Tüm alıştırma soruları

2131 soru

Soru 21Soru

Read the passage below and analyze the transition signals to determine the word that best completes the passage. Which word correctly fills the blank?

Aşağıdaki boşlukları doldurun

For centuries, historians characterized the medieval scholar’s reliance on authority as an uncritical submission to dogma; nevertheless, recent analytical readings of thirteenth-century scholastic disputations reveal that far from demonstrating deference, these texts engaged in rigorous dialectical interrogation, employing subtle distinctions to modify canonical texts without explicitly repudiating them.
Cevabı ve açıklamayı göster

Cevap

The blank requires a word meaning slavish, unquestioning, or excessively submissive (such as 'servile' or 'slavish'), which accurately reflects the traditional characterization of uncritical submission that the passage's contrast signals refute.
The contrast transition 'nevertheless' paired with the structural signal 'far from demonstrating {{blank_1}} deference' indicates that the blank must echo the traditional historical view of 'uncritical submission to dogma'. Therefore, an adjective indicating slavish, blind, or excessively passive submissiveness (such as 'servile' or 'slavish') is required to complete the structural logic of the sentence.

Adım Adım Çözüm

1
Identify the primary macro-structural signal in the passage.
The transition word 'nevertheless' signals a sharp contrast between the traditional historical view described in the first clause and the recent analytical findings presented in the main clause.
Understanding macro-transitions establishes the overarching direction of the argument.
2
Analyze the immediate structural frame around the target blank.
The prepositional phrase 'far from demonstrating {{blank_1}} deference' sets up an internal negation. The blank describes the trait that the recent readings show was NOT actually present.
The structural clue 'far from' indicates that the missing word must echo the traditional, erroneous assumption ('uncritical submission') rather than the scholars' actual behavior.
3
Determine the required semantic meaning and tone.
To align with 'uncritical submission to dogma', the adjective modifying 'deference' must denote submissive, blind, or slavish adherence.
Matching the vocabulary tone to the baseline claim being negated ensures logical coherence across the sentence.
4
Select valid completion candidates.
Words such as 'servile', 'slavish', or 'unquestioning' fit the exact semantic profile required by the structural clues.
These terms capture the concept of blind submission rejected by the contrast phrase.

Anahtar Kavram

Deciphering Meaning via Structural Clues and Contrast/Continuation Signals
Tahmini Süre:1m 30s
Soru 22Soru

Complete the text below by providing the word that correctly fills the blank according to the contrast pivot signal in the sentence.

Aşağıdaki boşlukları doldurun

While classical numismatists maintained that provincial minting practices during the late empire were strictly regimented, recent die-analysis demonstrates that coin production was unexpectedly , yielding substantial stylistic and compositional divergences even within single production runs.
Cevabı ve açıklamayı göster

Cevap

haphazard (or an equivalent synonym such as erratic, unmethodical, or arbitrary)
The transition word 'While' signals a contrast between the belief that minting was 'strictly regimented' and the recent evidence. The blank requires an adjective opposing strict order that aligns with 'substantial stylistic and compositional divergences', making 'haphazard' (or 'erratic' / 'unmethodical') the correct fit.

Adım Adım Çözüm

1
Identify the contrast signal (pivot word) establishing sentence structure.
The opening transition 'While' establishes a contrast between the historical consensus and recent analytical findings.
Contrast pivots signal a reversal of semantic direction between clauses.
2
Analyze the clue provided in the main reference clause.
The initial clause describes minting practices as 'strictly regimented', implying high control, order, and uniformity.
The target word in the blank must express an opposing characteristic to 'strictly regimented'.
3
Deduce the word for the blank and verify against remaining context.
A word meaning lacking system or order, such as 'haphazard' or 'erratic', fits the semantic reversal and matches the elaboration 'yielding substantial stylistic and compositional divergences'.
'Haphazard' directly reverses 'strictly regimented' and creates contextual coherence.

Anahtar Kavram

Contrast and Reversal Clues
Soru 23Soru

Which of the following rational numbers are strictly greater than 35\frac{3}{5}? Select all that apply.

Geçerli olan tümünü seçin

Cevabı ve açıklamayı göster

Cevap: 710\frac{7}{10}; 23\frac{2}{3}; 1115\frac{11}{15}

Cevap

The fractions greater than 3/5 are 7/10, 2/3, and 11/15.
Converting 3/5 to decimal form yields 0.60. Evaluating the options: 7/10 equals 0.70, 2/3 is approximately 0.667, and 11/15 is approximately 0.733. Because each of these three values is strictly greater than 0.60, all three are correct choices.

Adım Adım Çözüm

1
Convert the benchmark fraction 3/5 to decimal form.
3/5 = 0.60.
Decimal conversion provides a clear standard for comparing rational numbers.
2
Convert each given choice to decimal form and compare it to 0.60.
7/10 = 0.70; 2/3 ≈ 0.667; 5/9 ≈ 0.556; 4/7 ≈ 0.571; 11/15 ≈ 0.733.
Direct comparison reveals which decimals exceed 0.60.
3
Select all fractions whose values exceed 0.60.
The values 0.70, 0.667, and 0.733 are all strictly greater than 0.60.
The corresponding fractions 7/10, 2/3, and 11/15 satisfy the given condition.

Anahtar Kavram

Comparing Rational Numbers and Fractions
Soru 24Soru

Read the passage below and answer the question that follows.

While early historiographies of early modern science portrayed Isaac Newton’s esoteric laboratory notes as an embarrassing aberration that was deliberately (i)_______ by Enlightenment commentators, recent archival analyses suggest that eighteenth-century natural philosophers did not view these manuscripts with (ii)_______. Far from signaling a secret (iii)_______ of rationalist principles, Newton’s alchemical inquiries were deeply intertwined with his overarching search for a unified active principle in nature.

