}
By the co-function identity for complementary angles in a right triangle, sin(B)=cos(A)\sin(B) = \cos(A), which means the expression sin(A)sin(B)\sin(A)\sin(B) is equivalent to sin(A)cos(A)\sin(A)\cos(A). Squaring the equation sin(A)cos(A)=15\sin(A) - \cos(A) = \frac{1}{5} gives sin2(A)2sin(A)cos(A)+cos2(A)=125\sin^2(A) - 2\sin(A)\cos(A) + \cos^2(A) = \frac{1}{25}. Substituting the Pythagorean identity sin2(A)+cos2(A)=1\sin^2(A) + \cos^2(A) = 1 simplifies this to 12sin(A)cos(A)=1251 - 2\sin(A)\cos(A) = \frac{1}{25}. Solving for sin(A)cos(A)\sin(A)\cos(A) yields 2sin(A)cos(A)=24252\sin(A)\cos(A) = \frac{24}{25}, or sin(A)cos(A)=1225\sin(A)\cos(A) = \frac{12}{25}.

Adım Adım Çözüm

1
Express the target expression in terms of a single angle using complementary relationships.
Since angle C=90C = 90^\circ, angles AA and BB are complementary, so sin(B)=cos(A)\sin(B) = \cos(A). Thus, sin(A)sin(B)=sin(A)cos(A)\sin(A)\sin(B) = \sin(A)\cos(A).
In any right triangle, the sine of one acute angle equals the cosine of the other acute angle.
2
Square both sides of the given equation sin(A)cos(A)=15\sin(A) - \cos(A) = \frac{1}{5}.
(sin(A)cos(A))2=(15)2    sin2(A)2sin(A)cos(A)+cos2(A)=125(\sin(A) - \cos(A))^2 = \left(\frac{1}{5}\right)^2 \implies \sin^2(A) - 2\sin(A)\cos(A) + \cos^2(A) = \frac{1}{25}.
Squaring the difference allows us to introduce the product term sin(A)cos(A)\sin(A)\cos(A) and the squared terms.
3
Apply the Pythagorean identity to simplify the equation.
Since sin2(A)+cos2(A)=1\sin^2(A) + \cos^2(A) = 1, the equation becomes 12sin(A)cos(A)=1251 - 2\sin(A)\cos(A) = \frac{1}{25}.
The sum of the squares of sine and cosine of the same angle is always equal to 1.
4
Solve for the product sin(A)cos(A)\sin(A)\cos(A).
2sin(A)cos(A)=1125=2425    sin(A)cos(A)=12252\sin(A)\cos(A) = 1 - \frac{1}{25} = \frac{24}{25} \implies \sin(A)\cos(A) = \frac{12}{25}.
Subtracting 1/251/25 from 11 and dividing the resulting fraction by 22 isolates the target product.

Anahtar Kavram

Pythagorean identity and co-function relationships in right triangles
Soru 102Soru

The amount of a radioactive isotope remaining after tt days is modeled by the function A(t)=A0(0.64)t2A(t) = A_0(0.64)^{\frac{t}{2}}, where A0A_0 is the initial amount of the isotope. If the function is rewritten in the form A(t)=A0(1r)tA(t) = A_0(1 - r)^t, where rr is the daily decay rate, what is the value of rr?

Cevabı ve açıklamayı göster

Cevap: 0.20

Cevap

The daily decay rate rr is 0.200.20.
The correct value of rr is 0.200.20. By rewriting the given expression using exponent rules, we obtain (0.64)t/2=((0.64)1/2)t=(0.8)t(0.64)^{t/2} = ((0.64)^{1/2})^t = (0.8)^t. Setting the base equal to the target decay rate form gives 1r=0.81 - r = 0.8, which simplifies to r=0.20r = 0.20.

Adım Adım Çözüm

1
Apply the power of a power exponent rule, (xa)b=xab(x^a)^b = x^{ab}, to rewrite the exponential term.
A(t)=A0(0.641/2)tA(t) = A_0\left(0.64^{1/2}\right)^t
This isolates the variable tt as the exponent, allowing us to find the daily decay factor.
2
Evaluate the base 0.641/20.64^{1/2}.
0.64=0.8\sqrt{0.64} = 0.8, so the expression becomes A(t)=A0(0.8)tA(t) = A_0(0.8)^t.
Calculating the square root of 0.640.64 gives the daily decay factor of 0.80.8.
3
Equate the daily decay factor 0.80.8 to the target form 1r1 - r and solve for rr.
1r=0.8    r=0.201 - r = 0.8 \implies r = 0.20
Solving the equation gives the value of the daily decay rate.

Anahtar Kavram

Rewriting exponential equations by manipulating bases and exponents

Alternatif Yöntem

We can solve for rr by choosing a specific value for tt, such as t=2t = 2. After 2 days, the remaining amount is A(2)=A0(0.64)1=0.64A0A(2) = A_0(0.64)^1 = 0.64A_0. Using the target equation form, the remaining amount after 2 days is A0(1r)2A_0(1 - r)^2. Setting the two expressions equal to each other gives A0(1r)2=0.64A0A_0(1 - r)^2 = 0.64A_0. Dividing both sides by A0A_0 gives (1r)2=0.64(1 - r)^2 = 0.64. Taking the square root of both sides gives 1r=0.81 - r = 0.8, which yields r=0.20r = 0.20.
Tahmini Süre:1m 30s
Soru 103Soru

In right triangle ABCABC, the measure of angle BB is 9090^\circ. The acute angles AA and CC satisfy sin(A)=k3\sin(A) = \frac{k}{3} and cos(C)=4k+4\cos(C) = \frac{4}{k+4} for some positive constant kk. What is the value of kk?

