Tüm alıştırma soruları

13931 soru

Soru 12921Soru

Arrange the following physiological events in the correct sequence to describe the path of hemolymph through the open circulatory system of an insect (phylum Arthropoda), starting from the initiation of heart contraction.

Öğeleri doğru sıraya koymak için sürükleyin

Cevabı ve açıklamayı göster

Cevap

The correct sequence begins with the contraction of the dorsal vessel propelling hemolymph forward through the aorta, followed by its release into the head cavity and hemocoel, direct bathing of the tissues and organs, and finally its return to the relaxed dorsal vessel via the ostia.
In arthropods, the open circulatory system operates in a defined directional loop: contraction of the dorsal heart drives hemolymph forward through the aorta into the head cavity and body sinuses (hemocoel). There, hemolymph directly bathes the internal organs before being drawn back into the relaxed heart through lateral ostia.

Adım Adım Çözüm

1
Identify the primary pumping action that initiates blood flow.
The muscular dorsal vessel contracts, driving hemolymph anteriorly into the aorta.
Circulation in insects is powered by peristaltic waves of contraction in the dorsal heart.
2
Determine where hemolymph travels after exiting the vessel.
Hemolymph discharges from the open anterior aorta into the head space and body sinuses (hemocoel).
Arthropods possess open circulatory systems lacking a continuous capillary network.
3
Identify the functional interaction between hemolymph and organs in the hemocoel.
Hemolymph flows backwards through the body, directly bathing visceral organs and tissues.
Direct contact between interstitial fluid and organ membranes allows efficient nutrient and metabolic exchange.
4
Trace the return path of hemolymph back to the heart.
As the dorsal heart relaxes, hemolymph enters the cardiac chambers through lateral openings called ostia.
Ostia contain one-way valves that open during relaxation to refill the vessel.

Anahtar Kavram

Open circulatory system and pathway of hemolymph in Arthropoda
Soru 12922Soru

In an isolated system where two colliding bodies of unequal mass undergo a perfectly elastic head-on collision, the body with the larger mass imparts a greater magnitude of impulse on the lighter body than the lighter body imparts on the heavier body.

Cevabı ve açıklamayı göster

Cevap: False

Cevap

The statement is false. By Newton's Third Law, interaction forces are equal in magnitude and opposite in direction at all times, making the impulse imparted by each body on the other equal in magnitude.
The statement is false because Newton's Third Law dictates that the force exerted by object 1 on object 2 is equal in magnitude to the force exerted by object 2 on object 1 at every instant during contact. Integrating force over time yields equal magnitudes of impulse (J1=J2|J_1| = |J_2|), independent of mass differences.

Adım Adım Çözüm

1
Apply Newton's Third Law to interaction forces.
F12=F21F_{12} = -F_{21}, where F12F_{12} is the force exerted on body 2 by body 1, and F21F_{21} is the force exerted on body 1 by body 2.
Forces between interacting objects always occur in equal and opposite action-reaction pairs regardless of mass.
2
Integrate both forces over the duration of collision Δt\Delta t.
J12=F12dt=F21dt=J21J_{12} = \int F_{12} \, dt = -\int F_{21} \, dt = -J_{21}.
Impulse is defined as the time-integral of force.
3
Compare impulse magnitudes.
J12=J21|J_{12}| = |J_{21}|.
Taking the magnitude of both sides shows that both bodies experience equal magnitudes of impulse regardless of mass ratio or collision elasticity.

Anahtar Kavram

Newton's Third Law and Equality of Mutual Impulse
Soru 12923Soru

In an experiment to determine the density of a solid sphere, the mass of the sphere is measured as (50.0±0.5) g(50.0 \pm 0.5)\text{ g} and its radius is measured as (1.00±0.02) cm(1.00 \pm 0.02)\text{ cm}. What is the maximum percentage error in the calculated density of the sphere?

Cevabı ve açıklamayı göster

Cevap: 7

Cevap

The maximum percentage error in the calculated density of the sphere is 7.0%7.0\%.
Density is related to mass and radius by ρ=m43πr3\rho = \frac{m}{\frac{4}{3}\pi r^3}. In error analysis, the maximum fractional error of a calculated quantity is the sum of the fractional errors of its components multiplied by their respective powers. The mass has a percentage error of 0.550.0×100%=1.0%\frac{0.5}{50.0} \times 100\% = 1.0\%, and the radius has a percentage error of 0.021.00×100%=2.0%\frac{0.02}{1.00} \times 100\% = 2.0\%. Multiplying the radius percentage error by 3 gives 6.0%6.0\%, and adding the mass percentage error of 1.0%1.0\% yields a maximum percentage error of 7.0%7.0\%.