Which set of words, when inserted into the blanks in order, best completes the passage so that it maintains cross-sentence contextual coherence throughout?

Cevabı ve açıklamayı göster

Cevap: (i) expunged, (ii) derision, (iii) repudiation

Cevap

The correct completion is the set containing 'expunged', 'derision', and 'repudiation'.
The correct set of words maintains logical, thematic, and rhetorical coherence across both sentences. 'Expunged' aligns with the portrayal of the notes as an 'embarrassing aberration', 'derision' fits the contrast showing natural philosophers did not hold the notes in contempt, and 'repudiation' establishes the concession needed before explaining that Newton's alchemical work was integrated into his broader rationalist pursuits.

Adım Adım Çözüm

1
Analyze Blank (i) using the initial contrast clue 'While' and the phrase 'embarrassing aberration'.
The word in blank (i) must reflect negative treatment or removal. 'Expunged' (erased/removed) logically fits the idea that historians portrayed the notes as deliberately suppressed.
An 'embarrassing aberration' would historically be covered up or omitted rather than celebrated.
2
Analyze Blank (ii) using the shift introduced by 'recent archival analyses suggest that... did not view these manuscripts with...'.
The word in blank (ii) must represent negative judgment or contempt, which the recent analyses refute. 'Derision' (contemptuous ridicule) fits seamlessly.
Saying contemporary scholars 'did not view these manuscripts with derision' directly contrasts with the old historiographical view that they were seen as an embarrassing aberration.
3
Analyze Blank (iii) using the concessionary shift 'Far from signaling a secret... of rationalist principles, Newton’s alchemical inquiries were deeply intertwined with...'.
The word in blank (iii) must denote a rejection or abandonment of rationalism. 'Repudiation' (rejection/disavowal) completes the thought that his work was not a rejection of rationalism, but part of it.
The structure 'Far from X, [statement of Y]' requires X to represent the opposite of Y.

Anahtar Kavram

Cross-Sentence Contextual Coherence in Multi-Blank Text Completion
Soru 25Soru

A baker has a flour mixture consisting only of wheat flour and rye flour. Currently, wheat flour accounts for 25\frac{2}{5} of the total weight of the mixture. If the baker adds 99 pounds of wheat flour to the mixture, wheat flour will account for 12\frac{1}{2} of the new total weight of the mixture. What was the total weight, in pounds, of the original flour mixture?

Cevabı ve açıklamayı göster

Cevap: 45

Cevap

The total weight of the original flour mixture was 45 pounds.
The initial total weight of the mixture is 45 pounds. Initially, wheat flour makes up 25×45=18\frac{2}{5} \times 45 = 18 pounds. Adding 9 pounds of wheat flour increases the wheat flour to 18+9=2718 + 9 = 27 pounds and the total weight to 45+9=5445 + 9 = 54 pounds. The new fraction of wheat flour is 2754=12\frac{27}{54} = \frac{1}{2}, which satisfies the given conditions.

Adım Adım Çözüm

1
Express the initial weight of wheat flour in terms of the initial total weight WW.
Initial weight of wheat flour = 25W\frac{2}{5}W.
Wheat flour represents 25\frac{2}{5} of the total mixture.
2
Formulate an equation reflecting the addition of 9 pounds of wheat flour.
\frac{\frac{2}{5}W + 9}{W + 9} = \frac{1}{2}
Adding 9 pounds of wheat flour increases both the amount of wheat flour and the total weight of the mixture by 9 pounds.
3
Solve the algebraic equation for WW.
Cross-multiplying gives 2(25W+9)=W+92\left(\frac{2}{5}W + 9\right) = W + 9, which simplifies to 45W+18=W+9\frac{4}{5}W + 18 = W + 9. Subtracting 45W\frac{4}{5}W and 99 from both sides gives 15W=9\frac{1}{5}W = 9, so W=45W = 45.
Isolating WW gives the value of the original total weight.

Anahtar Kavram

Setting up and solving equations involving fractional parts when a quantity is added to both the part and the whole.
Soru 26Soru

How many positive integers nn less than 3030 satisfy the condition that n21n^2 - 1 is divisible by 2424?

Cevabı ve açıklamayı göster

Cevap: 10

Cevap

10
For n21n^2 - 1 to be divisible by 24=8×324 = 8 \times 3, nn must be an odd integer that is not divisible by 3, which means gcd(n,6)=1\gcd(n, 6) = 1. The positive integers less than 30 coprime to 6 are 1, 5, 7, 11, 13, 17, 19, 23, 25, and 29, totaling 10 integers.

Adım Adım Çözüm

1
Factor the expression and analyze divisibility requirements for 24.
n21=(n1)(n+1)n^2 - 1 = (n - 1)(n + 1). Since 24=8×324 = 8 \times 3 with gcd(8,3)=1\gcd(8, 3) = 1, n21n^2 - 1 must be divisible by both 88 and 33.
Decompose 24 into coprime prime-power factors to evaluate modular conditions independently.
2
Determine the condition for n21n^2 - 1 to be divisible by 8.
If nn is even, n21n^2 - 1 is odd and cannot be divisible by 8. If nn is odd, let n=2k+1n = 2k + 1; then n21=4k(k+1)n^2 - 1 = 4k(k + 1). Since one of kk or k+1k + 1 is always even, 4k(k+1)4k(k + 1) is divisible by 8. Thus, nn must be odd.
Analyze parity requirements for the power of 2.
3
Determine the condition for n21n^2 - 1 to be divisible by 3.
If nn is a multiple of 3, n211(mod3)n^2 - 1 \equiv -1 \pmod 3, which is not divisible by 3. If nn is not a multiple of 3, n1n \equiv 1 or 2(mod3)2 \pmod 3, so n21(mod3)n^2 \equiv 1 \pmod 3 and n21n^2 - 1 is divisible by 3. Thus, nn cannot be a multiple of 3.
Analyze remainder properties modulo 3.
4
Combine the conditions and count valid positive integers n<30n < 30.
The combined requirement is gcd(n,6)=1\gcd(n, 6) = 1 (nn is odd and not a multiple of 3). The positive integers less than 30 satisfying this are 1, 5, 7, 11, 13, 17, 19, 23, 25, and 29. Counting these yields 10 integers.
Enumerate all integers meeting the coprime condition within the specified domain.

