Tüm alıştırma soruları

1526 soru

Soru 1401Soru

A closed rigid container holds a mixture of dry air and water vapour at a temperature of 27C27^\circ\text{C} under a total pressure of 740 mmHg740\text{ mmHg}. The relative humidity of the air inside the container is 80%80\%, and the saturated vapour pressure of water at 27C27^\circ\text{C} is 25 mmHg25\text{ mmHg}. If the container is heated at constant volume to 127C127^\circ\text{C}, what is the partial pressure of the dry air in mmHg\text{mmHg} at this higher temperature?

Cevabı ve açıklamayı göster

Cevap: 960

Cevap

The partial pressure of dry air inside the container at 127C127^\circ\text{C} is 960 mmHg960\text{ mmHg}.
First, the partial pressure of water vapour at 27C27^\circ\text{C} is determined by multiplying relative humidity (80%80\%) by the saturated vapour pressure (25 mmHg25\text{ mmHg}), yielding 20 mmHg20\text{ mmHg}. Next, subtracting this vapour pressure from the total pressure of 740 mmHg740\text{ mmHg} gives the partial pressure of dry air alone as 720 mmHg720\text{ mmHg} at 27C27^\circ\text{C} (300 K300\text{ K}). Finally, applying the Pressure Law (P1T1=P2T2\frac{P_1}{T_1} = \frac{P_2}{T_2}) for the dry air between 300 K300\text{ K} and 400 K400\text{ K} (127C127^\circ\text{C}) yields P2=720×400300=960 mmHgP_2 = 720 \times \frac{400}{300} = 960\text{ mmHg}.

Adım Adım Çözüm

1
Calculate the partial pressure of water vapour at 27C27^\circ\text{C}
Pvapour,1=0.80×25 mmHg=20 mmHgP_{\text{vapour}, 1} = 0.80 \times 25\text{ mmHg} = 20\text{ mmHg}
Relative humidity is the ratio of actual partial vapour pressure to the saturated vapour pressure at that temperature.
2
Determine the initial partial pressure of the dry air at 27C27^\circ\text{C} using Dalton's Law
Pdry air,1=740 mmHg20 mmHg=720 mmHgP_{\text{dry air}, 1} = 740\text{ mmHg} - 20\text{ mmHg} = 720\text{ mmHg}
Total pressure of a gas mixture is the sum of the partial pressures of its individual components.
3
Convert temperatures to Kelvin and apply Gay-Lussac's Pressure Law for dry air at constant volume
T1=27+273=300 KT_1 = 27 + 273 = 300\text{ K}, T2=127+273=400 KT_2 = 127 + 273 = 400\text{ K}. Pdry air,2=720 mmHg×(400 K300 K)=960 mmHgP_{\text{dry air}, 2} = 720\text{ mmHg} \times \left(\frac{400\text{ K}}{300\text{ K}}\right) = 960\text{ mmHg}
For a fixed mass of gas at constant volume, pressure is directly proportional to absolute temperature.

Anahtar Kavram

Dalton's Law of Partial Pressures and Gay-Lussac's Pressure Law applied to gas-vapour mixtures
Soru 1402Soru

A sample of hydrated sodium trioxocarbonate(IV), Na2CO3xH2O\text{Na}_2\text{CO}_3 \cdot x\text{H}_2\text{O}, is heated strongly in a crucible until a constant mass is reached. If the salt loses 62.94%62.94\% of its initial mass as water vapor during heating, what is the integer value of xx?

[Relative atomic masses: Na=23\text{Na} = 23, C=12\text{C} = 12, O=16\text{O} = 16, H=1\text{H} = 1]

Cevabı ve açıklamayı göster

Cevap: 10

Cevap

The integer value of xx is 10.
Heating hydrated sodium trioxocarbonate(IV) drives off all water of crystallization as steam. Since 62.94%62.94\% of the total mass is lost, water accounts for 62.94%62.94\% of the molar mass of Na2CO3xH2O\text{Na}_2\text{CO}_3 \cdot x\text{H}_2\text{O}. Solving 18x106+18x=0.6294\frac{18x}{106 + 18x} = 0.6294 yields x=10x = 10, representing decahydrate crystals, Na2CO310H2O\text{Na}_2\text{CO}_3 \cdot 10\text{H}_2\text{O}.

Adım Adım Çözüm

1
Calculate the formula masses of the anhydrous salt Na2CO3\text{Na}_2\text{CO}_3 and water H2O\text{H}_2\text{O}.
Molar mass of Na2CO3=106 g/mol\text{Na}_2\text{CO}_3 = 106\text{ g/mol} and molar mass of H2O=18 g/mol\text{H}_2\text{O} = 18\text{ g/mol}.
Establishing the molar component masses is required to determine the percentage ratio of water of crystallization to the total mass of the hydrated salt.
2
Set up an algebraic ratio relating the mass of water lost to the total hydrated mass using the given percentage.
18x106+18x=0.6294\frac{18x}{106 + 18x} = 0.6294.
Heating to constant mass removes all water of crystallization, meaning the mass lost corresponds to the xH2Ox\text{H}_2\text{O} component of the hydrated crystal.
3
Solve the algebraic equation for xx.
x=10x = 10.
Isolating xx yields the exact stoichiometric coefficient of water molecules per mole of hydrated salt.

Anahtar Kavram

Quantitative determination of water of crystallization using percentage mass loss.
Soru 1403Soru

A light, rigid horizontal bar ABAB of length 1.5 m1.5\text{ m} is smoothly pivoted at end AA. A vertical downward load of 40 N40\text{ N} is hung from end BB. The bar is kept in horizontal equilibrium by a light string attached at point CC, located 1.0 m1.0\text{ m} from AA. The string exerts a tension force TT pulling upwards at an angle of 3030^\circ relative to the horizontal bar. What is the magnitude of the tension TT in newtons?