Adım Adım Çözüm

1
Determine the percentage error in the measurement of mass (mm).
Percentage error in mass = 0.5 g50.0 g×100%=1.0%\frac{0.5\text{ g}}{50.0\text{ g}} \times 100\% = 1.0\%.
Relative error multiplied by 100 gives the percentage error of a measurement.
2
Determine the percentage error in the measurement of radius (rr).
Percentage error in radius = 0.02 cm1.00 cm×100%=2.0%\frac{0.02\text{ cm}}{1.00\text{ cm}} \times 100\% = 2.0\%.
Relative error in radius multiplied by 100 gives its percentage error.
3
Apply the error propagation formula for the density of a sphere.
Maximum percentage error in density = 1.0%+3(2.0%)=7.0%1.0\% + 3(2.0\%) = 7.0\%.
Density is given by ρ=m43πr3\rho = \frac{m}{\frac{4}{3}\pi r^3}. For a formula of the form X=AaBbX = A^a B^b, the fractional error propagates as ΔXX=aΔAA+bΔBB\frac{\Delta X}{X} = a\frac{\Delta A}{A} + b\frac{\Delta B}{B}. Here, the exponent of rr is 3, so its percentage error is multiplied by 3.

Anahtar Kavram

Error propagation in fractional powers and derived physical quantities
Soru 12924Soru

At the Ajaokuta steel complex in Kogi State, Nigeria, iron ore and coal are major raw materials utilized in heavy metallurgical manufacturing. During the blast furnace operation, limestone (CaCO3CaCO_3) is also added as an essential raw material. Which of the following best describes the primary industrial function of limestone in this process?

Cevabı ve açıklamayı göster

Cevap: It thermally decomposes into calcium oxide (CaOCaO), which reacts with silica impurities (SiO2SiO_2) to form removable molten slag (CaSiO3CaSiO_3).

Cevap

Limestone thermally decomposes into calcium oxide (CaOCaO), which reacts with silica impurities (SiO2SiO_2) to form removable molten slag (CaSiO3CaSiO_3).
In heavy metallurgical chemical processing (such as iron extraction at Ajaokuta), raw materials serve distinct chemical roles. Limestone (CaCO3CaCO_3) decomposes under heat to produce calcium oxide (CaOCaO), a basic flux. CaOCaO combines with acidic impurities like silica (SiO2SiO_2) in iron ore to form molten calcium trioxosilicate(IV) (CaSiO3CaSiO_3 or slag), which floats on molten iron and is easily removed.

Adım Adım Çözüm

1
Identify the chemical transformation of limestone (CaCO3CaCO_3) at high temperatures in the blast furnace.
Limestone undergoes thermal decomposition: CaCO3(s)CaO(s)+CO2(g)CaCO_3(s) \rightarrow CaO(s) + CO_2(g).
High heat inside the blast furnace breaks down limestone into basic calcium oxide and carbon(IV) oxide.
2
Determine the reaction of calcium oxide with sandy/earthy impurities present in the iron ore.
Calcium oxide acts as a basic flux reacting with silicon(IV) oxide: CaO(s)+SiO2(s)CaSiO3(l)CaO(s) + SiO_2(s) \rightarrow CaSiO_3(l).
Iron ore contains acidic silica impurities (SiO2SiO_2) which must be removed to prevent contamination of the produced iron.
3
Evaluate the physical separation of the resulting byproduct.
Molten calcium trioxosilicate(IV) (CaSiO3CaSiO_3, slag) floats on top of the denser molten iron and is tapped off separately.
Slag removal cleans the iron and prevents re-oxidation of molten iron by furnace gases.

Anahtar Kavram

Industrial raw material roles and fluxing in heavy metallurgy (blast furnace operation)
Tahmini Süre:1m 0s
Soru 12925Soru

A metal boiler base has a thermal conductivity of 200 Wm1K1200\text{ W}\cdot\text{m}^{-1}\cdot\text{K}^{-1}, a thickness of 6.0 mm6.0\text{ mm}, and an effective surface area of 0.15 m20.15\text{ m}^2. If heat is conducted through the base at a rate of 500 kW500\text{ kW}, what is the temperature difference across the two faces of the boiler base?

Cevabı ve açıklamayı göster

Cevap: 100 C100\text{ }^\circ\text{C}

Cevap

The temperature difference across the two faces of the boiler base is 100 C100\text{ }^\circ\text{C}.
Using Fourier's law of thermal conduction, P=kAΔTdP = \frac{k A \Delta T}{d}. Substituting P=500,000 WP = 500,000\text{ W}, d=0.006 md = 0.006\text{ m}, k=200 Wm1K1k = 200\text{ W}\cdot\text{m}^{-1}\cdot\text{K}^{-1}, and A=0.15 m2A = 0.15\text{ m}^2 yields ΔT=500,000×0.006200×0.15=100 C\Delta T = \frac{500,000 \times 0.006}{200 \times 0.15} = 100\text{ }^\circ\text{C}.