Anahtar Kavram

Modular arithmetic properties of quadratic expressions and coprimality constraints
Soru 27Soru

Based on the contextual clues in the sentence below, identify the vocabulary word that accurately completes the passage when used in its secondary meaning.

Aşağıdaki boşlukları doldurun

Despite the principal investigator's initial optimism regarding the clinical trial, her enthusiasm began to after several months of repetitive data collection failed to yield statistically significant results.
Cevabı ve açıklamayı göster

Cevap

The word 'flag' correctly completes the sentence, functioning in its secondary sense as a verb meaning to lose vigor, tire, or decline in intensity.
In the provided context, the transition word 'Despite' contrasts initial optimism with a subsequent decline in enthusiasm. The verb 'flag' secondary definition is to languish, tire, or lose vigor, making it the intended fit for the blank.

Adım Adım Çözüm

1
Analyze the structural contrast and tone signals in the sentence.
The opening word 'Despite' signals a shift from the investigator's 'initial optimism' to a state of diminishing energy or enthusiasm caused by unpromising experimental results.
The context requires a verb that expresses a drop, weakening, or loss of momentum.
2
Evaluate high-frequency words for relevant secondary definitions.
While 'flag' is most commonly known as a noun referring to a banner or marker, its secondary verb definition specifically means to become unsteady, dwindle, or decline in vigor.
Using 'flag' in this sense provides an exact semantic match for diminishing enthusiasm.

Anahtar Kavram

Secondary and Alternative Meanings of High-Frequency Words
Soru 28Soru

Let nn be a positive integer whose prime factorization consists only of the prime factors 22 and 33. If nn has exactly 1212 positive divisors and gcd(n,36)=12\gcd(n, 36) = 12, what is the value of nn?

Cevabı ve açıklamayı göster

Cevap: 96

Cevap

The value of nn is 9696.
Representing n=2a×3bn = 2^a \times 3^b, the number of positive divisors is (a+1)(b+1)=12(a+1)(b+1) = 12. The greatest common divisor gcd(n,36)=gcd(2a×3b,22×32)=2min(a,2)×3min(b,2)=12=22×31\gcd(n, 36) = \gcd(2^a \times 3^b, 2^2 \times 3^2) = 2^{\min(a,2)} \times 3^{\min(b,2)} = 12 = 2^2 \times 3^1. This requires min(a,2)=2    a2\min(a,2) = 2 \implies a \ge 2 and min(b,2)=1    b=1\min(b,2) = 1 \implies b = 1. Substituting b=1b = 1 into (a+1)(1+1)=12(a+1)(1+1) = 12 gives 2(a+1)=122(a+1) = 12, so a=5a = 5. Therefore, n=25×31=32×3=96n = 2^5 \times 3^1 = 32 \times 3 = 96.

Adım Adım Çözüm

1
Set up the prime factorization of nn and the divisor count equation.
n=2a×3bn = 2^a \times 3^b and (a+1)(b+1)=12(a + 1)(b + 1) = 12.
Since the prime factors of nn are only 22 and 33, nn must take the form 2a×3b2^a \times 3^b, where the number of positive divisors is (a+1)(b+1)(a+1)(b+1).
2
Analyze the exponent requirements using the greatest common divisor.
a2a \ge 2 and b=1b = 1.
gcd(2a×3b,22×32)=2min(a,2)×3min(b,2)=22×31\gcd(2^a \times 3^b, 2^2 \times 3^2) = 2^{\min(a,2)} \times 3^{\min(b,2)} = 2^2 \times 3^1. Matching powers gives min(a,2)=2    a2\min(a,2) = 2 \implies a \ge 2, and min(b,2)=1    b=1\min(b,2) = 1 \implies b = 1.
3
Solve for exponent aa and calculate nn.
a=5a = 5, giving n=25×31=96n = 2^5 \times 3^1 = 96.
Substituting b=1b = 1 into (a+1)(1+1)=12(a+1)(1+1) = 12 gives 2(a+1)=12    a=52(a+1) = 12 \implies a = 5, which satisfies a2a \ge 2.

Anahtar Kavram

Prime exponent rules for GCD and divisor counting
Tahmini Süre:2m 0s
Soru 29Soru

Let K=25×34×53×112K = 2^5 \times 3^4 \times 5^3 \times 11^2. How many positive integer factors of KK are divisible by 300300 but are not divisible by 900900?

Cevabı ve açıklamayı göster

Cevap: 24

Cevap

24
The correct answer 24 is obtained by analyzing the prime factorizations 300=22×31×52300 = 2^2 \times 3^1 \times 5^2 and 900=22×32×52900 = 2^2 \times 3^2 \times 5^2. Any factor f=2a×3b×5c×11df = 2^a \times 3^b \times 5^c \times 11^d must satisfy a{2,3,4,5}a \in \{2, 3, 4, 5\} (4 choices), b=1b = 1 (1 choice, since b1b \ge 1 for 300 but b<2b < 2 for 900), c{2,3}c \in \{2, 3\} (2 choices), and d{0,1,2}d \in \{0, 1, 2\} (3 choices). Multiplying these choices gives 4×1×2×3=244 \times 1 \times 2 \times 3 = 24.