Cevabı ve açıklamayı göster

Cevap: 120

Cevap

The magnitude of the tension TT in the string is 120 N120\text{ N}.
For the bar to maintain rotational equilibrium, the clockwise moment about pivot AA must equal the counterclockwise moment about AA. The 40 N40\text{ N} load exerts a clockwise moment of 40 N×1.5 m=60 Nm40\text{ N} \times 1.5\text{ m} = 60\text{ N}\cdot\text{m}. The string tension TT exerts a counterclockwise moment given by its vertical component multiplied by the distance from the pivot: (Tsin30)×1.0 m=0.5T Nm(T \sin 30^\circ) \times 1.0\text{ m} = 0.5T \text{ N}\cdot\text{m}. Equating the two moments gives 0.5T=60 Nm0.5T = 60\text{ N}\cdot\text{m}, yielding T=120 NT = 120\text{ N}.

Adım Adım Çözüm

1
Calculate the clockwise moment about the pivot at end AA
τclockwise=40 N×1.5 m=60 Nmτ_{\text{clockwise}} = 40\text{ N} \times 1.5\text{ m} = 60\text{ N}\cdot\text{m}
The weight at BB acts vertically downward at a perpendicular distance of 1.5 m1.5\text{ m} from pivot AA.
2
Determine the perpendicular component of tension TT relative to the bar
F=Tsin30=0.5TF_{\perp} = T \sin 30^\circ = 0.5T
Only the component of force perpendicular to the bar produces a moment about the pivot.
3
Set up the counterclockwise moment about pivot AA
τcounterclockwise=(0.5T)×1.0 m=0.5T Nmτ_{\text{counterclockwise}} = (0.5T) \times 1.0\text{ m} = 0.5T \text{ N}\cdot\text{m}
The string is attached at point CC, which is 1.0 m1.0\text{ m} away from pivot AA.
4
Apply the principle of moments for rotational equilibrium and solve for TT
0.5T=60    T=120 N0.5T = 60 \implies T = 120\text{ N}
For rotational equilibrium, total clockwise moments must equal total counterclockwise moments about any pivot.

Anahtar Kavram

Principle of moments and rotational equilibrium for forces acting at non-perpendicular angles.
Tahmini Süre:1m 30s
Soru 1404Soru
A Uranium-235 nucleus undergoes nuclear fission after absorbing a thermal neutron according to the reaction equation:
92235U+01n54140Xe+3894Sr+x 01n{^{235}_{92}\text{U}} + {^{1}_{0}\text{n}} \rightarrow {^{140}_{54}\text{Xe}} + {^{94}_{38}\text{Sr}} + x\ {^{1}_{0}\text{n}}
Given the rest masses:
- Mass of 92235U=235.0439 u{^{235}_{92}\text{U}} = 235.0439\text{ u}
- Mass of 54140Xe=139.9216 u{^{140}_{54}\text{Xe}} = 139.9216\text{ u}
- Mass of 3894Sr=93.9154 u{^{94}_{38}\text{Sr}} = 93.9154\text{ u}
- Mass of 01n=1.0087 u{^{1}_{0}\text{n}} = 1.0087\text{ u}
- 1 u=931.5 MeV1\text{ u} = 931.5\text{ MeV}

Calculate the total energy released during this fission process in MeV.

Cevabı ve açıklamayı göster

Cevap: 184.62

Cevap

184.62 MeV
The total energy released is calculated by first balancing the nuclear equation to determine that 2 neutrons are emitted (x=2x = 2). The total mass of reactants is 236.0526 u236.0526\text{ u} and the products is 235.8544 u235.8544\text{ u}. The mass defect of 0.1982 u0.1982\text{ u} multiplied by 931.5 MeV/u931.5\text{ MeV/u} yields 184.62 MeV184.62\text{ MeV}.

Adım Adım Çözüm

1
Balance the mass numbers in the nuclear equation to find the number of emitted neutrons (xx)
x=2x = 2 neutrons
Conservation of mass number requires 235+1=140+94+x235 + 1 = 140 + 94 + x, giving 236=234+x236 = 234 + x, so x=2x = 2.
2
Calculate the total mass of the reactants before fission
236.0526 u236.0526\text{ u}
Summing the mass of U-235 (235.0439 u235.0439\text{ u}) and the incident neutron (1.0087 u1.0087\text{ u}).
3
Calculate the total mass of the products after fission
235.8544 u235.8544\text{ u}
Summing masses of Xe-140 (139.9216 u139.9216\text{ u}), Sr-94 (93.9154 u93.9154\text{ u}), and 2 neutrons (2×1.0087 u=2.0174 u2 \times 1.0087\text{ u} = 2.0174\text{ u}).
4
Determine the mass defect (mass difference)
Δm=0.1982 u\Delta m = 0.1982\text{ u}
Mass defect Δm=mreactantsmproducts=236.0526235.8544=0.1982 u\Delta m = m_{\text{reactants}} - m_{\text{products}} = 236.0526 - 235.8544 = 0.1982\text{ u}.
5
Convert mass defect to energy using 1 u=931.5 MeV1\text{ u} = 931.5\text{ MeV}
184.62 MeV184.62\text{ MeV}
Multiplying mass defect 0.1982 u0.1982\text{ u} by 931.5 MeV/u931.5\text{ MeV/u} gives 184.6233 MeV184.6233\text{ MeV}, which rounds to 184.62 MeV184.62\text{ MeV}.

Anahtar Kavram

Mass defect and mass-energy equivalence in nuclear fission reactions
Tahmini Süre:2m 30s
Soru 1405Soru

A metal block of mass 4.0 kg4.0\text{ kg} absorbs 12 kJ12\text{ kJ} of thermal energy, causing its temperature to rise by 15 K15\text{ K}. What is the specific heat capacity of the metal block in J kg1K1\text{J kg}^{-1}\text{K}^{-1}?