Cevabı ve açıklamayı göster

Cevap: 2

Cevap

2
In right triangle ABCABC, the measure of angle BB is 9090^\circ, which means the acute angles AA and CC are complementary. Therefore, the co-function identity states that sin(A)=cos(C)\sin(A) = \cos(C). Equating the given expressions yields k3=4k+4\frac{k}{3} = \frac{4}{k+4}. Cross-multiplying results in k(k+4)=12k(k+4) = 12, which simplifies to k2+4k12=0k^2 + 4k - 12 = 0. Factoring this equation gives (k+6)(k2)=0(k+6)(k-2) = 0. This quadratic has solutions k=6k = -6 and k=2k = 2. Since kk must be positive, the value of kk is 22.

Adım Adım Çözüm

1
Identify the relationship between the acute angles in a right triangle.
Since the measure of angle BB is 9090^\circ, the sum of angles AA and CC is 9090^\circ, which means they are complementary angles. By the co-function identity, sin(A)=cos(C)\sin(A) = \cos(C).
In a right triangle, the sine of one acute angle equals the cosine of the other acute angle.
2
Equate the expressions for sin(A)\sin(A) and cos(C)\cos(C) and set up the equation for kk.
k3=4k+4\frac{k}{3} = \frac{4}{k+4}
This sets up the algebraic relation to solve for kk using the given trigonometric expressions.
3
Solve the algebraic equation for kk.
Cross-multiplying gives k(k+4)=12k(k+4) = 12, which expands to k2+4k=12k^2 + 4k = 12. Subtracting 1212 from both sides results in the quadratic equation k2+4k12=0k^2 + 4k - 12 = 0. Factoring this equation yields (k+6)(k2)=0(k+6)(k-2) = 0.
Cross-multiplication eliminates the denominators, converting the equation to a quadratic form that can be solved by factoring.
4
Determine the valid positive value for kk.
The solutions to the equation (k+6)(k2)=0(k+6)(k-2) = 0 are k=6k = -6 and k=2k = 2. Since kk must be a positive constant, we select k=2k = 2.
The problem specifies that kk is a positive constant, so the negative solution is discarded.

Anahtar Kavram

Co-function identity relating sine and cosine of complementary angles
Tahmini Süre:1m 30s
Soru 104Soru

If the expression (x+4)2(x4)2(x + 4)^2 - (x - 4)^2 is equivalent to kxkx for all values of xx, where kk is a constant, what is the value of kk?

Cevabı ve açıklamayı göster

Cevap: 16

Cevap

The value of the constant kk is 1616.
To find the value of kk, the expression (x+4)2(x4)2(x + 4)^2 - (x - 4)^2 is simplified by expanding both binomials. The first binomial expands to x2+8x+16x^2 + 8x + 16, and the second binomial expands to x28x+16x^2 - 8x + 16. Subtracting the second expression from the first requires distributing the negative sign across all terms: (x2+8x+16)(x28x+16)=x2x2+8x(8x)+1616=16x(x^2 + 8x + 16) - (x^2 - 8x + 16) = x^2 - x^2 + 8x - (-8x) + 16 - 16 = 16x. Equating 16x16x to kxkx yields k=16k = 16.

Adım Adım Çözüm

1
Expand the first squared term, (x+4)2(x + 4)^2
x2+8x+16x^2 + 8x + 16
Applying the binomial expansion formula (a+b)2=a2+2ab+b2(a + b)^2 = a^2 + 2ab + b^2 where a=xa = x and b=4b = 4.
2
Expand the second squared term, (x4)2(x - 4)^2
x28x+16x^2 - 8x + 16
Applying the binomial expansion formula (ab)2=a22ab+b2(a - b)^2 = a^2 - 2ab + b^2 where a=xa = x and b=4b = 4.
3
Subtract the second expanded expression from the first and simplify
16x16x
Group like terms and distribute the negative sign: (x2+8x+16)(x28x+16)=x2x2+8x+8x+1616=16x(x^2 + 8x + 16) - (x^2 - 8x + 16) = x^2 - x^2 + 8x + 8x + 16 - 16 = 16x.
4
Equate the simplified expression to kxkx to determine the constant kk
k=16k = 16
Since 16x=kx16x = kx for all values of xx, the coefficients must be equal.

Anahtar Kavram

Equivalent Algebraic Expressions
Soru 105Soru

In the study of historical sociology, researchers often examine how structural changes in communication technologies influence social movements. While early theories suggested that the printing press directly caused the Protestant Reformation, contemporary scholars argue that the technology’s impact was actually ________ by pre-existing trade networks and literacy rates, which dictated where and how quickly new ideas could spread.

Which choice completes the text with the most logical and precise word or phrase?