Adım Adım Çözüm

1
Convert given quantities into standard SI units
Heat transfer rate P=500 kW=500,000 WP = 500\text{ kW} = 500,000\text{ W}, thickness d=6.0 mm=0.006 md = 6.0\text{ mm} = 0.006\text{ m}, area A=0.15 m2A = 0.15\text{ m}^2, thermal conductivity k=200 Wm1K1k = 200\text{ W}\cdot\text{m}^{-1}\cdot\text{K}^{-1}.
All parameters must be in SI base units before substitution into the thermal conduction equation.
2
State the equation for rate of heat conduction and rearrange for temperature difference (ΔT\Delta T)
P=kAΔTd    ΔT=PdkAP = \frac{k A \Delta T}{d} \implies \Delta T = \frac{P \cdot d}{k \cdot A}.
To isolate the unknown temperature gradient component.
3
Substitute the values and compute the result
\Delta T = \frac{500,000 \times 0.006}{200 \times 0.15} = \frac{3000}{30} = 100\text{ }^\circ\text{C}.
Direct algebraic simplification yields the temperature difference.

Anahtar Kavram

Thermal Conduction Rate Formula
Tahmini Süre:1m 30s
Soru 12926Soru

According to de Broglie's hypothesis on wave-particle duality, how does the de Broglie wavelength of a moving particle change if its momentum is doubled?

Cevabı ve açıklamayı göster

Cevap: It is halved

Cevap

The de Broglie wavelength is halved when the momentum of the particle is doubled.
By de Broglie's equation λ=hp\lambda = \frac{h}{p}, the wavelength λ\lambda is inversely proportional to momentum pp. Doubling the momentum replaces pp with 2p2p, resulting in a new wavelength of h2p=λ2\frac{h}{2p} = \frac{\lambda}{2}, which means the wavelength is halved.

Adım Adım Çözüm

1
State the de Broglie wavelength formula
λ=hp\lambda = \frac{h}{p}
The de Broglie wavelength λ\lambda is inversely proportional to particle momentum pp.
2
Substitute doubled momentum p=2pp' = 2p into the formula
λ=h2p=12λ\lambda' = \frac{h}{2p} = \frac{1}{2}\lambda
Increasing momentum by a factor of 2 scales the wavelength by 12\frac{1}{2}.

Anahtar Kavram

Inverse proportionality between de Broglie wavelength and particle momentum
Tahmini Süre:45s
Soru 12927Soru

A chemist carried out paper chromatography to analyze a food coloring sample XX. The solvent front traveled 15.0 cm15.0\text{ cm} from the baseline, while the sample produced a single spot that traveled 6.0 cm6.0\text{ cm}. What is the RfR_f value of sample XX, and what does the single spot indicate regarding its purity?

Cevabı ve açıklamayı göster

Cevap: Rf=0.40R_f = 0.40, indicating that the sample is pure

Cevap

Rf=0.40R_f = 0.40, indicating that the sample is pure
The retention factor RfR_f is calculated using the formula Rf=distance traveled by spotdistance traveled by solvent front=6.0 cm15.0 cm=0.40R_f = \frac{\text{distance traveled by spot}}{\text{distance traveled by solvent front}} = \frac{6.0\text{ cm}}{15.0\text{ cm}} = 0.40. In paper chromatography, a pure substance produces only one single spot, demonstrating that no additional component fractions are present in the sample.

Adım Adım Çözüm

1
Calculate the Retention Factor (RfR_f)
Rf=Distance traveled by solute spotDistance traveled by solvent front=6.0 cm15.0 cm=0.40R_f = \frac{\text{Distance traveled by solute spot}}{\text{Distance traveled by solvent front}} = \frac{6.0\text{ cm}}{15.0\text{ cm}} = 0.40
The RfR_f value is defined as the ratio of the distance moved by the substance spot to the distance moved by the solvent front from the baseline.
2
Interpret the chromatogram for purity criteria
Single spot confirms a pure substance
A pure chemical compound produces a single characteristic spot in paper chromatography under specific solvent conditions, whereas a mixture separates into two or more spots.

Anahtar Kavram

Criteria of Purity: RfR_f Value and Chromatography
Tahmini Süre:1m 0s
Soru 12928Soru

A flat circular coil of 8080 turns, each having an area of 0.02 m20.02\text{ m}^2, is placed perpendicularly in a uniform magnetic field. If the magnetic flux density decreases uniformly from 0.60 T0.60\text{ T} to 0 T0\text{ T} in 0.16 s0.16\text{ s}, what is the magnitude of the induced electromotive force (e.m.f.) in the coil?

Cevabı ve açıklamayı göster

Cevap: 6.0 V6.0\text{ V}

Cevap

6.0 V6.0\text{ V}
According to Faraday's law of electromagnetic induction, the magnitude of the induced e.m.f. is equal to the rate of change of magnetic flux linkage: E=NΔΦΔt=NAΔBΔt\mathcal{E} = N \frac{\Delta \Phi}{\Delta t} = N \cdot A \cdot \frac{\Delta B}{\Delta t}. Substituting N=80N = 80, A=0.02 m2A = 0.02\text{ m}^2, ΔB=0.60 T\Delta B = 0.60\text{ T}, and Δt=0.16 s\Delta t = 0.16\text{ s} yields E=80×0.02×0.600.16=6.0 V\mathcal{E} = 80 \times 0.02 \times \frac{0.60}{0.16} = 6.0\text{ V}.