Cevabı ve açıklamayı göster

Cevap: 200

Cevap

The specific heat capacity of the metal block is 200 J kg1K1200\text{ J kg}^{-1}\text{K}^{-1}.
Specific heat capacity cc is determined using c=QmΔTc = \frac{Q}{m \Delta T}. Substituting Q=12,000 JQ = 12,000\text{ J}, m=4.0 kgm = 4.0\text{ kg}, and ΔT=15 K\Delta T = 15\text{ K} yields c=120004.0×15=200 J kg1K1c = \frac{12000}{4.0 \times 15} = 200\text{ J kg}^{-1}\text{K}^{-1}.

Adım Adım Çözüm

1
Convert given energy to standard SI units
Q=12 kJ=12,000 JQ = 12\text{ kJ} = 12,000\text{ J}
Calculation of specific heat capacity requires heat energy in Joules.
2
Relate heat energy, mass, specific heat capacity, and temperature change
Q=mcΔT    c=QmΔTQ = m c \Delta T \implies c = \frac{Q}{m \Delta T}
Specific heat capacity cc represents heat energy per unit mass per Kelvin temperature change.
3
Substitute the values and compute the result
c=120004.0×15=200 J kg1K1c = \frac{12000}{4.0 \times 15} = 200\text{ J kg}^{-1}\text{K}^{-1}
Evaluating the expression gives 200 J kg1K1200\text{ J kg}^{-1}\text{K}^{-1}.

Anahtar Kavram

Specific heat capacity is the quantity of heat required to raise the temperature of 1 kg1\text{ kg} of a substance by 1 K1\text{ K}, expressed as c=QmΔTc = \frac{Q}{m \Delta T}.
Soru 1406Soru

A concave shaving mirror has a radius of curvature of 60 cm60\text{ cm}. A person places their face in front of the mirror such that an upright image magnified 33 times is formed. What is the distance of the face from the mirror, in centimeters?

Cevabı ve açıklamayı göster

Cevap: 20

Cevap

The distance of the person's face from the mirror is 20 cm20\text{ cm}.
For a concave mirror with a radius of curvature of 60 cm60\text{ cm}, the focal length is f=+30 cmf = +30\text{ cm}. An upright image is virtual, corresponding to a positive magnification m=+3m = +3. Since m=vum = -\frac{v}{u}, the image distance is v=3uv = -3u. Substituting these into the mirror formula 1f=1u+1v\frac{1}{f} = \frac{1}{u} + \frac{1}{v} gives 130=1u13u=23u\frac{1}{30} = \frac{1}{u} - \frac{1}{3u} = \frac{2}{3u}, solving to u=20 cmu = 20\text{ cm}.

Adım Adım Çözüm

1
Determine the focal length of the concave mirror.
f=30 cmf = 30\text{ cm}
The focal length is half the radius of curvature (f=r2=60 cm2=30 cmf = \frac{r}{2} = \frac{60\text{ cm}}{2} = 30\text{ cm}).
2
Express the image distance vv in terms of the object distance uu using the magnification relationship.
v=3uv = -3u
An upright image produced by a spherical mirror is virtual, so linear magnification m=+3m = +3. Using m=vu=+3m = -\frac{v}{u} = +3, we obtain v=3uv = -3u.
3
Substitute ff and vv into the mirror equation to solve for uu.
u=20 cmu = 20\text{ cm}
Applying the mirror formula 1f=1u+1v    130=1u13u=23u    3u=60    u=20 cm\frac{1}{f} = \frac{1}{u} + \frac{1}{v} \implies \frac{1}{30} = \frac{1}{u} - \frac{1}{3u} = \frac{2}{3u} \implies 3u = 60 \implies u = 20\text{ cm}.

Anahtar Kavram

Mirror equation and sign conventions for virtual images formed by concave mirrors
Soru 1407Soru

Two long, straight parallel wires separated by a distance of 5.0 cm5.0\text{ cm} in air carry equal currents in opposite directions. If the repulsive force per unit length between the wires is 1.6×103 N/m1.6 \times 10^{-3}\text{ N/m}, determine the magnitude of the current flowing through each wire in amperes. (Take μ0=4π×107 Tm/A\mu_0 = 4\pi \times 10^{-7}\text{ T}\cdot\text{m/A})

Cevabı ve açıklamayı göster

Cevap: 20

Cevap

The magnitude of the current flowing through each wire is 20 A20\text{ A}.
Using the parallel conductor force formula FL=μ0I22πd\frac{F}{L} = \frac{\mu_0 I^2}{2\pi d}, we substitute FL=1.6×103 N/m\frac{F}{L} = 1.6 \times 10^{-3}\text{ N/m}, d=0.05 md = 0.05\text{ m}, and μ0=4π×107 Tm/A\mu_0 = 4\pi \times 10^{-7}\text{ T}\cdot\text{m/A}. Simplifying yields 1.6×103=4×106I21.6 \times 10^{-3} = 4 \times 10^{-6} I^2, giving I2=400I^2 = 400 and I=20 AI = 20\text{ A}.

Adım Adım Çözüm

1
Recall the expression for force per unit length between two current-carrying parallel wires
FL=μ0I22πd\frac{F}{L} = \frac{\mu_0 I^2}{2\pi d}
The magnetic field generated by one wire exerts a magnetic force on the current in the adjacent wire.
2
Convert distance to meters and substitute all given values into the formula
d=0.05 md = 0.05\text{ m}, leading to 1.6×103=(4π×107)I22π(0.05)1.6 \times 10^{-3} = \frac{(4\pi \times 10^{-7}) I^2}{2\pi (0.05)}
Standard SI unit for distance is meters, necessary for dimensional consistency.
3
Simplify the equation and compute the current magnitude
1.6×103=4×106I2    I2=400    I=20 A1.6 \times 10^{-3} = 4 \times 10^{-6} I^2 \implies I^2 = 400 \implies I = 20\text{ A}
Solving the quadratic term gives the scalar current magnitude in amperes.