Cevabı ve açıklamayı göster

Cevap: mediated

Cevap

mediated
The correct answer is 'mediated'. In this context, 'mediated' means influenced, channeled, or moderated by an intervening factor. The passage contrasts the early theory of direct causation with the contemporary view that the printing press's impact was shaped or channeled by pre-existing trade networks and literacy rates.

Adım Adım Çözüm

1
Analyze the context of the sentence containing the blank.
The sentence sets up a contrast between an early theory ('printing press directly caused the Protestant Reformation') and contemporary views ('was actually ________ by pre-existing trade networks').
Understanding the contrast helps determine that the blank must describe how the printing press's impact was modified or channeled by other factors, rather than being direct.
2
Evaluate the choices to find the word that means influenced, channeled, or moderated by intervening factors.
The word 'mediated' fits this definition perfectly, as the trade networks and literacy rates acted as intervening channels for the technology's impact.
Selecting the option that matches the contextual meaning of moderation or channeling by secondary factors.

Anahtar Kavram

Words in Context: High-Utility Vocabulary
Tahmini Süre:1m 0s
Soru 106Soru

For decades, agricultural scientists assumed that soil quality was determined solely by chemical composition. However, recent research highlights the role of soil microbiomes, demonstrating that diverse microbial communities are crucial to plant health. Consequently, focusing exclusively on chemical inputs represents a ___________ approach that overlooks the dynamic, biological systems essential for sustainable crop yields.

Which choice completes the text with the most logical and precise word or phrase?

Cevabı ve açıklamayı göster

Cevap: myopic

Cevap

The correct answer is the word describing a narrow or short-sighted approach, which is 'myopic'.
The correct option is the word that describes a short-sighted or narrow perspective. In the context of the passage, focusing solely on chemical inputs and neglecting the crucial biological aspects of soil microbiomes is described as a narrow approach that overlooks essential factors. The word 'myopic' precisely conveys this meaning of being short-sighted or lacking foresight.

Adım Adım Çözüm

1
Analyze the context of the sentence containing the blank.
The sentence indicates that focusing 'exclusively on chemical inputs' results in an approach that 'overlooks the dynamic, biological systems' of the soil.
This shows that the blank requires a word describing an approach that is narrow, short-sighted, or limited in its view.
2
Evaluate the choices to find the word that best conveys a short-sighted or narrow perspective.
The word 'myopic' means short-sighted or lacking foresight, which precisely describes focusing on one narrow aspect while ignoring the broader biological reality. Other choices do not match this meaning.
This identifies the correct choice based on contextual meaning.

Anahtar Kavram

Contextual vocabulary usage requires identifying logical transitions and connotations in a text to select the most precise word.
Soru 107Soru

Sociologist Dr. Liam O'Connor and colleagues investigated the social impact of urban "pocket parks"—small public green spaces built on single vacant lots. O'Connor hypothesized that pocket parks with active community-led stewardship, such as neighborhood-organized planting groups, foster stronger local social cohesion than pocket parks maintained exclusively by municipal government workers. To test this hypothesis, the researchers surveyed residents living within a two-block radius of various pocket parks.

Which choice, if true, would most directly support O'Connor and colleagues' hypothesis?

Cevabı ve açıklamayı göster

Cevap: Residents living near community-stewardship parks reported knowing their neighbors by name and participating in local cooperative efforts at a significantly higher rate than residents near municipally maintained parks.

Cevap

The option stating that residents near community-stewardship parks reported knowing their neighbors by name and participating in local cooperative efforts at a higher rate.
The correct choice directly supports the hypothesis by showing a clear, positive correlation between community-led stewardship and indicators of social cohesion (knowing neighbors by name and cooperating locally) compared to municipally maintained parks.

Adım Adım Çözüm

1
Identify the researchers' hypothesis in the passage.
The hypothesis is that pocket parks with community-led stewardship foster stronger local social cohesion than parks maintained exclusively by municipal workers.
Understanding the precise claim is necessary to determine what evidence would support it.
2
Evaluate the choices to find one that compares the two types of parks in terms of social cohesion.
The correct option shows a clear difference in neighborhood ties (knowing neighbors, cooperative efforts) in favor of community-led stewardship parks.
Supporting evidence must directly connect community stewardship to increased social cohesion.
3
Eliminate choices that focus on unrelated outcomes or fail to compare the two types of parks.
Options about biodiversity, general park visits, or future desires are eliminated because they do not support the specific comparative claim.
Distractors often present true statements or related concepts that do not address the specific hypothesis.

Anahtar Kavram

Identifying textual evidence that directly supports a specific research hypothesis.
Soru 108Soru

Lines L1L_1 and L2L_2 are parallel. Points PP and QQ lie on line L1L_1, and points RR and SS lie on line L2L_2. Segment PSPS and segment QRQR intersect at point TT. If the measure of angle TPQTPQ is 3838^\circ and the measure of angle PTQPTQ is 105105^\circ, what is the measure, in degrees, of angle TRSTRS?