Adım Adım Çözüm

1
Express any factor of KK in terms of prime factor exponent constraints.
Any factor ff of KK has the form f=2a×3b×5c×11df = 2^a \times 3^b \times 5^c \times 11^d, where 0a50 \le a \le 5, 0b40 \le b \le 4, 0c30 \le c \le 3, and 0d20 \le d \le 2.
The prime factors of ff must be subsets of the prime factors of KK with exponents not exceeding those in KK.
2
Find the prime factorizations of 300300 and 900900.
300=22×31×52300 = 2^2 \times 3^1 \times 5^2 and 900=22×32×52900 = 2^2 \times 3^2 \times 5^2.
Divisibility criteria correspond to minimum exponent requirements for each prime factor.
3
Apply the divisibility conditions to determine constraints on each exponent.
For ff to be divisible by 300300, we need a2a \ge 2, b1b \ge 1, and c2c \ge 2. For ff to NOT be divisible by 900900, we must have b<2b < 2. Thus, b=1b = 1.
Combining b1b \ge 1 and b<2b < 2 uniquely restricts bb to 11.
4
Count the number of valid choices for each exponent.
a{2,3,4,5}a \in \{2, 3, 4, 5\} (44 choices), b{1}b \in \{1\} (11 choice), c{2,3}c \in \{2, 3\} (22 choices), and d{0,1,2}d \in \{0, 1, 2\} (33 choices).
The exponent dd is unrestricted by 300300 or 900900, so it can take any valid power present in KK.
5
Multiply the number of independent choices using the fundamental counting principle.
4×1×2×3=244 \times 1 \times 2 \times 3 = 24.
Each exponent choice can be paired independently to form a unique factor.

Anahtar Kavram

Counting Divisors Using Prime Exponent Constraints
Soru 30Soru

Based on the explicit continuation and causal structural signals in the sentence below, identify the word that best completes the statement logically.

Aşağıdaki boşlukları doldurun

The extremophilic organisms discovered near the deep-sea hydrothermal vent did not merely endure the extreme thermal pressure; indeed, exposure to the superheated environment their metabolic activity, driving unprecedented rates of cellular reproduction.
Cevabı ve açıklamayı göster

Cevap

A verb conveying intensification or acceleration (such as 'accelerated', 'stimulated', or 'catalyzed')
The structural combination 'did not merely... indeed' functions as an intensifying continuation signal. The second clause must advance the narrative beyond baseline endurance. Therefore, a correct completion must express that the environmental conditions actively heightened or accelerated metabolic function.

Adım Adım Çözüm

1
Analyze the structural signals in the sentence stem.
The phrase 'did not merely... indeed' establishes an intensifying continuation signal.
Recognizing structural signals reveals the logical direction and degree of momentum required for the blank.
2
Determine the contextual meaning required for the blank.
Since the organisms went beyond simple endurance, the environment must actively increase or spur their metabolic activity.
The continuation signal 'indeed' reinforces and escalates the claim from passive survival to active enhancement.
3
Formulate valid completions that fulfill the causal progression.
Words such as 'accelerated', 'stimulated', or 'catalyzed' fit the context logically.
These verbs match both the positive valence and the increased rate implied by 'driving unprecedented rates of cellular reproduction'.

Anahtar Kavram

Interpreting Continuation and Causal Structural Signals
Tahmini Süre:1m 0s
Soru 31Soru

In circle OO, sector AOBAOB has a central angle of 6060^\circ and a radius of 1212. A smaller circle CC is inscribed within sector AOBAOB such that it is tangent to radii OAOA and OBOB, as well as to arc ABAB. What is the area of the region inside sector AOBAOB that lies outside circle CC?

Cevabı ve açıklamayı göster

Cevap: 8π8\pi

Cevap

The area of the region inside sector AOBAOB outside circle CC is 8π8\pi.
The correct answer is derived by first finding the area of sector AOBAOB using 60360π(122)=24π\frac{60}{360} \pi (12^2) = 24\pi. Then, analyzing the geometry of the inscribed circle reveals that the line from OO to the center of circle CC bisects the 6060^\circ angle. In the resulting 30609030^\circ-60^\circ-90^\circ right triangle, the hypotenuse length is 2r2r, making the total radius of sector AOBAOB equal to 2r+r=3r=122r + r = 3r = 12, which yields r=4r = 4. The area of circle CC is π(42)=16π\pi (4^2) = 16\pi. Subtracting the circle area from the sector area gives 24π16π=8π24\pi - 16\pi = 8\pi.

Adım Adım Çözüm

1
Calculate the area of sector AOBAOB
Sector area =60360×π(122)=16×144π=24π= \frac{60^\circ}{360^\circ} \times \pi (12^2) = \frac{1}{6} \times 144\pi = 24\pi
The area of a sector with central angle θ\theta and radius RR is θ360πR2\frac{\theta}{360^\circ} \pi R^2.
2
Find the radius rr of the inscribed circle CC
Distance from OO to center of circle CC is OP=2rOP = 2r, so total radius R=OP+r=3r=12    r=4R = OP + r = 3r = 12 \implies r = 4
The line segment connecting center OO to center PP of circle CC bisects the 6060^\circ angle into two 3030^\circ angles. A perpendicular dropped from PP to radius OAOA forms a 30609030^\circ-60^\circ-90^\circ right triangle where sin(30)=rOP=12\sin(30^\circ) = \frac{r}{OP} = \frac{1}{2}, giving OP=2rOP = 2r.
3
Calculate the area of circle CC
Area of circle C=πr2=π(42)=16πC = \pi r^2 = \pi (4^2) = 16\pi
The area of a circle with radius rr is πr2\pi r^2.
4
Subtract the area of circle CC from the area of sector AOBAOB
24π16π=8π24\pi - 16\pi = 8\pi
The desired region is the difference between the full sector area and the enclosed circle's area.