Anahtar Kavram

Force per unit length between parallel current-carrying conductors
Soru 1408Soru

A car of mass 1200 kg1200\text{ kg} ascends a straight road inclined at an angle θ\theta to the horizontal, where sinθ=0.1\sin\theta = 0.1, at a steady speed of 15 m s115\text{ m s}^{-1}. If the total frictional resistance to motion is 400 N400\text{ N}, what is the useful mechanical power output of the engine in kilowatts? (Take g=10 m s2g = 10\text{ m s}^{-2})

Cevabı ve açıklamayı göster

Cevap: 24

Cevap

24 kW
To maintain a constant ascending speed, the engine must supply a force equal to the sum of the component of weight parallel to the incline (mgsinθ=1200 Nmg\sin\theta = 1200\text{ N}) and the frictional force (400 N400\text{ N}), resulting in a total force of 1600 N1600\text{ N}. Multiplying this total force by the constant speed of 15 m s115\text{ m s}^{-1} yields a power output of 24000 W24000\text{ W}, which corresponds to 24 kW24\text{ kW}.

Adım Adım Çözüm

1
Calculate the gravitational force component acting down the slope
1200 N
The component of the car's weight parallel to the incline opposes upward motion: Fg=mgsinθ=1200 kg×10 m s2×0.1=1200 NF_g = m g \sin\theta = 1200 \text{ kg} \times 10 \text{ m s}^{-2} \times 0.1 = 1200 \text{ N}.
2
Determine the total tractive force required from the car engine
1600 N
Because the velocity is constant, the net force is zero; hence, the engine force must balance both the gravitational slope component and the frictional resistance: Fengine=Fg+Ffriction=1200 N+400 N=1600 NF_{\text{engine}} = F_g + F_{\text{friction}} = 1200 \text{ N} + 400 \text{ N} = 1600 \text{ N}.
3
Calculate the mechanical power delivered by the engine
24 kW
Power is the product of tractive force and constant speed: P=Fengine×v=1600 N×15 m s1=24000 W=24 kWP = F_{\text{engine}} \times v = 1600 \text{ N} \times 15 \text{ m s}^{-1} = 24000 \text{ W} = 24 \text{ kW}.

Anahtar Kavram

Power required to maintain motion against opposing forces on an inclined plane
Soru 1409Soru

A small object lies at the bottom of a transparent vessel containing two immiscible liquid layers, AA and BB. Layer AA (top) has a real thickness of 7.0 cm7.0\text{ cm} and a refractive index of 1.401.40. Layer BB (bottom) has a real thickness of 8.0 cm8.0\text{ cm} and a refractive index of 1.601.60. Calculate the apparent displacement of the object, in centimeters, when viewed vertically from directly above.

Cevabı ve açıklamayı göster

Cevap: 5

Cevap

The apparent displacement of the object is 5.0 cm5.0\text{ cm}.
For multiple refractive layers viewed normally, the total apparent depth is the sum of individual layer apparent depths: 7.01.40+8.01.60=5.0+5.0=10.0 cm\frac{7.0}{1.40} + \frac{8.0}{1.60} = 5.0 + 5.0 = 10.0\text{ cm}. Subtracting this total apparent depth from the total real depth of 15.0 cm15.0\text{ cm} gives an apparent vertical shift (displacement) of 5.0 cm5.0\text{ cm}.

Adım Adım Çözüm

1
Calculate the apparent depth of the top liquid layer (Layer A)
Apparent depth of Layer A = 5.0 cm5.0\text{ cm}
Apparent depth for a single medium is obtained by dividing real depth by its refractive index: 7.01.40=5.0 cm\frac{7.0}{1.40} = 5.0\text{ cm}.
2
Calculate the apparent depth of the bottom liquid layer (Layer B)
Apparent depth of Layer B = 5.0 cm5.0\text{ cm}
Apparent depth for Layer B is 8.01.60=5.0 cm\frac{8.0}{1.60} = 5.0\text{ cm}.
3
Calculate total real depth and total apparent depth
Total real depth = 15.0 cm15.0\text{ cm}; Total apparent depth = 10.0 cm10.0\text{ cm}
Depths in composite media are additive.
4
Calculate vertical apparent displacement
Apparent displacement = 5.0 cm5.0\text{ cm}
Displacement is the difference between total real depth and total apparent depth: 15.0 cm10.0 cm=5.0 cm15.0\text{ cm} - 10.0\text{ cm} = 5.0\text{ cm}.

Anahtar Kavram

Refraction through composite media and vertical apparent displacement
Soru 1410Soru

An electric water heater operating at a voltage of 240V240\,\text{V} has a heating element of resistance 48Ω48\,\Omega. It is used to heat 1.5kg1.5\,\text{kg} of water from 20C20^\circ\text{C} to 100C100^\circ\text{C}. If the thermal efficiency of the heating process is 80%80\%, calculate the total electrical energy consumed by the heater in kilojoules (kJ\text{kJ}). [Take specific heat capacity of water = 4200Jkg1K14200\,\text{J}\cdot\text{kg}^{-1}\cdot\text{K}^{-1}]

Cevabı ve açıklamayı göster

Cevap: 630

Cevap

The total electrical energy consumed by the heater is 630kJ630\,\text{kJ}.
The thermal energy required to raise the temperature of 1.5kg1.5\,\text{kg} of water by 80C80^\circ\text{C} is Q=1.5×4200×80=504,000J=504kJQ = 1.5 \times 4200 \times 80 = 504,000\,\text{J} = 504\,\text{kJ}. Taking into account the 80%80\% thermal efficiency, the total electrical energy consumed is Eelec=504kJ0.80=630kJE_{\text{elec}} = \frac{504\,\text{kJ}}{0.80} = 630\,\text{kJ}.