Cevabı ve açıklamayı göster

Cevap: 37

Cevap

37
To find the measure of angle TRSTRS, we first find the measure of angle TQPTQP using the property that the sum of interior angles in triangle TPQTPQ is 180180^\circ. This gives TQP=18038105=37\angle TQP = 180^\circ - 38^\circ - 105^\circ = 37^\circ. Since lines L1L_1 and L2L_2 are parallel, the transversal line QRQR creates alternate interior angles that are equal in measure. Therefore, angle TRSTRS is equal to angle TQPTQP, which is 3737^\circ.

Adım Adım Çözüm

1
Calculate the measure of angle TQPTQP in triangle TPQTPQ.
TQP=37\angle TQP = 37^\circ
The sum of the angles in a triangle is 180180^\circ. Therefore, TQP=180TPQPTQ=18038105=37\angle TQP = 180^\circ - \angle TPQ - \angle PTQ = 180^\circ - 38^\circ - 105^\circ = 37^\circ.
2
Relate angle TQPTQP to angle TRSTRS using parallel line properties.
TRS=37\angle TRS = 37^\circ
Since line L1L_1 is parallel to line L2L_2, the transversal line QRQR creates equal alternate interior angles. Thus, TRS=TQP=37\angle TRS = \angle TQP = 37^\circ.

Anahtar Kavram

Alternate interior angles and triangle angle sum theorem
Soru 109Soru

In a 2018 study of traditional Andean music, ethnomusicologist Sofia Morales analyzed the *caja*, a small hand-held drum played during agricultural festivals. Many scholars have argued that the instrument's primary function is strictly rhythmic, acting as a simple metronome for communal dances. However, Morales observed that players adjust their striking technique to produce specific resonant overtones that mimic the calls of highland birds during planting seasons. This subtle acoustic imitation does not merely accompany the ritual; rather, it actively integrates the natural environment into the performance. Thus, the *caja* serves a complex symbolic role, mediating the community's relationship with their ecological surroundings.

Which choice best describes the function of the underlined sentence in the text as a whole?

Cevabı ve açıklamayı göster

Cevap: It introduces a specific observation that complicates a common assumption about the primary function of the *caja*.

Cevap

The underlined sentence introduces a specific observation that complicates a common assumption about the primary function of the *caja*.
The correct answer identifies that the underlined sentence introduces a specific observation (players modifying their technique to mimic bird calls) that complicates the previous claim (that the drum serves a strictly rhythmic function). This is marked by the contrast transition word 'However' and directly transitions the reader from the traditional view to Morales's new interpretation.

Adım Adım Çözüm

1
Analyze the context before the underlined sentence.
The text states that many scholars view the *caja* as having a strictly rhythmic function, acting as a simple metronome.
This establishes the baseline consensus that the author is responding to.
2
Analyze the underlined sentence itself.
The underlined sentence begins with 'However' and notes that players adjust their technique to mimic bird calls.
This contrasts with the previous claim and presents a new finding about the drum's actual musical use.
3
Analyze the sentences after the underlined sentence.
The text explains that this imitation integrates the natural environment and concludes that the drum serves a complex symbolic role.
This demonstrates how the finding in the underlined sentence serves as a pivot or foundation for the passage's final conclusion.
4
Match the findings with the correct option.
The correct option describes this function as introducing an observation that complicates the common assumption.
It accurately represents the part-to-whole relationship of the sentence within the paragraph's structure.

Anahtar Kavram

Part-to-Whole Rhetorical Function
Tahmini Süre:1m 15s
Soru 110Soru

In marine ecosystems, the dinoflagellate *Noctiluca scintillans* exhibits bioluminescence when physically disturbed by predators. Researchers hypothesized that this bioluminescence acts as a 'burglar alarm,' illuminating the predator and attracting larger secondary predators that consume the primary predator. To test this, researchers placed the copepod *Temora longicornis* (a primary predator of *N. scintillans*) and three-spined stickleback fish (a secondary predator) in tanks containing *N. scintillans*. In dark conditions, stickleback predation on copepods was significantly higher in tanks with bioluminescent *N. scintillans* than in those with a non-bioluminescent mutant strain, suggesting that ______

Which choice most logically completes the text?

Cevabı ve açıklamayı göster

Cevap: the bioluminescence of *N. scintillans* aids stickleback fish in locating copepods under low-light conditions.

Cevap

The bioluminescence of *N. scintillans* aids stickleback fish in locating copepods under low-light conditions.
The correct option is supported because the experiment showed that sticklebacks successfully preyed on more copepods in dark conditions only when the dinoflagellates produced bioluminescence. This directly supports the idea that the bioluminescence acts as a beacon, helping the fish locate the copepods in the dark.

Adım Adım Çözüm

1
Identify the main premise and hypothesis in the passage.
The passage states that *N. scintillans* bioluminesces when disturbed, and researchers hypothesized this attracts secondary predators (stickleback fish) to consume primary predators (copepods) by illuminating them.
Understanding the setup helps determine what the experimental results should show.
2
Analyze the experimental results.
In dark conditions, stickleback predation on copepods was significantly higher in tanks with bioluminescent *N. scintillans* than in those with a non-bioluminescent mutant strain.
The difference in predation rate must be attributed to the only variable changed, which is the bioluminescence.
3
Draw a logical inference based on the results.
Since predation by sticklebacks (which are secondary predators) on copepods was higher when bioluminescence was present, the bioluminescence must have made the copepods more visible or easier to locate for the sticklebacks in the dark.
This connects the experimental result back to the hypothesis that the bioluminescence aids secondary predators.