Anahtar Kavram

Inscribed circles in sectors and central angle sector area calculations
Tahmini Süre:2m 30s
Soru 32Soru

While early botanists viewed plant responses to pest attacks as mere passive physiological reactions, recent ecological studies indicate that flora actively emit volatile organic compounds to signal neighboring plants of impending threats. To test this phenomenon in controlled environments, researchers synthesized synthetic compounds mimicking plant distress signals and exposed healthy crops to them. Remarkably, the uninjured crops responded by preemptively synthesizing defensive enzymes. This finding strongly supports the hypothesis that plants communicate through chemical signaling, though further field trials are necessary to verify whether such interactions occur with equal efficacy in complex, unmonitored ecosystems.

Which of the following best describes the primary rhetorical function of the sentence beginning with 'Remarkably'?

Cevabı ve açıklamayı göster

Cevap: It describes an empirical finding that serves as evidence supporting the hypothesis being tested.

Cevap

The sentence describes an empirical finding that serves as evidence supporting the hypothesis being tested.
The sentence starting with 'Remarkably' reports the observed outcome of the researchers' experiment—namely, that uninjured crops responded to distress signals by producing defensive enzymes. In the broader rhetorical structure of the passage, this observed outcome serves as empirical evidence supporting the idea that plants communicate via chemical signals.

Adım Adım Çözüm

1
Analyze the context surrounding the target sentence.
The preceding sentence outlines an experimental setup (exposing healthy crops to synthetic signals). The target sentence reports what happened next (uninjured crops responded by producing enzymes).
Understanding the surrounding context clarifies how the target sentence relates to the passage's argument structure.
2
Determine the functional role of the target sentence.
The observation that uninjured crops responded demonstrates a concrete experimental result, providing empirical backing for the communication hypothesis mentioned in the subsequent sentence.
Identifying what role the sentence plays within the argument chain is key to choosing the correct description.

Anahtar Kavram

Identifying sentence function and evidence structure within an argument.
Soru 33Soru

Based on the support and cause-effect clues in the passage, which words best complete the blanks to maintain sentence coherence?

Aşağıdaki boşlukları doldurun

Because the head archivist maintained an unwavering adherence to traditional preservation protocols throughout her tenure, historians deduced that the institution operated under a regime of strictly administrative practices—a systemic discipline that consequently the development of idiosyncratic filing methods.
Cevabı ve açıklamayı göster

Cevap

For the first blank, words such as 'regimented' or 'standardized' correctly align with the cause clue of 'unwavering adherence to traditional preservation protocols.' For the second blank, verbs such as 'forestalled' or 'stymied' complete the cause-effect relationship introduced by 'consequently,' reflecting how rigid standardization prevents individual variations from emerging.
The introductory clause establishes a clear cause: the archivist's 'unwavering adherence' to rules. This directly supports a descriptor for the first blank that signifies strict, uniform discipline (such as 'regimented' or 'standardized'). The phrase 'consequently' then sets up the downstream effect of this rigid environment: it prevented or hindered the emergence of individual, non-standard practices, which is logically completed by verbs like 'forestalled', 'stymied', or 'precluded'.

Adım Adım Çözüm

1
Identify the cause clue driving the first blank.
The clause 'Because the head archivist maintained an unwavering adherence to traditional preservation protocols' provides direct support for the nature of the administrative practices.
The causal conjunction 'Because' dictates that the first blank must describe practices characterized by strict order, uniformity, and adherence to rules.
2
Determine the appropriate semantic fit for the first blank.
Words like 'regimented', 'standardized', or 'codified' match the required intensity of strict discipline.
These terms echo the sentiment of unwavering adherence to established rules without introducing contradictory nuance.
3
Analyze the cause-effect transition for the second blank.
The phrase 'a systemic discipline that consequently {{blank_2}}...' signals that the second blank expresses the direct outcome of a rigid system on personal variations.
A highly standardized regime naturally stops, prevents, or impedes the growth of irregular, non-standard ('idiosyncratic') practices.
4
Select the correct term for the second blank based on causal direction.
Verbs like 'forestalled', 'stymied', 'precluded', or 'stifled' fit the logical outcome.
These terms correctly capture the action of preventing or obstructing something before it can take root.

Anahtar Kavram

Support and Cause-Effect Clues in Text Completion
Soru 34Soru

If b>1b > 1, which of the following expressions are equivalent to b3b23b16\frac{\sqrt{b^3 \cdot \sqrt[3]{b^2}}}{b^{-\frac{1}{6}}}? Select all that apply.

Geçerli olan tümünü seçin

Cevabı ve açıklamayı göster

Cevap: (b3)6(\sqrt[3]{b})^6; b73b13\frac{b^{\frac{7}{3}}}{b^{\frac{1}{3}}}; (b12)4\left(b^{-\frac{1}{2}}\right)^{-4}

Cevap

The equivalent expressions are (b3)6(\sqrt[3]{b})^6, b73b13\frac{b^{\frac{7}{3}}}{b^{\frac{1}{3}}}, and (b12)4\left(b^{-\frac{1}{2}}\right)^{-4}.
Simplifying the original expression yields b3b2/3b1/6=b11/6b1/6=b11/6(1/6)=b12/6=b2\frac{\sqrt{b^3 \cdot b^{2/3}}}{b^{-1/6}} = \frac{b^{11/6}}{b^{-1/6}} = b^{11/6 - (-1/6)} = b^{12/6} = b^2. The expression (b3)6(\sqrt[3]{b})^6 equals b6/3=b2b^{6/3} = b^2. The expression b7/3b1/3\frac{b^{7/3}}{b^{1/3}} equals b7/31/3=b2b^{7/3 - 1/3} = b^2. The expression (b1/2)4\left(b^{-1/2}\right)^{-4} equals b(1/2)(4)=b2b^{(-1/2)(-4)} = b^2. All three equal b2b^2.