Adım Adım Çözüm

1
Calculate the change in magnetic flux density (ΔB\Delta B) and the change in magnetic flux per turn (ΔΦ\Delta \Phi).
ΔB=0.60 T0 T=0.60 T\Delta B = 0.60\text{ T} - 0\text{ T} = 0.60\text{ T}, and ΔΦ=A×ΔB=0.02 m2×0.60 T=0.012 Wb\Delta \Phi = A \times \Delta B = 0.02\text{ m}^2 \times 0.60\text{ T} = 0.012\text{ Wb}.
Magnetic flux is defined as the product of the perpendicular magnetic flux density and the cross-sectional area.
2
Apply Faraday's Law of Electromagnetic Induction for an NN-turn coil: E=NΔΦΔt\mathcal{E} = N \frac{\Delta \Phi}{\Delta t}.
\mathcal{E} = 80 \times \frac{0.012\text{ Wb}}{0.16\text{ s}} = 80 \times 0.075\text{ V} = 6.0\text{ V}.
The induced e.m.f. is directly proportional to the total rate of change of magnetic flux linkage through all NN turns of the coil.

Anahtar Kavram

Faraday's Law of Electromagnetic Induction
Soru 12929Soru

During an investigation of organisms causing palm wine fermentation, a biology student isolates a unicellular organism whose cell wall is composed of chitin and stores excess carbohydrate as glycogen. Which mode of nutrition and structural feature correctly identify how this organism differs from green plants?

Cevabı ve açıklamayı göster

Cevap: Saprophytic nutrition and a chitinous cell wall

Cevap

Saprophytic nutrition and a chitinous cell wall
Members of Kingdom Fungi, including yeast (*Saccharomyces*), are characterized by non-photosynthetic saprophytic nutrition and rigid cell walls made of chitin. Green plants, in contrast, are autotrophic organisms with cellulosic cell walls.

Adım Adım Çözüm

1
Identify the fungal archetype from the prompt characteristics
The unicellular fermenting organism with a chitin cell wall and glycogen storage is yeast (Saccharomyces), belonging to Kingdom Fungi.
Chitin walls, glycogen storage reserves, and unicellular structure are diagnostic features of yeasts.
2
Determine the mode of nutrition and cell wall differences relative to green plants
Fungi exhibit heterotrophic saprophytic nutrition and have chitin cell walls, whereas green plants are autotrophic and possess cellulose cell walls.
Fungi lack chlorophyll and perform extracellular digestion of organic substrates.

Anahtar Kavram

Distinctive cellular features (chitin wall, glycogen reserve) and heterotrophic saprophytic mode of nutrition in Kingdom Fungi
Soru 12930Soru

When a bar magnet is placed in the magnetic meridian with its North pole pointing towards the Earth's magnetic North pole, the neutral points formed where its magnetic field cancels the horizontal component of the Earth's magnetic field lie along its end-on (axial) line.

Cevabı ve açıklamayı göster

Cevap: False

Cevap

The statement is false. When a bar magnet is placed with its North pole pointing towards magnetic North, neutral points lie along its broadside-on (equatorial) axis, not its end-on (axial) axis.
The statement is incorrect. When a bar magnet's North pole points North, its magnetic field along its axis points in the same direction as Earth's horizontal field, reinforcing it. The fields oppose each other and form neutral points along the broadside-on (equatorial) line.

Adım Adım Çözüm

1
Determine the direction of Earth's horizontal magnetic field
The horizontal component of Earth's magnetic field (BHB_H) points Northward along the magnetic meridian.
By definition, Earth's horizontal magnetic field vectors point from magnetic South to magnetic North.
2
Analyze the magnetic field of the bar magnet along its axial (end-on) line
Outside the magnet along its axis, field lines point away from the North pole (Northward).
Since both the magnet's field and Earth's horizontal field point Northward along the axial line, they reinforce each other (Btotal=Bmagnet+BH>0B_{\text{total}} = B_{\text{magnet}} + B_H > 0), so no neutral points can form here.
3
Analyze the magnetic field of the bar magnet along its equatorial (broadside-on) line
Along the equatorial line, field lines curve from the North pole to the South pole, pointing Southward.
Because the magnet's field points Southward while Earth's field points Northward, they oppose each other and cancel when equal in magnitude (Bmagnet=BHB_{\text{magnet}} = B_H).
4
Evaluate the statement
The neutral points form on the broadside-on (equatorial) line, making the given statement false.
The statement incorrectly asserts that neutral points occur on the end-on (axial) line.