Anahtar Kavram

Logical Inferences
Tahmini Süre:1m 30s
Soru 111Soru

In right triangle ABCABC, the measure of angle CC is 9090^\circ. If cos(A)=ksin(A)\cos(A) = k \sin(A) for some positive constant kk, which of the following expressions represents cos(B)\cos(B) in terms of kk?

Cevabı ve açıklamayı göster

Cevap: 11+k2\frac{1}{\sqrt{1 + k^2}}

Cevap

The expression that represents cos(B)\cos(B) is 11+k2\frac{1}{\sqrt{1 + k^2}}.
In right triangle ABCABC with right angle CC, the acute angles AA and BB are complementary (A+B=90A + B = 90^\circ). By the co-function identity, cos(B)=sin(A)\cos(B) = \sin(A). Using the given relation cos(A)=ksin(A)\cos(A) = k \sin(A) and substituting it into the Pythagorean identity sin2(A)+cos2(A)=1\sin^2(A) + \cos^2(A) = 1, we get sin2(A)+(ksin(A))2=1    sin2(A)(1+k2)=1\sin^2(A) + (k \sin(A))^2 = 1 \implies \sin^2(A)(1 + k^2) = 1. Solving for sin(A)\sin(A) gives sin(A)=11+k2\sin(A) = \frac{1}{\sqrt{1 + k^2}} because sin(A)\sin(A) must be positive for an acute angle. Since cos(B)=sin(A)\cos(B) = \sin(A), we conclude that the correct expression is 11+k2\frac{1}{\sqrt{1 + k^2}}.

Adım Adım Çözüm

1
Use the relationship between the acute angles in right triangle ABCABC.
Since angle CC is 9090^\circ, angles AA and BB are complementary. Thus, cos(B)=sin(A)\cos(B) = \sin(A).
This allows us to convert the target term cos(B)\cos(B) into sin(A)\sin(A), which can be related to the given equation.
2
Substitute the given relation cos(A)=ksin(A)\cos(A) = k \sin(A) into the Pythagorean identity.
Using sin2(A)+cos2(A)=1\sin^2(A) + \cos^2(A) = 1, we substitute to get sin2(A)+(ksin(A))2=1\sin^2(A) + (k \sin(A))^2 = 1, which simplifies to sin2(A)(1+k2)=1\sin^2(A)(1 + k^2) = 1.
This sets up a single equation containing only sin(A)\sin(A) and the constant kk.
3
Solve for sin(A)\sin(A) and substitute back to find cos(B)\cos(B).
Solving for sin(A)\sin(A) gives sin(A)=11+k2\sin(A) = \frac{1}{\sqrt{1 + k^2}} (since sin(A)>0\sin(A) > 0 for acute angle AA). Since cos(B)=sin(A)\cos(B) = \sin(A), we have cos(B)=11+k2\cos(B) = \frac{1}{\sqrt{1 + k^2}}.
This yields the final value of cos(B)\cos(B) in terms of kk.

Anahtar Kavram

Applying complementary angle trigonometric identities (co-functions) and the Pythagorean identity in a right triangle.

Alternatif Yöntem

Alternatively, you can model this by setting up a right triangle. Since cos(A)=ksin(A)\cos(A) = k \sin(A), we can divide both sides by sin(A)\sin(A) to get cot(A)=k\cot(A) = k, which means tan(A)=1k\tan(A) = \frac{1}{k}. In a right triangle ABCABC with right angle CC, tan(A)=oppositeadjacent=BCAC=1k\tan(A) = \frac{\text{opposite}}{\text{adjacent}} = \frac{BC}{AC} = \frac{1}{k}. Let BC=1BC = 1 and AC=kAC = k. By the Pythagorean theorem, the hypotenuse AB=12+k2=1+k2AB = \sqrt{1^2 + k^2} = \sqrt{1 + k^2}. Then, cos(B)=adjacent to Bhypotenuse=BCAB=11+k2\cos(B) = \frac{\text{adjacent to } B}{\text{hypotenuse}} = \frac{BC}{AB} = \frac{1}{\sqrt{1 + k^2}}.
Tahmini Süre:2m 0s
Soru 112Soru

The quadratic function ff is defined by f(x)=2x2+bx+cf(x) = -2x^2 + bx + c, where bb and cc are constants. In the xyxy-plane, the vertex of the graph of ff has an xx-coordinate of 33. If f(1)=2f(1) = 2, what is the yy-coordinate of the vertex of the graph of ff?

Cevabı ve açıklamayı göster

Cevap: 10

Cevap

10
The quadratic function in standard form is f(x)=2x2+bx+cf(x) = -2x^2 + bx + c, which has a leading coefficient of a=2a = -2. The vertex form of a quadratic function is f(x)=a(xh)2+kf(x) = a(x-h)^2 + k, where (h,k)(h, k) is the vertex of the parabola. Given that the xx-coordinate of the vertex is 33 (so h=3h = 3), we can write the function as f(x)=2(x3)2+kf(x) = -2(x-3)^2 + k. Since the graph passes through the point (1,2)(1, 2), we substitute x=1x = 1 and f(1)=2f(1) = 2 into the equation: 2=2(13)2+k2 = -2(1-3)^2 + k. Simplifying the expression gives 2=2(2)2+k2 = -2(-2)^2 + k, which becomes 2=2(4)+k2 = -2(4) + k, or 2=8+k2 = -8 + k. Adding 88 to both sides yields k=10k = 10. Thus, the yy-coordinate of the vertex is 1010.