Adım Adım Çözüm

1
Calculate the useful heat energy needed to heat the water.
Q=mc(T2T1)=1.5×4200×(10020)=504,000J=504kJQ = m c (T_2 - T_1) = 1.5 \times 4200 \times (100 - 20) = 504,000\,\text{J} = 504\,\text{kJ}.
The thermal energy transferred to the water depends on its mass, specific heat capacity, and temperature increase.
2
Account for the efficiency of the heating element to find total electrical energy input.
Eelec=QEfficiency=504kJ0.80=630kJE_{\text{elec}} = \frac{Q}{\text{Efficiency}} = \frac{504\,\text{kJ}}{0.80} = 630\,\text{kJ}.
Since only 80%80\% of the electrical energy is converted into useful heat energy for the water, the input electrical energy must be greater than the output heat energy.

Anahtar Kavram

Conversion of electrical energy to thermal energy and application of thermal efficiency.
Soru 1411Soru

The mass defect of a nitrogen nucleus 714N^{14}_{7}\text{N} is calculated to be 0.112 u0.112\text{ u}. Taking 1 u=931.5 MeV1\text{ u} = 931.5\text{ MeV}, what is the total binding energy of the nucleus in MeV\text{MeV}?

Cevabı ve açıklamayı göster

Cevap: 104.328

Cevap

The total binding energy of the 714N^{14}_{7}\text{N} nucleus is 104.328 MeV104.328\text{ MeV}.
The total binding energy of a nucleus is equal to the mass defect multiplied by the energy equivalent of one atomic mass unit (931.5 MeV/u931.5\text{ MeV/u}). Calculating 0.112 u×931.5 MeV/u0.112\text{ u} \times 931.5\text{ MeV/u} gives 104.328 MeV104.328\text{ MeV}.

Adım Adım Çözüm

1
Apply the binding energy formula Eb=Δm×931.5 MeV/uE_b = \Delta m \times 931.5\text{ MeV/u}.
Eb=0.112 u×931.5 MeV/u=104.328 MeVE_b = 0.112\text{ u} \times 931.5\text{ MeV/u} = 104.328\text{ MeV}.
The binding energy is obtained by converting the mass defect directly into its energy equivalent.

Anahtar Kavram

Mass Defect and Binding Energy Conversion
Soru 1412Soru

An object is placed at a distance uu in front of a concave mirror of focal length 12 cm12\text{ cm}. A plane mirror is placed perpendicular to the principal axis at a distance of 32 cm32\text{ cm} in front of the concave mirror, between the object and the concave mirror. If the real image formed by the concave mirror coincides in space with the virtual image formed by the plane mirror, what is the value of uu in centimeters?

Cevabı ve açıklamayı göster

Cevap: 48

Cevap

The correct object distance uu is 48 cm48\text{ cm}.
The object is located at distance uu from the concave mirror. With the plane mirror at 32 cm32\text{ cm} from the concave mirror, the object distance from the plane mirror is u32u - 32. The plane mirror forms an image at distance u32u - 32 behind itself, which corresponds to 32(u32)=64u32 - (u - 32) = 64 - u from the concave mirror. Setting v=64uv = 64 - u in the mirror formula 112=1u+164u\frac{1}{12} = \frac{1}{u} + \frac{1}{64 - u} gives u264u+768=0u^2 - 64u + 768 = 0. Factoring yields u=48 cmu = 48\text{ cm} or u=16 cmu = 16\text{ cm}. Because the plane mirror is between the object and the concave mirror, u>32 cmu > 32\text{ cm}, so u=48 cmu = 48\text{ cm}.

Adım Adım Çözüm

1
Find the position of the image formed by the plane mirror in terms of uu.
The object is at a distance (u32) cm(u - 32)\text{ cm} in front of the plane mirror. Its virtual image is formed (u32) cm(u - 32)\text{ cm} behind the plane mirror, which places it at 32(u32)=(64u) cm32 - (u - 32) = (64 - u)\text{ cm} in front of the concave mirror.
A plane mirror forms an image behind it at a distance equal to the object distance in front of it.
2
Equate the image distance of the concave mirror vv to the position of the plane mirror image.
v=64uv = 64 - u
The question states that the image formed by the concave mirror coincides in position with the image formed by the plane mirror.
3
Substitute f=12 cmf = 12\text{ cm} and v=64uv = 64 - u into the mirror equation.
112=1u+164u\frac{1}{12} = \frac{1}{u} + \frac{1}{64 - u}
The standard mirror formula relates focal length, object distance, and image distance.
4
Solve the algebraic equation for uu.
112=(64u)+uu(64u)    64uu2=768    u264u+768=0\frac{1}{12} = \frac{(64 - u) + u}{u(64 - u)} \implies 64u - u^2 = 768 \implies u^2 - 64u + 768 = 0
Combining fractions and multiplying across gives a quadratic equation in standard form.
5
Factor the quadratic equation and select the physical root.
(u48)(u16)=0    u=48 cm(u - 48)(u - 16) = 0 \implies u = 48\text{ cm} or u=16 cmu = 16\text{ cm}. Since u>32 cmu > 32\text{ cm}, u=48 cmu = 48\text{ cm}.
The plane mirror is situated between the object and the concave mirror at 32 cm32\text{ cm}, so the object distance uu must be greater than 32 cm32\text{ cm}.

Anahtar Kavram

Image coincidence in combined plane and curved optical systems
Tahmini Süre:3m 0s
Soru 1413Soru

A spring balance is attached to the ceiling of an elevator accelerating downwards at 2.0 m s22.0\text{ m s}^{-2}. Suspended from the hook of the spring balance is a light, frictionless pulley carrying two masses of 3.0 kg3.0\text{ kg} and 1.0 kg1.0\text{ kg} connected by a light inextensible string. Taking the acceleration due to gravity g=10.0 m s2g = 10.0\text{ m s}^{-2}, what is the reading registered by the spring balance in newtons?