Anahtar Kavram

Neutral points of a bar magnet in Earth's magnetic field
Tahmini Süre:2m 0s
Soru 12931Soru

The specific latent heat of vaporization of a pure substance is substantially greater than its specific latent heat of fusion because vaporizing requires completely separating the molecules against intermolecular forces and performing work against external pressure, whereas melting requires only overcoming the long-range order of the crystalline lattice.

Cevabı ve açıklamayı göster

Cevap: True

Cevap

True. The specific latent heat of vaporization is substantially larger than the specific latent heat of fusion because vaporization requires completely overcoming intermolecular cohesive forces to transition molecules into the gas phase, in addition to performing work against atmospheric pressure during expansion, whereas melting only disrupts long-range lattice order while keeping molecular spacing nearly identical.
The statement is true because vaporization involves breaking all intermolecular bonds to create a gas phase and doing external work against atmospheric pressure during large volume expansion, whereas fusion only weakens lattice alignment without significant separation or expansion.

Adım Adım Çözüm

1
Analyze energy and structural changes during fusion (melting).
Melting breaks long-range crystalline order, but molecules remain in close contact in the liquid state with minimal volume change.
Only a small fraction of intermolecular potential energy is changed, and negligible work is done against external pressure.
2
Analyze energy and structural changes during vaporization (boiling).
Vaporization requires complete separation of molecules against attractive forces to form a gas, accompanied by a large increase in volume.
Energy must be supplied both to overcome intermolecular attractions completely and to perform mechanical work (PΔVP\Delta V) against surrounding atmospheric pressure.
3
Compare the thermodynamic energy requirements (LvL_v vs. LfL_f).
Because full molecular separation and expansion work require far more energy than minor lattice disruption, LvLfL_v \gg L_f.
This confirms the physics reasoning in the statement is true.

Anahtar Kavram

Microscopic and Thermodynamic Basis of Latent Heat of Fusion vs. Vaporization
Soru 12932Soru

A magnetic compass needle free to swing in a vertical plane comes to rest at an angle of dip of 3030^\circ to the horizontal at a given location. If the magnitude of the Earth's total magnetic field at this point is 5.0×105 T5.0 \times 10^{-5}\text{ T}, what is the vertical component of the Earth's magnetic field?

Cevabı ve açıklamayı göster

Cevap: 2.5×105 T2.5 \times 10^{-5}\text{ T}

Cevap

2.5×105 T2.5 \times 10^{-5}\text{ T}
The vertical component of the Earth's magnetic field is found by multiplying the total magnetic field by the sine of the angle of dip: Bv=BsinθB_v = B \sin\theta. Substituting B=5.0×105 TB = 5.0 \times 10^{-5}\text{ T} and θ=30\theta = 30^\circ yields 2.5×105 T2.5 \times 10^{-5}\text{ T}.

Adım Adım Çözüm

1
Identify given parameters and formula for vertical magnetic component
Total magnetic field B=5.0×105 TB = 5.0 \times 10^{-5}\text{ T} and angle of dip θ=30\theta = 30^\circ. Formula: Bv=BsinθB_v = B \sin\theta.
The vertical component BvB_v of the Earth's magnetic field is resolved by projecting the total magnetic flux density BB along the vertical axis using the sine of the inclination angle.
2
Substitute values and solve for BvB_v
Bv=5.0×105 T×sin(30)=5.0×105 T×0.5=2.5×105 TB_v = 5.0 \times 10^{-5}\text{ T} \times \sin(30^\circ) = 5.0 \times 10^{-5}\text{ T} \times 0.5 = 2.5 \times 10^{-5}\text{ T}.
Since sin(30)=0.5\sin(30^\circ) = 0.5, multiplying gives the vertical component directly.

Anahtar Kavram

Resolution of Earth's Magnetic Field Components
Tahmini Süre:1m 0s
Soru 12933Soru

During an ecological survey of a newly formed coastal sand dune (psammosere), researchers monitor changes in plant community structure, soil organic content, and microclimatic conditions over a period of 150 years. Which of the following trends accurately describes the ecological changes that occur as this primary succession progresses toward a climax community?

Cevabı ve açıklamayı göster

Cevap: Both species diversity and soil organic content gradually increase, creating more stable soil and complex food webs.

Cevap

Both species diversity and soil organic content gradually increase, creating more stable soil and complex food webs.
In primary succession on a sand dune, pioneer plants colonize bare substrate and gradually decompose, accumulating soil organic matter (humus). This soil improvement enhances water and nutrient retention, enabling succession through intermediate seral stages toward a climax community characterized by high species diversity and ecosystem stability.

Adım Adım Çözüm

1
Identify the type of ecological succession described in the scenario.
The formation of a coastal sand dune represents primary succession because it starts on a newly exposed, bare substrate with no initial soil or organic material.
Differentiating primary from secondary succession establishes the baseline substrate conditions (absence vs. presence of pre-existing soil).
2
Analyze ecosystem property trends (biomass, species diversity, soil structure) across seral stages.
Pioneer species bind the loose sand and decompose upon dying, generating initial soil humus. Subsequent seral stages build deeper soil, higher water retention, and greater niche diversity.
Understanding ecological succession dynamics requires tracing how early colonizers modify abiotic conditions to facilitate colonization by later species.
3
Evaluate the options against standard succession principles.
The statement indicating that both species diversity and soil organic content gradually increase toward the climax community is scientifically accurate.
Climax communities characteristically display maximal species diversity, high total biomass, and well-developed soil layers compared to early pioneer stages.