Adım Adım Çözüm

1
Write the quadratic function in vertex form.
f(x)=2(x3)2+kf(x) = -2(x-3)^2 + k
The standard form equation f(x)=2x2+bx+cf(x) = -2x^2 + bx + c shows that the leading coefficient a=2a = -2. The vertex form is f(x)=a(xh)2+kf(x) = a(x-h)^2 + k, where (h,k)(h, k) is the vertex. Since the xx-coordinate of the vertex is 33, we substitute a=2a = -2 and h=3h = 3 into the vertex form.
2
Substitute the point (1,2)(1, 2) into the vertex form equation.
2=2(13)2+k2 = -2(1-3)^2 + k
Since f(1)=2f(1) = 2, the graph passes through the point (1,2)(1, 2). Substituting these values allows us to solve for the unknown vertex yy-coordinate, kk.
3
Simplify the equation and solve for kk.
k=10k = 10
Simplifying the term 2(13)2-2(1-3)^2 yields 2(2)2=2(4)=8-2(-2)^2 = -2(4) = -8. This simplifies the equation to 2=8+k2 = -8 + k. Adding 88 to both sides gives k=10k = 10.

Anahtar Kavram

Vertex form of a quadratic function
Soru 113Soru

In the system of equations below, what is the value of yy?

4x+3y=254x + 3y = 25
2x+3y=172x + 3y = 17
Cevabı ve açıklamayı göster

Cevap: 3

Cevap

The value of yy is 33.
Subtracting the second equation from the first equation gives (4x+3y)(2x+3y)=2517(4x + 3y) - (2x + 3y) = 25 - 17, which simplifies to 2x=82x = 8. Dividing by 2 gives x=4x = 4. Substituting x=4x = 4 into the second equation gives 2(4)+3y=172(4) + 3y = 17, which simplifies to 8+3y=178 + 3y = 17. Subtracting 8 from both sides gives 3y=93y = 9, and dividing by 3 gives y=3y = 3.

Adım Adım Çözüm

1
Subtract the second equation from the first equation to eliminate the yy term.
2x=82x = 8
Subtracting the equations eliminates 3y3y since it is common to both equations, leaving a single variable equation.
2
Solve for xx by dividing both sides of the equation by 2.
x=4x = 4
Dividing isolates the variable xx so we can find its numerical value.
3
Substitute x=4x = 4 into the second equation 2x+3y=172x + 3y = 17 and solve for yy.
y=3y = 3
Substituting the value of xx leaves only the variable yy, which can then be isolated and solved.

Anahtar Kavram

Solving systems of linear equations using elimination
Soru 114Soru

In the field of volcanology, analyzing the microscopic structures within volcanic rock helps researchers reconstruct the history of past eruptions. Each of the olivine crystals retrieved from the ancient basaltic lava flows of Mount Etna ______ crucial data about the cooling rate and chemical composition of the magma chamber before the eruption occurred.

Which choice completes the text so that it conforms to the conventions of Standard English?

Cevabı ve açıklamayı göster

Cevap: provides

Cevap

provides
The singular verb 'provides' agrees with the singular pronoun subject 'Each'. The intervening modifying phrase containing plural nouns does not alter the singular nature of the subject.

Adım Adım Çözüm

1
Identify the true grammatical subject of the sentence.
The subject of the sentence is the singular indefinite pronoun 'Each'.
The prepositional phrase 'of the olivine crystals retrieved from the ancient basaltic lava flows of Mount Etna' contains plural nouns ('crystals', 'flows'), but it acts as a modifier and does not change the subject of the sentence.
2
Determine the correct verb form that agrees in number with the singular subject.
A singular verb is required.
A singular subject ('Each') must be paired with a singular verb form ('provides') to maintain grammatical agreement.

Anahtar Kavram

Subject-Verb Agreement
Soru 115Soru

A circle in the xyxy-plane is defined by the equation (x7)2+(y+2)2=36(x - 7)^2 + (y + 2)^2 = 36. What is the diameter of this circle?

Cevabı ve açıklamayı göster

Cevap: 12

Cevap

12
The standard equation of a circle is (xh)2+(yk)2=r2(x - h)^2 + (y - k)^2 = r^2, where (h,k)(h, k) is the center of the circle and rr is the radius. In the equation (x7)2+(y+2)2=36(x - 7)^2 + (y + 2)^2 = 36, the value of r2r^2 is 36. Taking the square root gives the radius, r=6r = 6. The diameter of a circle is twice its radius, so the diameter is 2(6)=122(6) = 12.