Cevabı ve açıklamayı göster

Cevap: 24

Cevap

The reading registered by the spring balance is 24 N.
In a frame accelerating downwards at a=2.0 m s2a = 2.0\text{ m s}^{-2}, the effective acceleration due to gravity is reduced to g=ga=8.0 m s2g' = g - a = 8.0\text{ m s}^{-2}. Within this frame, the tension in the Atwood machine string is T=2(3.0)(1.0)3.0+1.0×8.0=12.0 NT = \frac{2(3.0)(1.0)}{3.0 + 1.0} \times 8.0 = 12.0\text{ N}. Since two string segments act downward on the light pulley suspended from the spring balance, the total tension force registered by the balance scale is 2T=24.0 N2T = 24.0\text{ N}.

Adım Adım Çözüm

1
Determine the effective local acceleration due to gravity inside the accelerating elevator
g=8.0 m s2g' = 8.0\text{ m s}^{-2}
Because the elevator accelerates downward at a=2.0 m s2a = 2.0\text{ m s}^{-2}, objects inside experience an apparent gravitational acceleration of g=gag' = g - a.
2
Compute the tension in the string supporting the two masses in the modified gravitational field
T=12.0 NT = 12.0\text{ N}
For an Atwood machine system in effective gravity gg', string tension is T=2m1m2m1+m2g=2(3.0)(1.0)4.0×8.0=12.0 NT = \frac{2 m_1 m_2}{m_1 + m_2} g' = \frac{2(3.0)(1.0)}{4.0} \times 8.0 = 12.0\text{ N}.
3
Calculate the downward pull on the spring balance
F=24.0 NF = 24.0\text{ N}
The spring balance supports the frictionless pulley, which experiences a downward force from two upward string segments, making the total measured weight force equal to 2T=24.0 N2T = 24.0\text{ N}.

Anahtar Kavram

Apparent weight measurement and tension forces in accelerating frames
Soru 1414Soru

Two long, straight, parallel horizontal conductors are separated vertically by a distance of 2.0 cm2.0\text{ cm}. The upper conductor has a mass per unit length of 0.04 kg/m0.04\text{ kg/m} and carries a steady current of 50 A50\text{ A}. Assuming the currents in the two conductors flow in opposite directions so that the resulting magnetic force is repulsive, what current (in amperes) must flow through the lower conductor to magnetically levitate and balance the weight of the upper conductor? (Take g=9.8 m/s2g = 9.8\text{ m/s}^2 and μ0=4π×107 Tm/A\mu_0 = 4\pi \times 10^{-7}\text{ T}\cdot\text{m/A})

Cevabı ve açıklamayı göster

Cevap: 784

Cevap

The required current in the lower conductor is 784 A784\text{ A}.
Equating magnetic repulsion per unit length μ0I1I22πd\frac{\mu_0 I_1 I_2}{2\pi d} to weight per unit length λg\lambda g gives (2×107)×50×I20.02=0.04×9.8\frac{(2 \times 10^{-7}) \times 50 \times I_2}{0.02} = 0.04 \times 9.8, which simplifies to 5×104I2=0.3925 \times 10^{-4} I_2 = 0.392, yielding I2=784 AI_2 = 784\text{ A}.

Adım Adım Çözüm

1
Equate the upward repulsive magnetic force per unit length to the downward gravitational weight per unit length.
\frac{\mu_0 I_1 I_2}{2\pi d} = \lambda g
For the upper conductor to levitate in vertical static equilibrium, the upward magnetic force per meter must exactly balance its weight per meter.
2
Substitute all given physical values in SI units into the force balance equation.
\frac{(4\pi \times 10^{-7}) \times 50 \times I_2}{2\pi \times 0.02} = 0.04 \times 9.8
Converting distance d=2.0 cm=0.02 md = 2.0\text{ cm} = 0.02\text{ m} and using mass density λ=0.04 kg/m\lambda = 0.04\text{ kg/m} sets up a single equation with unknown I2I_2.
3
Simplify both sides of the equation.
5 \times 10^{-4} I_2 = 0.392
Calculating 2×107×500.02=5×104 N/(Am)\frac{2 \times 10^{-7} \times 50}{0.02} = 5 \times 10^{-4}\text{ N/(A}\cdot\text{m)} and 0.04×9.8=0.392 N/m0.04 \times 9.8 = 0.392\text{ N/m}.
4
Solve for the unknown current I2I_2.
I_2 = \frac{0.392}{5 \times 10^{-4}} = 784\text{ A}
Dividing the weight per meter by the magnetic force coefficient yields the exact required current magnitude.

Anahtar Kavram

Interaction force between parallel current-carrying conductors and mechanical equilibrium
Soru 1415Soru

A nitrogen nucleus 714N^{14}_{7}\text{N} has a nuclear mass of 13.9992 u13.9992\text{ u}. Given that the mass of a proton is 1.0073 u1.0073\text{ u} and the mass of a neutron is 1.0087 u1.0087\text{ u}, what is the total binding energy of the nucleus in MeV\text{MeV}? (Take 1 u=931 MeV1\text{ u} = 931\text{ MeV})

Cevabı ve açıklamayı göster

Cevap: 105.02

Cevap

The total binding energy of the 714N^{14}_{7}\text{N} nucleus is 105.02 MeV105.02\text{ MeV}.
The total binding energy is computed by finding the total rest mass of 7 protons and 7 neutrons (14.1120 u), subtracting the actual nuclear mass of Nitrogen-14 (13.9992 u) to obtain a mass defect of 0.1128 u, and converting this mass defect to energy by multiplying by 931 MeV/u, yielding 105.02 MeV.