Adım Adım Çözüm

1
Simplify the expression inside the square root in the numerator.
b3b23=b3b23=b3+23=b113b^3 \cdot \sqrt[3]{b^2} = b^3 \cdot b^{\frac{2}{3}} = b^{3 + \frac{2}{3}} = b^{\frac{11}{3}}
Convert radical to rational exponent and use product rule for exponents.
2
Apply the square root to the numerator.
b113=(b113)12=b116\sqrt{b^{\frac{11}{3}}} = \left(b^{\frac{11}{3}}\right)^{\frac{1}{2}} = b^{\frac{11}{6}}
Taking the square root is equivalent to raising to the power of 12\frac{1}{2}.
3
Divide by the denominator.
\frac{b^{\frac{11}{6}}}{b^{-\frac{1}{6}}} = b^{\frac{11}{6} - \left(-\frac{1}{6}\right)} = b^{\frac{12}{6}} = b^2
Apply quotient rule for exponents: subtract the exponent of the denominator from the numerator.
4
Evaluate each given option to determine which simplify to b2b^2.
The expressions (b3)6=b2(\sqrt[3]{b})^6 = b^2, b73b13=b2\frac{b^{\frac{7}{3}}}{b^{\frac{1}{3}}} = b^2, and (b12)4=b2\left(b^{-\frac{1}{2}}\right)^{-4} = b^2 are all equivalent.
Matching each simplified candidate expression to the target simplified value b2b^2.

Anahtar Kavram

Simplification of nested algebraic radicals and rational exponents using exponent rules
Tahmini Süre:2m 0s
Soru 35Soru

If xx is a real number that satisfies the compound absolute value inequality 2x574||2x - 5| - 7| \le 4, which of the following values could be the value of xx? Select all such values.

Geçerli olan tümünü seçin

Cevabı ve açıklamayı göster

Cevap: 2-2; 00; 66

Cevap

The real numbers 2-2, 00, and 66 satisfy the inequality.
The solution set to the compound inequality 2x574||2x - 5| - 7| \le 4 is the union of two intervals: [3,1][-3, 1] and [4,8][4, 8]. Among the options provided, 2-2 and 00 fall into the interval [3,1][-3, 1], and 66 falls into the interval [4,8][4, 8]. Therefore, these three values satisfy the original inequality.

Adım Adım Çözüm

1
Unfold the outer absolute value inequality.
42x574-4 \le |2x - 5| - 7 \le 4
For any expression UU and constant c0c \ge 0, Uc|U| \le c is equivalent to cUc-c \le U \le c.
2
Isolate the inner absolute value term by adding 77 across all parts.
32x5113 \le |2x - 5| \le 11
Adding a constant preserves inequality directions.
3
Break the compound inequality into two separate absolute value conditions.
Condition 1: 2x511|2x - 5| \le 11; Condition 2: 2x53|2x - 5| \ge 3
Both conditions must hold simultaneously for xx.
4
Solve Condition 1 (2x511|2x - 5| \le 11).
112x511    62x16    3x8-11 \le 2x - 5 \le 11 \implies -6 \le 2x \le 16 \implies -3 \le x \le 8
Expanding the bounded absolute value inequality and solving for xx.
5
Solve Condition 2 (2x53|2x - 5| \ge 3).
2x532x - 5 \ge 3 or 2x53    2x82x - 5 \le -3 \implies 2x \ge 8 or 2x2    x42x \le 2 \implies x \ge 4 or x1x \le 1
For Uc|U| \ge c, UcU \ge c or UcU \le -c.
6
Find the intersection of the two solution sets.
x[3,1][4,8]x \in [-3, 1] \cup [4, 8]
Intersecting [3,8][-3, 8] with (,1][4,)(-\infty, 1] \cup [4, \infty) yields [3,1][4,8][-3, 1] \cup [4, 8].
7
Test the provided choices against the solution set [3,1][4,8][-3, 1] \cup [4, 8].
2[3,1]-2 \in [-3, 1] (valid), 0[3,1]0 \in [-3, 1] (valid), 3[3,1][4,8]3 \notin [-3, 1] \cup [4, 8] (invalid), 6[4,8]6 \in [4, 8] (valid), 9[3,1][4,8]9 \notin [-3, 1] \cup [4, 8] (invalid).
Values lying within the solution intervals satisfy the original inequality.

Anahtar Kavram

Solving nested absolute value inequalities using multi-step compound interval intersections.
Soru 36Soru

An equilateral triangle ABCABC with side length 636\sqrt{3} is inscribed in a circle with center OO. What is the area of sector AOBAOB, divided by π\pi?

Cevabı ve açıklamayı göster

Cevap: 12

Cevap

The area of sector AOBAOB divided by π\pi is 12.
Since triangle ABCABC is equilateral, its three vertices divide the circle into three congruent arcs of 120120^\circ each. Thus, central angle AOB=120\angle AOB = 120^\circ. The relationship between the side length ss of an inscribed equilateral triangle and the radius RR of its circumscribed circle is s=R3s = R\sqrt{3}. Given s=63s = 6\sqrt{3}, we solve for RR to find R=6R = 6. The area of sector AOBAOB is 120360πR2=13π(62)=12π\frac{120^\circ}{360^\circ} \pi R^2 = \frac{1}{3} \pi (6^2) = 12\pi. Dividing this area by π\pi yields 1212.