Adım Adım Çözüm

1
Identify the value of the radius squared, r2r^2, from the given equation of the circle.
r2=36r^2 = 36
In the standard equation of a circle, (xh)2+(yk)2=r2(x - h)^2 + (y - k)^2 = r^2, the constant on the right side of the equation is equal to the square of the radius.
2
Determine the radius, rr, by taking the square root of r2r^2.
r=36=6r = \sqrt{36} = 6
Since the radius represents a distance, it must be the positive square root of the constant term.
3
Calculate the diameter of the circle by multiplying the radius by 2.
Diameter = 2×6=122 \times 6 = 12
The diameter of a circle is defined as twice its radius.

Anahtar Kavram

Identifying circle properties from its standard equation form (xh)2+(yk)2=r2(x - h)^2 + (y - k)^2 = r^2.
Soru 116Soru

Two linear equations are defined as follows:

3x+2y=123x + 2y = 12
x2y=4x - 2y = 4

If the ordered pair (x,y)(x, y) satisfies both equations, what is the value of xx?

Cevabı ve açıklamayı göster

Cevap: 4

Cevap

The value of xx is 4.
Adding the two equations 3x+2y=123x + 2y = 12 and x2y=4x - 2y = 4 eliminates the yy terms, resulting in 4x=164x = 16. Dividing both sides by 4 gives the value of xx as 4.

Adım Adım Çözüm

1
Add the two equations together to eliminate the yy variable.
4x=164x = 16
Since the coefficients of yy are opposites (22 and 2-2), adding the equations eliminates yy directly.
2
Divide both sides of the equation by 4.
x=4x = 4
To isolate the variable xx.

Anahtar Kavram

Solving systems of linear equations using the elimination method.

Alternatif Yöntem

We can solve the second equation for xx to get x=2y+4x = 2y + 4. Substituting this expression into the first equation gives 3(2y+4)+2y=123(2y + 4) + 2y = 12, which simplifies to 6y+12+2y=126y + 12 + 2y = 12, or 8y=08y = 0, meaning y=0y = 0. Substituting y=0y = 0 back into x=2y+4x = 2y + 4 yields x=4x = 4.
Tahmini Süre:45s
Soru 117Soru

A student is preparing a presentation on the Lycurgus Cup and has taken the following notes:
* The Lycurgus Cup is a Roman glass chalice dating to the 4th century AD.
* It is made of dichroic glass, which displays different colors depending on how light hits it.
* When light is reflected off the front of the cup, the glass appears green.
* When light is transmitted through the glass from behind, the cup glows red.
* This color-changing property is caused by nanoparticles of gold and silver embedded in the glass.

The student wants to write a sentence that emphasizes the two specific colors the cup displays depending on the lighting direction.

Based on the notes, complete the sentence to achieve this goal.

Aşağıdaki boşlukları doldurun

Highlighting its unique properties, the Lycurgus Cup appears in reflected light but glows in transmitted light.
Cevabı ve açıklamayı göster

Cevap

Highlighting its unique properties, the Lycurgus Cup appears green in reflected light but glows red in transmitted light.
The completed sentence correctly identifies that the Lycurgus Cup appears green in reflected light and red in transmitted light. This directly satisfies the rhetorical goal of emphasizing the two specific colors the cup displays depending on the direction of the light, using the facts provided in the notes.

Adım Adım Çözüm

1
Identify the rhetorical goal stated in the prompt.
The goal is to emphasize the two specific colors the cup displays depending on the lighting direction.
This determines which specific details from the bulleted notes must be synthesized in the sentence.
2
Locate the relevant details matching the goal from the notes.
The notes indicate the cup appears green when light is reflected off the front (reflected light) and red when light is transmitted from behind (transmitted light).
These details directly provide the specific colors and corresponding lighting directions needed.
3
Fill in the blanks to complete the sentence structure.
The first blank, associated with reflected light, is filled with 'green', and the second blank, associated with transmitted light, is filled with 'red'.
This completes the sentence while accurately reflecting the facts and satisfying the student's rhetorical goal.

Anahtar Kavram

Synthesizing specific details from notes to achieve a target rhetorical goal.
Tahmini Süre:1m 0s
Soru 118Soru

A robotic arm rotates counterclockwise by 210210^\circ and then rotates clockwise by 7575^\circ. What is the net counterclockwise rotation of the robotic arm, in radians?

Cevabı ve açıklamayı göster

Cevap: 3π4\frac{3\pi}{4}

Cevap

The correct answer is 3π4\frac{3\pi}{4} radians.
The correct answer is determined by first finding the net angle of rotation. Subtracting the 7575^\circ clockwise rotation from the 210210^\circ counterclockwise rotation yields a net rotation of 135135^\circ counterclockwise. Converting this angle to radians is done by multiplying 135135^\circ by π180\frac{\pi}{180^\circ}, resulting in 135π180\frac{135\pi}{180} radians. Dividing both the numerator and denominator by 45 simplifies the fraction to 3π4\frac{3\pi}{4} radians.

Adım Adım Çözüm

1
Calculate the net counterclockwise rotation in degrees.
21075=135210^\circ - 75^\circ = 135^\circ
Since counterclockwise rotation is positive and clockwise rotation is negative, we subtract the clockwise rotation from the counterclockwise rotation.
2
Convert the angle from degrees to radians.
135×π180=135π180135 \times \frac{\pi}{180} = \frac{135\pi}{180} radians
To convert degrees to radians, multiply the degree measure by the conversion factor π180\frac{\pi}{180^\circ}.
3
Simplify the fraction to its lowest terms.
3π4\frac{3\pi}{4} radians
Divide both the numerator and the denominator by their greatest common divisor, which is 45.