Anahtar Kavram

Trends in Ecosystem Properties During Primary Succession
Tahmini Süre:1m 15s
Soru 12934Soru

During the fractional distillation of liquid air, nitrogen gas boils off at 196C-196^\circ\text{C} prior to oxygen gas at 183C-183^\circ\text{C} because liquid air is a homogeneous mixture whose constituent substances retain their individual physical properties.

Cevabı ve açıklamayı göster

Cevap: True

Cevap

The statement is TRUE.
Liquid air behaves as a physical mixture rather than a chemical compound. Consequently, its components retain their individual physical constants. Nitrogen boils off at 196C-196^\circ\text{C} before oxygen at 183C-183^\circ\text{C} during fractional distillation precisely because the mixture does not have a single fixed compound boiling point and its components maintain their independent identities.

Adım Adım Çözüm

1
Classify liquid air as an element, compound, or mixture
Liquid air is a homogeneous mixture composed mainly of nitrogen (~78%) and oxygen (~21%) alongside small amounts of argon and other gases.
Distinguishing the classification of the matter is essential to determine its thermodynamic and physical behavior during separation.
2
Apply the fundamental property of mixtures regarding constituent properties
In a mixture, constituents retain their original individual physical and chemical properties because no chemical reaction or bond formation has occurred between them.
Chemical compounds undergo chemical combination resulting in entirely new properties, whereas mixtures retain component properties.
3
Evaluate the separation behavior based on boiling points
Because nitrogen retains its boiling point of 196C-196^\circ\text{C} and oxygen retains its boiling point of 183C-183^\circ\text{C}, warming liquid air causes the more volatile nitrogen to boil off first.
Fractional distillation relies directly on differences in the individual boiling points of components in a mixture.

Anahtar Kavram

Retention of individual physical properties by components of a mixture vs. chemical compounds
Tahmini Süre:1m 30s
Soru 12935Soru

When bright light shines directly into a human eye, the pupil rapidly constricts in an involuntary response to protect the retina from light damage. Which sequence correctly represents the flow of the nerve impulse through the reflex arc during this response?

Cevabı ve açıklamayı göster

Cevap: Photoreceptors in retina \rightarrow sensory neuron \rightarrow brain stem integration center \rightarrow motor neuron \rightarrow iris sphincter muscle

Cevap

Photoreceptors in retina \rightarrow sensory neuron \rightarrow brain stem integration center \rightarrow motor neuron \rightarrow iris sphincter muscle
The correct answer accurately traces the unidirectional flow of a reflex arc: stimulus perception by the sensory receptor (retina), signal conduction via afferent (sensory) neurons to the central integration center (brain stem), and signal transmission via efferent (motor) neurons to the target muscle (iris sphincter).

Adım Adım Çözüm

1
Identify the stimulus and receptor
Bright light stimulates photoreceptors (rods and cones) located in the retina.
The reflex pathway must begin at the sensory receptor that detects the environmental change.
2
Trace afferent signal transmission
Nerve impulses travel along the sensory neuron of the optic nerve toward the central nervous system.
Sensory neurons transmit impulses from receptors toward the integrating center.
3
Trace central integration and efferent transmission
The brain stem processes the signal and transmits impulses via motor neurons of the oculomotor nerve to the iris muscle.
The integration center routes the response along motor pathways to the effector organ.

Anahtar Kavram

Pupillary reflex arc pathway
Tahmini Süre:1m 0s
Soru 12936Soru

Match each industrial chemical listed on the left with its appropriate chemical category and operational production characteristic on the right.

Soldaki öğeye tıklayın, sonra eşleşen sağdaki öğeye tıklayın

Öğeler

Tetraoxosulfate(VI) acid (H2SO4H_2SO_4)
Paracetamol (Acetaminophen)
Sodium hydroxide (NaOHNaOH)
Analytical grade Silver Nitrate (AgNO3AgNO_3)

Eşleşmeler

Cevabı ve açıklamayı göster

Cevap

Tetraoxosulfate(VI) acid matches heavy chemical produced continuously in massive tonnage; Paracetamol matches fine chemical produced in small batches for pharmaceutical applications; Sodium hydroxide matches heavy chemical synthesized on a large scale as a basic alkali raw material; Analytical grade Silver Nitrate matches fine chemical manufactured in limited quantities with strict purity for laboratory testing.
Heavy chemicals like Tetraoxosulfate(VI) acid and Sodium hydroxide are manufactured on a massive industrial scale through continuous production processes. They serve as fundamental raw materials for other industries and have low to moderate unit costs. Fine chemicals like Paracetamol and Analytical grade Silver Nitrate are produced in small batch quantities, possess high chemical purity standards, command high unit prices, and serve specialized applications such as medicine and scientific research.