Adım Adım Çözüm

1
Determine the number of constituent protons and neutrons
Z=7Z = 7 protons and N=147=7N = 14 - 7 = 7 neutrons
The atomic number is 7 and the mass number is 14.
2
Calculate the total mass of the constituent nucleons
Mnucleons=(7×1.0073 u)+(7×1.0087 u)=7.0511 u+7.0609 u=14.1120 uM_{\text{nucleons}} = (7 \times 1.0073\text{ u}) + (7 \times 1.0087\text{ u}) = 7.0511\text{ u} + 7.0609\text{ u} = 14.1120\text{ u}
The sum of the individual rest masses of all isolated protons and neutrons.
3
Compute the mass defect
Δm=14.1120 u13.9992 u=0.1128 u\Delta m = 14.1120\text{ u} - 13.9992\text{ u} = 0.1128\text{ u}
Mass defect is the difference between total mass of isolated nucleons and the bound nuclear mass.
4
Convert the mass defect into energy in MeV
Eb=0.1128 u×931 MeV/u=105.0168 MeV105.02 MeVE_b = 0.1128\text{ u} \times 931\text{ MeV/u} = 105.0168\text{ MeV} \approx 105.02\text{ MeV}
Applying the mass-energy equivalence factor 1 u=931 MeV1\text{ u} = 931\text{ MeV}.

Anahtar Kavram

Mass Defect and Binding Energy
Tahmini Süre:2m 0s
Soru 1416Soru

A simple pendulum suspended in a physics laboratory has a length of 0.64 m0.64\text{ m}. Given that acceleration due to gravity g=10 m/s2g = 10\text{ m/s}^2 and taking π2=10\pi^2 = 10, what is the period of oscillation of the pendulum in seconds?

Cevabı ve açıklamayı göster

Cevap: 1.6

Cevap

The period of oscillation of the simple pendulum is 1.6 s1.6\text{ s}.
Using the pendulum period relationship T=2πLgT = 2\pi \sqrt{\frac{L}{g}}, substituting L=0.64 mL = 0.64\text{ m}, g=10 m/s2g = 10\text{ m/s}^2, and π=10\pi = \sqrt{10} yields T=2100.6410=20.64=1.6 sT = 2\sqrt{10}\sqrt{\frac{0.64}{10}} = 2\sqrt{0.64} = 1.6\text{ s}.

Adım Adım Çözüm

1
Identify the formula for the period of a simple pendulum.
The period formula is T=2πLgT = 2\pi \sqrt{\frac{L}{g}}.
The period depends on the length of the pendulum LL and acceleration due to gravity gg.
2
Substitute the given values into the formula.
T=2π0.64 m10 m/s2T = 2\pi \sqrt{\frac{0.64\text{ m}}{10\text{ m/s}^2}}.
Given parameters are L=0.64 mL = 0.64\text{ m} and g=10 m/s2g = 10\text{ m/s}^2.
3
Simplify the equation using π=10\pi = \sqrt{10}.
T=210×0.064=210×0.064=20.64=2×0.8=1.6 sT = 2\sqrt{10} \times \sqrt{0.064} = 2 \sqrt{10 \times 0.064} = 2 \sqrt{0.64} = 2 \times 0.8 = 1.6\text{ s}.
Using π2=10\pi^2 = 10 simplifies the calculation cleanly without requiring a calculator.

Anahtar Kavram

Simple Pendulum Period of Oscillation
Soru 1417Soru

A particle moves along a circular track of radius rr with a constant speed vv. If the radius of the track is measured with a percentage error of 1.2%1.2\%, and the speed is measured as (10.0±0.3) m s1(10.0 \pm 0.3)\text{ m s}^{-1}, what is the percentage error in the calculated centripetal acceleration of the particle?

Cevabı ve açıklamayı göster

Cevap: 7.2

Cevap

The percentage error in the calculated centripetal acceleration is 7.2%.
The centripetal acceleration is ac=v2ra_c = \frac{v^2}{r}. The percentage error in vv is 0.310.0×100%=3.0%\frac{0.3}{10.0} \times 100\% = 3.0\%. According to error propagation rules, the percentage error in aca_c is 2×(percentage error in v)+(percentage error in r)=2(3.0%)+1.2%=7.2%2 \times (\text{percentage error in } v) + (\text{percentage error in } r) = 2(3.0\%) + 1.2\% = 7.2\%.

Adım Adım Çözüm

1
Calculate the percentage error in the speed measurement vv.
Percentage error in v=0.310.0×100%=3.0%\text{Percentage error in } v = \frac{0.3}{10.0} \times 100\% = 3.0\%
Percentage error is given by dividing the absolute error by the measured value and multiplying by 100%.
2
Write the relationship for centripetal acceleration aca_c in terms of vv and rr.
ac=v2ra_c = \frac{v^2}{r}
Centripetal acceleration is directly proportional to the square of speed and inversely proportional to radius.
3
Apply the fractional error propagation law for a quantity involving powers and quotients.
Δacac=2(Δvv)+Δrr\frac{\Delta a_c}{a_c} = 2\left(\frac{\Delta v}{v}\right) + \frac{\Delta r}{r}
When a measured quantity is raised to a power nn, its fractional error contribution is multiplied by nn. Errors accumulate additively.
4
Substitute the individual percentage errors to find the total percentage error in aca_c.
Percentage error in ac=2(3.0%)+1.2%=7.2%\text{Percentage error in } a_c = 2(3.0\%) + 1.2\% = 7.2\%
Multiplying the speed's percentage error by 2 and adding the radius percentage error yields the total relative error.

Anahtar Kavram

Propagation of percentage errors in physical formulas containing powers and ratios.
Soru 1418Soru

A nation's economic records for a given fiscal year provide the following national income figures:

- Gross Domestic Product (GDP\text{GDP}): N5,400 million\text{N}5,400\text{ million}
- Income earned by domestic citizens working abroad: N450 million\text{N}450\text{ million}
- Income earned by foreign nationals operating domestically: N600 million\text{N}600\text{ million}
- Capital Consumption Allowance (CCA\text{CCA}): N380 million\text{N}380\text{ million}

Calculate the Net National Product (NNP\text{NNP}) of the country in millions of Naira.