Anahtar Kavram

To convert an angle from degrees to radians, multiply the degree measure by π180\frac{\pi}{180^\circ} and simplify the resulting fraction.

Alternatif Yöntem

Alternatively, convert each individual rotation to radians first, then subtract. Convert 210210^\circ to radians: 210×π180=7π6210 \times \frac{\pi}{180} = \frac{7\pi}{6} radians. Convert 7575^\circ to radians: 75×π180=5π1275 \times \frac{\pi}{180} = \frac{5\pi}{12} radians. Subtract the clockwise rotation from the counterclockwise rotation: 7π65π12=14π125π12=9π12=3π4\frac{7\pi}{6} - \frac{5\pi}{12} = \frac{14\pi}{12} - \frac{5\pi}{12} = \frac{9\pi}{12} = \frac{3\pi}{4} radians.
Tahmini Süre:1m 30s
Soru 119Soru

In the xyxy-plane, a right triangle has vertices at the origin O(0,0)O(0, 0), A(x,0)A(x, 0), and B(0,y)B(0, y), where x>0x > 0 and y>0y > 0. If the length of the hypotenuse ABAB is 2626 and the slope of the line containing segment ABAB is 125-\frac{12}{5}, what is the value of yy?

Cevabı ve açıklamayı göster

Cevap: 24

Cevap

The value of yy is 24.
The correct answer is 24 because the slope of the line through A(x,0)A(x, 0) and B(0,y)B(0, y) is yx-\frac{y}{x}. Setting this equal to 125-\frac{12}{5} gives the relationship y=125xy = \frac{12}{5}x. Substituting this into the Pythagorean theorem equation x2+y2=262x^2 + y^2 = 26^2 yields x2+(125x)2=676x^2 + \left(\frac{12}{5}x\right)^2 = 676, which simplifies to 16925x2=676\frac{169}{25}x^2 = 676. Solving for xx gives x=10x = 10, and multiplying by 125\frac{12}{5} gives the value of yy as 24.

Adım Adım Çözüm

1
Express the slope of the line containing segment ABAB in terms of xx and yy.
y=125xy = \frac{12}{5}x
The line passes through A(x,0)A(x, 0) and B(0,y)B(0, y), so its slope is yx-\frac{y}{x}. Setting this equal to the given slope of 125-\frac{12}{5} gives the relationship between xx and yy.
2
Apply the Pythagorean theorem to the right triangle OABOAB.
x2+y2=676x^2 + y^2 = 676
The lengths of the legs of the right triangle are xx and yy, and the hypotenuse is 2626.
3
Substitute the slope relationship into the Pythagorean equation to solve for xx.
x=10x = 10
Substituting y=125xy = \frac{12}{5}x gives x2+14425x2=676x^2 + \frac{144}{25}x^2 = 676, which simplifies to 16925x2=676\frac{169}{25}x^2 = 676. Solving for xx gives 1010.
4
Calculate the value of yy.
y=24y = 24
Using x=10x = 10 in y=125xy = \frac{12}{5}x gives 2424.

Anahtar Kavram

Solving right triangle problems in the coordinate plane by combining linear equations (slope) with the Pythagorean theorem.
Soru 120Soru

A sign is in the shape of a parallelogram with a base of 1818 inches and a height of 1010 inches. A smaller, similar parallelogram is cut out from the center of the sign. If the scale factor of the smaller parallelogram to the larger parallelogram is 11 to 33, what is the area, in square inches, of the remaining portion of the sign?

Cevabı ve açıklamayı göster

Cevap: 160

Cevap

160
The area of the larger parallelogram is 18×10=18018 \times 10 = 180 square inches. Since the smaller parallelogram is similar to the larger one with a scale factor of 11 to 33, the area of the smaller parallelogram is (13)2=19\left(\frac{1}{3}\right)^2 = \frac{1}{9} of the area of the larger parallelogram. This gives an area of 180×19=20180 \times \frac{1}{9} = 20 square inches for the smaller parallelogram. Subtracting this from the larger area yields 18020=160180 - 20 = 160 square inches.

Adım Adım Çözüm

1
Calculate the area of the larger parallelogram.
Alarger=180A_{\text{larger}} = 180 square inches
The area of a parallelogram is the product of its base and height (A=bhA = bh).
2
Determine the area of the smaller, similar parallelogram.
Asmaller=20A_{\text{smaller}} = 20 square inches
The ratio of the areas of similar figures is the square of the scale factor: (13)2=19\left(\frac{1}{3}\right)^2 = \frac{1}{9}.
3
Subtract the smaller area from the larger area to find the remaining area.
Aremaining=160A_{\text{remaining}} = 160 square inches
The remaining portion of the sign is the total area minus the cutout area.

Anahtar Kavram

The area of similar geometric shapes scales by the square of the linear scale factor.
ÖncekiSayfa 6 / 140Sonraki
Tüm alıştırma soruları — SAT | Examkin