Adım Adım Çözüm

1
Analyze Tetraoxosulfate(VI) acid (H2SO4H_2SO_4)
H2SO4H_2SO_4 is manufactured worldwide in millions of tonnes via the Contact process. It is a classic heavy chemical with a relatively low cost per unit mass used broadly across chemical manufacturing.
Heavy chemicals are characterized by high volume, continuous production, and widespread raw material utility.
2
Analyze Paracetamol
Paracetamol is a pharmaceutical drug prepared in small, carefully monitored batch processes to guarantee high chemical purity and safety for human consumption.
Pharmaceuticals are classified as fine chemicals due to their high unit value, precise batch manufacturing, and high degree of purity.
3
Analyze Sodium hydroxide (NaOHNaOH)
Sodium hydroxide is produced in vast amounts alongside chlorine gas in the chlor-alkali process, functioning as a primary basic heavy alkali.
Large-scale industrial bases and alkalis produced for general industrial operations are heavy chemicals.
4
Analyze Analytical grade Silver Nitrate (AgNO3AgNO_3)
Analytical reagents are synthesized in small amounts with strict quality specifications (>99.9%>99.9\% purity) for qualitative and quantitative laboratory procedures.
Specialty laboratory reagents sold in high-cost, small-quantity containers fall under fine chemicals.

Anahtar Kavram

Classification and operational properties of Heavy Chemicals vs Fine Chemicals
Soru 12937Soru

A sample of ice with a mass of 0.20 kg0.20\text{ kg} at 0C0^\circ\text{C} absorbs 67,200 J67,200\text{ J} of thermal energy to melt completely into water at 0C0^\circ\text{C}. What is the specific latent heat of fusion of ice in J kg1\text{J kg}^{-1}?

Cevabı ve açıklamayı göster

Cevap: 336000

Cevap

The specific latent heat of fusion of ice is 336,000 J kg1336,000\text{ J kg}^{-1}.
For a change of state from solid to liquid at constant temperature, the thermal energy transferred is related to mass by Q=mLfQ = m L_f. Dividing the absorbed energy (67,200 J67,200\text{ J}) by the mass (0.20 kg0.20\text{ kg}) yields the specific latent heat of fusion, 336,000 J kg1336,000\text{ J kg}^{-1}.

Adım Adım Çözüm

1
Identify the given values from the problem statement
Heat energy Q=67,200 JQ = 67,200\text{ J}, Mass m=0.20 kgm = 0.20\text{ kg}
These parameters are required to calculate the specific latent heat.
2
Apply the energy formula for phase transition at constant temperature
Q=mLfQ = m L_f
During melting, temperature remains constant at 0C0^\circ\text{C}, so heat absorbed depends only on mass and specific latent heat of fusion.
3
Solve for the specific latent heat of fusion LfL_f
Lf=Qm=67,2000.20=336,000 J kg1L_f = \frac{Q}{m} = \frac{67,200}{0.20} = 336,000\text{ J kg}^{-1}
Dividing total energy by mass gives heat required per kilogram.

Anahtar Kavram

Specific Latent Heat of Fusion
Soru 12938Soru

A commercial fish farming enterprise in Asaba harvests fresh catfish from its ponds, processes a portion into dried smoked fish to prolong shelf life, and transports the packaged products to retail markets in Warri. Which type of utility is primarily created through the smoking and packaging stage of this business?

Cevabı ve açıklamayı göster

Cevap: Form utility

Cevap

Form utility
Form utility is created whenever raw materials or primary products are transformed into a different physical shape, state, or structure that increases their capacity to satisfy human wants. Processing fresh catfish into dried smoked fish alters the physical condition of the product, thereby creating form utility.

Adım Adım Çözüm

1
Analyze the economic activity performed during the processing stage.
Raw harvested catfish undergo smoking and packaging, changing their physical state into preserved fish.
Production is defined as the creation of utility. Changing the form, shape, or physical condition of a raw material to increase its usefulness constitutes form utility.
2
Distinguish between the different types of utility created across the supply chain.
Processing creates form utility, transportation creates place utility, storing creates time utility, and retail selling creates possession utility.
Since the question specifically asks about the smoking and packaging stage, it refers to physical transformation, which is form utility.

Anahtar Kavram

Types of Utility in Production
Soru 12939Soru

A power plant routinely discharges high-temperature cooling water into a freshwater stream, raising the mean water temperature by several degrees. Which of the following best describes the primary immediate ecological consequence of this thermal pollution on the stream's fish population?

Cevabı ve açıklamayı göster

Cevap: Dissolved oxygen concentration decreases while the metabolic rate and oxygen demand of the fish increase.