Adım Adım Çözüm

1
Find the central angle AOB\angle AOB corresponding to side ABAB of the inscribed equilateral triangle.
AOB=120\angle AOB = 120^\circ
An inscribed equilateral triangle divides the 360360^\circ circle into three equal central angles.
2
Calculate the radius RR of the circumscribed circle from the given side length s=63s = 6\sqrt{3}.
R=6R = 6
In an inscribed equilateral triangle, s=R3s = R\sqrt{3}. Substituting 63=R36\sqrt{3} = R\sqrt{3} gives R=6R = 6.
3
Compute the area of sector AOBAOB and divide by π\pi.
12
Sector Area=120360×π×62=12π\text{Sector Area} = \frac{120^\circ}{360^\circ} \times \pi \times 6^2 = 12\pi. Dividing by π\pi leaves 1212.

Anahtar Kavram

Relationship between inscribed shapes, circle radii, and sector area
Soru 37Soru

A right circular cylinder has base radius rr and height hh. The height of the cylinder is increased by 50%50\%, and its base radius is decreased by 20%20\%. Which of the following statements about the modified cylinder compared to the original cylinder must be true? Select all that apply.

Geçerli olan tümünü seçin

Cevabı ve açıklamayı göster

Cevap: The volume of the cylinder decreases by 4%4\%.; The lateral surface area of the cylinder increases by 20%20\%.; If h=rh = r, the total surface area of the cylinder decreases.

Cevap

The statements confirming a 4%4\% volume decrease, a 20%20\% lateral surface area increase, and a total surface area decrease when h=rh = r are all true.
The volume of the modified cylinder decreases by 4%4\% because 0.82×1.5=0.960.8^2 \times 1.5 = 0.96. The lateral surface area increases by 20%20\% because 0.8×1.5=1.200.8 \times 1.5 = 1.20. When h=rh = r, the original total surface area 4πr24\pi r^2 reduces to 3.68πr23.68\pi r^2, confirming a decrease.

Adım Adım Çözüm

1
Express original and modified dimensions algebraically.
Original: radius =r= r, height =h= h. Modified: radius =0.8r= 0.8r, height =1.5h= 1.5h.
Decreasing radius by 20%20\% multiplies it by 10.20=0.801 - 0.20 = 0.80, while increasing height by 50%50\% multiplies it by 1+0.50=1.501 + 0.50 = 1.50.
2
Calculate the ratio of modified volume to original volume.
Vnew=π(0.8r)2(1.5h)=0.64×1.5πr2h=0.96VoldV_{new} = \pi (0.8r)^2 (1.5h) = 0.64 \times 1.5 \pi r^2 h = 0.96 V_{old}, indicating a 4%4\% volume decrease.
Volume of a cylinder is given by V=πr2hV = \pi r^2 h.
3
Calculate the ratio of modified lateral surface area to original lateral surface area.
Lnew=2π(0.8r)(1.5h)=2.4πrh=1.20LoldL_{new} = 2\pi (0.8r)(1.5h) = 2.4\pi r h = 1.20 L_{old}, indicating a 20%20\% lateral surface area increase.
Lateral surface area of a cylinder is given by L=2πrhL = 2\pi r h.
4
Evaluate the base area change and total surface area under specific height-to-radius ratios.
Base area becomes (0.8)2=0.64(0.8)^2 = 0.64 of original (36%36\% decrease). For h=rh = r, total surface area changes from 4πr24\pi r^2 to 3.68πr23.68\pi r^2 (decrease). For h=4rh = 4r, total surface area changes from 10πr210\pi r^2 to 10.88πr210.88\pi r^2 (increase).
Total surface area is the sum of lateral surface area and base area, A=2πr2+2πrhA = 2\pi r^2 + 2\pi r h.

Anahtar Kavram

Impact of dimensional scaling on volume, lateral surface area, and total surface area of cylinders
Soru 38Soru

A quality control engineer records the thickness, in millimeters, of 9 sample components: 11,13,15,17,19,21,23,25,11, 13, 15, 17, 19, 21, 23, 25, and 2727. Each thickness measurement xx is then converted to a scaled rating yy using the linear formula y=1.5x+4.8y = 1.5x + 4.8. What is the interquartile range (IQR) of the transformed dataset of yy-values?

Cevabı ve açıklamayı göster

Cevap: 15

Cevap

The interquartile range of the transformed dataset is 15.
The interquartile range (IQR) measures the spread of the middle 50% of the data (Q3Q1Q_3 - Q_1). For the original dataset 11,13,15,17,19,21,23,25,2711, 13, 15, 17, 19, 21, 23, 25, 27, the median is 1919. Q1Q_1 is the median of the lower half {11,13,15,17}\{11, 13, 15, 17\}, which is 13+152=14\frac{13+15}{2} = 14. Q3Q_3 is the median of the upper half {21,23,25,27}\{21, 23, 25, 27\}, which is 23+252=24\frac{23+25}{2} = 24. Thus, the original IQR=2414=10\text{IQR} = 24 - 14 = 10. Under a linear transformation y=ax+by = ax + b, measures of position shift by ax+ba x + b, so Q1(y)=1.5(14)+4.8=25.8Q_1(y) = 1.5(14) + 4.8 = 25.8 and Q3(y)=1.5(24)+4.8=40.8Q_3(y) = 1.5(24) + 4.8 = 40.8. Subtracting these yields IQR(y)=40.825.8=15\text{IQR}(y) = 40.8 - 25.8 = 15. Notice that this is simply 1.5×101.5 \times 10, as adding a constant shifts the location of the distribution but leaves measures of spread unchanged.