Cevabı ve açıklamayı göster

Cevap: 4870

Cevap

The Net National Product (NNP) of the country is N4,870 million.
Net National Product (NNP) is obtained by adding Net Factor Income from Abroad (NFIA) to Gross Domestic Product (GDP) to get Gross National Product (GNP), and then subtracting Capital Consumption Allowance (CCA). Here, NFIA = N450 million - N600 million = -N150 million. Thus, GNP = N5,400 million - N150 million = N5,250 million. Finally, NNP = N5,250 million - N380 million = N4,870 million.

Adım Adım Çözüm

1
Calculate Net Factor Income from Abroad (NFIA)
NFIA = N450 million - N600 million = -N150 million
NFIA measures the net flow of factor payments between domestic citizens abroad and foreign residents domestically.
2
Calculate Gross National Product (GNP)
GNP = N5,400 million + (-N150 million) = N5,250 million
GNP adjusts GDP for net factor receipts from abroad.
3
Calculate Net National Product (NNP)
NNP = N5,250 million - N380 million = N4,870 million
NNP reflects the net output available to an economy after accounting for capital depreciation.

Anahtar Kavram

Basic National Income Aggregates (GDP, GNP, NNP, NDP)
Soru 1419Soru

A sample of a radioactive isotope used in medical imaging has an initial activity of 320 MBq320\text{ MBq}. If its activity decreases to 20 MBq20\text{ MBq} after an elapsed time of 15 hours15\text{ hours}, what is the half-life of the isotope in hours?

Cevabı ve açıklamayı göster

Cevap: 3.75

Cevap

The half-life of the radioactive isotope is 3.75 hours3.75\text{ hours}.
The initial activity of 320 MBq320\text{ MBq} drops to 20 MBq20\text{ MBq}, which is a reduction to 20320=116\frac{20}{320} = \frac{1}{16} of its original value. Since 116=(12)4\frac{1}{16} = \left(\frac{1}{2}\right)^4, exactly 4 half-lives have elapsed over the period of 15 hours15\text{ hours}. Therefore, one half-life is 15 hours4=3.75 hours\frac{15\text{ hours}}{4} = 3.75\text{ hours}.

Adım Adım Çözüm

1
Calculate the fraction of initial activity remaining
Fraction remaining = 20 MBq320 MBq=116\frac{20\text{ MBq}}{320\text{ MBq}} = \frac{1}{16}
The ratio of current activity to initial activity determines the fraction of un-decayed nuclei remaining.
2
Determine the number of half-lives (nn) that have elapsed
n=4n = 4 half-lives, since (12)4=116\left(\frac{1}{2}\right)^4 = \frac{1}{16}
Each half-life reduces the remaining sample activity by half.
3
Calculate the half-life duration (T1/2T_{1/2})
T1/2=tn=15 hours4=3.75 hoursT_{1/2} = \frac{t}{n} = \frac{15\text{ hours}}{4} = 3.75\text{ hours}
Dividing total elapsed time by the number of half-lives gives the duration of one half-life.

Anahtar Kavram

Radioactive Decay Law and relationship between remaining activity fraction, number of half-lives, and total elapsed time.
Soru 1420Soru

A mixture of 15 cm315\text{ cm}^3 of ethene (C2H4C_2H_4) and 50 cm350\text{ cm}^3 of oxygen gas was exploded at constant temperature and pressure. If the resulting mixture was cooled to room temperature, what is the total volume of the residual gas in cm3\text{cm}^3?

Cevabı ve açıklamayı göster

Cevap: 35

Cevap

35 cm³
According to Gay-Lussac's Law, 15 cm315\text{ cm}^3 of ethene reacts with 45 cm345\text{ cm}^3 of oxygen to produce 30 cm330\text{ cm}^3 of carbon(IV) oxide gas. Since 50 cm350\text{ cm}^3 of oxygen was initially present, 5 cm35\text{ cm}^3 of unreacted oxygen gas remains. Upon cooling to room temperature, water condenses to liquid, leaving a total residual gaseous volume of 5 cm3+30 cm3=35 cm35\text{ cm}^3 + 30\text{ cm}^3 = 35\text{ cm}^3.

Adım Adım Çözüm

1
Write the balanced equation for the complete combustion of ethene gas.
C2H4(g)+3O2(g)2CO2(g)+2H2O(l)C_2H_4(g) + 3O_2(g) \rightarrow 2CO_2(g) + 2H_2O(l)
By Gay-Lussac's Law of Combining Volumes, gases react in simple whole-number volume ratios equal to their stoichiometric coefficients at constant temperature and pressure.
2
Determine the volume of oxygen required and the unreacted excess volume.
Volume of O2O_2 consumed = 3×15 cm3=45 cm33 \times 15\text{ cm}^3 = 45\text{ cm}^3. Remaining unreacted O2=50 cm345 cm3=5 cm3O_2 = 50\text{ cm}^3 - 45\text{ cm}^3 = 5\text{ cm}^3.
Since 15 cm315\text{ cm}^3 of C2H4C_2H_4 requires only 45 cm345\text{ cm}^3 of O2O_2, oxygen is in excess and ethene is the limiting reactant.
3
Calculate the volume of carbon(IV) oxide gas produced.
Volume of CO2CO_2 produced = 2×15 cm3=30 cm32 \times 15\text{ cm}^3 = 30\text{ cm}^3.
1 volume of C2H4C_2H_4 produces 2 volumes of CO2CO_2 gas.
4
Calculate the total volume of the residual gaseous mixture after cooling to room temperature.
Total residual gaseous volume = 5 cm3 (excess O2)+30 cm3 (produced CO2)=35 cm35\text{ cm}^3 \text{ (excess } O_2\text{)} + 30\text{ cm}^3 \text{ (produced } CO_2\text{)} = 35\text{ cm}^3.
Water formed is in the liquid state at room temperature and contributes negligible volume to the gaseous mixture.

Anahtar Kavram

Gay-Lussac's Law of Combining Volumes and Residual Gas Volume Calculations
Tahmini Süre:1m 30s
ÖncekiSayfa 71 / 77Sonraki
Tüm alıştırma soruları — JAMB UTME | Examkin