Cevap

Dissolved oxygen concentration decreases while the metabolic rate and oxygen demand of the fish increase.
Thermal pollution reduces the solubility of gases in water, leading to a decline in dissolved oxygen levels. Simultaneously, because fish are ectothermic (poikilothermic), an increase in ambient water temperature elevates their metabolic rate and cellular oxygen demand. This dual effect creates a severe physiological stress environment for aquatic life.

Adım Adım Çözüm

1
Analyze the physical effect of increased temperature on gas solubility in water.
Higher water temperatures decrease the solubility of gases, leading to a reduced concentration of dissolved oxygen.
Gas solubility in liquid solvent is inversely proportional to water temperature.
2
Analyze the physiological effect of temperature increase on poikilothermic aquatic organisms (fish).
Increased environmental temperature elevates body temperature and speeds up metabolic reactions, raising physiological oxygen demand.
Fish are poikilothermic and their metabolic rates increase with ambient temperature.
3
Combine the physical and biological impacts to identify the primary ecological hazard.
Fish experience increased respiratory demand in an environment with depleted dissolved oxygen, leading to physiological stress or suffocation.
The combination of decreased supply and increased demand creates severe respiratory distress.

Anahtar Kavram

Thermal Pollution and Aquatic Gas Solubility
Tahmini Süre:1m 0s
Soru 12940Soru
Consider the reduction of zinc oxide by carbon monoxide:
ZnO(s)+CO(g)Zn(s)+CO2(g)\text{ZnO}(s) + \text{CO}(g) \rightarrow \text{Zn}(s) + \text{CO}_2(g)
Given the standard enthalpies of formation (ΔHf\Delta H_f^\circ):
- ΔHf[ZnO(s)]=348.0 kJ mol1\Delta H_f^\circ[\text{ZnO}(s)] = -348.0\text{ kJ mol}^{-1}
- ΔHf[CO(g)]=110.5 kJ mol1\Delta H_f^\circ[\text{CO}(g)] = -110.5\text{ kJ mol}^{-1}
- ΔHf[CO2(g)]=393.5 kJ mol1\Delta H_f^\circ[\text{CO}_2(g)] = -393.5\text{ kJ mol}^{-1}

What is the standard enthalpy change of the reaction, ΔH\Delta H^\circ, in kJ mol1\text{kJ mol}^{-1}?

Cevabı ve açıklamayı göster

Cevap: 65

Cevap

The standard enthalpy change of the reaction is +65.0 kJ mol^-1.
According to Hess's Law, the standard enthalpy change of a reaction is calculated by subtracting the sum of the standard enthalpies of formation of the reactants from the sum of the standard enthalpies of formation of the products. For this reaction, ΔH=[393.5+0][348.0+(110.5)]=393.5(458.5)=+65.0 kJ mol1\Delta H^\circ = [-393.5 + 0] - [-348.0 + (-110.5)] = -393.5 - (-458.5) = +65.0\text{ kJ mol}^{-1}.

Adım Adım Çözüm

1
Determine the standard enthalpy of formation for zinc element in standard state
ΔHf[Zn(s)]=0 kJ mol1\Delta H_f^\circ[\text{Zn}(s)] = 0\text{ kJ mol}^{-1}
By definition, the standard enthalpy of formation of an element in its standard reference state is zero.
2
Apply Hess's Law relationship using enthalpies of formation
ΔH=ΔHf(products)ΔHf(reactants)\Delta H^\circ = \sum \Delta H_f^\circ(\text{products}) - \sum \Delta H_f^\circ(\text{reactants})
Enthalpy change of a reaction equals the total enthalpy of formation of products minus that of reactants.
3
Calculate the sum of formation enthalpies for products
ΔHf(products)=393.5+0=393.5 kJ mol1\sum \Delta H_f^\circ(\text{products}) = -393.5 + 0 = -393.5\text{ kJ mol}^{-1}
Products are 1 mole of CO2(g)\text{CO}_2(g) and 1 mole of Zn(s)\text{Zn}(s).
4
Calculate the sum of formation enthalpies for reactants
ΔHf(reactants)=348.0+(110.5)=458.5 kJ mol1\sum \Delta H_f^\circ(\text{reactants}) = -348.0 + (-110.5) = -458.5\text{ kJ mol}^{-1}
Reactants are 1 mole of ZnO(s)\text{ZnO}(s) and 1 mole of CO(g)\text{CO}(g).
5
Subtract reactant total from product total to obtain reaction enthalpy
ΔH=393.5(458.5)=+65.0 kJ mol1\Delta H^\circ = -393.5 - (-458.5) = +65.0\text{ kJ mol}^{-1}
Performing the subtraction 393.5+458.5-393.5 + 458.5 yields +65.0 kJ mol1+65.0\text{ kJ mol}^{-1}.

Anahtar Kavram

Calculating standard enthalpy change of reaction using standard enthalpies of formation via Hess's Law.
ÖncekiSayfa 647 / 697Sonraki
Tüm alıştırma soruları — JAMB UTME | Examkin