Adım Adım Çözüm

1
Find the quartiles of the original 9-element dataset.
Q1=14Q_1 = 14 and Q3=24Q_3 = 24
The median of the dataset is 19 (the 5th value). The lower half of the data consists of 11,13,15,1711, 13, 15, 17, so Q1=13+152=14Q_1 = \frac{13 + 15}{2} = 14. The upper half consists of 21,23,25,2721, 23, 25, 27, so Q3=23+252=24Q_3 = \frac{23 + 25}{2} = 24.
2
Calculate the interquartile range of the original dataset.
IQRx=10\text{IQR}_x = 10
IQRx=Q3Q1=2414=10\text{IQR}_x = Q_3 - Q_1 = 24 - 14 = 10.
3
Apply the linear transformation rules to find the transformed interquartile range.
IQRy=15\text{IQR}_y = 15
For a linear transformation y=ax+by = ax + b, the interquartile range scales by a|a|, so IQRy=aIQRx=1.5×10=15\text{IQR}_y = |a| \cdot \text{IQR}_x = 1.5 \times 10 = 15. The constant addition of 4.84.8 shifts all values equally and does not affect the spread/IQR.

Anahtar Kavram

Effect of linear transformations on measures of dispersion (IQR, standard deviation, range)

Alternatif Yöntem

Transform the individual quartiles directly: Q1(y)=1.5(14)+4.8=25.8Q_1(y) = 1.5(14) + 4.8 = 25.8 and Q3(y)=1.5(24)+4.8=40.8Q_3(y) = 1.5(24) + 4.8 = 40.8. Then calculate the new IQR directly as 40.825.8=1540.8 - 25.8 = 15.
Tahmini Süre:1m 30s
Soru 39Soru

A commercial coffee roaster creates a custom blend by mixing two existing bean blends: Blend X and Blend Y. Blend X consists of 60% Arabica beans and 40% Robusta beans by weight, whereas Blend Y consists of 30% Arabica beans and 70% Robusta beans by weight. The roaster mixes a quantity of Blend X with a quantity of Blend Y to produce a total of 50 pounds of a new mixture that is 42% Arabica beans by weight. How many pounds of Blend X are in the final mixture?

Cevabı ve açıklamayı göster

Cevap: 20

Cevap

20 pounds
Let xx represent the number of pounds of Blend X. The remaining weight of the mixture, (50x)(50 - x) pounds, comes from Blend Y. Setting up the equation for the total weight of Arabica beans gives 0.60x+0.30(50x)=0.42(50)0.60x + 0.30(50 - x) = 0.42(50). Simplifying this expression yields 0.60x+150.30x=210.60x + 15 - 0.30x = 21, which reduces to 0.30x=60.30x = 6. Dividing by 0.300.30 gives x=20x = 20. Therefore, 20 pounds of Blend X were used.

Adım Adım Çözüm

1
Define variables for component weights
Let xx be the pounds of Blend X. The weight of Blend Y used is 50x50 - x pounds.
The total combined weight of the mixture is given as 50 pounds.
2
Formulate an equation for the total weight of Arabica beans
0.60x+0.30(50x)=0.42(50)0.60x + 0.30(50 - x) = 0.42(50), which simplifies to 0.60x+150.30x=210.60x + 15 - 0.30x = 21.
The sum of Arabica beans contributed by each blend must equal the total weight of Arabica beans in the combined mixture.
3
Solve the linear equation for xx
0.30x+15=21    0.30x=6    x=200.30x + 15 = 21 \implies 0.30x = 6 \implies x = 20.
Subtract 15 from both sides to isolate the variable term, then divide by 0.30.

Anahtar Kavram

Linear Modeling and Mixture Problems
Tahmini Süre:1m 30s
Soru 40Soru

If xx is a real number that satisfies the inequality 52x7|5 - 2x| \le 7, what is the minimum possible value of the expression 34x3 - 4x?

Cevabı ve açıklamayı göster

Cevap: 21-21

Cevap

21-21
Solving 52x7|5 - 2x| \le 7 yields 752x7-7 \le 5 - 2x \le 7. Subtracting 55 gives 122x2-12 \le -2x \le 2. Dividing by 2-2 and flipping the inequality direction gives 1x6-1 \le x \le 6. To minimize 34x3 - 4x, we choose the maximum value of xx because the term 4x-4x decreases as xx increases. Substituting x=6x = 6 yields 34(6)=213 - 4(6) = -21.

Adım Adım Çözüm

1
Unpack the absolute value inequality into a compound inequality
752x7-7 \le 5 - 2x \le 7
For any real constant k0k \ge 0, uk|u| \le k is equivalent to kuk-k \le u \le k.
2
Isolate the variable term by subtracting 55 from all parts of the inequality
122x2-12 \le -2x \le 2
Subtracting a constant from all parts preserves inequality direction.
3
Divide all parts by 2-2 and reverse the inequality signs
6x16 \ge x \ge -1, which is equivalent to 1x6-1 \le x \le 6
Dividing an inequality by a negative number reverses the direction of the inequality signs.
4
Find the minimum value of 34x3 - 4x over the interval [1,6][-1, 6]
The minimum value occurs at x=6x = 6: 34(6)=324=213 - 4(6) = 3 - 24 = -21
Because the linear expression 34x3 - 4x has a negative coefficient for xx, it is a decreasing function; its minimum occurs at the largest allowed value of xx.

Anahtar Kavram

Linear Inequalities and Absolute Value Bounds
Tahmini Süre:1m 30s
ÖncekiSayfa 2 / 107Sonraki
Tüm alıştırma soruları — GRE General Test | Examkin